From 3c69c0c10123b4f49400e9ada7a72d81afbf24ae Mon Sep 17 00:00:00 2001 From: j Date: Sat, 21 Jun 2025 08:29:19 +0200 Subject: [PATCH] minimal support for epub documents --- pandora/document/epub.py | 189 + pandora/document/fulltext.py | 7 + pandora/document/models.py | 33 +- pandora/document/views.py | 24 +- pandora/templates/epub.html | 176 + pandora/urls.py | 1 + static/epub.js/css/annotations.css | 3 + static/epub.js/css/main.css | 817 + static/epub.js/css/normalize.css | 505 + static/epub.js/css/popup.css | 96 + static/epub.js/font/fontello.eot | Bin 0 -> 10204 bytes static/epub.js/font/fontello.svg | 33 + static/epub.js/font/fontello.ttf | Bin 0 -> 10036 bytes static/epub.js/font/fontello.woff | Bin 0 -> 6032 bytes static/epub.js/img/.gitignore | 0 static/epub.js/img/annotator-glyph-sprite.png | Bin 0 -> 5085 bytes static/epub.js/img/annotator-icon-sprite.png | Bin 0 -> 7184 bytes static/epub.js/img/apple-touch-icon.png | Bin 0 -> 1333 bytes static/epub.js/img/cancelfullscreen.png | Bin 0 -> 246 bytes static/epub.js/img/close.png | Bin 0 -> 1065 bytes static/epub.js/img/fullscreen.png | Bin 0 -> 220 bytes static/epub.js/img/loader.gif | Bin 0 -> 6820 bytes static/epub.js/img/menu-icon.png | Bin 0 -> 947 bytes static/epub.js/img/save.png | Bin 0 -> 1237 bytes static/epub.js/img/saved.png | Bin 0 -> 1132 bytes static/epub.js/img/settings-s.png | Bin 0 -> 1436 bytes static/epub.js/img/settings.png | Bin 0 -> 1537 bytes static/epub.js/img/star.png | Bin 0 -> 278 bytes static/epub.js/index.html | 1 + static/epub.js/js/epub.js | 23139 ++++++++++++++++ static/epub.js/js/epub.min.js | 1 + static/epub.js/js/epub.min.map | 1 + static/epub.js/js/hooks.min.js | 1 + static/epub.js/js/hooks.min.map | 1 + .../epub.js/js/hooks/extensions/highlight.js | 14 + static/epub.js/js/libs/jquery.min.js | 4 + static/epub.js/js/libs/localforage.min.js | 7 + static/epub.js/js/libs/screenfull.js | 145 + static/epub.js/js/libs/screenfull.min.js | 7 + static/epub.js/js/libs/zip.min.js | 15 + static/epub.js/js/plugins/hypothesis.js | 80 + static/epub.js/js/plugins/search.js | 125 + static/epub.js/js/reader.js | 4372 +++ static/epub.js/js/reader.js.map | 89 + static/epub.js/js/reader.min.js | 8 + static/epub.js/js/reader.min.map | 1 + static/js/EpubViewer.js | 99 + static/js/document.js | 10 + static/js/utils.js | 2 +- static/reader/epub.js | 213 + 50 files changed, 30209 insertions(+), 10 deletions(-) create mode 100644 pandora/document/epub.py create mode 100644 pandora/templates/epub.html create mode 100644 static/epub.js/css/annotations.css create mode 100755 static/epub.js/css/main.css create mode 100755 static/epub.js/css/normalize.css create mode 100644 static/epub.js/css/popup.css create mode 100644 static/epub.js/font/fontello.eot create mode 100644 static/epub.js/font/fontello.svg create mode 100644 static/epub.js/font/fontello.ttf create mode 100644 static/epub.js/font/fontello.woff create mode 100755 static/epub.js/img/.gitignore create mode 100644 static/epub.js/img/annotator-glyph-sprite.png create mode 100644 static/epub.js/img/annotator-icon-sprite.png create mode 100755 static/epub.js/img/apple-touch-icon.png create mode 100644 static/epub.js/img/cancelfullscreen.png create mode 100644 static/epub.js/img/close.png create mode 100644 static/epub.js/img/fullscreen.png create mode 100644 static/epub.js/img/loader.gif create mode 100644 static/epub.js/img/menu-icon.png create mode 100644 static/epub.js/img/save.png create mode 100644 static/epub.js/img/saved.png create mode 100644 static/epub.js/img/settings-s.png create mode 100644 static/epub.js/img/settings.png create mode 100644 static/epub.js/img/star.png create mode 100755 static/epub.js/index.html create mode 100644 static/epub.js/js/epub.js create mode 100644 static/epub.js/js/epub.min.js create mode 100644 static/epub.js/js/epub.min.map create mode 100644 static/epub.js/js/hooks.min.js create mode 100644 static/epub.js/js/hooks.min.map create mode 100644 static/epub.js/js/hooks/extensions/highlight.js create mode 100644 static/epub.js/js/libs/jquery.min.js create mode 100644 static/epub.js/js/libs/localforage.min.js create mode 100644 static/epub.js/js/libs/screenfull.js create mode 100644 static/epub.js/js/libs/screenfull.min.js create mode 100644 static/epub.js/js/libs/zip.min.js create mode 100644 static/epub.js/js/plugins/hypothesis.js create mode 100644 static/epub.js/js/plugins/search.js create mode 100644 static/epub.js/js/reader.js create mode 100644 static/epub.js/js/reader.js.map create mode 100644 static/epub.js/js/reader.min.js create mode 100644 static/epub.js/js/reader.min.map create mode 100644 static/js/EpubViewer.js create mode 100644 static/reader/epub.js diff --git a/pandora/document/epub.py b/pandora/document/epub.py new file mode 100644 index 00000000..d4656619 --- /dev/null +++ b/pandora/document/epub.py @@ -0,0 +1,189 @@ +import os +import xml.etree.ElementTree as ET +import zipfile +import re +from urllib.parse import unquote +import lxml.html +from io import BytesIO + +from PIL import Image + +from ox import strip_tags, decode_html, normalize_name + +import logging +logging.getLogger('PIL').setLevel(logging.ERROR) +logger = logging.getLogger(__name__) + + +def get_ratio(data): + try: + img = Image.open(BytesIO(data)) + return img.size[0]/img.size[1] + except: + return -1 + + +def normpath(path): + return '/'.join(os.path.normpath(path).split(os.sep)) + + +def cover(path): + logger.debug('cover %s', path) + data = None + try: + z = zipfile.ZipFile(path) + except zipfile.BadZipFile: + logger.debug('invalid epub file %s', path) + return data + + def use(filename): + logger.debug('using %s', filename) + try: + data = z.read(filename) + except: + return None + r = get_ratio(data) + if r < 0.3 or r > 2: + return None + return data + + files = [] + for f in z.filelist: + if f.filename == 'calibre-logo.png': + continue + if 'cover' in f.filename.lower() and f.filename.split('.')[-1] in ('jpg', 'jpeg', 'png'): + return use(f.filename) + files.append(f.filename) + opf = [f for f in files if f.endswith('opf')] + if opf: + #logger.debug('opf: %s', z.read(opf[0]).decode()) + info = ET.fromstring(z.read(opf[0])) + metadata = info.findall('{http://www.idpf.org/2007/opf}metadata') + if metadata: + metadata = metadata[0] + manifest = info.findall('{http://www.idpf.org/2007/opf}manifest') + if manifest: + manifest = manifest[0] + if metadata and manifest: + for e in list(metadata): + if e.tag == '{http://www.idpf.org/2007/opf}meta' and e.attrib.get('name') == 'cover': + cover_id = e.attrib['content'] + for e in list(manifest): + if e.attrib['id'] == cover_id: + filename = unquote(e.attrib['href']) + filename = normpath(os.path.join(os.path.dirname(opf[0]), filename)) + if filename in files: + return use(filename) + if manifest: + images = [e for e in list(manifest) if 'image' in e.attrib['media-type']] + if images: + image_data = [] + for e in images: + filename = unquote(e.attrib['href']) + filename = normpath(os.path.join(os.path.dirname(opf[0]), filename)) + if filename in files: + image_data.append(filename) + if image_data: + image_data.sort(key=lambda name: z.getinfo(name).file_size) + return use(image_data[-1]) + for e in list(manifest): + if 'html' in e.attrib['media-type']: + filename = unquote(e.attrib['href']) + filename = normpath(os.path.join(os.path.dirname(opf[0]), filename)) + html = z.read(filename).decode('utf-8', 'ignore') + img = re.compile(' 0: size = self.resolution diff --git a/pandora/document/views.py b/pandora/document/views.py index 1e52fa7e..843518ed 100644 --- a/pandora/document/views.py +++ b/pandora/document/views.py @@ -5,6 +5,7 @@ import mimetypes import os import re import unicodedata +import zipfile import ox from ox.utils import json @@ -15,7 +16,7 @@ from oxdjango.shortcuts import render_to_json_response, get_object_or_404_json, from django import forms from django.conf import settings from django.db.models import Count, Sum -from django.http import HttpResponse +from django.http import HttpResponse, Http404 from django.shortcuts import render from item import utils @@ -557,3 +558,24 @@ def document(request, fragment): context['url'] = request.build_absolute_uri('/documents/' + fragment) context['settings'] = settings return render(request, "document.html", context) + +def epub(request, id, filename): + document = get_document_or_404_json(request, id) + if not document.access(request.user): + raise Http404 + if document.extension != 'epub': + raise Http404 + z = zipfile.ZipFile(document.file.path) + if filename == '': + context = {} + context["epub"] = document + return render(request, "epub.html", context) + elif filename not in [f.filename for f in z.filelist]: + raise Http404 + else: + content_type = { + 'xpgt': 'application/vnd.adobe-page-template+xml' + }.get(filename.split('.')[0], mimetypes.guess_type(filename)[0]) or 'text/plain' + content = z.read(filename) + response = HttpResponse(content, content_type=content_type) + return response diff --git a/pandora/templates/epub.html b/pandora/templates/epub.html new file mode 100644 index 00000000..b619315e --- /dev/null +++ b/pandora/templates/epub.html @@ -0,0 +1,176 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ Menu +
+
+ +   –   + +
+
+ Bookmark +
+
+ +
+ +
+ + +
+
+ +
+ + + diff --git a/pandora/urls.py b/pandora/urls.py index f6b66ae2..c0788646 100644 --- a/pandora/urls.py +++ b/pandora/urls.py @@ -53,6 +53,7 @@ urlpatterns += [ re_path(r'^resetUI$', user.views.reset_ui), re_path(r'^collection/(?P.*?)/icon(?P\d*).jpg$', documentcollection.views.icon), re_path(r'^documents/(?P[A-Z0-9]+)/(?P\d*)p(?P[\d,]*).jpg$', document.views.thumbnail), + re_path(r'^documents/(?P[A-Z0-9]+)/epub/(?P.*?)$', document.views.epub), re_path(r'^documents/(?P[A-Z0-9]+)/(?P.*?\.[^\d]{3,4})$', document.views.file), re_path(r'^documents/(?P.*?)$', document.views.document), re_path(r'^edit/(?P.*?)/icon(?P\d*).jpg$', edit.views.icon), diff --git a/static/epub.js/css/annotations.css b/static/epub.js/css/annotations.css new file mode 100644 index 00000000..7a77e668 --- /dev/null +++ b/static/epub.js/css/annotations.css @@ -0,0 +1,3 @@ +.annotator-adder { + width: 80px; +} diff --git a/static/epub.js/css/main.css b/static/epub.js/css/main.css new file mode 100755 index 00000000..27e77a32 --- /dev/null +++ b/static/epub.js/css/main.css @@ -0,0 +1,817 @@ +@font-face { + font-family: 'fontello'; + src: url('../font/fontello.eot?60518104'); + src: url('../font/fontello.eot?60518104#iefix') format('embedded-opentype'), + url('../font/fontello.woff?60518104') format('woff'), + url('../font/fontello.ttf?60518104') format('truetype'), + url('../font/fontello.svg?60518104#fontello') format('svg'); + font-weight: normal; + font-style: normal; +} + +body { + background: #4e4e4e; + overflow: hidden; +} + +#main { + /* height: 500px; */ + position: absolute; + width: 100%; + height: 100%; + right: 0; + /* left: 40px; */ +/* -webkit-transform: translate(40px, 0); + -moz-transform: translate(40px, 0); */ + + /* border-radius: 5px 0px 0px 5px; */ + border-radius: 5px; + background: #fff; + overflow: hidden; + -webkit-transition: -webkit-transform .4s, width .2s; + -moz-transition: -webkit-transform .4s, width .2s; + -ms-transition: -webkit-transform .4s, width .2s; + + -moz-box-shadow: inset 0 0 50px rgba(0,0,0,.1); + -webkit-box-shadow: inset 0 0 50px rgba(0,0,0,.1); + -ms-box-shadow: inset 0 0 50px rgba(0,0,0,.1); + box-shadow: inset 0 0 50px rgba(0,0,0,.1); +} + + +#titlebar { + height: 8%; + min-height: 20px; + padding: 10px; + /* margin: 0 50px 0 50px; */ + position: relative; + color: #4f4f4f; + font-weight: 100; + font-family: Georgia, "Times New Roman", Times, serif; + opacity: .5; + text-align: center; + -webkit-transition: opacity .5s; + -moz-transition: opacity .5s; + -ms-transition: opacity .5s; + z-index: 10; +} + +#titlebar:hover { + opacity: 1; +} + +#titlebar a { + width: 18px; + height: 19px; + line-height: 20px; + overflow: hidden; + display: inline-block; + opacity: .5; + padding: 4px; + border-radius: 4px; +} + +#titlebar a::before { + visibility: visible; +} + +#titlebar a:hover { + opacity: .8; + border: 1px rgba(0,0,0,.2) solid; + padding: 3px; +} + +#titlebar a:active { + opacity: 1; + color: rgba(0,0,0,.6); + /* margin: 1px -1px -1px 1px; */ + -moz-box-shadow: inset 0 0 6px rgba(155,155,155,.8); + -webkit-box-shadow: inset 0 0 6px rgba(155,155,155,.8); + -ms-box-shadow: inset 0 0 6px rgba(155,155,155,.8); + box-shadow: inset 0 0 6px rgba(155,155,155,.8); +} + +#book-title { + font-weight: 600; +} + +#title-seperator { + display: none; +} + +#viewer { + width: 80%; + height: 80%; + /* margin-left: 10%; */ + margin: 0 auto; + max-width: 1250px; + z-index: 2; + position: relative; + overflow: hidden; +} + +#viewer iframe { + border: none; +} + +#prev { + left: 40px; +} + +#next { + right: 40px; +} + +.arrow { + position: absolute; + top: 50%; + margin-top: -32px; + font-size: 64px; + color: #E2E2E2; + font-family: arial, sans-serif; + font-weight: bold; + cursor: pointer; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.arrow:hover { + color: #777; +} + +.arrow:active, +.arrow.active { + color: #000; +} + +#sidebar { + background: #6b6b6b; + position: absolute; + /* left: -260px; */ + /* -webkit-transform: translate(-260px, 0); + -moz-transform: translate(-260px, 0); */ + top: 0; + min-width: 300px; + width: 25%; + height: 100%; + -webkit-transition: -webkit-transform .5s; + -moz-transition: -moz-transform .5s; + -ms-transition: -moz-transform .5s; + + overflow: hidden; +} + +#sidebar.open { + /* left: 0; */ + /* -webkit-transform: translate(0, 0); + -moz-transform: translate(0, 0); */ +} + +#main.closed { + /* left: 300px; */ + -webkit-transform: translate(300px, 0); + -moz-transform: translate(300px, 0); + -ms-transform: translate(300px, 0); +} + +#main.single { + width: 75%; +} + +#main.single #viewer { + /* width: 60%; + margin-left: 20%; */ +} + +#panels { + background: #4e4e4e; + position: absolute; + left: 0; + top: 0; + width: 100%; + padding: 13px 0; + height: 14px; + -moz-box-shadow: 0px 1px 3px rgba(0,0,0,.6); + -webkit-box-shadow: 0px 1px 3px rgba(0,0,0,.6); + -ms-box-shadow: 0px 1px 3px rgba(0,0,0,.6); + box-shadow: 0px 1px 3px rgba(0,0,0,.6); +} + +#opener { + /* padding: 10px 10px; */ + float: left; +} + +/* #opener #slider { + width: 25px; +} */ + +#metainfo { + display: inline-block; + text-align: center; + max-width: 80%; +} + +#title-controls { + float: right; +} + +#panels a { + visibility: hidden; + width: 18px; + height: 20px; + overflow: hidden; + display: inline-block; + color: #ccc; + margin-left: 6px; +} + +#panels a::before { + visibility: visible; +} + +#panels a:hover { + color: #AAA; +} + +#panels a:active { + color: #AAA; + margin: 1px 0 -1px 6px; +} + +#panels a.active, +#panels a.active:hover { + color: #AAA; +} + +#searchBox { + width: 165px; + float: left; + margin-left: 10px; + margin-top: -1px; + /* + border-radius: 5px; + background: #9b9b9b; + float: left; + margin-left: 5px; + margin-top: -5px; + padding: 3px 10px; + color: #000; + border: none; + outline: none; */ + +} + +input::-webkit-input-placeholder { + color: #454545; +} +input:-moz-placeholder { + color: #454545; +} +input:-ms-placeholder { + color: #454545; +} + +#divider { + position: absolute; + width: 1px; + border-right: 1px #000 solid; + height: 80%; + z-index: 1; + left: 50%; + margin-left: -1px; + top: 10%; + opacity: .15; + box-shadow: -2px 0 15px rgba(0, 0, 0, 1); + display: none; +} + +#divider.show { + display: block; +} + +#loader { + position: absolute; + z-index: 10; + left: 50%; + top: 50%; + margin: -33px 0 0 -33px; +} + +#tocView, +#bookmarksView { + overflow-x: hidden; + overflow-y: hidden; + min-width: 300px; + width: 25%; + height: 100%; + visibility: hidden; + -webkit-transition: visibility 0 ease .5s; + -moz-transition: visibility 0 ease .5s; + -ms-transition: visibility 0 ease .5s; +} + + + +#sidebar.open #tocView, +#sidebar.open #bookmarksView { + overflow-y: auto; + visibility: visible; + -webkit-transition: visibility 0 ease 0; + -moz-transition: visibility 0 ease 0; + -ms-transition: visibility 0 ease 0; +} + +#sidebar.open #tocView { + display: block; +} + +#tocView > ul, +#bookmarksView > ul { + margin-top: 15px; + margin-bottom: 50px; + padding-left: 20px; + display: block; +} + +#tocView li, +#bookmarksView li { + margin-bottom:10px; + width: 225px; + font-family: Georgia, "Times New Roman", Times, serif; + list-style: none; + text-transform: capitalize; +} + +#tocView li:active, +#tocView li.currentChapter +{ + list-style: none; +} + +.list_item a { + color: #AAA; + text-decoration: none; +} + +.list_item a.chapter { + font-size: 1em; +} + +.list_item a.section { + font-size: .8em; +} + +.list_item.currentChapter > a, +.list_item a:hover { + color: #f1f1f1 +} + +/* #tocView li.openChapter > a, */ +.list_item a:hover { + color: #E2E2E2; +} + +.list_item ul { + padding-left:10px; + margin-top: 8px; + display: none; +} + +.list_item.currentChapter > ul, +.list_item.openChapter > ul { + display: block; +} + +#tocView.hidden { + display: none; +} + +.toc_toggle { + display: inline-block; + width: 14px; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.toc_toggle:before { + content: '▸'; + color: #fff; + margin-right: -4px; +} + +.currentChapter > .toc_toggle:before, +.openChapter > .toc_toggle:before { + content: '▾'; +} + +.view { + width: 300px; + height: 100%; + display: none; + padding-top: 50px; + overflow-y: auto; +} + +#searchResults { + margin-bottom: 50px; + padding-left: 20px; + display: block; +} + +#searchResults li { + margin-bottom:10px; + width: 225px; + font-family: Georgia, "Times New Roman", Times, serif; + list-style: none; +} + +#searchResults a { + color: #AAA; + text-decoration: none; +} + +#searchResults p { + text-decoration: none; + font-size: 12px; + line-height: 16px; +} + +#searchResults p .match { + background: #ccc; + color: #000; +} + +#searchResults li > p { + color: #AAA; +} + +#searchResults li a:hover { + color: #E2E2E2; +} + +#searchView.shown { + display: block; + overflow-y: scroll; +} + +#notes { + padding: 0 0 0 34px; +} + +#notes li { + color: #eee; + font-size: 12px; + width: 240px; + border-top: 1px #fff solid; + padding-top: 6px; + margin-bottom: 6px; +} + +#notes li a { + color: #fff; + display: inline-block; + margin-left: 6px; +} + +#notes li a:hover { + text-decoration: underline; +} + +#notes li img { + max-width: 240px; +} + +#note-text { + display: block; + width: 260px; + height: 80px; + margin: 0 auto; + padding: 5px; + border-radius: 5px; +} + +#note-text[disabled], #note-text[disabled="disabled"]{ + opacity: .5; +} + +#note-anchor { + margin-left: 218px; + margin-top: 5px; +} + +#settingsPanel { + display:none; +} + +#settingsPanel h3 { + color:#f1f1f1; + font-family:Georgia, "Times New Roman", Times, serif; + margin-bottom:10px; +} + +#settingsPanel ul { + margin-top:60px; + list-style-type:none; +} + +#settingsPanel li { + font-size:1em; + color:#f1f1f1; +} + +#settingsPanel .xsmall { font-size:x-small; } +#settingsPanel .small { font-size:small; } +#settingsPanel .medium { font-size:medium; } +#settingsPanel .large { font-size:large; } +#settingsPanel .xlarge { font-size:x-large; } + +.highlight { background-color: yellow } + +.modal { + position: fixed; + top: 50%; + left: 50%; + width: 50%; + width: 630px; + + height: auto; + z-index: 2000; + visibility: hidden; + margin-left: -320px; + margin-top: -160px; + +} + +.overlay { + position: fixed; + width: 100%; + height: 100%; + visibility: hidden; + top: 0; + left: 0; + z-index: 1000; + opacity: 0; + background: rgba(255,255,255,0.8); + -webkit-transition: all 0.3s; + -moz-transition: all 0.3s; + -ms-transition: all 0.3s; + transition: all 0.3s; +} + +.md-show { + visibility: visible; +} + +.md-show ~ .overlay { + opacity: 1; + visibility: visible; +} + +/* Content styles */ +.md-content { + color: #fff; + background: #6b6b6b; + position: relative; + border-radius: 3px; + margin: 0 auto; + height: 320px; +} + +.md-content h3 { + margin: 0; + padding: 6px; + text-align: center; + font-size: 22px; + font-weight: 300; + opacity: 0.8; + background: rgba(0,0,0,0.1); + border-radius: 3px 3px 0 0; +} + +.md-content > div { + padding: 15px 40px 30px; + margin: 0; + font-weight: 300; + font-size: 14px; +} + +.md-content > div p { + margin: 0; + padding: 10px 0; +} + +.md-content > div ul { + margin: 0; + padding: 0 0 30px 20px; +} + +.md-content > div ul li { + padding: 5px 0; +} + +.md-content button { + display: block; + margin: 0 auto; + font-size: 0.8em; +} + +/* Effect 1: Fade in and scale up */ +.md-effect-1 .md-content { + -webkit-transform: scale(0.7); + -moz-transform: scale(0.7); + -ms-transform: scale(0.7); + transform: scale(0.7); + opacity: 0; + -webkit-transition: all 0.3s; + -moz-transition: all 0.3s; + -ms-transition: all 0.3s; + transition: all 0.3s; +} + +.md-show.md-effect-1 .md-content { + -webkit-transform: scale(1); + -moz-transform: scale(1); + -ms-transform: scale(1); + transform: scale(1); + opacity: 1; +} + +.md-content > .closer { + font-size: 18px; + position: absolute; + right: 0; + top: 0; + font-size: 24px; + padding: 4px; +} + +@media only screen and (max-width: 1040px) { + #viewer{ + width: 50%; + margin-left: 25%; + } + + #divider, + #divider.show { + display: none; + } +} + +@media only screen and (max-width: 900px) { + #viewer{ + width: 60%; + margin-left: 20%; + } + + #prev { + left: 20px; + } + + #next { + right: 20px; + } +} + +@media only screen and (max-width: 550px) { + #viewer{ + width: 80%; + margin-left: 10%; + } + + #prev { + left: 0; + } + + #next { + right: 0; + } + + .arrow { + height: 100%; + top: 45px; + width: 10%; + text-indent: -10000px; + } + + #main { + -webkit-transform: translate(0, 0); + -moz-transform: translate(0, 0); + -ms-transform: translate(0, 0); + -webkit-transition: -webkit-transform .3s; + -moz-transition: -moz-transform .3s; + -ms-transition: -moz-transform .3s; + } + + #main.closed { + -webkit-transform: translate(260px, 0); + -moz-transform: translate(260px, 0); + -ms-transform: translate(260px, 0); + } + + #titlebar { + /* font-size: 16px; */ + /* margin: 0 50px 0 50px; */ + } + + #metainfo { + font-size: 10px; + } + + #tocView { + width: 260px; + } + + #tocView li { + font-size: 12px; + } + + #tocView > ul{ + padding-left: 10px; + } +} + + +/* For iPad portrait layouts only */ +@media only screen and (min-device-width: 481px) and (max-device-width: 1024px) and (orientation: portrait) { + #viewer iframe { + width: 460px; + height: 740px; + } +} + /*For iPad landscape layouts only */ +@media only screen and (min-device-width: 481px) and (max-device-width: 1024px) and (orientation: landscape) { + #viewer iframe { + width: 460px; + height: 415px; + } +} +/* For iPhone portrait layouts only */ +@media only screen and (max-device-width: 480px) and (orientation: portrait) { + #viewer { + width: 256px; + height: 432px; + } + #viewer iframe { + width: 256px; + height: 432px; + } +} +/* For iPhone landscape layouts only */ +@media only screen and (max-device-width: 480px) and (orientation: landscape) { + #viewer iframe { + width: 256px; + height: 124px; + } +} + +[class^="icon-"]:before, [class*=" icon-"]:before { + font-family: "fontello"; + font-style: normal; + font-weight: normal; + speak: none; + + display: inline-block; + text-decoration: inherit; + width: 1em; + margin-right: .2em; + text-align: center; + /* opacity: .8; */ + + /* For safety - reset parent styles, that can break glyph codes*/ + font-variant: normal; + text-transform: none; + + /* you can be more comfortable with increased icons size */ + font-size: 112%; +} + + +.icon-search:before { content: '\e807'; } /* '' */ +.icon-resize-full-1:before { content: '\e804'; } /* '' */ +.icon-cancel-circled2:before { content: '\e80f'; } /* '' */ +.icon-link:before { content: '\e80d'; } /* '' */ +.icon-bookmark:before { content: '\e805'; } /* '' */ +.icon-bookmark-empty:before { content: '\e806'; } /* '' */ +.icon-download-cloud:before { content: '\e811'; } /* '' */ +.icon-edit:before { content: '\e814'; } /* '' */ +.icon-menu:before { content: '\e802'; } /* '' */ +.icon-cog:before { content: '\e813'; } /* '' */ +.icon-resize-full:before { content: '\e812'; } /* '' */ +.icon-cancel-circled:before { content: '\e80e'; } /* '' */ +.icon-up-dir:before { content: '\e80c'; } /* '' */ +.icon-right-dir:before { content: '\e80b'; } /* '' */ +.icon-angle-right:before { content: '\e809'; } /* '' */ +.icon-angle-down:before { content: '\e80a'; } /* '' */ +.icon-right:before { content: '\e815'; } /* '' */ +.icon-list-1:before { content: '\e803'; } /* '' */ +.icon-list-numbered:before { content: '\e801'; } /* '' */ +.icon-columns:before { content: '\e810'; } /* '' */ +.icon-list:before { content: '\e800'; } /* '' */ +.icon-resize-small:before { content: '\e808'; } /* '' */ diff --git a/static/epub.js/css/normalize.css b/static/epub.js/css/normalize.css new file mode 100755 index 00000000..c3e014d9 --- /dev/null +++ b/static/epub.js/css/normalize.css @@ -0,0 +1,505 @@ +/*! normalize.css v1.0.1 | MIT License | git.io/normalize */ + +/* ========================================================================== + HTML5 display definitions + ========================================================================== */ + +/* + * Corrects `block` display not defined in IE 6/7/8/9 and Firefox 3. + */ + +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +nav, +section, +summary { + display: block; +} + +/* + * Corrects `inline-block` display not defined in IE 6/7/8/9 and Firefox 3. + */ + +audio, +canvas, +video { + display: inline-block; + *display: inline; + *zoom: 1; +} + +/* + * Prevents modern browsers from displaying `audio` without controls. + * Remove excess height in iOS 5 devices. + */ + +audio:not([controls]) { + display: none; + height: 0; +} + +/* + * Addresses styling for `hidden` attribute not present in IE 7/8/9, Firefox 3, + * and Safari 4. + * Known issue: no IE 6 support. + */ + +[hidden] { + display: none; +} + +/* ========================================================================== + Base + ========================================================================== */ + +/* + * 1. Corrects text resizing oddly in IE 6/7 when body `font-size` is set using + * `em` units. + * 2. Prevents iOS text size adjust after orientation change, without disabling + * user zoom. + */ + +html { + font-size: 100%; /* 1 */ + -webkit-text-size-adjust: 100%; /* 2 */ + -ms-text-size-adjust: 100%; /* 2 */ +} + +/* + * Addresses `font-family` inconsistency between `textarea` and other form + * elements. + */ + +html, +button, +input, +select, +textarea { + font-family: sans-serif; +} + +/* + * Addresses margins handled incorrectly in IE 6/7. + */ + +body { + margin: 0; +} + +/* ========================================================================== + Links + ========================================================================== */ + +/* + * Addresses `outline` inconsistency between Chrome and other browsers. + */ + +a:focus { + outline: thin dotted; +} + +/* + * Improves readability when focused and also mouse hovered in all browsers. + */ + +a:active, +a:hover { + outline: 0; +} + +/* ========================================================================== + Typography + ========================================================================== */ + +/* + * Addresses font sizes and margins set differently in IE 6/7. + * Addresses font sizes within `section` and `article` in Firefox 4+, Safari 5, + * and Chrome. + */ + +h1 { + font-size: 2em; + margin: 0.67em 0; +} + +h2 { + font-size: 1.5em; + margin: 0.83em 0; +} + +h3 { + font-size: 1.17em; + margin: 1em 0; +} + +h4 { + font-size: 1em; + margin: 1.33em 0; +} + +h5 { + font-size: 0.83em; + margin: 1.67em 0; +} + +h6 { + font-size: 0.75em; + margin: 2.33em 0; +} + +/* + * Addresses styling not present in IE 7/8/9, Safari 5, and Chrome. + */ + +abbr[title] { + border-bottom: 1px dotted; +} + +/* + * Addresses style set to `bolder` in Firefox 3+, Safari 4/5, and Chrome. + */ + +b, +strong { + font-weight: bold; +} + +blockquote { + margin: 1em 40px; +} + +/* + * Addresses styling not present in Safari 5 and Chrome. + */ + +dfn { + font-style: italic; +} + +/* + * Addresses styling not present in IE 6/7/8/9. + */ + +mark { + background: #ff0; + color: #000; +} + +/* + * Addresses margins set differently in IE 6/7. + */ + +p, +pre { + margin: 1em 0; +} + +/* + * Corrects font family set oddly in IE 6, Safari 4/5, and Chrome. + */ + +code, +kbd, +pre, +samp { + font-family: monospace, serif; + _font-family: 'courier new', monospace; + font-size: 1em; +} + +/* + * Improves readability of pre-formatted text in all browsers. + */ + +pre { + white-space: pre; + white-space: pre-wrap; + word-wrap: break-word; +} + +/* + * Addresses CSS quotes not supported in IE 6/7. + */ + +q { + quotes: none; +} + +/* + * Addresses `quotes` property not supported in Safari 4. + */ + +q:before, +q:after { + content: ''; + content: none; +} + +/* + * Addresses inconsistent and variable font size in all browsers. + */ + +small { + font-size: 80%; +} + +/* + * Prevents `sub` and `sup` affecting `line-height` in all browsers. + */ + +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} + +sup { + top: -0.5em; +} + +sub { + bottom: -0.25em; +} + +/* ========================================================================== + Lists + ========================================================================== */ + +/* + * Addresses margins set differently in IE 6/7. + */ + +dl, +menu, +ol, +ul { + margin: 1em 0; +} + +dd { + margin: 0 0 0 40px; +} + +/* + * Addresses paddings set differently in IE 6/7. + */ + +menu, +ol, +ul { + padding: 0 0 0 40px; +} + +/* + * Corrects list images handled incorrectly in IE 7. + */ + +nav ul, +nav ol { + list-style: none; + list-style-image: none; +} + +/* ========================================================================== + Embedded content + ========================================================================== */ + +/* + * 1. Removes border when inside `a` element in IE 6/7/8/9 and Firefox 3. + * 2. Improves image quality when scaled in IE 7. + */ + +img { + border: 0; /* 1 */ + -ms-interpolation-mode: bicubic; /* 2 */ +} + +/* + * Corrects overflow displayed oddly in IE 9. + */ + +svg:not(:root) { + overflow: hidden; +} + +/* ========================================================================== + Figures + ========================================================================== */ + +/* + * Addresses margin not present in IE 6/7/8/9, Safari 5, and Opera 11. + */ + +figure { + margin: 0; +} + +/* ========================================================================== + Forms + ========================================================================== */ + +/* + * Corrects margin displayed oddly in IE 6/7. + */ + +form { + margin: 0; +} + +/* + * Define consistent border, margin, and padding. + */ + +fieldset { + border: 1px solid #c0c0c0; + margin: 0 2px; + padding: 0.35em 0.625em 0.75em; +} + +/* + * 1. Corrects color not being inherited in IE 6/7/8/9. + * 2. Corrects text not wrapping in Firefox 3. + * 3. Corrects alignment displayed oddly in IE 6/7. + */ + +legend { + border: 0; /* 1 */ + padding: 0; + white-space: normal; /* 2 */ + *margin-left: -7px; /* 3 */ +} + +/* + * 1. Corrects font size not being inherited in all browsers. + * 2. Addresses margins set differently in IE 6/7, Firefox 3+, Safari 5, + * and Chrome. + * 3. Improves appearance and consistency in all browsers. + */ + +button, +input, +select, +textarea { + font-size: 100%; /* 1 */ + margin: 0; /* 2 */ + vertical-align: baseline; /* 3 */ + *vertical-align: middle; /* 3 */ +} + +/* + * Addresses Firefox 3+ setting `line-height` on `input` using `!important` in + * the UA stylesheet. + */ + +button, +input { + line-height: normal; +} + +/* + * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio` + * and `video` controls. + * 2. Corrects inability to style clickable `input` types in iOS. + * 3. Improves usability and consistency of cursor style between image-type + * `input` and others. + * 4. Removes inner spacing in IE 7 without affecting normal text inputs. + * Known issue: inner spacing remains in IE 6. + */ + +button, +html input[type="button"], /* 1 */ +input[type="reset"], +input[type="submit"] { + -webkit-appearance: button; /* 2 */ + cursor: pointer; /* 3 */ + *overflow: visible; /* 4 */ +} + +/* + * Re-set default cursor for disabled elements. + */ + +button[disabled], +input[disabled] { + cursor: default; +} + +/* + * 1. Addresses box sizing set to content-box in IE 8/9. + * 2. Removes excess padding in IE 8/9. + * 3. Removes excess padding in IE 7. + * Known issue: excess padding remains in IE 6. + */ + +input[type="checkbox"], +input[type="radio"] { + box-sizing: border-box; /* 1 */ + padding: 0; /* 2 */ + *height: 13px; /* 3 */ + *width: 13px; /* 3 */ +} + +/* + * 1. Addresses `appearance` set to `searchfield` in Safari 5 and Chrome. + * 2. Addresses `box-sizing` set to `border-box` in Safari 5 and Chrome + * (include `-moz` to future-proof). + */ +/* +input[type="search"] { + -webkit-appearance: textfield; + -moz-box-sizing: content-box; + -webkit-box-sizing: content-box; + box-sizing: content-box; +} +*/ + +/* + * Removes inner padding and search cancel button in Safari 5 and Chrome + * on OS X. + */ + +/* input[type="search"]::-webkit-search-cancel-button, +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} */ + +/* + * Removes inner padding and border in Firefox 3+. + */ + +button::-moz-focus-inner, +input::-moz-focus-inner { + border: 0; + padding: 0; +} + +/* + * 1. Removes default vertical scrollbar in IE 6/7/8/9. + * 2. Improves readability and alignment in all browsers. + */ + +textarea { + overflow: auto; /* 1 */ + vertical-align: top; /* 2 */ +} + +/* ========================================================================== + Tables + ========================================================================== */ + +/* + * Remove most spacing between table cells. + */ + +table { + border-collapse: collapse; + border-spacing: 0; +} diff --git a/static/epub.js/css/popup.css b/static/epub.js/css/popup.css new file mode 100644 index 00000000..c41aac71 --- /dev/null +++ b/static/epub.js/css/popup.css @@ -0,0 +1,96 @@ +/* http://davidwalsh.name/css-tooltips */ +/* base CSS element */ +.popup { + background: #eee; + border: 1px solid #ccc; + padding: 10px; + border-radius: 8px; + box-shadow: 0 2px 5px rgba(0, 0, 0, 0.2); + position: fixed; + max-width: 300px; + font-size: 12px; + + display: none; + margin-left: 2px; + + margin-top: 30px; +} + +.popup.above { + margin-top: -10px; +} + +.popup.left { + margin-left: -20px; +} + +.popup.right { + margin-left: 40px; +} + +.pop_content { + max-height: 225px; + overflow-y: auto; +} + +.pop_content > p { + margin-top: 0; +} + +/* below */ +.popup:before { + position: absolute; + display: inline-block; + border-bottom: 10px solid #eee; + border-right: 10px solid transparent; + border-left: 10px solid transparent; + border-bottom-color: rgba(0, 0, 0, 0.2); + left: 50%; + top: -10px; + margin-left: -6px; + content: ''; +} + +.popup:after { + position: absolute; + display: inline-block; + border-bottom: 9px solid #eee; + border-right: 9px solid transparent; + border-left: 9px solid transparent; + left: 50%; + top: -9px; + margin-left: -5px; + content: ''; +} + +/* above */ +.popup.above:before { + border-bottom: none; + border-top: 10px solid #eee; + border-top-color: rgba(0, 0, 0, 0.2); + top: 100%; +} + +.popup.above:after { + border-bottom: none; + border-top: 9px solid #eee; + top: 100%; +} + +.popup.left:before, +.popup.left:after +{ + left: 20px; +} + +.popup.right:before, +.popup.right:after +{ + left: auto; + right: 20px; +} + + +.popup.show, .popup.on { + display: block; +} \ No newline at end of file diff --git a/static/epub.js/font/fontello.eot b/static/epub.js/font/fontello.eot new file mode 100644 index 0000000000000000000000000000000000000000..f63ffa043ea29008e7f5b161b87c44ce567d15fc GIT binary patch literal 10204 zcmeHNYiwM{b)LEJz5C=oN$qNR$>nls?t|p=X_BH=yQC;vr1+G~6>WJ}S4m2h z6DgAIHgO2Yc8tJqT@;Ce#0VO+xKz@{cHKBY)z&fcFp3s2Vxx7@pj8Vu&5txq1dHl7 zcXuUH@uLCqvy}JFIcLtydCZwJXYTbo5klJVql6>uk0T;)0H8cW88kFn#P2)}GSGeD zE8TafWynG1$O>5|8>B!M@oxnkHZl(E6gdk#Pu4*3l4GE(k#(|QaBHN6BuF!QK4?71 zOsI`qCOpZFOf)6?8V(DBv79W|@|8`4+_0JIEd1k(lpQVBL3xrf^=ZL4KG2 z8t^ILb@NLb=kI4DN#zAR9$Z|R$?v~9@C)Efr{<;n`BnP7I!Z{D0$f|pFBQJ`M^%2{ z4UqBu)s^*)EByPX3Gx3D`rfm;R#<)Z$_uv$secFj#|Y)`rOyzNDBLHwS3!BQ*wS}N z3&k?sStIoA`Wu}am?f#}=w?Z6&=k2Zdk%{|}zRANMLZMa;xULZpfGkU=t=%F8xRuuGiC3F5RvvGSaW z@`U53D^v@7P05G>5ISK7LI?Ntwls(9sw%A(N;0Y5!F>li+nRe?x}yzsP2og!pfXfd z>vC9pR;SB`c?6>{pJ9rU(J=hS$f4iI6BC*tz`k1TWuUn`2e@8@ClYL~EJVchrMQ(4Z z`8c&ZveaW=rZ!JAm6a1sjlAmW3vj%+*T$IziBe94r%Y*|i{t5m!@6a3Dm6#!4v)j` znfFrF}YS3BOUu`M`wGj6!C=GTRn1+x;&x!_O?F0v#nmP zl_Pz$HR<)ZZJgZNE_x972>E>!n*`f{vN7##o$Vn>j&!zq?(XNoFYn<0hrU>EU3EZn zRQA{eTcxU+>P$Vavp1_wB>-*NYh!jx;GK5thCx3RI3SS ziH1O8Ptaa_^$e4NhlT#EtE)fZkyUr&;6J~$D66W>9@KkAR;fi|d~Dw#b3C|b}#)1YhGZ}^zOKdxsKs1dzZ)W>}RfI^Oar6LYLtzl*_Jv8tX4x5J?~L zm1U{6)0&+B$M?KX>9H7SxPP;^n67I}eZOEqi& zl#Fp~u?9RIS@!rn{tAa|m90+65e;`%)O1EVsqB*@as`^23STF!h+y+ac*mvft;?53 zw*T(Y%cGyVOh+Dll;PaPOP5D3U0%7otv_~YgiBnyG1VT$(I6-+Rv`%9@M&Auv>{ z*utcwhe&EkODf?Oc}~E_hB6%C&Ir%~VT}f!Vrmb_Ql;1FkZR=`hvgHkUZ2A}O=11v?eS4a}!dr0)*O10kq#6p@D3naI^``=1iHFBl zoF*J+=K6ghEWYTD(zXPZg0zoPw*;TTWeKiN2y#BR?DKMuf8l%22~Yj~le9M0?S5_c zlcUehr?}q5r@r#!Y8OB7nuk7i>RIl&H=dWC+>U-dN}7IUW_9ksk$KI1K>Vk<5d80a|kW2;q5d0!1A+==R*( zUCA`XCaq_y3N`E7_R|Q8Gh_3+?G&MWd&7IHX=g{WntJJvllynxuia<37acnoo4#6$L`_Lx~z zrs3UPX+7ZPDx%aa(;e#Ka83H4*O0XRzG#yIlJxf5k`xdf0!0nhEimvaf<#cV2qM^q5gLy&R4 zzQRAx--ldqFF8*BAhoB9n#7|691&copJYBg8Rbm<5+`%0T~(BK&A4Nm1Tjabj3CRQ z6eY3=TR9M~tf_gu=`+nOEtvAtiSb0!M&gMghGoBX^VSysF!FXCUN9$dpq$pg+J*pN8s@kds(VBy5(riX+PO3q)AhxP+t^LjQ*O#SFy!!K3KJ~7R_3ky7 zxd86QKX>-p#>Tb(U=PGGf7_N2^430I-eB8S)#B}p71q9{$^ z-Xjfqyq>)<%c=OHVIyblOkBmVFYeJ|`szd;w(&ujwadQQG3?NxVdSJSNg5iGB!&+U z;Zelb#y4Mla+I5V;*URl?2|i8{pGkQ4iAgsI7VWaO}Y!uO>9nbqfdSLDU98m*kv~C zzJ)csf;D9I!d{Y0HNiq=Ce89l+Jb;H7%gGTM+BU~fhu=}1yux(eMKeN9z`usQ{nc8 z@vKR9xY&`5@~V@a#3;A2baMLz3omW|A)QdvLmhQDopsnAVeY5lHko_;=F^JmL=vee(Ro&|phn>5QF=3_ zQF;r4aiR#5sKtdtp@t4msI^x1;`FPJ(suT!mG;t5Z8_39#FEBPID+d<((7Xnj~iDa z?hRGBXxs!YDyn!54!$PR!iD2EublbOE(9yjeeL9EXtF0-TX7C{;f&nkj~jM1lb%#pLv z+{BK_IXGeg@y7`xSPXVd3fy3~+qb8a9h0Twkk!YiXIa879f!ELAs_7wL!-E+U&VQ+ zy6rdE9U)*IWhY`vq~COFrV=c^GG_F9si=rAkEwWRfg_P+YcR0W^X(moO)7ERwn;@z zGEa`A4$owV4hTf-Ho=Cr20v~OG>p4}kY=wg@X`w<3XH@Z0mUfZO|ZKX zAwgM@kNwwKBDUiEL4DY1)DlS5K6uN=CbLsi5?Jn@@$=){v5jLipvd#8+0`J4_ED=W z4_ECm$%5m8VsZF=Ba%Zp=*6Y4LA5J$vO-mHUa|SYMP6mNau0S##RXg{>;dnnXqOMU z1);}gnnN9bqGxjQ+~nkW*6Rp*{7Ec;XOxP)R%IyQP~}r5ORp%Uf~W~BNqfL=rxw}Z zt=gl-WsB?{Ewb7b#b6aP0k94mjEEHM0(L+BiLsyUI6?c!A}c2F;?B?aQ+I|LDLEl>@d905joDtbS&~jZV+#9%s6xJDe=pA8TYXR ze8wUDn+i&`kR3yC>zw~s<=8tBRH6MDyai0$Qy=tuU5GZxZDJRgi0o@7;Z|C&wBqbO>iEk8M-NnY&}Yk2 zY=8T7af0*-Y7<;iKoR)1aA}T%GG_`fJ5xxu_cRqn7Kw z65jW)z4yO~nZM4$>j&2>s*U#F-ufq;n5U7Qhk>)#AH_e6DZVQgnh=TqBeWDXE%ma- z$7W*h;aSUPOYN6Hd!zW{0W&%+0Dr91;%h^hZj1pBlVHH*ISdUU;dyS7dxifBzb&MN z=Y*e#L*nm=uZZtRg7jlKCBLeu$~om-(^u5z)z=N}eB?4LV1Jx(_AdkavFY;$g%BtC z$J;ivgJx9Ccq*j51al}5_LX2B^!^eo03IsAcp*wAORxm`!zEZHQGCcL&S}Qm)MpXo zR6q$!PLr>eU`ia+UV=GX^r}lR4|===3xM~PV3By~a0!+`pDDpAIY!q@u$k1;?`Bq3 zA6Z*CHNT-XWbVS<()c=G9i$R!$dY zHWKq28>`(-P34hH9?9U9)GB!dU$++Es(E|~)9`U6L+(MF#DcY;IMB#RaA@ExaxLJC zSsq`wp_N7sqTTrgP=h~M-)YP<1MY<3l?_n4NfZ9vEwgMNqN==4 zjhC6F2;bTG5a4)mfD;1QpUPCBCaO|1wNNXyAxAoB1$9yvbyE-ShCX3&VSU5O9`WU~ zOD79!g;`;#uzXfBNG;a2!urA|3h}wKi;M9V<>boBnWg;N8Cw~M7nW8x9+B1y`L&sO zONn`XDZjXA&M%)@EX0lIREzNJ%I_|l3_^T%VNE)_${HxJe8x7DU!Ex}#%C7RW)=&x z_T6Ywo>^HuyR^J+V>2wSO%c-T^N|2stMKjH>WgxbabjlPi6g@-o>Dd%j7r$Slur6#7(;b+>HM8$O>rpuY=RfJI{myYWq&`>(0=_HiS>z7YL zm@YKNbt$GXjktjsoerGL^&3jaMIwoYwm2c2(*`y}dFC|3M&f6F&^14#mBs0NIF#=% z4pw4YqBx+_e1BXw#W0_y>88y6%mn~K>8!3YY#f*hEUv3D?InSnWRDpL(#@Hiwwcp( zGxUw?=GfuMsV$lIXX|upA#^^jTVjXDrVdXOiT)bUT?XA6+ai|C(WxzqB?IwkU5#dS zlF_+vddtKfDjquZ!U;USZEfMRBYY4}Z^Ew-Yig_sVOSaV7yH=|E^PE>Va6boAI!mj zcU-nbh${rsGdk(JiWiQCyKT@#9GILUx+Rp>a+vqetX7JXC7s^PZCS;rz7+M>!gxCv zZPB>yh;32UR>ZbA);eQbJZoLCErGRec$KxD*p|dvZ){6utuMBvu(mR`WnyhrOjn}+ zN7;KIy9#6ckj>fvWV3cJWV1F1*{rRGY}RU!&Dt8sW^FBGvo-|TtgVY_y+-_mV=&p8 z(=u>qjx9hQtzOqy6W8lwdN`_w5qS{=*&t%09D1RAS4i7DI(0V@D;(DwZu^sZ^+=;m zJLF;F)k05urWKHNPhlMP4>==SiK~(M}rKpzGP3R7iP8^ zWL?1y(X@jh_$`Vci0f^J`Ou6jd526+CA40oX{J|+h{<-iFAVHHbRp0NWHZ#J=2Pu+;@&f8=-{|>q9Hre1V58cIc zZ%l8FmV0(h+8xtdqMKN9wziuH{$CReXD9S}$nP;c!s4auKpn9VLZ~JXxkVj&u^W-i zZU223&@1{`HPeE^Oz9tJ$Xco;Cnco>jnJlz0}Gad#^Gad#!$aom=P)twW zcJm2_=p7(GY(SlWaz@mE+yx{b(_3$IpJa%^J!3$Od)9y$Yayn$-DaI*h{1ZwfEeq% z0WsEvnBIPy^)y2a)-wjgSQib5u`b1;x>C^jy3zA2eaDe`55GiSAICvVpUS?h;HovF zAxrk_d}#Hm&|n%E@4u>Ya^sdn`?u=o6Jt|)>WQf>iSI|80YkmOP*eu^dx_rqeO>q* K{$I9!LjD)8G->Dn literal 0 HcmV?d00001 diff --git a/static/epub.js/font/fontello.svg b/static/epub.js/font/fontello.svg new file mode 100644 index 00000000..2db13984 --- /dev/null +++ b/static/epub.js/font/fontello.svg @@ -0,0 +1,33 @@ + + + +Copyright (C) 2013 by original authors @ fontello.com + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/static/epub.js/font/fontello.ttf b/static/epub.js/font/fontello.ttf new file mode 100644 index 0000000000000000000000000000000000000000..95715f86629cdbe17012ceb0595caaf61c8c15cb GIT binary patch literal 10036 zcmeHNdu*H6b-(v}^W#%|N+wNx5=BW7ACjnNELo;W$#P=JdfE{!$003I4_mKEvgfpR z?Ic^83aOI@MUZ6}S{H3ltl03;?bgK0nga8-H0UE3HZ*98EyIe<8?vr{bX{x2@_zRt zY0F8ItU&)9Wq$XZbI-l!anC*X+>a)d5Mm>j2v4#j6U~Xf#)EHx@-DtdXO?qoZ`N0R zlMvdE?}IaEH#O;dw(DCmOOMX!e_Id< z;hrVL^Xx)CH%kMt7YV7<(BHWLg8UBuRp3*=>lT(b&ppUSlFIXV9A8?U$?dy3@C)Ef zr2=V_C`rfy;o?mL?Fw15e?@y~<4yGx3oS zX(l~nkjy4?vW*k$5+`zkIPFlZJZGXj;rQta)dF8rGGYLPPMCqv!M(k$E#bPVN~?vE zbh3AF?}4uNmY&u_9_0~5s}qoFBv8elVx&&+nsDVM(vIa_1IUa&C^0<x>KXA>a5gu! zDmLqJq7d1o$kW6{oFRi}i-EUQ1a`8h%nHQKRf19#0nM^Wv_^_s(e{^$wX>m4p z_~FA3AD@2c==j*^$j}4*`?bB=-rk-%zqi8K;0o1NRz`eoNv>_^^0p;9JKE)j&V97A ztD{zG@Ps;Tq zIzp1%(ADO7e?Jd?c?bVL^hJB?ssoy%vd1RaDpl1~XX?4u5vZka2!Yy0FYmNgxtpz> zT4Q&8yq*s7!>V%Yn4+o*_mXUR??3;dmr~K!IMl-*-q}HSBAu}W4YyV~93i1va#mXv z%F*DF*8NfwO=aBb?s%}W(rR;1ttOzw8w2rOL3{1h(@X{)7W%X9?*6z(R^3g5|NPdH ztg145Q15A3r51_tv3-YZfBRSbG449CW9K!K&SYC76+{I|o^mN1G6F9O(_rJUZ>CwA zrz52eK*?Zz2mab5Pb6IOPeVt0XBYg*{M7(|G2B=)E}UCCm=qM#Lbg#8 z1aWG#(jjnscZajigSV-RGycauL7J-O* zvkXJ@_wUBo_E4D)9_~UhJelC_;c~~l1AcIqg{`T8`1}I@48I#Egq667pY$j9@2aZw zdEG9j-DWYXCPfkjiY`i1A}{c4sfG=Jk}-}g)_}(&%O1bSU*V9gvehX$BH^xzny!W} zD*NOHxdKg1g|CZNG+^^L@Q#byg-e%4w*T(2OQWBfE#87X7W28Y! zoDPdh0@N?qBQ)U)QeOquRtnWNQ}%3#(~b%RQD+;sWwE%hS)8iP@BYOv+`Ft6r`PMW zSb4Lk1l_k)x7n(F*K$D@KX@}s~D zrvM;3k_B)tLQ9SxAw17bps3>p-JbjRR5DGmN$c6FLe2X2eY63^nX&oZc8XBGv*Eqf zw5u~wO}+F_yaDsrE22Z(CrPi2n!UE0$b4V93%Y~q*ejAv+9%OH=;BOc*F-T1elQ2T zUb-kVUO;SMxz~tIJchV2;vu_}yUZ*qQ}FIRX+7ZPDk9V^(;e#Ka83B2*O0XRo@kQ- zlJxf5k`xdf0!0nBM`mO(0EOQEaj_dXJc60w#3}l(kXM=X*bR9`_~U*6Kpe{M`q5yfz^R9lao z)Q4#H(*5d9=9Yl@rbg+Jp>u&>oxub{sH8I`^ho#2gzOC)Fd7m;E3Qt{Ur0L z$p~lampGY2?W&@@Yr*}^B#2o;WdvCkr6`e2*a8BPsUROmNJ^aa5MoT3Ac~^${r+Tv z4dF%80vjV!ZsFqxWs=s1j{1DN8hw>jjc&Cv5^hIm*2>62)!0sQZJc69xnW-dc2c7g zjx-2e4RMYg>#l}!z!;9fE;L#`YTtCk9bVo-InArsY=YP2*s#YO&G=JA49kA|*6jlS2=aCvX(i3cXwYNfjeJQ&WF$@`)5uAJz#)rsoG?KIP8js~ z+yQqLD}msmuFjI58tQ9{&XUV6^cjBaa@#0NQWUP^9#ivqRc%v)Xw5-2VK$>RC)6NX z5ZlzZ*8k?l>nqYHUj6yCPrYMfy}Qk2E`ayqpFMMZbMyLtum|Fpzhg@Xd227rT$;}& z3dmF`B13aoV8*~Kkwa{Wk|d50QIsZd?~w*QUe9irW`m1`pF%p{&HLthlfRR z93wHzCcO{OPHatbqnE#Q8DqC5?lBv7-^LnV!5Xr9VK+%6n_(d{lV*4%Z9%{pjFzzF zBLdFgK$W|~f+~W?zM_(BkDwN)sc?J4c-AC3UF=9kdDX>EVw77MI=TI#g_pMfkWMJ- z!Opr{&N^(5F!$4NyUaat>lsCLa=&xyg3A5rtz+SK+F8fF#2Ty#2i<-pv_Q8?(ngZW zy-k!#t)b#cB8gO#=mINPP$TdQD7~4|D7^*2I8lU2)Z)UyP-CYj)K)8dar)IqXa{@L zO1o*Owj61lVo75t+<@y%!s}xXj~iDa?hRGBVB7>QD5`iJ4!$nZ{P|*z- z$m(O%vn*kkjziqrkdJnTp;27Zui(5>-S(U8ju0@9vJ){W(r>smQwbKYjT!x3Dk|bD zV=7)+;7DZI8Vv08e0v9ClS&+SY*JB^ERe&=Lo=D7{Q?p9m|#PDqaU{i8pho~NU>KJ zc|@`UU~ z4ItZS11n-={IUAKqoKY5_Tq`eik*e>Ax>G5kNwwGBDUfDL4DX|)DlS5K6uN=CbLsi z5?Jn@@pI$c(aobYpvViV+0`hC_ED=W4_ECn$%5m&VsZF=Ba%Zp;Kik{QMD^`vO-mH zL9zM5MP6mNau;?-#d%yR>;dnnXqOMV1);}gnnN9bqGxjQ?BwJ**6Rp*{0S_8XOxP) zR%IyQP~~}(rB{@aLDU46ggxN5Q;TfyR_)SavPE`}7Fq3zVz7$o09c0&MnnpB0lT06 z#MsYvoS=Q=Amx+JWM9u72jU9XH=5c{1@_*jcy`LT0>}c2F;?AXasCR}LDLEl>@d90 z5joDtbS&~jZV+#9%s6xJEAh*C8TYXRe8wUDn+i&{k{v^E>s*;NYgh%K@%_g71e6lZZR?$eKXuH)+v=; zSGGTMgaJLbRiuWEcob{sPVa7tgv{T-4fUW``JpKO(B$D> zR#f_Vyy>`LLE;ka(qAhk%LUb#AGO?`E8)G5*n9t*nE4wlyuN>piFpdy zc^Ei*{Zag2Oz~a0(2Pj@AEC9VX{nbrJ~k7356@aYQ)<5m+8f0$517$u9{A&>7QZ%> z>BboFFbM`+p2N@(5?VpRn98!n7*vO zpuTQs=OdS30sC;q*}nqlN2bpi6hfTjAMe=E0h&=YZEbz^RDNbNzOcEuwx_wdJd(*HX}pqJBaf1GoP+Z?TsDb@ zA6L@kKC}reSSyMHjhqCB2F@baB3U6hvII(woWY0%qh|wn65lysE1>4Vu>?3yX7F78 z0DT-B^BBK`S=K+$`~F#uf_t58Kub2e2EF3Y?)_YY;94;_bA|@9;4JFCLC!*20@O{6 zVp^^nT505fG2>l*HTZ+|ox(gb;Eo$!*#vbDX~y6CWtQzjRF(Is@iMa%;X4~20vs<6 za6%yaQ<*B%L{)007HXw7=a!btxs~~) ze9VYWwFu9y{_cv&AjD=D*QGOStbqb6r)@L2m6`lfY-VwNW+^{wzZXr&GpkEymRB}x zY=))P+-z)SY4yykd53cR%<8<5pIzJ(4FN@uptQv8*1pp{2Am)Xei(0H@YP9F*Rpdl zokq1;P5<_&F4P~>g@Ng*nox~@Yf95cN2hA^WX7-Q-3;o^WHenJ$j$1F3{?j-y@dfS zjN{v*Q`(%iwUqFN@G1&Rl+sZ08DFJ+7_lOw20xYv8n8+KR2G4 z3T4ojoR~s~pJ`tb71M>NE~g_`5k~23DyEA-L#dFalTa$BUpfh4y3iEUrKrX<;s$1P zI&d=EZzv%bi6jy#a6&k%4Qz#S%xQ*=#LxVoYko*8i_`gVDA!*ctV9c+jIJ_l9GD6$rmIoyWr3Vzj~NKk&FQSRmDO}J^o{A}=%LA}f=v4} zb-FblIv3L|(L-ZXhbD?de+}p^gKmu$h$Vews$j9CAwH$6k&I5#Iu}kAOzffJp;IrM zz~i^A0)BRc55lP}_!VMJO*J75E5rU`KO4e@jou8*7=-eJS@`d+%L;_JLNGn8lfJ8X z;b^$q23^E~$tj{+LMbhadH>96r8rqqsjY0mDn|6>h`$!b+remy#B@irKv`Q6EpV)L zMhiS^UD1NTS~tAPT2HhfvDO?b3Cme;z)~uF>L$hoFa%lCsrka>u zAJxMVJ&ed}K#&b0Hp-zF%5{gdts_(KCt`(TdgC2`Qm@|7q*G6e;lBHJntN|oQ&j6P zw24HC&KKhwyQD0SfyDa_BTe-8g}Mt()B~-eumKvBxv~hLTz5>5MdQBSm>&N%y;%7f za5Tet#2eP)+92CwF#3V5t-;VBcFxpE*q~GFFjJs=hL}aY+f#%^8?OiuoJ+RgJ7h?(1BdHKZJP>KzlUCT$rLb6(k@b0D(^; zx`;Iu*;tIrfhBCrjwh0zKU9;sJ0n&v!R*l>L#!{^6Y7PTZ3bCautPNMKnQ+|AP8c5 zyJ0>w<4WEklT&f67ipU5RU%@t9qtPQdjMSsw1JsW(c{I87AkoaI>q#klEie`tyy*^ zz>2cxJEI{j&dfi6{M4I?7wV}Sk==EN4Cmh^ci$l!+~uM7@Z2BOTO#G2dnVlz)mtN5 zSaPSdDT~kvt)5lvC3l*=&;S2Y)!=*!003oR>MOLxnB^DE z9Zg+eS~QFc!FI(dMv_)@FAr+ic>t#2!$6KW{(@-bV(kdi76AbGdjJ3>B^K33*xJ+` zmWwzCi$VT>z_xbqwSsA@004#<06>sjKiq&|V`*vuD@6{A;eQ2?{7sGxOoVBgFis5v zJ<=xJ7aK4OAMQ~4cE^d}EPV^3@X}==1DCfl|&)meK z#Uih#XSAnRbFeuoB%}yQibu?Z%fiCU#Kg?R(y9j)G-IGaOm4*W4cij)pqVh`FgYD-AZfJyTv6&LxXK#QOvPITg9T5{qzrUKSHl)uRfXIy`Sgl*YbRXRkc1_7oukjao$eqvPEj@e;~A+*M(Vo;!FD8a6n8BvqsBOQRu z7bzc3RWIPV&Pt4eODH{cHE*Q{nTGi)=4#-;tU7{y1jqB>F0u+ZPXFWqq28w2C~iuh znxJ&nGZ{yFlMZ!p~KSEsim9qJrWJgYD3qiQwb{!1H~T>9tAQ03P#AzAy9=c z4^&BVEjPHdKMBPBVUS)WqV+b)4=$TW*x!}=)QPFO(WSHi>8-Pu*G_(vbcIe-@bm+b z^46GK(zaQUnAC%sT@bAbeHmDH?6M+~%2kJ2s+~I;jc9aJBV5o!c6rIla0kkL6FGUW zSZOMXvV2f-7lit(LeEBStzL31pEqv4;90wBt)>L+Boco6RXT(A><=1R9nXHa>1RST zE#uGk>j=Crh|$(h66?GXN{^W=ip|cs#mb#Fv8boGnq`LkgZQVhEakS7IcAYJ6dGeQ zpLyQyy!>3(QkaJqbO3u}$5pbkvx827Bzpzc9CZ>B-m&k^}e92 zwqHEB8zk5|^mD_-DcELxR6o~T06!mKE`PIHdmF~0RaNmAuiEf+ z0`D=YAi=EauKlKm^E;b0I8n_2UP(GFzTtx*W^>+5zP$~24{q(Cew%r-N6}T){8Fu& zcBQP7T)f-O=FVrK| z8+*%uiDb*a-WTpOptr3$Xme`BGAnx7qv-R|))8fOgX23LT%gx@!;S~Q55OV0LEic6 zFUrU3Rl0qSoZ0K|y%qWN9wyD3ecl!T_uh8XtMgUP?juq>&}~ zyHxVfuOl?kKWOAf+A+?v$U~WSu>;;?_6mUOR4o2wA}s+PCW><)tOu zis;^i$XZb8$sDDm9OE5nP_ke9$H_nU(n5lH-OQz)V~~`dmtdqJdd_<2Q#KvTSIp0U z6EXk6e>$o)g1wYs-!I_H3joU}52_pJpugbRy}$0g5g0(f;ZMJT#Gsxo6I*PzTq+Y& zTFt4^NKpy32wZNUm-FObQa@ooG#eiw6mG<$whfzO38g;h5Z6O;RI6D`M(^kEq`EIT znnLI&MJLmvel+ioq#J6Cg7EpK9> z!~_Z&P>@mu70zt%ED9$dpRrq9I>z{Pun;s!87&f^qJ&cNxn~sHR}0E}UVnNNtNe5C z7!{D__0-ZI+<$web80cevHT-k|0!!d^Q1R6SAO|Y-~SoY@XrhLQvSe8Csnn#C@E)I z<&=@|{!(x~%M3X32flCg6K1=VezmBQiC)}hR#Mp3)yFAq)WYD}=WSSa0SScrcTUa4Wu`4?4pB`je0+2^DAd2HchmZog zRBZPd!?J%k+J}E|SyCuMx{8k%5eWhr&gRwvh>uJGZYq`C5XEX*{X_RN3Tyc|(JS%9 z6RINzrDpvLNonrw4$1>`^mSGS$a!L_yk{pnsZ%4`mYe@=Z(RUUd=rb|iqVXRVTp6} zl-$d8J`Lc^Qx&su#~;arQ(a6gT-iCzvMht2Z<+AdN2yDhKVLeqh6o+M^A*Go_eUa} zQpDT@c++m=@oEHnNlpwg!i$UhoXfA{bbNPyG7fskn)0L}bKyj$kgD2EbB(IB+ShT2 zal*x;`zkRy-{qv%24)5df!|RI=wzlOn60wo^^EbZz2l?aF=TkUs#M{atygWCGp^%3 z$#9%nr+i#1CvrS4dEs|-!64)|Y{P;Ioq0bK)}X*ez3)aa_l8HQjB9CX`l~cX(;LYV zHNtyO?i=cmj5ZIg5EEC|YVKLiKJ${@s<7J5lv?VgOkjpj=f(pe+K3dsi3*A8(IMrD z!0cKE1$@5GMVYlz%2ZU%D_##y6Q%9?%TG7EegMZ+urzf9U6}tabQh_N~&Ni70>N>^1YzF2wwGo)=4z;ElAi*+z{68}$vGgUKnXjk{g$ zHY`tDZ`>{)?@7X7@8My)G=HCij1K?NAjhK}rl&j1I1vqm=fCzRmcL>NXq6piq!Kmd za&xyo+Yc9)9ILO{Gz4FubqbQlb~y3kTS?Y2 zoSv@hcB&Oq1z_(Ki-LpW@jspKw205nmKTobKzMIeq*QZzU2$ z(qjSY`->DYGSJV3{|Ti`(r-X%XUkm}>DgB;jSFN_%}lD8SwW|m>eq5^@UU7P{FvkR zOl1^0_Ye4ZI$vRJ^r3pDXt*wTr)-kSLTn$%V^)XAs@9)b+uA_V{BdUtq13cgp89?=jWCYOgS>F4RBPzmDJp(UY0*LiN@AG%`3>GK&dZEN|F z%5)Ofa)06RC+zkR*2@{N*U4h-x!dp?!DIj2Yk4royEC+0FL*wHC@r%ZG~^4N%y3 z4Ep*}IBel1M%lH&;hBF-hph zL1=VvcseNid2(_O?f9N^jwL&)#e3bXpg&+q!B3&6L;Ns2tAG zV)>a_lf+v@*i=9PIh?U7oy=?Wj8y3)XX@{%ZUaWL0_v2hUE}VTlHqyryR)d)&-d2Si7klU?e+cw&t)4c2F4pts!Q?)-uj<- zf7hC3w=au^v1L^bMN9mMpv{nkzLOQ$sv508**_8q_4HhI&DYjstMYA+FK8MN%{CDL zA0JkS`YxI%XdZJsYg=s|1tw4=xHs* zCKy9ZDZ_I3HN7#6!njiSy<9R91Xh?05^@7xJd0lVKO5vJoU~{?eW1u_(65nMdXIEj z3s*62`(Dj>{dCg7nTJHWn8v@Zn4i~9*@T{FPs^0W(}fSoE~me^cSHQtTHYPf%^#hM z0iXhgU+Gzq>iTlv*`sk5Nq;%8@Jcz$Ua-YBQdf`5babASK0^8ij}|h*QXL?6Y^55l zVHpDS;E<+hoVYrj8)q>ehT=a5%LFfsF0!-tjHDiE{YyWURs<-02@;cfTRBAU_7cx# zHbVs(KxsK$EWL~697}iQezq5Hzcuo^3X*hR)o$b{aH9W)q$pjJ-V^FyULVnf&4;Zy zzDMRQrm4w+@YSsP@C>ig|J)VqR%Rs@pYOt+wD(`x>Rq)qU-U;8ldWi`*tZh!IJPMGF}5gXqSJ zG_hUSPK%0=St_5~H@}lsA|^S4J|xf=>0ocPbxP_mZ#YZke;&Z9aON-c>p0l)kfA+8 zltmHKo*`9E&aogb+E&iBb^Ih*XtYRsdWf}F<^tmwUY~4P1n>ij8GH~uIkRPF;}_1B zEM4wKY_VO*(12_(Dd*!9KXN~-Sf&Jzugx1(4l7Wq&uW;v>iBfpF%wNu44)|Rv39#4 z9-&!Pr64u_aU)@)-Z$HM2$jpl%tCGMvS3lj!~$>s&pBUcr4J8SZuc$7lV@wfMMHTp z_N@*41dY5giGglgbNzWbIW$#83CHnZ3_yiypN67Dlmss&ZBWaIgBKoaRXiA;eD0f@ zvw{_!TyK3;Q(k^w^W*~hP!RwonOyBI_?JsH$*4Vr^A=b`TAPTDse7Q~6ByQ@uD0oQ ziXZ(H5o)4byuza!Ob}maiGdQ&<%yC8yynTj5>Xk}Py9|Y;9FpKj&^6PeEv_BOw0dP zrB{D{`D;F1FrFm7-|ji=AN`+(;SWNANGr9|kKcMMB4+m`h&qzuC~@ppK}y%W5wbW) zjfQuM1X*L}+q#s9*&T+zB|G4KrYo6T?tHIhpztcx^(4{Tt?qj+wfpCzqozIr`RH8J z#fMvJwZoGZ=T7AX-gXzG3Cl#zQ%ny|SEi?8rh(2^12+03MoWgpH_v~s5r(vT)XeOp zG<1W@8;0OOI#Zi_Ul+RWJV$PKaDRnDyA#(IADctpU6{Kpgfz>Pb|o(Iaz(D7URH$P zUZ@Cd*@c4$|apUFr#SWee?mdhn13<6p|NJNm6O;ehT*Z?;=P$x>G;nJ02+?o= zS26fxm|qpt+tc&vlaa{t$VnX{NHl0*qnm{dkZ6QFF)}+QU?Z7R=gLyWynsT16>b=2 z|Emkg0%?Le;7Z~C!Arqs!tWv|BZMP#Agm(7BQ7IJAbmqdMfO78L@7nhLLGVS8$bm3 z_@A=~GxT8YpD4fyrY)nSyjJtc^GyC}*C&A=`EoH6C#A1<(9*=JX!~tCff|``t(lC) zNhzK?W*}Y}+`Difd}aE88<_cz(VRsQkMVE5^F*E?31HzaQsSS8>n^*?5c57rWxC0r zG`Pipwp*8@Bv#-j)776$HXjL-_E@rj`cUS49=*-k#-5C}W`mxHw%5>R1KL~mPp)i6 zZwjXTGug7D=iCTxx9tnH^(hdFQlOHCExEOcc}``;vA6=6XUpM=6^)$xtlUB5Y{MEq zMU$RQC_4S9&h}%z&dM`1?(yE*?J{+FC5W$RsR~H0WVPqnL(`>mX>|171Wdjw;;wco zxwsWUFRbq)B*pp48Xh8(&@$1Uz^HeSTt1dOHr7N-?}9Virt2=3Ra+YWNbU|sshy0^ zI_cT*_T3#W{rG6EJuO!qbrIeyOgH+?!Wgqtc#Je9m3?;nvMYYasOPp;+Xzp|vBc`_O81RE=_ A2mk;8 literal 0 HcmV?d00001 diff --git a/static/epub.js/img/.gitignore b/static/epub.js/img/.gitignore new file mode 100755 index 00000000..e69de29b diff --git a/static/epub.js/img/annotator-glyph-sprite.png b/static/epub.js/img/annotator-glyph-sprite.png new file mode 100644 index 0000000000000000000000000000000000000000..5bb11cd84602e862e0b0542fd9b31da9719e0554 GIT binary patch literal 5085 zcmaJ_XH=8hwhg@qNRf^hiqfQnkkFNc&>_;hAdo-;0Rn`M(wi6wAR=9=NL8dBL_{!h zM3CM=k&dA$f`I6Y=iYPP`*H7Ee|8yb%{BMhbFBT1FV!4rz|Jbf3IG7ujSLZ%)R7wi zpb=+gq|Wwx;*iuqkf3Kzu=4jLgt`Ty0Wg%mI~r)@>*j^FM7yEF1O7y70RVL3SZjNN zy_u@xO32sPo_3isHb(TnIke z;{PILZ)OhE^$$b?AqqvD}j_0m6R1h%JLvp4Y0C?k`nOW zCQi*3i1O61MCkuJ7j>mAjv)~68j6acp`i+)UilBhSqBIat6%ZH< z0YhO3FbJdvf3`gui1^{~N3FUt@nu!52@>j6ers zL(nMwK!0E0Uq{x!{s%79gi3IAJzXju=s$D$S1jtkb5Z`UTokEf6n|gr|GDVDx2Wp* zJ^e?v)Wtu-NBdFL9!Qn7VcC@e0D#lN2m!MWo1x^hSf8`wORA~KH-p``EqfSXc8*_V zQ<}_6qHh(*p+_mpuBw$u|A}$hX7$4EvMF2eU`30a>xaXI&cpeL=ay)ywY9fH7B`>po;$bvxY^I|x@JTK zG!&1=VB}GwWMcBst5>hsg}aVr4~EMOrYGQmK|!iD>E|^MOmH|{h@)d(+Qqz7u?u>L z-aSHqQCL{%#k`fZwYA$~1R}p*-WiF$RkQrNfJUzOy)2XA0b*84ERwLO^c+6hIKlX# z%Ic~rQr)Y}*J-Yy1VVxG(dpp_^O|v?iz)hLAP(*xYKpLnW<_z{-rj9%Pxt16W?XKN z^wp|rYwvw-hSk^CXAM6aM>(N9_gmXG=zsm(Xd%sOL=-yomC_HmwfO(02i7ZfiY&R}o8Y6j;Ci8g7LhJK2wy{jv zo`A1KuaNkI80;?K^tS!F(7a}y=0HWcvzA6WkP?23MUsxbt}&KZTu)8CrZzZj0fBfU zUw@5Q9QSs9w!|H*u}uq<{;YUw;^7JZWo9}`psBO7mX}Y>;@A%!U&UoBBIe!5zgltcNxI4(POK<#@XQs%3 zeGRSt*D%Wzts%y6amLh9Sa{+2#=W!O z`9|NPwn~iDVBnk{22YEguS@<8c=gpAG2qRoUfgZ2FLks2zW!`!DNn&;4c#C6c`3x~ zyEd{#!j#WF?b!L}7PeAO&Fgg*EQ1PTmy$ST-o2URSE^Gj8Xl+B^POf*>DRfcBfV`N zye_6*5@~G~XTkK*LEChGb0vqz+4(vX$KHj~s?^%~hjfmu*dDZ}XUovVP1-PijJwRT z1H?vT96oFRxlUF_=CRo47APy{9T%Jm`SPsuK+4`+!2tsYPRNQuOUtq9sW69naYjaw z3qP?^_dxe2dsV&-P)qGhhhd1Zqc6D`$``x)(v)JWgG1!VP$F{KX%niyUSmm!(`3&~ z9`MHLcq*lQH|YD(Gc;A4H?Ci6W@~9p!YK2T#yzLGfI;>>w`;5zSRj=~b=5S=%pG0E z)y5=;m|9SOBhAyEqJ{RV9B~9meHBhmbcq|P{ou#^+M;pcy;*arNR=E)K-f+czCb70 zE#xYPItXC-0w9g>UluJn{0Z1-_^5m;)@d4NUUeqKN!t12lq+pGPY2z*ubRTo%C1c9 z#D$Hdfl)Ppo+~k@fKDwQ6hF3p%!de+M@;6yCYE9gr_#MbF5%?u!>6lH0W6+SN!-@D zHj_Aq`!t(~SJO#Jx6@QzVpFC}DAN})97Qv$GYS5|@^-no!dn5v%<1wa80$)$Lyw$O zOGgJ&cM=>5&l8f#XJLu$g?D(X6QjgtFOr-tTP|emuTGM>jcw%OP^tCWH`q0E4r*I_ z4{x7~WdF94wDe24E{;b1vUdkpEzdTLHejdp@%ABkP?TW_9W}tz;XY?_yp@pQNQWxE za&!HM4Rh!7eb4xpSmuhCs#%$t)n>NroCeK~+UM6sGfY$;Yv;c5y3xuy*+pNA;G$3A zQ66RQ^P?kHHw;ImDv#2DQ$A|}pLcfNl!nbT``9UkP^LPNNaPAUmP{1Rxg)H)U7wt6 z!1eZrV8eEFhA(aoV`pPi5zV_Z+q#pe9<+KnAL{GK`q3uLM79{@q3@2ttdDHZcer|u zJEvR-RUK*x|GL_N~VLd=e!N5)sv!JmX(dru$z7ei|@ANJp0XO zU;v(W>F3X%=L8jXMxvskv@Fg`1qePL#j;mVRNK@b&@UJM_oYBf}?UKH&4 zjtx_JR%Wcs#l>YWa6VcE2-I<1|JWVxUC?!RQ?L8G&=R_W_ipG%$49-rh?}&~sPDTz zr^nw+NMJ)q#8!M?U!Pu8>BIwADbuqXtU>t@pO$R2BBR15!mppFy94>E>BQ93fH#`X z@)rmMLal&$ASwcn$6Jq9n#rIQAbk1-Hzc}M{pJLUGc!jhUsn2&7^!-n$$ADQGQs}l zIp+lZW%r;@8F|FY!f8%qAwJhAsY#<*M|tforyX=*G``*R_G=(k=Ui(dd49h0bbYw& zv#|5_##?knTl$mG>TiXL!@1g=Nb0 zGYiU_M!S0F>3Kl;=*B8bS5Zz*sFar04?5#Y{N|Ywm`+E?)=W4vC>P$o^d>zT1Bi>n zWvEbYzC2;+1eh(z%E|Tf=d@Fmw`NHqcXyXeSkuF6iLI@nf{EuND%Qtq>||JHZubKn zZTr~R@=%lyUcauGz6nn;uK0t8kMF?X0bJ&8D4hz;R?N ze7rNQ*r2|n`}%aM=!TEDutOR$m)$;b4o|-nlA^*`f}-U+tH1IAaKck$AsFNA?EHN3 zbVnA3*-y-t8pwml@p|04sN%}n?}r7zC-$I!*oMH3YsN=7Z@qp0-v2lk>=jZXf|l48 zm|Rc-l$b=0(6GTcr?yr|b&%Zi*Z=gWkDp{;xB(H_Jrvxv>KA>4D!zk2rVa!*D zX=}Fi{cC^#%lK@AWAkPwES~W?6N(S$D=m)@{^NEdmlqw8q%z#knmi0Y8Pwc)9@h<` z?K#{m(M{%FM(ezQOLW{eEn&QRoJPY8a!MxGh#Mfv-n+En7ij@6(0RCXy8HgnfjnL@ z;iGPV%8i#XbXEG~QJK8z>glS5TfIeQF#@K8ZgZN+=hoV2s?h!Su{=`9xglyBFu3-p zK~`3S7W0H7wb2RHsZy3zwk%%1v9V!7N_jzCtW^KhLM+#K4THh1rVBwfdG-hNp*3X> z5Nc&aTL1Y!cvH0gJU`sXQUP9XrwkTqy22jeQ2xu=t0;-((|fw3@93wEX(F||$lNT0 zbGQVr=@emMJ!w&GcM|u8R*NOnJ)LcmC)MjJN}`Zt-x*hZAGq$SCvt7RJxHqVW}DpP zl}`gS+aOkQ80U4DQW7yLmaQ%MDGs3>yg8-{27?uIS%0o4+*JAqZ3Gf(PO|0f+|BNY zI;4;o2zN?0JS0)1rPno7W3!CqFzdd^>GXC~a@|R;3Xm7M^sTm$%v4kR_mN^I&WC zGh6k+?qZKNuI)zopVhOG$Zg$(a*}7lqqs z&G4B$fB4TdVV?@TQjs@+^I-sR*+UIKzB3G5`JqcT``Xr0amw7-C5gF8w>5fPLwLlXtDX|x&?SSf zvmOqTu)nVm;r)>LL zz_>$`&gW#yWL}D)4Sz#J=nOw2DwtM`N8jaPhOL6A0|U4sby_K?8qH@allnxhX_xPZ zRmsBSCX6q(Hewi*O?;sFrc4j8> zJ#1@hyKGf6e!<$tX8uiuI$!*cA3rLopYaWS{ry2L5x!>T=0l6rM>9sFb-2ZMR-_VH z7%@QYe~n0B)1QyT#Ka~KDbraAvI{jn4yhE&bS1Dq-Kb?$oXQ#vl%xEvl9-Pz!v zCgEXpvS&=^Sy)qP`B(&4xJfI{w5=AgzaDC3Y02j_YpWQ#KIC=}`DoUGYPQbK1r;ju zC79`{=OI)u+vmHzvYbDo#0r^P`O1?_%f>~6X^r?e)|+)9J5KD}G}!F7s`ukIJG(^p zoy8@|O2^j%)KFMUOUoDILR<44Ieb|odBaY9hLx}}+gKqL%q~>3@|SBvyfgjfkKs*R ziPJqXiQ_EGtE;v`0s`Mby?+i>#v_wojakG;$eV{bo)3a3dns_fiKa%#y!qeT| zUHa5xG>;yhLNXB>sACv=Q}(O1iJUo>o6ibe7LK?$)s6j z7P$23(|YkDWMyTAfr&%Jer!GDZ&xW2=FBsC$yN%*tB5D~CTeI0&wOFuibAWgsSD#Tv(zAEI5{?uki>7>3nd17oiLzro zfB*JbRi?4KFicr<*$E;m?A6F?5i8*FH{rP~hIo;*%%+$TQRRgBNAj=i1xk3Ae!0Eb z_mqsn8Wzhga25U{Mm9clu$55cLI?nQi|?~=9^(&P$!uRFLQF5vZ7&wp##E+X-g)*} zwOz`j_9~cHEHPcCP@paE+r8bJ6Virx>LvHDI7JbI_hbx35r+DY9?)?)Crr4zF0x%M zFA(?caLmt4yZ6L2L^&v}qt-&vak=Rm=;V;?xEMeO7^>1?-yJ@b`2EApNDqmqhu?_% EA8$|<*8l(j literal 0 HcmV?d00001 diff --git a/static/epub.js/img/annotator-icon-sprite.png b/static/epub.js/img/annotator-icon-sprite.png new file mode 100644 index 0000000000000000000000000000000000000000..3058651c59f19f4055c287959b1bd44909dffa39 GIT binary patch literal 7184 zcmbVRcQl;cy4Q)88J#F&5TcLXJJCgnPK?n;8Er5`7rlQ$l;}c2)P(2+QKAPSLG<1- zdKp|f=X~ehyVhCvkNd9mzPmlo@9Aspz2Dd;x{t|-8Hlm4u*fvjRSfRhl)G1uh~Vyf zV}4|O*U%$XO_7G~4oE+!mpzuEox80)NW%^4Xm4N-we$BJu$RHY!gYWfnIcVfw54F~ zZv4i;2>RCpzLVx< z=OAUEqV_LYcOzM_6B6kmB_QDE=g03S%CDsB*b?|!RPIdKtfS`2yeE( z5mfBGVP0?#B-|YV`hy6yb@xHag6}l_rwMKzIy(ObMtJ|rQFksAKtVkOApC*?Zf<|< z`UkZ)(!l<|)%cIp-bVf&_5ud>-tInLu)BCTu>H+^=ez$~&>zA(ZKU+P;CDfRx~jOt zeBA62NDUQP@ZAc(9o$YzP*_3`0udJx6c-W{lYl@ZM3fX&B~`>kR3(KJg_Onq#`urC zl4_EwiYh8%f)Yv)h$=)ZavioF-y*WOOe%iRt1 z5C2NR|C4;t|82Jo==U7Zx5P*y}*+It@f#){jOFSMhz)nZl87D_4UNobtN3O$RXIR6D;+|{UXIwl2W;}68Q;!??($5`b@~28qA}na&haC)} z-U;NGI*2@7i_>8OJSO=7H^vW`+rUi$q^72pI6lE%-N?1zQLwyLT#<`iuuuu$Lm6kG z9+te})6~=qA9jcsuoe4&3bA?# zZNTc4nqEViY=lO92E>2vepu|7{7cJgwBbuzI5MOuP|d|nxCq)(qQDLtI~Pz8wSB(#q1z`ssjys zx2)mB&773bo}M0#gfGLYs_bUEMXs6>Stn*0nJKMYb%sLQiJ|q8KOF*2;{2NG#7r&7 zK85v<-~tyoJ@3Ihy_tS$wxyQfxZO+_Ir2Tw;nQ>e=8@thJm%`Sj{VoYww$LR1B;TO z1kdZoHs^1FT6FO_JF-X2x>^eRy1zg2G6^AxcxiTIDUU(TceHy}(jr1gagCqESQIBkkrBry+Am9ZO8;)oSVJZN}trfq^ zzDT>dWR7x4GUt@vU|*gpx_Qwa#D0tC5e-ZykWzJeE3Er`uVQZ{1T(`j{Lgi<$Sy1(Oos#zZz#1WXBQWLNI&8Q#;UbHeuAh{eF_We#Jp>Z z>YDi$Gg7EOxp0(i98;^VEfjqEY>IaX`pFxC4dE#;-kp?xZ*~L}bNflyrGWsGc_48aujR;B%?73g}*PzPjT%l_&75iwqz2W{P98GtcpA0@k+ZmZ7zIoC-o%O8Z|4R&GPD2#l zy`+&|Z#lC+|GZ>6S6aTi(Q^e8Ke(yDA{$^t0eF79RhF+Ac37kuzv&XQ+*P!i#P#xQ zW7{|$9WQ4!bBvyUGwmk_SM-!Tcpm$N>Me%|7*Zvimpef#mDf#~-1~X`ZKp{e{Og-| z=Y?mfwQ&@N7QsG(zV*^%uNv^TCGAs=oi95q7n^@1XPUkk_?0knZ+>iVK!4Hc^~@O> z$W<~-c2B^US;?tAJM zwsqmjh|@32&kq{x1uZSRDWJDT|*IU z25L$%{a*U?y)jQa=8$J#O(#nTzq+HHvEy?g3bd^Xt*%t zA)Fpwu(Q)h@R?MuQanmlnqaCgPQR`VaQzmaEGLI_c3g;PI`J!$N6@;%p(9WC4=5bx zBVUS);i1o5p6v4)muY@p)0Eiz@|HS=-b@(+&yrSG?MUeau|Byk7&996g1C8GW3zM2 zd$z;^@x~8P#yb-6O%xyccG$I!*2V)ccE)-PN0Tz3(8&mLuvs8={RI>K&maQ{N-=E-oFWwSj_0*i~&qS5F^|D#f2Q)7&5 zYD7`v14faYr3}AK&F=?#W;WN905*LXOA~gIZtm%GHEKSw z@YMalR7Oob3vu4<#I2)KuMALm=cz5KgD!R|U=)XOai3Cw18u|~ooFVqve*`vjN*PrtawXXXO`gH~&;n9lyuDc83Y)YDth;y1( z@XkYnWP4B#dUTsG=2|vvcLfWxY$Es8DFT&$H@-Pt_`&E458?_mmOp+i2$*`z&lX_E zXv?xs5->Uh^=MvbjR{yu<p}Ftya~CG* zy2zM*KE4VV${b_5N}h(UE((^E_H<6NFYmnU>>!ViiCgtR!LpYnSJSz6t=qRN8XmL$a}jDDbv=^6CEt&73@`2a|+BV znHaeJjf>k>_;rEse2Os1Afoy?#CooSrh*uSW z$BcWC-TB>UwrOu1zOF!OEl96J{V7GnofmwCj9hcZT`19mgIi4ef=w5WQ>l;V37~cjzhw> zJ8c{&xG8zO1tezDnHqG)Yi-d{G0SE4^D<28S>~YAk!vD3Dt@p_M<^STycO~J0Wv1; zfLM35J79&zc|j5f-K=pTQ}n8Wcr0=&$Q~Npr*KTykkLJtezkC4_85>Ma4Rqn1ktZ8 zuiq`C$HmW%3_JIU9Mp0(qEsW>+F#=4rmS7}2KuXxgkI=s*3iVz)+=*dc%C9yH#4$V z>5X?H%_rNQGk&L}Hs~Cx;4Nq#W)~>Wm)_*n)<8MaYC{!S15UOhH}am7!{L-1)AseI zW0RAsRK>|pg>_fv!Yn`(Pe|Ekv@-?e2u{?reY<2n1$36OM%m zhyyvYIdAU0)u<`*`{@xQI^5W_f|H$`{`oYB?*#!#J*a4TMo7_ukuMKoObrOz*8Dh1 z*Z&GXE;csx`}52lTRnZ5>!Aq)i*J;SBELM#wlp_v`1b>E{I`P6_UD7l3qox{)0)lI zwyxlqI4lFgxi0ZOEl>97&N=o@XUexz<1`>|Pd3AVF~7Dkn`5?nMC^%NkA#CTOm`EAQ1>&UPN8Oo^=Ew$i??U&ib1Zo{xom>8!k|9fsIB?T&Vg3 zl2v7etgI~5My}uQg^-&grmXY)k({zeAOR8;5ne#*LF5IubdtyU553UaAXq;W`u2+M zekEZ;>uFa^6h7FE7tj)+WW;h?>Vr>oJkbIK zsSFkHQmMp%H`AT+tkxN#v*f=PuUjij%j=R^isC40DUvaWQy0Mp&&pk-T6^mv%R`BY zNgi0*5T26qc6PU-i_vKmz*xqRQ@7IN^!Q?a=Da(`dimpZ`YXS@=C@CNPtJQx zQp^v2?V+Thi3<-W5zN*$`$Yoz*@71Fc7qQ&bNz_e^l(r;xL(|G%6Y$MVNVGCkUfjO z@_?3@xei?RUdkQ=S;stEsfy<&G-vJH@;_RsQQE^l0ZPH3vt>U2+v~GWG}P4YT)Y_O z)KsV--SJ=2-h|)%D*l{QwHqTN@f$ssmZLguPO4|uTp1uK8<|>V9~yp@^Uv5+FGN(0 zGb)ko&h2OJ?;CN-N7n$zt%`_teV!E-3b}W$&G`^xiXMg-Po-AUKF|_p6s1yJctk2C zcC#CT^g3|1w|(QbB^9|`b0b7NG%fzVLh4)IGd2QnRhrV!z`zA%3-yQA_q?#7%<)ae z3H)97(=$9N#-goN`T4|3ajq#B$kPr1A#4{JZ=Wa##qR(268?U8#S@tjkIxNu~lj(o<+1K}g# zPDoUad%Rj`L{Qi|iJfFjxe)Fgaqsc_NG>sxDtS1s!TPlN%KTFa&t(wQLjb*{P{C+N8EL0 zFe80&PMo|Sr*>h|WOZud(xGEXk4bFm*~lVl-XqCnEqPCvCikix3r5LOa|a})Y5+7w zJT`+T&52F{^c!v55HqMYn=*oq&6o0{$jZF$;`w_g{Yw=M<)pG}WpbU}^4!hxdEb(8 z9DOBNdhZ*_q_WOXn}r%?4C*Q=2JAQYLV^5a60R#r+b_#8&Wa)%QGRWXJYlUa;QN}` zEgyu=`Z_MRD|kafpkSSDTwtn&Oqp(OZ!L_o;bzZ0RRF20eqUV$fi~s&R9KEW_+IoO2WOc@Ecl%{ptAoUyWbZ>vQk#5 z#D3N#Y#R#pirrWMUP#QOb%<8%K2g9_KOAOt<{xsClQiQ5N&DxJ2mby{*zu+emb_J} zmn||N0ED1xHahS2>;pX?BJ)*4_?K{ zEWbOadTMftcqG*#X%n1CB?r3kS&I%C+jg_gpIH&to_%heTOguFF9S}`uUi*X|hmtTka-bZSd2Rh&+A*EkJW?eI#Bda%sTLs&kBN!p zEyZnCP-4(#E z+|(T7vuE(Jfd_BGO;!5`U0sDrbzorU;Sp2cF55gA$#Gk{1omrl3@gb z(Im@#{Li0Yi~vIvg|tM}GJh=el`CIOHaN z86aPccM!spWvU0OFsZiQ3S=juPnMHXu9Mpx&wKqEmb2xDSetEKoGpv}*m`rh)000u zk+j<3g=pznh(GkxvF5G(A^vNohj-NB(nv(9$zMw*_MUtfUZHyQr?vprr6&v+2`| z)e!%&WL$=jAVQ>i9^XeZQdoGcDX+g&F8}gNJvlRh_*3eoR|3y;iJBZkNXIzkDHCkm z2UaBHmd%%FO>E~JXgq!X{NZ5Gc@`@CXI!&kz;q8~;+R|A zo(U+bkB@w}FfdWj%4dKI|^K-~-sHue<-iOJciB??KY z>6v-9O7C~?S5nAKu~iB;^)>Jbs{}UJ3djZt>nkaMm6T-LDnT3-;TxdfoL`ixV5(=Vn`~fcs9E!^lV%s6w~6GOr}DLN~8i8D@e@YH@N=Wx*A$ZZ2GPaY;}r!o64xE)J1T?`q ze0{Av^NLFn^O93NU2K(rX6R*RrdSy{npwEIm|I#p8k-s#x*AzJ8ko5`ySf>>7`d2O znpwc~y5uL9=BDPA!1Sgd^g80y3rY;R1wfl!Qj0RnQd8WD@^clyp0>)w?G|&K=0WwQ z;C71zPQCg-$LNEi7AdM>LcsI`V!{(HkONQpsd>QkUIa|o0qSSW85kIsd%8G=RNQ(q zOaFXRfXK0rQ!Nu$xR{%B_xAc3OwbYVb(21OHtC`Eggbv2jO-b6T$t`YFju(b)A7IJ z{I_Z5nj5&ozu5e|clZ9ed7tN0ORm*9J)`YKduHFPBd4B4KG~Hgz%sQcV^*5Pv2NE$ zzO`YiS7o!g?>X|rg1_O`+iw{rtC}9v*c~tQnKbpW#qmNBSH*L?ZszEmRyxV`>TA^^ z4Wab6B~~-m_r6&B|C7!8s=d?fgnaZpgM8NC_ex7zZb?usEnMr&h0oVW5 z)$feq%AI*Otw|vu;cDsL7v6K9S6Y?!E?SYX@88{E#Z>7D>lfs0@BaBKBvE48>eZ`O zm2T!^Yc8r=8gN}JZu5-wJjV0S7an_L%WeBXPA)=6>~GzCCT(5*E8lxL*0o-KIpxqD zt&e)Ck<*-Fk3asXem+9rOvH>W7RmShPjs!Rtmc-}-F^4m_u5A+?S~r;vL~r*%U#Sq vK{T@SS;Ml-(BdbSi(3B+*4n;a&%n%Ze)X*~?oO2X9puoX=V1dNL|MKg?mR^aG z5aVlnU$SfU0;K~h&hl{Pyit>MoAqzu%6R!b2PFc2aedQy&am#f+=D%d-%fA%#*&o( loZsNLp=0X`Yi2n{HU^D5?3ZJCcZ2L;@O1TaS?83{1OR|~Y777X literal 0 HcmV?d00001 diff --git a/static/epub.js/img/close.png b/static/epub.js/img/close.png new file mode 100644 index 0000000000000000000000000000000000000000..46189e543b173b456c5169506cfb2545714e29a3 GIT binary patch literal 1065 zcmaJ=O-K|`9G@~pZLJQXR)-#=5JfxlX59~WaMN{X%>~Dnbs^~x&Ca}aN1cymp6%!% z)RRF6p+i=egox}AUJB{UKnaTu9_-SgLwHvLp&+m~>+ag2Z4UGP@6Z4D`+xo3?c~6v zhWb8`h*lY8(q7$hWra#*3eE`m;nCj=V85^%IJ-R7MLUEt-3?YdbS6hiQ5gx)V|NKAs5VIdG; zpjU=L4g~!S=Z9f`_yX`j4ziq&g&{8o`9O$=94LM?$z~~8J|*-PbCFww&S7lwESt~g znS48ASi>wA4u@IjV|_j^iSXJJI+h%-Znu^g1Z2yWYGT#Ufy*dmjBy;HNu~QOXl9vK zw~J#U17jV@WH|=9EtLXA@&BQkR*trD3LVt@PhvYgVInq#Y-8M#$>OrDZYqbEFhOiEz;Hm6WL0-P1%xQ_3Ejq$E~A7Hp$P}0stO;3T(l$93){J9 z568uQ9l@|K4tqkuKu0tlhM^KxFywI!>9~Yd4zOHBtSbi1B$)+dsW*|*YZ)3SG|j6O zYl+7z@)fa4#aiOM6|pQShILo_*Q!e{q94~R3zuBV(nmVcyG4Y(wbD%93-vG|MAOdK z%+I~OuBzahkuT5cmbZ4KrW*g!lNh=Mb}8~pu^>)(#8eQ2ED<^2BiRNbfhmlq_HYKPUcY;v`G>E430e!L-edcJMr z=$)-sCm#Q5owKUGi<>*X&l}s_=WA!1?`rf5yS~%2SUunJ)I%NiP(PkLIAWc9_tt&9 MiTHr=%&!0bU-@d(Y;lls_|MmB(SpsF*N`m}? zf!zQ988+`Vm^N9~x$*tNxsCjp8aox3 zQ`W5b+vvhSBT)9IXLD-`$Dh2Tvu`d>7Y{Xa{L^}lbxy%jZ|`Xg%nVL)EcSVOlgxo8 OGkCiCxvXWmwa1--pMFfy5XC#vHhT(w##QM|U$E(ka~y>gZ9@jf9jUNGc&BAsvDsARvMu zB`6{wCJ%c5pLfswKc4ILb^NY3=W%|%pYKmyQw=X?s{~L2d;tJXPEOq1+_JN?8yXt6 zx3>od2EKp)9u^k1u&@C5zYgx?jGn5Av9h9ps)UFbi0bqX?l)T5*U{GB(E%Ie;_r;L zb+rw4_p)^maq)EW0^q)ZX=qPx3H|xnpGN`U6ZoL!gQq5#(I+P?KFFB{VxKM9T|1uF zF`Ig2sl;~PSEyUC5H5xyNtIhUdc#SuZk&1$p(H=c%*jL?9&Dti1&08#m<3SFF|n7R z$qm=`6)t8P{#dNn=m1H&5n(78P>&qeqlNmegV?Y-Ry ze%aE9mOwm7(E*;PsSEPLB^eE|9T3@1YUlp@ZeZV_>8A1q0G!YY=U!V6MI; zN7%D`I?|v4Q)D6=O}?Voa!y79<^-c8r$)dH^8e7Qwis%x(7pn+lZj{lQgJ>BFBj_W zi%lCV#Cyl6z!A-h@`xpb*`JQ4~n67#@S#=q`o$`aEI@pdn6 z^5xCg3}fK@J%a44ugY_$Gr5R^db~4_Ps;TyVLk+-Y$!Ox&DCvc<+@kj(3@$WeK-iR z|6P3IGl#-xfO-Hl9MtTDD})3uO_7F;X7V(f*pqv_QTN9Y1O2vMhbhBl62-t@!NXh1 zG}byh2ENHQ1C65i{jppnC(Xwn9DglNnx#prT3yI#K6_66ZQ+f$x;QKR*Y|TYH)4iA zBj0Rt4$mCvorK0D+Otd!U_xEaM;D7tnGu%3x*VI-Mzl&0vIzrp?VLQ*DNg?t7}y_R zaL5@S(qCYhoI*@_{s8mP8ggRSo@9mBf?E#ph{ z0ViuWwDI+&MZpYFpC_<31S$&C#-urKX%`>?eX{JhQ}1Kh%?4A5#SGyryS+GI77p=L z80CDt-}d5AQkeA2QZ8G@zS88rRF&Z^q&&}^ z*UT2ixAO#8H`N}kae13a_d7_ zzOwUq=e0gQcyzozkQ}CDedinh_g&RhCT>B_S~lH_QlE_$;dOIR8-4H|o9WdRnm%nQ zgx3C&#r7^U)&Gl|7@JekFb$aIy;p3-JHw8`J1dEvFjT5QR9c-8o=zx=x1os{n>&8N z(HpM^Z+79WxQnt=(j@tQ)Sb8bT!E(E^URP2@Dxam_+o6x2wfjdq^^-W&((-9NU%9D zF$|c_2Fo!QXN7`pi#WI-xC)HLJiU0bgovPAK&)K?i$@in7!82J%H^Jxb151Zqo1WX z@lX%8X+9ZBa!%NkaZlh5U&-|U%K)QtH# z%p8*n_dXB^n68^A3<7jip0*6&;B=LU%?U^Za-{z9lufy!gNpgn%XgiYrx=p5w#tZ}bAtJWmiLN|PmbD2OjivG7~v2bIp*P8@mgWp5wf zS9jW_krfeAapKuP)gS%b(q06=yk;Ra(Pc)c4o_@V&VK5IngX*~O{j&dWK3e8ljK~p z;N&xSAq)2_o!uFi8#)XS#3S+`kzp@xnbB3~}9vX%{OKq_Z4dLf2 zg6ypvU}ytcr>#||R{jkc|Np24o9#{di%h)vh3A=?r^t-D-RSHnG%(^LN%f<3Bk^D)ajY7K_LJ?V^Rz_NmX7F-3qx`<{-~yl1=^Hvmb;)#qAo(^m_g>(ws`Cs^3kC5 zkH%ITM;D!Tzb0(>uN)J1-pbxOLFf%uPN0B-l%)^I)K_zxkamDl>6CdzjXLy?s{;`mK)=3tub}PTIzsY41 zx6RSs=XKtM>M7wUIH=eBh()uN8 zH0x#A@ZlH39SdiI@OvM69}Cf-AU9!rok(4{|C1R(%DLij_TX>4aU!Y+t`vW|(r3_>s zhC^Nw8m5IhF4Uz=Ksxa+NAB&q6LB@ijZMBDonnAWYHWxfrD=jRXP9;b#8kxXVMB#(H6UCOJuCJ8{QD z*NAwTA&hPi3)Ngjn$gSlb^n|xyM?)VW+ut#SM6h6X7&xc)e9M1O1{$$hc!AVTvcZ( zrKQ9w>)o7-TOr65=G}Be|Iu_8;26bDuP+HVdgwIyMx*S?*%DO0 z&Ts-l;r|jq|ImWXcEUwbJrq*S&8jCx5t{LQl?U?d5~l$~NEL`N9OYGn(PjfP=U%_z zySD|F(d6XS<2l?HfL(YZNl;^=nfBa0w%a>;h!7!n^+Pu}MCEO?%yrB>fIw?MFw7MZ z$P9)AJAkqw`m6!jf@Z0v_Te(P1Yf}bqg1{mIlYITQTPCmlLt7pIVJvi{(t#Tv3TqE2V1pTD&6?;{VKSH6mm{PT9y%;dZ}#R_ZTP==yN7{M z>mLw59T&n$APxA{ZU-Q@Cez#}EL3Y7tl_=pVXGV`irih`9RR3$F`Qg-&WuRXdziZR zvGmWRJCXwvY>(1ZT#ZQn(Y{qEle`Y5l8u07Z8qJTEYnyC!Jv$;v#4Ku-GB`3%D#|b zc+xf+EV+r~R@39Dg=F4~NK~g0)1B|(zUIv}lP|S@l;2tHJ4tXHG*X#OKkS-``O0-~ zIzBS_VjI5`;w?NX&KY8`0jOq#ZUQ^bhLGmQg~&T2KMuqRAVp2;-$AVY1?hJgTgTne z4clix)uzjm7vs1auDJf_+)4ET!s*pH`8!fyg_wcLQ3Te-RX(0}ADwyzNA=P4DaPCG%&?JlU zV&uvO4@ zv_7@Fyhh;1!NQFgl(;hiXB+`jn4fvAwr5zZmW8_ksLr|DelQ1Jb9O^LPoU{dD9i<+ zDeBBYjt2x7IuYgU)2;+000J=QVnMRKH$FBlu;l&~aIpxqx$cpWU;9mW>!(l9 zg`GH_dfUXjJ{GG%Y(_D(`(`T+R*52WmyL?>178~#BrQD#t;n2P;GSOR+Ir5}f_}5k zGFSQ0cjoKr(QlwtE>9{umEZ&Tf#95-db`L2HPmZfxLRxCyHN~AJhGJ9f9qt}r&U#a z`FskW@o6>ktw_reGtb78Ki_4#P2)ITGGyEpart7@X*HVW)-1ILxSoeg-g^<8ncHJR zdRg38^v;U2#|kE20=z zSo`jHB1)lbaVNc}t3yzoajK-c^NH*Zm5MJ$`w|Cpf-ui z@&>|~h|rILS)m+=Vcro!DzL;`O2JY%4_Ti)7KcVa9{Yt&i-N%%8 zP)A!!ZF|-uichDPO+TATllRa-y|GSOSGST)2%GWrD?x{jIL_RZ@mH}OW!OgjwQh^v zhS5b1|Pc-(@IBc$XWcmG=bTyQh|leSB#f&4199XpXc z1$&|ll%Lagh@k=+RiAI&NgD~}GL$i4?=L?caQ#9vvtDr0=88B7gSHKMy49_(eIJ1# zMzyHKvd6dO(kP>1b^fts)d5yBcd|`8_6LY`k(m$nG=1X!5sYx)~tk^=Dx>q+Z`F)T>` z?NGQqVMVooJ~7^sai6La+u9`%{(Waf7+618bABEg*;8pzte4l_oH+O_o@G6;P-#Up z-Cm_Jh@0_OBLQdfpBG;Kw-SxS{ZUH<+|-by@^|ZE9#h!3y;S0CtSZl5$>Isa zrV2zG(!XwUrf}wZrypqQJmO|KvujcXaEaxi`Z&zv@fBzca#~*3@4Q_18trZLYw_Bc zrvVgfg9sCa#o)AC%jn9w@LfKI3Tp#M034-BuC8tp(0keJT^9#7KZQoLKt-B54*=c(X;_5 zgp^iTu$NVlJtP9|fk|Ng(O`*74ELxRC`1_*#^$v+EZ^)oTSoV%FctDb0BU$2xp!!} zkU0e?AJa}F4_BcmGYD};k#f_z;Qd`C?0YkKG9xT_^n>VoZ$Htifr~!8Z`is?6fwuV ztLwCpPc|_ha=y^tE#`+Wo8>64&N)-PH8;2ACDJ&4%jU>OKupYF!I7GmyMZl%Xs;l9k0uqSvtOld%s$ucaWrE?+0y=oMSsd4JXDs19KtM z9LrGl5K+p&q&tvQZ|&9UGCg+-tZ?p}lZOSTgeasQGA)vXHR4XoHn23$PZKm!ae!6`8@XCNs8p|y21H7E zRAn}cSS1rWC1qH}UdX3rgL_h?PAy6Zi!9WZQqSFFj z_{S_gXElr*APHxTS%WpwOEe|~pK7aGO_RTtsuTtlexq z7qgl;BE1yhfoFlfuCGCJ@)#RlQR*c9cfM}(P%3-c$NVq~Uh%l>eS^&o^n%D}A+x%ZLyK?zLwj4K~+80%>3~FZL+E3FSxH&%Yv&RDjqZ zGGt;hddXw*EIUvf7Aq|_N>D- z#8ZPRY@XsOxH3=)IgmbGKFAOXmXnw{ZVsEQW`Vo{w$3Sn7bxezBOUM9)-qPu=0A-` ze>fC;e&j@X`|?}U#N>J81W`Em;w|51RrBEM%d*iNtf3MEo?VI*%Qf4@!9Sn~oxoTv z!0D0CGq}#s^2y=m$v{zS8T-GWylb{x8;l3FIiA<9loG$ar0>o_i*K`s z!Zxz+nO;imb#+U)?=MeHns)A5i2z!RX)s-y0Yz5L!n0WxUPQL2Ub^(VnbN($%m0lp zcBMd@u!P@?ekxIN#^N%_f2to&FxwY+oE;^l)<=&lY)kNfm+a(5PUaE5m)wqg9Xt6_ zjc))F!4Qb7mY&GED~|=)(rxB;?d%FlW)1T|YFG=xrPs<+`0Jq90-z(CMoJv3?8K4t z!t54G^}vVjMw5}g=WBBz;a_)WE!8CikgDrWSF$n!u~~}G_}jxXeY2)7y<@z1CZIN zgV^|-W0NxQAY$l^B;mkND9l0@s^Ngli%^a&$qE$&S2{x>bw$voyK%}D#5)w7hwg^J z$CT2${pA{IT{HOanHNA?>w$L_&q4DR*DT5;K$_+hWyJ z7md6BX+rq(J-IMHU?dRlr+_4v^U@K;yl7tqH&&iDp^QeRYZ=728=%l@H2IRn(G+5} zfrW-xre2|Bu+du1w4R>0MGD#^!P)wWXX#QAMWE!~(;JNME8_<{m6Kl}ClE z2S_TfSUy*ovw{jKl}FaI^TN?Wy~azo5#v z;%J?nO2&v^e_T%FLMJRW%x+OEG(JebtL!Z{5?4vvwlZNhK?15owF`2YX_ literal 0 HcmV?d00001 diff --git a/static/epub.js/img/menu-icon.png b/static/epub.js/img/menu-icon.png new file mode 100644 index 0000000000000000000000000000000000000000..5f40e0e9c728d71076246e8d22e58cda45033b49 GIT binary patch literal 947 zcmaJ=KX21O6gNbTP^GF8OfaC63tQv6a}vk4VoGW!G!l-gG!hwmu`i9)+Gp%b<8+}Q zF|feShu{k^Fe8-_3Go3~;UjQP>Xf0ygYVtb`~BYU{keDhy=NQi57s3~+UV{%eQ|E) z_MNi$pFXU$#Brauhx~wz`HUn~YWZwLK{q5vv`>jYfBBU*C8_i%7!3K)eQtUzR7f79 zWMM4OlGNPEV&WZB4o37Sh%EW{=Pxn{d`o^&caa<0bQ0{HCG_B|H}KAmJ;RrGo`7a% z3WAVw00~$-3K;HD5xu_;vo$Kt)}1_GHS*)P!UED zs}MCR7@75ki7>eQWRWfL$7bK@T;>utOP+8Zn-I=sGi6p)SaJlhVHgmpP*p1;qLR)d zPO?grZWRm;O}!+DdB7r&Gm;UTa!VFUmnDSpiZ)6w+awwWGZI6rpuD6a&~^VG8iuRr zl=tbC-fM}|!91q0Pg6EcJTbWOR-P(0?SvA}k^y5UMHlxcjI(sYVqhQC6%1VB1ySx< zAY9k%MkyzeN4t(C3l1d+eABTtRa5mw727t(ZB^F{wT*TgT3v6o4b&*G4)dlVjd+3e zudw=!*nAnnSY&o+5}Z=MlduphiZ+95v}g#o^hQUk;@0leEQc-mj#PnPRIHZt82`Ti~3Uk?B!Ylp0*+7m{3+ootz+WN)WnQ(*-(AUCxn zQK2F?C$HG5!d3}vt`(3C64qBz04piUwpD^SD#ABF!8yMuRl!uxSU1_g&``n5OwZ87 z)XdCKN5ROz&`93^h|F{iO{`4Ktc=VRpg;*|TTx1yRgjAt)Gi>;Rw<*Tq`*pFzr4I$ zuiRKKzbIYb(9+TpWQLKEE>MMTab;dfVufyAu`f(~1RD^r68eAMwS&*t9 zlvO-#>2=9ZF3nBND}m`vLFjeHsTY(OatnYqyQCInmZhe+73JqDfIV%MiQ6rfIL(9V zO~LIJN1S@~fsWA!MJ-ZP!-Rn82gHOYTp$OY^i%VI>AeV;uzf;w*%=rZ-923#Ln>}9 zndqqD;wW)EeVU90pG%_tA{D(SAN*pr-P!S`v5bF;OpKX(wL@WX(L=Y4om%YCvtO@1 zYgO>{!3JF~K~2{`%l^IEy7#SS{NH=#?`Qw7PunM%?R4n-U)M`QUk>QzRL$ESymm9A zv+PQ4v4qH{Rl0L2AYB%8lXVk(5 z!-Fx*kA-*+N#Ai^za?{fahScNheyGxTT6Pv1=0`NeVX%Z)7P3`51F@>u;1NpyK=3t z#gcDpX1%Vy{qxR7d5JBDIhwqM1z)sZJ+;_){p%O{1#6P8ck#_=6T7it*Ob^9hV}h2 zXV~snc9?LT)#^Pc^5mh<)^LqW_ew+ZC4aPCjhZ#%r~8cwvbR0l4H)J=he?5olYS)$c z7WfE)D2dm|3A|48zT!gsuX^0M9xwAztR5v{Bg&`_AR;UsA*JN!~YX*pH08NG^Q6H~dr$|GWs4YQ-RqQB88#V0? zNVeCewDx8#q*H5Fli{q01x$ccGHbS2u9%gmQC$)5Ju^d*qY%_AQNM$#SL(^&`m>|j3xzgnWAcj}Ij;VP8_3J`hQYM4XBjxgE}&OC&?HBb7LEL| zuzB^yxO)Cra4LE7U~n*u*V?~YoipM2@wVfGix1ai-{VBPfC_VRDhf#KJM1)F-OFS&4uc-e8vo;IhaW`D}~F~_=bu(LZ|8u@r&%DG1c zyj>iA_h7@+S@%Y+p5Ypat=+!i?&6k_3v(~+nN`{0@7h*;UAeXX`>>xu1Oa|7eYJ$StQ@awJ<6~mW@_8xh4v3CrJ(wQpSvcWZ$&g_$>WkcY k{P}dv=BLZvZ~ro52l2L3`U;Q7`@Q=gkJZXOYjTBRz;GCL~=}}db8eHWUl3bOYY?-2DZ>L~WVFffGH?<^D zp&~aYuh^=>Rtapb6_5=Q)>l#hD=EpgRf0Gw!Z$#{Ilm}X!Bo#!H`&0@P{GVh&(Orw z%*;?n!N|bSNZ$a6%ybP+tW3?UjLa3FKnZADQA(Oskc%7CE+EfVDWjyMz)D}gyu4hm z+*mKaC|%#s($W%ShLMpjP=#)BWnM{Qg>GK4GRy>*)Z*l#%z~24{5%DaiHS-1r6smX zK$k+ikXryZHm?{OOuzusuShJ=H`Fr#c?qV_*B8Ii++4Wo;*y|LgnO|XTpUtakg6Y) zTAW{6lnjixG-Z%g1y;^Qsfi`|MIrh5Ij~R+$jC3rFV4s>P;d@5Q_%2DOwP;$321_K z`1)FT<`tJD<|U_ky4WfK&CtutOtEscG&izvb+a@vHZU_ZbTzVcG_kZWvNSeyGd6Ox zFgAqgb;(aI%}vcKf$2>_=yk-Y7nB%s3xGDeq!wkCrKY$Q<>xAZJ#CeV+b!le&4cPq z!R;0coO<#DphYAP1iGQ}cl7y$G1Fvp89L85o%OJY5_^DsGts zd3#GIitPQInqx77zwA?;4*Ci@iikVaJH&D* znM{bkaQ4BWsoaWA9!`qA?(@Wd8^ZwrF^NOE&tqkdU_SrJkNOG3n@+GgW zI2BL4{;Hb>+=Bbu4B2g7?^$@4m}D{q)wHtx@GW zD=lR9iF6;8x6l{7sLelN(n%G@UZsgAj4vclKG~ACS+X!eNcr`QFDj=$%{rTA%@E%r=^u`2-hjAuSe^+aqvQt*h`}A|qt*otP z2OL~K^X_%uefM9~$`Fr)JCZJWg+i=5qt=!kS)ew#^X1F0Rew2l6^V7XTFvcKp6fUH z#rNO)rF-4xPPVX5+Z@@%#w@ukU}1p5jIRfT{?z@S@1XF(o8j-Cn>l%#u0Hr@D8aMI z?l2GAqx>i4Kj!UUcv?AWqr}Qpzc|mbtkRP4NjRY-%~U1tV9R)&X~+75zp`h14!&e^ zmgR|@l+GW13y1uMWip=c-mj#PnPRIHZt82`Ti~3Uk?B!Ylp0*+7m{3+ootz+WN)WnQ(*-(AUCxn zQK2F?C$HG5!d3}vt`(3C64qBz04piUwpD^SD#ABF!8yMuRl!uxSU1_g&``n5OwZ87 z)XdCKN5ROz&`93^h|F{iO{`4Ktc=VRpg;*|TTx1yRgjAt)Gi>;Rw<*Tq`*pFzr4I$ zuiRKKzbIYb(9+TpWQLKEE>MMTab;dfVufyAu`f(~1RD^r68eAMwS&*t9 zlvO-#2=9ZF3nBND}m`vLFjeGsTY(OatnYqyQCInmZhe+73JqDfIV%MiQ6qsIL(9V zO~LIJXPkQVfsWA!MJ-ZP!-Rn82gHOYTp$OY^i%VI>AeV;u;+D&ZDn9!D)w}745_$f z5^UKWoG7xlvNH0dTba?B_*ngiFqA3bjZnZnV_}w#fC10=2i}_rrv+O znRDC@9#nAh@i~(ww0Yl~?&mgY@--*7-zk1)`MvJ^g!9jjrWkqdjG1;YL7{8WiL}jv zp`l0LmdW4BF>_vhwd(Tguitvy7XSEL=ehjyrl_?p5BZzVrhQhOfByT`*I(<7{fbc$ zs$}`#x%%p^=FRPF&5qAL?|cxi$oV~MW5krY{rV3Je&{jGJes6_`s>++7BbtL4nD}e(Z#%{-(oWt zTei|fk2a@;u~7?Td@uj&J^ol+;a}h8$9~I;#XlvVSflOujk7>nRPx>;j>t{&mFs)m z78@tz?~2iz>9<_xQT7qphMe|SufG2J>9>4y*nt^$y;8y&tlHls7bG+vs~W>udDFfC(p47QHW2-x}q6>+QGmYu8rT{Nwr@aPVQT z*V3Xy=d%(Y>ZC%i8yn476|{27gEuViGyBVDc&bi5>7gU`n{}mj91Bz9a*co~wyHl? zl;&MY^?$FsMqyj?t|uWnJ_-L1t@|LP%aJ_)cylFNy?wwIm2cl2MbeG|jXIoN&7_(v z%6d!Th5o7fo|`M=Y)cdE?tPn+9wXfIzxK`Xkd+lS^HdL9Kk$vSb!UfIjO#SZW=oCP zpE#c!@ZQZd`&XQ+^of}Erq?_vr5~65R^Z+6=!ZsL(+l&gk3x3;4@B|xd#Q(>-1fKY z#Z2Lr^M%unMmcY^V^9ewna0m{q>9JzKdS_TNO9R?Pv<~OP@(MU>gTe~DWM4fDUV2p literal 0 HcmV?d00001 diff --git a/static/epub.js/img/star.png b/static/epub.js/img/star.png new file mode 100644 index 0000000000000000000000000000000000000000..451089359b60136873f0abb4fd5545c27abd7c94 GIT binary patch literal 278 zcmeAS@N?(olHy`uVBq!ia0vp^0zk~q!3HGX7W?Z1DajJoh?3y^w370~qErUQl>DSr z1<%~X^wgl##FWaylc_d9MLRrQ978H@B_${@^vT=nHTci#Y)E5OD4mzX+^|5dL$rZS zbwUoqm2WI6%^qcpo7Cp4OK{nAkzopr066kqbN~PV literal 0 HcmV?d00001 diff --git a/static/epub.js/index.html b/static/epub.js/index.html new file mode 100755 index 00000000..8b137891 --- /dev/null +++ b/static/epub.js/index.html @@ -0,0 +1 @@ + diff --git a/static/epub.js/js/epub.js b/static/epub.js/js/epub.js new file mode 100644 index 00000000..646e3395 --- /dev/null +++ b/static/epub.js/js/epub.js @@ -0,0 +1,23139 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(require("xmldom"), (function webpackLoadOptionalExternalModule() { try { return require("jszip"); } catch(e) {} }())); + else if(typeof define === 'function' && define.amd) + define(["xmldom", "jszip"], factory); + else if(typeof exports === 'object') + exports["ePub"] = factory(require("xmldom"), (function webpackLoadOptionalExternalModule() { try { return require("jszip"); } catch(e) {} }())); + else + root["ePub"] = factory(root["xmldom"], root["jszip"]); +})(typeof self !== 'undefined' ? self : this, function(__WEBPACK_EXTERNAL_MODULE_42__, __WEBPACK_EXTERNAL_MODULE_72__) { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) { +/******/ return installedModules[moduleId].exports; +/******/ } +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ i: moduleId, +/******/ l: false, +/******/ exports: {} +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.l = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // define getter function for harmony exports +/******/ __webpack_require__.d = function(exports, name, getter) { +/******/ if(!__webpack_require__.o(exports, name)) { +/******/ Object.defineProperty(exports, name, { +/******/ configurable: false, +/******/ enumerable: true, +/******/ get: getter +/******/ }); +/******/ } +/******/ }; +/******/ +/******/ // getDefaultExport function for compatibility with non-harmony modules +/******/ __webpack_require__.n = function(module) { +/******/ var getter = module && module.__esModule ? +/******/ function getDefault() { return module['default']; } : +/******/ function getModuleExports() { return module; }; +/******/ __webpack_require__.d(getter, 'a', getter); +/******/ return getter; +/******/ }; +/******/ +/******/ // Object.prototype.hasOwnProperty.call +/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = "/dist/"; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(__webpack_require__.s = 25); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +exports.uuid = uuid; +exports.documentHeight = documentHeight; +exports.isElement = isElement; +exports.isNumber = isNumber; +exports.isFloat = isFloat; +exports.prefixed = prefixed; +exports.defaults = defaults; +exports.extend = extend; +exports.insert = insert; +exports.locationOf = locationOf; +exports.indexOfSorted = indexOfSorted; +exports.bounds = bounds; +exports.borders = borders; +exports.nodeBounds = nodeBounds; +exports.windowBounds = windowBounds; +exports.indexOfNode = indexOfNode; +exports.indexOfTextNode = indexOfTextNode; +exports.indexOfElementNode = indexOfElementNode; +exports.isXml = isXml; +exports.createBlob = createBlob; +exports.createBlobUrl = createBlobUrl; +exports.revokeBlobUrl = revokeBlobUrl; +exports.createBase64Url = createBase64Url; +exports.type = type; +exports.parse = parse; +exports.qs = qs; +exports.qsa = qsa; +exports.qsp = qsp; +exports.sprint = sprint; +exports.treeWalker = treeWalker; +exports.walk = walk; +exports.blob2base64 = blob2base64; +exports.defer = defer; +exports.querySelectorByType = querySelectorByType; +exports.findChildren = findChildren; +exports.parents = parents; +exports.filterChildren = filterChildren; +exports.getParentByTagName = getParentByTagName; + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Core Utilities and Helpers + * @module Core +*/ + +/** + * Vendor prefixed requestAnimationFrame + * @returns {function} requestAnimationFrame + * @memberof Core + */ +var requestAnimationFrame = exports.requestAnimationFrame = typeof window != "undefined" ? window.requestAnimationFrame || window.mozRequestAnimationFrame || window.webkitRequestAnimationFrame || window.msRequestAnimationFrame : false; +var ELEMENT_NODE = 1; +var TEXT_NODE = 3; +var COMMENT_NODE = 8; +var DOCUMENT_NODE = 9; +var _URL = typeof URL != "undefined" ? URL : typeof window != "undefined" ? window.URL || window.webkitURL || window.mozURL : undefined; + +/** + * Generates a UUID + * based on: http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript + * @returns {string} uuid + * @memberof Core + */ +function uuid() { + var d = new Date().getTime(); + var uuid = "xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx".replace(/[xy]/g, function (c) { + var r = (d + Math.random() * 16) % 16 | 0; + d = Math.floor(d / 16); + return (c == "x" ? r : r & 0x7 | 0x8).toString(16); + }); + return uuid; +} + +/** + * Gets the height of a document + * @returns {number} height + * @memberof Core + */ +function documentHeight() { + return Math.max(document.documentElement.clientHeight, document.body.scrollHeight, document.documentElement.scrollHeight, document.body.offsetHeight, document.documentElement.offsetHeight); +} + +/** + * Checks if a node is an element + * @param {object} obj + * @returns {boolean} + * @memberof Core + */ +function isElement(obj) { + return !!(obj && obj.nodeType == 1); +} + +/** + * @param {any} n + * @returns {boolean} + * @memberof Core + */ +function isNumber(n) { + return !isNaN(parseFloat(n)) && isFinite(n); +} + +/** + * @param {any} n + * @returns {boolean} + * @memberof Core + */ +function isFloat(n) { + var f = parseFloat(n); + + if (isNumber(n) === false) { + return false; + } + + if (typeof n === "string" && n.indexOf(".") > -1) { + return true; + } + + return Math.floor(f) !== f; +} + +/** + * Get a prefixed css property + * @param {string} unprefixed + * @returns {string} + * @memberof Core + */ +function prefixed(unprefixed) { + var vendors = ["Webkit", "webkit", "Moz", "O", "ms"]; + var prefixes = ["-webkit-", "-webkit-", "-moz-", "-o-", "-ms-"]; + var upper = unprefixed[0].toUpperCase() + unprefixed.slice(1); + var length = vendors.length; + + if (typeof document === "undefined" || typeof document.body.style[unprefixed] != "undefined") { + return unprefixed; + } + + for (var i = 0; i < length; i++) { + if (typeof document.body.style[vendors[i] + upper] != "undefined") { + return prefixes[i] + unprefixed; + } + } + + return unprefixed; +} + +/** + * Apply defaults to an object + * @param {object} obj + * @returns {object} + * @memberof Core + */ +function defaults(obj) { + for (var i = 1, length = arguments.length; i < length; i++) { + var source = arguments[i]; + for (var prop in source) { + if (obj[prop] === void 0) obj[prop] = source[prop]; + } + } + return obj; +} + +/** + * Extend properties of an object + * @param {object} target + * @returns {object} + * @memberof Core + */ +function extend(target) { + var sources = [].slice.call(arguments, 1); + sources.forEach(function (source) { + if (!source) return; + Object.getOwnPropertyNames(source).forEach(function (propName) { + Object.defineProperty(target, propName, Object.getOwnPropertyDescriptor(source, propName)); + }); + }); + return target; +} + +/** + * Fast quicksort insert for sorted array -- based on: + * http://stackoverflow.com/questions/1344500/efficient-way-to-insert-a-number-into-a-sorted-array-of-numbers + * @param {any} item + * @param {array} array + * @param {function} [compareFunction] + * @returns {number} location (in array) + * @memberof Core + */ +function insert(item, array, compareFunction) { + var location = locationOf(item, array, compareFunction); + array.splice(location, 0, item); + + return location; +} + +/** + * Finds where something would fit into a sorted array + * @param {any} item + * @param {array} array + * @param {function} [compareFunction] + * @param {function} [_start] + * @param {function} [_end] + * @returns {number} location (in array) + * @memberof Core + */ +function locationOf(item, array, compareFunction, _start, _end) { + var start = _start || 0; + var end = _end || array.length; + var pivot = parseInt(start + (end - start) / 2); + var compared; + if (!compareFunction) { + compareFunction = function compareFunction(a, b) { + if (a > b) return 1; + if (a < b) return -1; + if (a == b) return 0; + }; + } + if (end - start <= 0) { + return pivot; + } + + compared = compareFunction(array[pivot], item); + if (end - start === 1) { + return compared >= 0 ? pivot : pivot + 1; + } + if (compared === 0) { + return pivot; + } + if (compared === -1) { + return locationOf(item, array, compareFunction, pivot, end); + } else { + return locationOf(item, array, compareFunction, start, pivot); + } +} + +/** + * Finds index of something in a sorted array + * Returns -1 if not found + * @param {any} item + * @param {array} array + * @param {function} [compareFunction] + * @param {function} [_start] + * @param {function} [_end] + * @returns {number} index (in array) or -1 + * @memberof Core + */ +function indexOfSorted(item, array, compareFunction, _start, _end) { + var start = _start || 0; + var end = _end || array.length; + var pivot = parseInt(start + (end - start) / 2); + var compared; + if (!compareFunction) { + compareFunction = function compareFunction(a, b) { + if (a > b) return 1; + if (a < b) return -1; + if (a == b) return 0; + }; + } + if (end - start <= 0) { + return -1; // Not found + } + + compared = compareFunction(array[pivot], item); + if (end - start === 1) { + return compared === 0 ? pivot : -1; + } + if (compared === 0) { + return pivot; // Found + } + if (compared === -1) { + return indexOfSorted(item, array, compareFunction, pivot, end); + } else { + return indexOfSorted(item, array, compareFunction, start, pivot); + } +} +/** + * Find the bounds of an element + * taking padding and margin into account + * @param {element} el + * @returns {{ width: Number, height: Number}} + * @memberof Core + */ +function bounds(el) { + + var style = window.getComputedStyle(el); + var widthProps = ["width", "paddingRight", "paddingLeft", "marginRight", "marginLeft", "borderRightWidth", "borderLeftWidth"]; + var heightProps = ["height", "paddingTop", "paddingBottom", "marginTop", "marginBottom", "borderTopWidth", "borderBottomWidth"]; + + var width = 0; + var height = 0; + + widthProps.forEach(function (prop) { + width += parseFloat(style[prop]) || 0; + }); + + heightProps.forEach(function (prop) { + height += parseFloat(style[prop]) || 0; + }); + + return { + height: height, + width: width + }; +} + +/** + * Find the bounds of an element + * taking padding, margin and borders into account + * @param {element} el + * @returns {{ width: Number, height: Number}} + * @memberof Core + */ +function borders(el) { + + var style = window.getComputedStyle(el); + var widthProps = ["paddingRight", "paddingLeft", "marginRight", "marginLeft", "borderRightWidth", "borderLeftWidth"]; + var heightProps = ["paddingTop", "paddingBottom", "marginTop", "marginBottom", "borderTopWidth", "borderBottomWidth"]; + + var width = 0; + var height = 0; + + widthProps.forEach(function (prop) { + width += parseFloat(style[prop]) || 0; + }); + + heightProps.forEach(function (prop) { + height += parseFloat(style[prop]) || 0; + }); + + return { + height: height, + width: width + }; +} + +/** + * Find the bounds of any node + * allows for getting bounds of text nodes by wrapping them in a range + * @param {node} node + * @returns {BoundingClientRect} + * @memberof Core + */ +function nodeBounds(node) { + var elPos = void 0; + var doc = node.ownerDocument; + if (node.nodeType == Node.TEXT_NODE) { + var elRange = doc.createRange(); + elRange.selectNodeContents(node); + elPos = elRange.getBoundingClientRect(); + } else { + elPos = node.getBoundingClientRect(); + } + return elPos; +} + +/** + * Find the equivelent of getBoundingClientRect of a browser window + * @returns {{ width: Number, height: Number, top: Number, left: Number, right: Number, bottom: Number }} + * @memberof Core + */ +function windowBounds() { + + var width = window.innerWidth; + var height = window.innerHeight; + + return { + top: 0, + left: 0, + right: width, + bottom: height, + width: width, + height: height + }; +} + +/** + * Gets the index of a node in its parent + * @param {Node} node + * @param {string} typeId + * @return {number} index + * @memberof Core + */ +function indexOfNode(node, typeId) { + var parent = node.parentNode; + var children = parent.childNodes; + var sib; + var index = -1; + for (var i = 0; i < children.length; i++) { + sib = children[i]; + if (sib.nodeType === typeId) { + index++; + } + if (sib == node) break; + } + + return index; +} + +/** + * Gets the index of a text node in its parent + * @param {node} textNode + * @returns {number} index + * @memberof Core + */ +function indexOfTextNode(textNode) { + return indexOfNode(textNode, TEXT_NODE); +} + +/** + * Gets the index of an element node in its parent + * @param {element} elementNode + * @returns {number} index + * @memberof Core + */ +function indexOfElementNode(elementNode) { + return indexOfNode(elementNode, ELEMENT_NODE); +} + +/** + * Check if extension is xml + * @param {string} ext + * @returns {boolean} + * @memberof Core + */ +function isXml(ext) { + return ["xml", "opf", "ncx"].indexOf(ext) > -1; +} + +/** + * Create a new blob + * @param {any} content + * @param {string} mime + * @returns {Blob} + * @memberof Core + */ +function createBlob(content, mime) { + return new Blob([content], { type: mime }); +} + +/** + * Create a new blob url + * @param {any} content + * @param {string} mime + * @returns {string} url + * @memberof Core + */ +function createBlobUrl(content, mime) { + var tempUrl; + var blob = createBlob(content, mime); + + tempUrl = _URL.createObjectURL(blob); + + return tempUrl; +} + +/** + * Remove a blob url + * @param {string} url + * @memberof Core + */ +function revokeBlobUrl(url) { + return _URL.revokeObjectURL(url); +} + +/** + * Create a new base64 encoded url + * @param {any} content + * @param {string} mime + * @returns {string} url + * @memberof Core + */ +function createBase64Url(content, mime) { + var data; + var datauri; + + if (typeof content !== "string") { + // Only handles strings + return; + } + + data = btoa(encodeURIComponent(content)); + + datauri = "data:" + mime + ";base64," + data; + + return datauri; +} + +/** + * Get type of an object + * @param {object} obj + * @returns {string} type + * @memberof Core + */ +function type(obj) { + return Object.prototype.toString.call(obj).slice(8, -1); +} + +/** + * Parse xml (or html) markup + * @param {string} markup + * @param {string} mime + * @param {boolean} forceXMLDom force using xmlDom to parse instead of native parser + * @returns {document} document + * @memberof Core + */ +function parse(markup, mime, forceXMLDom) { + var doc; + var Parser; + + if (typeof DOMParser === "undefined" || forceXMLDom) { + Parser = __webpack_require__(42).DOMParser; + } else { + Parser = DOMParser; + } + + // Remove byte order mark before parsing + // https://www.w3.org/International/questions/qa-byte-order-mark + if (markup.charCodeAt(0) === 0xFEFF) { + markup = markup.slice(1); + } + + doc = new Parser().parseFromString(markup, mime); + + return doc; +} + +/** + * querySelector polyfill + * @param {element} el + * @param {string} sel selector string + * @returns {element} element + * @memberof Core + */ +function qs(el, sel) { + var elements; + if (!el) { + throw new Error("No Element Provided"); + } + + if (typeof el.querySelector != "undefined") { + return el.querySelector(sel); + } else { + elements = el.getElementsByTagName(sel); + if (elements.length) { + return elements[0]; + } + } +} + +/** + * querySelectorAll polyfill + * @param {element} el + * @param {string} sel selector string + * @returns {element[]} elements + * @memberof Core + */ +function qsa(el, sel) { + + if (typeof el.querySelector != "undefined") { + return el.querySelectorAll(sel); + } else { + return el.getElementsByTagName(sel); + } +} + +/** + * querySelector by property + * @param {element} el + * @param {string} sel selector string + * @param {object[]} props + * @returns {element[]} elements + * @memberof Core + */ +function qsp(el, sel, props) { + var q, filtered; + if (typeof el.querySelector != "undefined") { + sel += "["; + for (var prop in props) { + sel += prop + "~='" + props[prop] + "'"; + } + sel += "]"; + return el.querySelector(sel); + } else { + q = el.getElementsByTagName(sel); + filtered = Array.prototype.slice.call(q, 0).filter(function (el) { + for (var prop in props) { + if (el.getAttribute(prop) === props[prop]) { + return true; + } + } + return false; + }); + + if (filtered) { + return filtered[0]; + } + } +} + +/** + * Sprint through all text nodes in a document + * @memberof Core + * @param {element} root element to start with + * @param {function} func function to run on each element + */ +function sprint(root, func) { + var doc = root.ownerDocument || root; + if (typeof doc.createTreeWalker !== "undefined") { + treeWalker(root, func, NodeFilter.SHOW_TEXT); + } else { + walk(root, function (node) { + if (node && node.nodeType === 3) { + // Node.TEXT_NODE + func(node); + } + }, true); + } +} + +/** + * Create a treeWalker + * @memberof Core + * @param {element} root element to start with + * @param {function} func function to run on each element + * @param {function | object} filter funtion or object to filter with + */ +function treeWalker(root, func, filter) { + var treeWalker = document.createTreeWalker(root, filter, null, false); + var node = void 0; + while (node = treeWalker.nextNode()) { + func(node); + } +} + +/** + * @memberof Core + * @param {node} node + * @param {callback} return false for continue,true for break inside callback + */ +function walk(node, callback) { + if (callback(node)) { + return true; + } + node = node.firstChild; + if (node) { + do { + var walked = walk(node, callback); + if (walked) { + return true; + } + node = node.nextSibling; + } while (node); + } +} + +/** + * Convert a blob to a base64 encoded string + * @param {Blog} blob + * @returns {string} + * @memberof Core + */ +function blob2base64(blob) { + return new Promise(function (resolve, reject) { + var reader = new FileReader(); + reader.readAsDataURL(blob); + reader.onloadend = function () { + resolve(reader.result); + }; + }); +} + +/** + * Creates a new pending promise and provides methods to resolve or reject it. + * From: https://developer.mozilla.org/en-US/docs/Mozilla/JavaScript_code_modules/Promise.jsm/Deferred#backwards_forwards_compatible + * @memberof Core + */ +function defer() { + var _this = this; + + /* A method to resolve the associated Promise with the value passed. + * If the promise is already settled it does nothing. + * + * @param {anything} value : This value is used to resolve the promise + * If the value is a Promise then the associated promise assumes the state + * of Promise passed as value. + */ + this.resolve = null; + + /* A method to reject the assocaited Promise with the value passed. + * If the promise is already settled it does nothing. + * + * @param {anything} reason: The reason for the rejection of the Promise. + * Generally its an Error object. If however a Promise is passed, then the Promise + * itself will be the reason for rejection no matter the state of the Promise. + */ + this.reject = null; + + this.id = uuid(); + + /* A newly created Pomise object. + * Initially in pending state. + */ + this.promise = new Promise(function (resolve, reject) { + _this.resolve = resolve; + _this.reject = reject; + }); + Object.freeze(this); +} + +/** + * querySelector with filter by epub type + * @param {element} html + * @param {string} element element type to find + * @param {string} type epub type to find + * @returns {element[]} elements + * @memberof Core + */ +function querySelectorByType(html, element, type) { + var query; + if (typeof html.querySelector != "undefined") { + query = html.querySelector(element + "[*|type=\"" + type + "\"]"); + } + // Handle IE not supporting namespaced epub:type in querySelector + if (!query || query.length === 0) { + query = qsa(html, element); + for (var i = 0; i < query.length; i++) { + if (query[i].getAttributeNS("http://www.idpf.org/2007/ops", "type") === type || query[i].getAttribute("epub:type") === type) { + return query[i]; + } + } + } else { + return query; + } +} + +/** + * Find direct decendents of an element + * @param {element} el + * @returns {element[]} children + * @memberof Core + */ +function findChildren(el) { + var result = []; + var childNodes = el.childNodes; + for (var i = 0; i < childNodes.length; i++) { + var node = childNodes[i]; + if (node.nodeType === 1) { + result.push(node); + } + } + return result; +} + +/** + * Find all parents (ancestors) of an element + * @param {element} node + * @returns {element[]} parents + * @memberof Core + */ +function parents(node) { + var nodes = [node]; + for (; node; node = node.parentNode) { + nodes.unshift(node); + } + return nodes; +} + +/** + * Find all direct decendents of a specific type + * @param {element} el + * @param {string} nodeName + * @param {boolean} [single] + * @returns {element[]} children + * @memberof Core + */ +function filterChildren(el, nodeName, single) { + var result = []; + var childNodes = el.childNodes; + for (var i = 0; i < childNodes.length; i++) { + var node = childNodes[i]; + if (node.nodeType === 1 && node.nodeName.toLowerCase() === nodeName) { + if (single) { + return node; + } else { + result.push(node); + } + } + } + if (!single) { + return result; + } +} + +/** + * Filter all parents (ancestors) with tag name + * @param {element} node + * @param {string} tagname + * @returns {element[]} parents + * @memberof Core + */ +function getParentByTagName(node, tagname) { + var parent = void 0; + if (node === null || tagname === '') return; + parent = node.parentNode; + while (parent.nodeType === 1) { + if (parent.tagName.toLowerCase() === tagname) { + return parent; + } + parent = parent.parentNode; + } +} + +/** + * Lightweight Polyfill for DOM Range + * @class + * @memberof Core + */ + +var RangeObject = exports.RangeObject = function () { + function RangeObject() { + _classCallCheck(this, RangeObject); + + this.collapsed = false; + this.commonAncestorContainer = undefined; + this.endContainer = undefined; + this.endOffset = undefined; + this.startContainer = undefined; + this.startOffset = undefined; + } + + _createClass(RangeObject, [{ + key: "setStart", + value: function setStart(startNode, startOffset) { + this.startContainer = startNode; + this.startOffset = startOffset; + + if (!this.endContainer) { + this.collapse(true); + } else { + this.commonAncestorContainer = this._commonAncestorContainer(); + } + + this._checkCollapsed(); + } + }, { + key: "setEnd", + value: function setEnd(endNode, endOffset) { + this.endContainer = endNode; + this.endOffset = endOffset; + + if (!this.startContainer) { + this.collapse(false); + } else { + this.collapsed = false; + this.commonAncestorContainer = this._commonAncestorContainer(); + } + + this._checkCollapsed(); + } + }, { + key: "collapse", + value: function collapse(toStart) { + this.collapsed = true; + if (toStart) { + this.endContainer = this.startContainer; + this.endOffset = this.startOffset; + this.commonAncestorContainer = this.startContainer.parentNode; + } else { + this.startContainer = this.endContainer; + this.startOffset = this.endOffset; + this.commonAncestorContainer = this.endOffset.parentNode; + } + } + }, { + key: "selectNode", + value: function selectNode(referenceNode) { + var parent = referenceNode.parentNode; + var index = Array.prototype.indexOf.call(parent.childNodes, referenceNode); + this.setStart(parent, index); + this.setEnd(parent, index + 1); + } + }, { + key: "selectNodeContents", + value: function selectNodeContents(referenceNode) { + var end = referenceNode.childNodes[referenceNode.childNodes - 1]; + var endIndex = referenceNode.nodeType === 3 ? referenceNode.textContent.length : parent.childNodes.length; + this.setStart(referenceNode, 0); + this.setEnd(referenceNode, endIndex); + } + }, { + key: "_commonAncestorContainer", + value: function _commonAncestorContainer(startContainer, endContainer) { + var startParents = parents(startContainer || this.startContainer); + var endParents = parents(endContainer || this.endContainer); + + if (startParents[0] != endParents[0]) return undefined; + + for (var i = 0; i < startParents.length; i++) { + if (startParents[i] != endParents[i]) { + return startParents[i - 1]; + } + } + } + }, { + key: "_checkCollapsed", + value: function _checkCollapsed() { + if (this.startContainer === this.endContainer && this.startOffset === this.endOffset) { + this.collapsed = true; + } else { + this.collapsed = false; + } + } + }, { + key: "toString", + value: function toString() { + // TODO: implement walking between start and end to find text + } + }]); + + return RangeObject; +}(); + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _core = __webpack_require__(0); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +var ELEMENT_NODE = 1; +var TEXT_NODE = 3; +var COMMENT_NODE = 8; +var DOCUMENT_NODE = 9; + +/** + * Parsing and creation of EpubCFIs: http://www.idpf.org/epub/linking/cfi/epub-cfi.html + + * Implements: + * - Character Offset: epubcfi(/6/4[chap01ref]!/4[body01]/10[para05]/2/1:3) + * - Simple Ranges : epubcfi(/6/4[chap01ref]!/4[body01]/10[para05],/2/1:1,/3:4) + + * Does Not Implement: + * - Temporal Offset (~) + * - Spatial Offset (@) + * - Temporal-Spatial Offset (~ + @) + * - Text Location Assertion ([) + * @class + @param {string | Range | Node } [cfiFrom] + @param {string | object} [base] + @param {string} [ignoreClass] class to ignore when parsing DOM +*/ + +var EpubCFI = function () { + function EpubCFI(cfiFrom, base, ignoreClass) { + _classCallCheck(this, EpubCFI); + + var type; + + this.str = ""; + + this.base = {}; + this.spinePos = 0; // For compatibility + + this.range = false; // true || false; + + this.path = {}; + this.start = null; + this.end = null; + + // Allow instantiation without the "new" keyword + if (!(this instanceof EpubCFI)) { + return new EpubCFI(cfiFrom, base, ignoreClass); + } + + if (typeof base === "string") { + this.base = this.parseComponent(base); + } else if ((typeof base === "undefined" ? "undefined" : _typeof(base)) === "object" && base.steps) { + this.base = base; + } + + type = this.checkType(cfiFrom); + + if (type === "string") { + this.str = cfiFrom; + return (0, _core.extend)(this, this.parse(cfiFrom)); + } else if (type === "range") { + return (0, _core.extend)(this, this.fromRange(cfiFrom, this.base, ignoreClass)); + } else if (type === "node") { + return (0, _core.extend)(this, this.fromNode(cfiFrom, this.base, ignoreClass)); + } else if (type === "EpubCFI" && cfiFrom.path) { + return cfiFrom; + } else if (!cfiFrom) { + return this; + } else { + throw new TypeError("not a valid argument for EpubCFI"); + } + } + + /** + * Check the type of constructor input + * @private + */ + + + _createClass(EpubCFI, [{ + key: "checkType", + value: function checkType(cfi) { + + if (this.isCfiString(cfi)) { + return "string"; + // Is a range object + } else if (cfi && (typeof cfi === "undefined" ? "undefined" : _typeof(cfi)) === "object" && ((0, _core.type)(cfi) === "Range" || typeof cfi.startContainer != "undefined")) { + return "range"; + } else if (cfi && (typeof cfi === "undefined" ? "undefined" : _typeof(cfi)) === "object" && typeof cfi.nodeType != "undefined") { + // || typeof cfi === "function" + return "node"; + } else if (cfi && (typeof cfi === "undefined" ? "undefined" : _typeof(cfi)) === "object" && cfi instanceof EpubCFI) { + return "EpubCFI"; + } else { + return false; + } + } + + /** + * Parse a cfi string to a CFI object representation + * @param {string} cfiStr + * @returns {object} cfi + */ + + }, { + key: "parse", + value: function parse(cfiStr) { + var cfi = { + spinePos: -1, + range: false, + base: {}, + path: {}, + start: null, + end: null + }; + var baseComponent, pathComponent, range; + + if (typeof cfiStr !== "string") { + return { spinePos: -1 }; + } + + if (cfiStr.indexOf("epubcfi(") === 0 && cfiStr[cfiStr.length - 1] === ")") { + // Remove intial epubcfi( and ending ) + cfiStr = cfiStr.slice(8, cfiStr.length - 1); + } + + baseComponent = this.getChapterComponent(cfiStr); + + // Make sure this is a valid cfi or return + if (!baseComponent) { + return { spinePos: -1 }; + } + + cfi.base = this.parseComponent(baseComponent); + + pathComponent = this.getPathComponent(cfiStr); + cfi.path = this.parseComponent(pathComponent); + + range = this.getRange(cfiStr); + + if (range) { + cfi.range = true; + cfi.start = this.parseComponent(range[0]); + cfi.end = this.parseComponent(range[1]); + } + + // Get spine node position + // cfi.spineSegment = cfi.base.steps[1]; + + // Chapter segment is always the second step + cfi.spinePos = cfi.base.steps[1].index; + + return cfi; + } + }, { + key: "parseComponent", + value: function parseComponent(componentStr) { + var component = { + steps: [], + terminal: { + offset: null, + assertion: null + } + }; + var parts = componentStr.split(":"); + var steps = parts[0].split("/"); + var terminal; + + if (parts.length > 1) { + terminal = parts[1]; + component.terminal = this.parseTerminal(terminal); + } + + if (steps[0] === "") { + steps.shift(); // Ignore the first slash + } + + component.steps = steps.map(function (step) { + return this.parseStep(step); + }.bind(this)); + + return component; + } + }, { + key: "parseStep", + value: function parseStep(stepStr) { + var type, num, index, has_brackets, id; + + has_brackets = stepStr.match(/\[(.*)\]/); + if (has_brackets && has_brackets[1]) { + id = has_brackets[1]; + } + + //-- Check if step is a text node or element + num = parseInt(stepStr); + + if (isNaN(num)) { + return; + } + + if (num % 2 === 0) { + // Even = is an element + type = "element"; + index = num / 2 - 1; + } else { + type = "text"; + index = (num - 1) / 2; + } + + return { + "type": type, + "index": index, + "id": id || null + }; + } + }, { + key: "parseTerminal", + value: function parseTerminal(termialStr) { + var characterOffset, textLocationAssertion; + var assertion = termialStr.match(/\[(.*)\]/); + + if (assertion && assertion[1]) { + characterOffset = parseInt(termialStr.split("[")[0]); + textLocationAssertion = assertion[1]; + } else { + characterOffset = parseInt(termialStr); + } + + if (!(0, _core.isNumber)(characterOffset)) { + characterOffset = null; + } + + return { + "offset": characterOffset, + "assertion": textLocationAssertion + }; + } + }, { + key: "getChapterComponent", + value: function getChapterComponent(cfiStr) { + + var indirection = cfiStr.split("!"); + + return indirection[0]; + } + }, { + key: "getPathComponent", + value: function getPathComponent(cfiStr) { + + var indirection = cfiStr.split("!"); + + if (indirection[1]) { + var ranges = indirection[1].split(","); + return ranges[0]; + } + } + }, { + key: "getRange", + value: function getRange(cfiStr) { + + var ranges = cfiStr.split(","); + + if (ranges.length === 3) { + return [ranges[1], ranges[2]]; + } + + return false; + } + }, { + key: "getCharecterOffsetComponent", + value: function getCharecterOffsetComponent(cfiStr) { + var splitStr = cfiStr.split(":"); + return splitStr[1] || ""; + } + }, { + key: "joinSteps", + value: function joinSteps(steps) { + if (!steps) { + return ""; + } + + return steps.map(function (part) { + var segment = ""; + + if (part.type === "element") { + segment += (part.index + 1) * 2; + } + + if (part.type === "text") { + segment += 1 + 2 * part.index; // TODO: double check that this is odd + } + + if (part.id) { + segment += "[" + part.id + "]"; + } + + return segment; + }).join("/"); + } + }, { + key: "segmentString", + value: function segmentString(segment) { + var segmentString = "/"; + + segmentString += this.joinSteps(segment.steps); + + if (segment.terminal && segment.terminal.offset != null) { + segmentString += ":" + segment.terminal.offset; + } + + if (segment.terminal && segment.terminal.assertion != null) { + segmentString += "[" + segment.terminal.assertion + "]"; + } + + return segmentString; + } + + /** + * Convert CFI to a epubcfi(...) string + * @returns {string} epubcfi + */ + + }, { + key: "toString", + value: function toString() { + var cfiString = "epubcfi("; + + cfiString += this.segmentString(this.base); + + cfiString += "!"; + cfiString += this.segmentString(this.path); + + // Add Range, if present + if (this.range && this.start) { + cfiString += ","; + cfiString += this.segmentString(this.start); + } + + if (this.range && this.end) { + cfiString += ","; + cfiString += this.segmentString(this.end); + } + + cfiString += ")"; + + return cfiString; + } + + /** + * Compare which of two CFIs is earlier in the text + * @returns {number} First is earlier = -1, Second is earlier = 1, They are equal = 0 + */ + + }, { + key: "compare", + value: function compare(cfiOne, cfiTwo) { + var stepsA, stepsB; + var terminalA, terminalB; + + var rangeAStartSteps, rangeAEndSteps; + var rangeBEndSteps, rangeBEndSteps; + var rangeAStartTerminal, rangeAEndTerminal; + var rangeBStartTerminal, rangeBEndTerminal; + + if (typeof cfiOne === "string") { + cfiOne = new EpubCFI(cfiOne); + } + if (typeof cfiTwo === "string") { + cfiTwo = new EpubCFI(cfiTwo); + } + // Compare Spine Positions + if (cfiOne.spinePos > cfiTwo.spinePos) { + return 1; + } + if (cfiOne.spinePos < cfiTwo.spinePos) { + return -1; + } + + if (cfiOne.range) { + stepsA = cfiOne.path.steps.concat(cfiOne.start.steps); + terminalA = cfiOne.start.terminal; + } else { + stepsA = cfiOne.path.steps; + terminalA = cfiOne.path.terminal; + } + + if (cfiTwo.range) { + stepsB = cfiTwo.path.steps.concat(cfiTwo.start.steps); + terminalB = cfiTwo.start.terminal; + } else { + stepsB = cfiTwo.path.steps; + terminalB = cfiTwo.path.terminal; + } + + // Compare Each Step in the First item + for (var i = 0; i < stepsA.length; i++) { + if (!stepsA[i]) { + return -1; + } + if (!stepsB[i]) { + return 1; + } + if (stepsA[i].index > stepsB[i].index) { + return 1; + } + if (stepsA[i].index < stepsB[i].index) { + return -1; + } + // Otherwise continue checking + } + + // All steps in First equal to Second and First is Less Specific + if (stepsA.length < stepsB.length) { + return 1; + } + + // Compare the charecter offset of the text node + if (terminalA.offset > terminalB.offset) { + return 1; + } + if (terminalA.offset < terminalB.offset) { + return -1; + } + + // CFI's are equal + return 0; + } + }, { + key: "step", + value: function step(node) { + var nodeType = node.nodeType === TEXT_NODE ? "text" : "element"; + + return { + "id": node.id, + "tagName": node.tagName, + "type": nodeType, + "index": this.position(node) + }; + } + }, { + key: "filteredStep", + value: function filteredStep(node, ignoreClass) { + var filteredNode = this.filter(node, ignoreClass); + var nodeType; + + // Node filtered, so ignore + if (!filteredNode) { + return; + } + + // Otherwise add the filter node in + nodeType = filteredNode.nodeType === TEXT_NODE ? "text" : "element"; + + return { + "id": filteredNode.id, + "tagName": filteredNode.tagName, + "type": nodeType, + "index": this.filteredPosition(filteredNode, ignoreClass) + }; + } + }, { + key: "pathTo", + value: function pathTo(node, offset, ignoreClass) { + var segment = { + steps: [], + terminal: { + offset: null, + assertion: null + } + }; + var currentNode = node; + var step; + + while (currentNode && currentNode.parentNode && currentNode.parentNode.nodeType != DOCUMENT_NODE) { + + if (ignoreClass) { + step = this.filteredStep(currentNode, ignoreClass); + } else { + step = this.step(currentNode); + } + + if (step) { + segment.steps.unshift(step); + } + + currentNode = currentNode.parentNode; + } + + if (offset != null && offset >= 0) { + + segment.terminal.offset = offset; + + // Make sure we are getting to a textNode if there is an offset + if (segment.steps[segment.steps.length - 1].type != "text") { + segment.steps.push({ + "type": "text", + "index": 0 + }); + } + } + + return segment; + } + }, { + key: "equalStep", + value: function equalStep(stepA, stepB) { + if (!stepA || !stepB) { + return false; + } + + if (stepA.index === stepB.index && stepA.id === stepB.id && stepA.type === stepB.type) { + return true; + } + + return false; + } + + /** + * Create a CFI object from a Range + * @param {Range} range + * @param {string | object} base + * @param {string} [ignoreClass] + * @returns {object} cfi + */ + + }, { + key: "fromRange", + value: function fromRange(range, base, ignoreClass) { + var cfi = { + range: false, + base: {}, + path: {}, + start: null, + end: null + }; + + var start = range.startContainer; + var end = range.endContainer; + + var startOffset = range.startOffset; + var endOffset = range.endOffset; + + var needsIgnoring = false; + + if (ignoreClass) { + // Tell pathTo if / what to ignore + needsIgnoring = start.ownerDocument.querySelector("." + ignoreClass) != null; + } + + if (typeof base === "string") { + cfi.base = this.parseComponent(base); + cfi.spinePos = cfi.base.steps[1].index; + } else if ((typeof base === "undefined" ? "undefined" : _typeof(base)) === "object") { + cfi.base = base; + } + + if (range.collapsed) { + if (needsIgnoring) { + startOffset = this.patchOffset(start, startOffset, ignoreClass); + } + cfi.path = this.pathTo(start, startOffset, ignoreClass); + } else { + cfi.range = true; + + if (needsIgnoring) { + startOffset = this.patchOffset(start, startOffset, ignoreClass); + } + + cfi.start = this.pathTo(start, startOffset, ignoreClass); + if (needsIgnoring) { + endOffset = this.patchOffset(end, endOffset, ignoreClass); + } + + cfi.end = this.pathTo(end, endOffset, ignoreClass); + + // Create a new empty path + cfi.path = { + steps: [], + terminal: null + }; + + // Push steps that are shared between start and end to the common path + var len = cfi.start.steps.length; + var i; + + for (i = 0; i < len; i++) { + if (this.equalStep(cfi.start.steps[i], cfi.end.steps[i])) { + if (i === len - 1) { + // Last step is equal, check terminals + if (cfi.start.terminal === cfi.end.terminal) { + // CFI's are equal + cfi.path.steps.push(cfi.start.steps[i]); + // Not a range + cfi.range = false; + } + } else { + cfi.path.steps.push(cfi.start.steps[i]); + } + } else { + break; + } + } + + cfi.start.steps = cfi.start.steps.slice(cfi.path.steps.length); + cfi.end.steps = cfi.end.steps.slice(cfi.path.steps.length); + + // TODO: Add Sanity check to make sure that the end if greater than the start + } + + return cfi; + } + + /** + * Create a CFI object from a Node + * @param {Node} anchor + * @param {string | object} base + * @param {string} [ignoreClass] + * @returns {object} cfi + */ + + }, { + key: "fromNode", + value: function fromNode(anchor, base, ignoreClass) { + var cfi = { + range: false, + base: {}, + path: {}, + start: null, + end: null + }; + + if (typeof base === "string") { + cfi.base = this.parseComponent(base); + cfi.spinePos = cfi.base.steps[1].index; + } else if ((typeof base === "undefined" ? "undefined" : _typeof(base)) === "object") { + cfi.base = base; + } + + cfi.path = this.pathTo(anchor, null, ignoreClass); + + return cfi; + } + }, { + key: "filter", + value: function filter(anchor, ignoreClass) { + var needsIgnoring; + var sibling; // to join with + var parent, previousSibling, nextSibling; + var isText = false; + + if (anchor.nodeType === TEXT_NODE) { + isText = true; + parent = anchor.parentNode; + needsIgnoring = anchor.parentNode.classList.contains(ignoreClass); + } else { + isText = false; + needsIgnoring = anchor.classList.contains(ignoreClass); + } + + if (needsIgnoring && isText) { + previousSibling = parent.previousSibling; + nextSibling = parent.nextSibling; + + // If the sibling is a text node, join the nodes + if (previousSibling && previousSibling.nodeType === TEXT_NODE) { + sibling = previousSibling; + } else if (nextSibling && nextSibling.nodeType === TEXT_NODE) { + sibling = nextSibling; + } + + if (sibling) { + return sibling; + } else { + // Parent will be ignored on next step + return anchor; + } + } else if (needsIgnoring && !isText) { + // Otherwise just skip the element node + return false; + } else { + // No need to filter + return anchor; + } + } + }, { + key: "patchOffset", + value: function patchOffset(anchor, offset, ignoreClass) { + if (anchor.nodeType != TEXT_NODE) { + throw new Error("Anchor must be a text node"); + } + + var curr = anchor; + var totalOffset = offset; + + // If the parent is a ignored node, get offset from it's start + if (anchor.parentNode.classList.contains(ignoreClass)) { + curr = anchor.parentNode; + } + + while (curr.previousSibling) { + if (curr.previousSibling.nodeType === ELEMENT_NODE) { + // Originally a text node, so join + if (curr.previousSibling.classList.contains(ignoreClass)) { + totalOffset += curr.previousSibling.textContent.length; + } else { + break; // Normal node, dont join + } + } else { + // If the previous sibling is a text node, join the nodes + totalOffset += curr.previousSibling.textContent.length; + } + + curr = curr.previousSibling; + } + + return totalOffset; + } + }, { + key: "normalizedMap", + value: function normalizedMap(children, nodeType, ignoreClass) { + var output = {}; + var prevIndex = -1; + var i, + len = children.length; + var currNodeType; + var prevNodeType; + + for (i = 0; i < len; i++) { + + currNodeType = children[i].nodeType; + + // Check if needs ignoring + if (currNodeType === ELEMENT_NODE && children[i].classList.contains(ignoreClass)) { + currNodeType = TEXT_NODE; + } + + if (i > 0 && currNodeType === TEXT_NODE && prevNodeType === TEXT_NODE) { + // join text nodes + output[i] = prevIndex; + } else if (nodeType === currNodeType) { + prevIndex = prevIndex + 1; + output[i] = prevIndex; + } + + prevNodeType = currNodeType; + } + + return output; + } + }, { + key: "position", + value: function position(anchor) { + var children, index; + if (anchor.nodeType === ELEMENT_NODE) { + children = anchor.parentNode.children; + if (!children) { + children = (0, _core.findChildren)(anchor.parentNode); + } + index = Array.prototype.indexOf.call(children, anchor); + } else { + children = this.textNodes(anchor.parentNode); + index = children.indexOf(anchor); + } + + return index; + } + }, { + key: "filteredPosition", + value: function filteredPosition(anchor, ignoreClass) { + var children, index, map; + + if (anchor.nodeType === ELEMENT_NODE) { + children = anchor.parentNode.children; + map = this.normalizedMap(children, ELEMENT_NODE, ignoreClass); + } else { + children = anchor.parentNode.childNodes; + // Inside an ignored node + if (anchor.parentNode.classList.contains(ignoreClass)) { + anchor = anchor.parentNode; + children = anchor.parentNode.childNodes; + } + map = this.normalizedMap(children, TEXT_NODE, ignoreClass); + } + + index = Array.prototype.indexOf.call(children, anchor); + + return map[index]; + } + }, { + key: "stepsToXpath", + value: function stepsToXpath(steps) { + var xpath = [".", "*"]; + + steps.forEach(function (step) { + var position = step.index + 1; + + if (step.id) { + xpath.push("*[position()=" + position + " and @id='" + step.id + "']"); + } else if (step.type === "text") { + xpath.push("text()[" + position + "]"); + } else { + xpath.push("*[" + position + "]"); + } + }); + + return xpath.join("/"); + } + + /* + To get the last step if needed: + // Get the terminal step + lastStep = steps[steps.length-1]; + // Get the query string + query = this.stepsToQuery(steps); + // Find the containing element + startContainerParent = doc.querySelector(query); + // Find the text node within that element + if(startContainerParent && lastStep.type == "text") { + container = startContainerParent.childNodes[lastStep.index]; + } + */ + + }, { + key: "stepsToQuerySelector", + value: function stepsToQuerySelector(steps) { + var query = ["html"]; + + steps.forEach(function (step) { + var position = step.index + 1; + + if (step.id) { + query.push("#" + step.id); + } else if (step.type === "text") { + // unsupported in querySelector + // query.push("text()[" + position + "]"); + } else { + query.push("*:nth-child(" + position + ")"); + } + }); + + return query.join(">"); + } + }, { + key: "textNodes", + value: function textNodes(container, ignoreClass) { + return Array.prototype.slice.call(container.childNodes).filter(function (node) { + if (node.nodeType === TEXT_NODE) { + return true; + } else if (ignoreClass && node.classList.contains(ignoreClass)) { + return true; + } + return false; + }); + } + }, { + key: "walkToNode", + value: function walkToNode(steps, _doc, ignoreClass) { + var doc = _doc || document; + var container = doc.documentElement; + var children; + var step; + var len = steps.length; + var i; + + for (i = 0; i < len; i++) { + step = steps[i]; + + if (step.type === "element") { + //better to get a container using id as some times step.index may not be correct + //For ex.https://github.com/futurepress/epub.js/issues/561 + if (step.id) { + container = doc.getElementById(step.id); + } else { + children = container.children || (0, _core.findChildren)(container); + container = children[step.index]; + } + } else if (step.type === "text") { + container = this.textNodes(container, ignoreClass)[step.index]; + } + if (!container) { + //Break the for loop as due to incorrect index we can get error if + //container is undefined so that other functionailties works fine + //like navigation + break; + } + } + + return container; + } + }, { + key: "findNode", + value: function findNode(steps, _doc, ignoreClass) { + var doc = _doc || document; + var container; + var xpath; + + if (!ignoreClass && typeof doc.evaluate != "undefined") { + xpath = this.stepsToXpath(steps); + container = doc.evaluate(xpath, doc, null, XPathResult.FIRST_ORDERED_NODE_TYPE, null).singleNodeValue; + } else if (ignoreClass) { + container = this.walkToNode(steps, doc, ignoreClass); + } else { + container = this.walkToNode(steps, doc); + } + + return container; + } + }, { + key: "fixMiss", + value: function fixMiss(steps, offset, _doc, ignoreClass) { + var container = this.findNode(steps.slice(0, -1), _doc, ignoreClass); + var children = container.childNodes; + var map = this.normalizedMap(children, TEXT_NODE, ignoreClass); + var child; + var len; + var lastStepIndex = steps[steps.length - 1].index; + + for (var childIndex in map) { + if (!map.hasOwnProperty(childIndex)) return; + + if (map[childIndex] === lastStepIndex) { + child = children[childIndex]; + len = child.textContent.length; + if (offset > len) { + offset = offset - len; + } else { + if (child.nodeType === ELEMENT_NODE) { + container = child.childNodes[0]; + } else { + container = child; + } + break; + } + } + } + + return { + container: container, + offset: offset + }; + } + + /** + * Creates a DOM range representing a CFI + * @param {document} _doc document referenced in the base + * @param {string} [ignoreClass] + * @return {Range} + */ + + }, { + key: "toRange", + value: function toRange(_doc, ignoreClass) { + var doc = _doc || document; + var range; + var start, end, startContainer, endContainer; + var cfi = this; + var startSteps, endSteps; + var needsIgnoring = ignoreClass ? doc.querySelector("." + ignoreClass) != null : false; + var missed; + + if (typeof doc.createRange !== "undefined") { + range = doc.createRange(); + } else { + range = new _core.RangeObject(); + } + + if (cfi.range) { + start = cfi.start; + startSteps = cfi.path.steps.concat(start.steps); + startContainer = this.findNode(startSteps, doc, needsIgnoring ? ignoreClass : null); + end = cfi.end; + endSteps = cfi.path.steps.concat(end.steps); + endContainer = this.findNode(endSteps, doc, needsIgnoring ? ignoreClass : null); + } else { + start = cfi.path; + startSteps = cfi.path.steps; + startContainer = this.findNode(cfi.path.steps, doc, needsIgnoring ? ignoreClass : null); + } + + if (startContainer) { + try { + + if (start.terminal.offset != null) { + range.setStart(startContainer, start.terminal.offset); + } else { + range.setStart(startContainer, 0); + } + } catch (e) { + missed = this.fixMiss(startSteps, start.terminal.offset, doc, needsIgnoring ? ignoreClass : null); + range.setStart(missed.container, missed.offset); + } + } else { + console.log("No startContainer found for", this.toString()); + // No start found + return null; + } + + if (endContainer) { + try { + + if (end.terminal.offset != null) { + range.setEnd(endContainer, end.terminal.offset); + } else { + range.setEnd(endContainer, 0); + } + } catch (e) { + missed = this.fixMiss(endSteps, cfi.end.terminal.offset, doc, needsIgnoring ? ignoreClass : null); + range.setEnd(missed.container, missed.offset); + } + } + + // doc.defaultView.getSelection().addRange(range); + return range; + } + + /** + * Check if a string is wrapped with "epubcfi()" + * @param {string} str + * @returns {boolean} + */ + + }, { + key: "isCfiString", + value: function isCfiString(str) { + if (typeof str === "string" && str.indexOf("epubcfi(") === 0 && str[str.length - 1] === ")") { + return true; + } + + return false; + } + }, { + key: "generateChapterComponent", + value: function generateChapterComponent(_spineNodeIndex, _pos, id) { + var pos = parseInt(_pos), + spineNodeIndex = (_spineNodeIndex + 1) * 2, + cfi = "/" + spineNodeIndex + "/"; + + cfi += (pos + 1) * 2; + + if (id) { + cfi += "[" + id + "]"; + } + + return cfi; + } + + /** + * Collapse a CFI Range to a single CFI Position + * @param {boolean} [toStart=false] + */ + + }, { + key: "collapse", + value: function collapse(toStart) { + if (!this.range) { + return; + } + + this.range = false; + + if (toStart) { + this.path.steps = this.path.steps.concat(this.start.steps); + this.path.terminal = this.start.terminal; + } else { + this.path.steps = this.path.steps.concat(this.end.steps); + this.path.terminal = this.end.terminal; + } + } + }]); + + return EpubCFI; +}(); + +exports.default = EpubCFI; +module.exports = exports["default"]; + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +var EPUBJS_VERSION = exports.EPUBJS_VERSION = "0.3"; + +// Dom events to listen for +var DOM_EVENTS = exports.DOM_EVENTS = ["keydown", "keyup", "keypressed", "mouseup", "mousedown", "click", "touchend", "touchstart", "touchmove"]; + +var EVENTS = exports.EVENTS = { + BOOK: { + OPEN_FAILED: "openFailed" + }, + CONTENTS: { + EXPAND: "expand", + RESIZE: "resize", + SELECTED: "selected", + SELECTED_RANGE: "selectedRange", + LINK_CLICKED: "linkClicked" + }, + LOCATIONS: { + CHANGED: "changed" + }, + MANAGERS: { + RESIZE: "resize", + RESIZED: "resized", + ORIENTATION_CHANGE: "orientationchange", + ADDED: "added", + SCROLL: "scroll", + SCROLLED: "scrolled", + REMOVED: "removed" + }, + VIEWS: { + AXIS: "axis", + LOAD_ERROR: "loaderror", + RENDERED: "rendered", + RESIZED: "resized", + DISPLAYED: "displayed", + SHOWN: "shown", + HIDDEN: "hidden", + MARK_CLICKED: "markClicked" + }, + RENDITION: { + STARTED: "started", + ATTACHED: "attached", + DISPLAYED: "displayed", + DISPLAY_ERROR: "displayerror", + RENDERED: "rendered", + REMOVED: "removed", + RESIZED: "resized", + ORIENTATION_CHANGE: "orientationchange", + LOCATION_CHANGED: "locationChanged", + RELOCATED: "relocated", + MARK_CLICKED: "markClicked", + SELECTED: "selected", + LAYOUT: "layout" + }, + LAYOUT: { + UPDATED: "updated" + }, + ANNOTATION: { + ATTACH: "attach", + DETACH: "detach" + } +}; + +/***/ }), +/* 3 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var d = __webpack_require__(27) + , callable = __webpack_require__(41) + + , apply = Function.prototype.apply, call = Function.prototype.call + , create = Object.create, defineProperty = Object.defineProperty + , defineProperties = Object.defineProperties + , hasOwnProperty = Object.prototype.hasOwnProperty + , descriptor = { configurable: true, enumerable: false, writable: true } + + , on, once, off, emit, methods, descriptors, base; + +on = function (type, listener) { + var data; + + callable(listener); + + if (!hasOwnProperty.call(this, '__ee__')) { + data = descriptor.value = create(null); + defineProperty(this, '__ee__', descriptor); + descriptor.value = null; + } else { + data = this.__ee__; + } + if (!data[type]) data[type] = listener; + else if (typeof data[type] === 'object') data[type].push(listener); + else data[type] = [data[type], listener]; + + return this; +}; + +once = function (type, listener) { + var once, self; + + callable(listener); + self = this; + on.call(this, type, once = function () { + off.call(self, type, once); + apply.call(listener, this, arguments); + }); + + once.__eeOnceListener__ = listener; + return this; +}; + +off = function (type, listener) { + var data, listeners, candidate, i; + + callable(listener); + + if (!hasOwnProperty.call(this, '__ee__')) return this; + data = this.__ee__; + if (!data[type]) return this; + listeners = data[type]; + + if (typeof listeners === 'object') { + for (i = 0; (candidate = listeners[i]); ++i) { + if ((candidate === listener) || + (candidate.__eeOnceListener__ === listener)) { + if (listeners.length === 2) data[type] = listeners[i ? 0 : 1]; + else listeners.splice(i, 1); + } + } + } else { + if ((listeners === listener) || + (listeners.__eeOnceListener__ === listener)) { + delete data[type]; + } + } + + return this; +}; + +emit = function (type) { + var i, l, listener, listeners, args; + + if (!hasOwnProperty.call(this, '__ee__')) return; + listeners = this.__ee__[type]; + if (!listeners) return; + + if (typeof listeners === 'object') { + l = arguments.length; + args = new Array(l - 1); + for (i = 1; i < l; ++i) args[i - 1] = arguments[i]; + + listeners = listeners.slice(); + for (i = 0; (listener = listeners[i]); ++i) { + apply.call(listener, this, args); + } + } else { + switch (arguments.length) { + case 1: + call.call(listeners, this); + break; + case 2: + call.call(listeners, this, arguments[1]); + break; + case 3: + call.call(listeners, this, arguments[1], arguments[2]); + break; + default: + l = arguments.length; + args = new Array(l - 1); + for (i = 1; i < l; ++i) { + args[i - 1] = arguments[i]; + } + apply.call(listeners, this, args); + } + } +}; + +methods = { + on: on, + once: once, + off: off, + emit: emit +}; + +descriptors = { + on: d(on), + once: d(once), + off: d(off), + emit: d(emit) +}; + +base = defineProperties({}, descriptors); + +module.exports = exports = function (o) { + return (o == null) ? create(base) : defineProperties(Object(o), descriptors); +}; +exports.methods = methods; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _pathWebpack = __webpack_require__(7); + +var _pathWebpack2 = _interopRequireDefault(_pathWebpack); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Creates a Path object for parsing and manipulation of a path strings + * + * Uses a polyfill for Nodejs path: https://nodejs.org/api/path.html + * @param {string} pathString a url string (relative or absolute) + * @class + */ +var Path = function () { + function Path(pathString) { + _classCallCheck(this, Path); + + var protocol; + var parsed; + + protocol = pathString.indexOf("://"); + if (protocol > -1) { + pathString = new URL(pathString).pathname; + } + + parsed = this.parse(pathString); + + this.path = pathString; + + if (this.isDirectory(pathString)) { + this.directory = pathString; + } else { + this.directory = parsed.dir + "/"; + } + + this.filename = parsed.base; + this.extension = parsed.ext.slice(1); + } + + /** + * Parse the path: https://nodejs.org/api/path.html#path_path_parse_path + * @param {string} what + * @returns {object} + */ + + + _createClass(Path, [{ + key: "parse", + value: function parse(what) { + return _pathWebpack2.default.parse(what); + } + + /** + * @param {string} what + * @returns {boolean} + */ + + }, { + key: "isAbsolute", + value: function isAbsolute(what) { + return _pathWebpack2.default.isAbsolute(what || this.path); + } + + /** + * Check if path ends with a directory + * @param {string} what + * @returns {boolean} + */ + + }, { + key: "isDirectory", + value: function isDirectory(what) { + return what.charAt(what.length - 1) === "/"; + } + + /** + * Resolve a path against the directory of the Path + * + * https://nodejs.org/api/path.html#path_path_resolve_paths + * @param {string} what + * @returns {string} resolved + */ + + }, { + key: "resolve", + value: function resolve(what) { + return _pathWebpack2.default.resolve(this.directory, what); + } + + /** + * Resolve a path relative to the directory of the Path + * + * https://nodejs.org/api/path.html#path_path_relative_from_to + * @param {string} what + * @returns {string} relative + */ + + }, { + key: "relative", + value: function relative(what) { + var isAbsolute = what && what.indexOf("://") > -1; + + if (isAbsolute) { + return what; + } + + return _pathWebpack2.default.relative(this.directory, what); + } + }, { + key: "splitPath", + value: function splitPath(filename) { + return this.splitPathRe.exec(filename).slice(1); + } + + /** + * Return the path string + * @returns {string} path + */ + + }, { + key: "toString", + value: function toString() { + return this.path; + } + }]); + + return Path; +}(); + +exports.default = Path; +module.exports = exports["default"]; + +/***/ }), +/* 5 */ +/***/ (function(module, exports) { + +var g; + +// This works in non-strict mode +g = (function() { + return this; +})(); + +try { + // This works if eval is allowed (see CSP) + g = g || Function("return this")() || (1,eval)("this"); +} catch(e) { + // This works if the window reference is available + if(typeof window === "object") + g = window; +} + +// g can still be undefined, but nothing to do about it... +// We return undefined, instead of nothing here, so it's +// easier to handle this case. if(!global) { ...} + +module.exports = g; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _path = __webpack_require__(4); + +var _path2 = _interopRequireDefault(_path); + +var _pathWebpack = __webpack_require__(7); + +var _pathWebpack2 = _interopRequireDefault(_pathWebpack); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * creates a Url object for parsing and manipulation of a url string + * @param {string} urlString a url string (relative or absolute) + * @param {string} [baseString] optional base for the url, + * default to window.location.href + */ +var Url = function () { + function Url(urlString, baseString) { + _classCallCheck(this, Url); + + var absolute = urlString.indexOf("://") > -1; + var pathname = urlString; + var basePath; + + this.Url = undefined; + this.href = urlString; + this.protocol = ""; + this.origin = ""; + this.hash = ""; + this.hash = ""; + this.search = ""; + this.base = baseString; + + if (!absolute && baseString !== false && typeof baseString !== "string" && window && window.location) { + this.base = window.location.href; + } + + // URL Polyfill doesn't throw an error if base is empty + if (absolute || this.base) { + try { + if (this.base) { + // Safari doesn't like an undefined base + this.Url = new URL(urlString, this.base); + } else { + this.Url = new URL(urlString); + } + this.href = this.Url.href; + + this.protocol = this.Url.protocol; + this.origin = this.Url.origin; + this.hash = this.Url.hash; + this.search = this.Url.search; + + pathname = this.Url.pathname; + } catch (e) { + // Skip URL parsing + this.Url = undefined; + // resolve the pathname from the base + if (this.base) { + basePath = new _path2.default(this.base); + pathname = basePath.resolve(pathname); + } + } + } + + this.Path = new _path2.default(pathname); + + this.directory = this.Path.directory; + this.filename = this.Path.filename; + this.extension = this.Path.extension; + } + + /** + * @returns {Path} + */ + + + _createClass(Url, [{ + key: "path", + value: function path() { + return this.Path; + } + + /** + * Resolves a relative path to a absolute url + * @param {string} what + * @returns {string} url + */ + + }, { + key: "resolve", + value: function resolve(what) { + var isAbsolute = what.indexOf("://") > -1; + var fullpath; + + if (isAbsolute) { + return what; + } + + fullpath = _pathWebpack2.default.resolve(this.directory, what); + return this.origin + fullpath; + } + + /** + * Resolve a path relative to the url + * @param {string} what + * @returns {string} path + */ + + }, { + key: "relative", + value: function relative(what) { + return _pathWebpack2.default.relative(what, this.directory); + } + + /** + * @returns {string} + */ + + }, { + key: "toString", + value: function toString() { + return this.href; + } + }]); + + return Url; +}(); + +exports.default = Url; +module.exports = exports["default"]; + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +if (!process) { + var process = { + "cwd" : function () { return '/' } + }; +} + +function assertPath(path) { + if (typeof path !== 'string') { + throw new TypeError('Path must be a string. Received ' + path); + } +} + +// Resolves . and .. elements in a path with directory names +function normalizeStringPosix(path, allowAboveRoot) { + var res = ''; + var lastSlash = -1; + var dots = 0; + var code; + for (var i = 0; i <= path.length; ++i) { + if (i < path.length) + code = path.charCodeAt(i); + else if (code === 47/*/*/) + break; + else + code = 47/*/*/; + if (code === 47/*/*/) { + if (lastSlash === i - 1 || dots === 1) { + // NOOP + } else if (lastSlash !== i - 1 && dots === 2) { + if (res.length < 2 || + res.charCodeAt(res.length - 1) !== 46/*.*/ || + res.charCodeAt(res.length - 2) !== 46/*.*/) { + if (res.length > 2) { + var start = res.length - 1; + var j = start; + for (; j >= 0; --j) { + if (res.charCodeAt(j) === 47/*/*/) + break; + } + if (j !== start) { + if (j === -1) + res = ''; + else + res = res.slice(0, j); + lastSlash = i; + dots = 0; + continue; + } + } else if (res.length === 2 || res.length === 1) { + res = ''; + lastSlash = i; + dots = 0; + continue; + } + } + if (allowAboveRoot) { + if (res.length > 0) + res += '/..'; + else + res = '..'; + } + } else { + if (res.length > 0) + res += '/' + path.slice(lastSlash + 1, i); + else + res = path.slice(lastSlash + 1, i); + } + lastSlash = i; + dots = 0; + } else if (code === 46/*.*/ && dots !== -1) { + ++dots; + } else { + dots = -1; + } + } + return res; +} + +function _format(sep, pathObject) { + var dir = pathObject.dir || pathObject.root; + var base = pathObject.base || + ((pathObject.name || '') + (pathObject.ext || '')); + if (!dir) { + return base; + } + if (dir === pathObject.root) { + return dir + base; + } + return dir + sep + base; +} + +var posix = { + // path.resolve([from ...], to) + resolve: function resolve() { + var resolvedPath = ''; + var resolvedAbsolute = false; + var cwd; + + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path; + if (i >= 0) + path = arguments[i]; + else { + if (cwd === undefined) + cwd = process.cwd(); + path = cwd; + } + + assertPath(path); + + // Skip empty entries + if (path.length === 0) { + continue; + } + + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = path.charCodeAt(0) === 47/*/*/; + } + + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + + // Normalize the path + resolvedPath = normalizeStringPosix(resolvedPath, !resolvedAbsolute); + + if (resolvedAbsolute) { + if (resolvedPath.length > 0) + return '/' + resolvedPath; + else + return '/'; + } else if (resolvedPath.length > 0) { + return resolvedPath; + } else { + return '.'; + } + }, + + + normalize: function normalize(path) { + assertPath(path); + + if (path.length === 0) + return '.'; + + var isAbsolute = path.charCodeAt(0) === 47/*/*/; + var trailingSeparator = path.charCodeAt(path.length - 1) === 47/*/*/; + + // Normalize the path + path = normalizeStringPosix(path, !isAbsolute); + + if (path.length === 0 && !isAbsolute) + path = '.'; + if (path.length > 0 && trailingSeparator) + path += '/'; + + if (isAbsolute) + return '/' + path; + return path; + }, + + + isAbsolute: function isAbsolute(path) { + assertPath(path); + return path.length > 0 && path.charCodeAt(0) === 47/*/*/; + }, + + + join: function join() { + if (arguments.length === 0) + return '.'; + var joined; + for (var i = 0; i < arguments.length; ++i) { + var arg = arguments[i]; + assertPath(arg); + if (arg.length > 0) { + if (joined === undefined) + joined = arg; + else + joined += '/' + arg; + } + } + if (joined === undefined) + return '.'; + return posix.normalize(joined); + }, + + + relative: function relative(from, to) { + assertPath(from); + assertPath(to); + + if (from === to) + return ''; + + from = posix.resolve(from); + to = posix.resolve(to); + + if (from === to) + return ''; + + // Trim any leading backslashes + var fromStart = 1; + for (; fromStart < from.length; ++fromStart) { + if (from.charCodeAt(fromStart) !== 47/*/*/) + break; + } + var fromEnd = from.length; + var fromLen = (fromEnd - fromStart); + + // Trim any leading backslashes + var toStart = 1; + for (; toStart < to.length; ++toStart) { + if (to.charCodeAt(toStart) !== 47/*/*/) + break; + } + var toEnd = to.length; + var toLen = (toEnd - toStart); + + // Compare paths to find the longest common path from root + var length = (fromLen < toLen ? fromLen : toLen); + var lastCommonSep = -1; + var i = 0; + for (; i <= length; ++i) { + if (i === length) { + if (toLen > length) { + if (to.charCodeAt(toStart + i) === 47/*/*/) { + // We get here if `from` is the exact base path for `to`. + // For example: from='/foo/bar'; to='/foo/bar/baz' + return to.slice(toStart + i + 1); + } else if (i === 0) { + // We get here if `from` is the root + // For example: from='/'; to='/foo' + return to.slice(toStart + i); + } + } else if (fromLen > length) { + if (from.charCodeAt(fromStart + i) === 47/*/*/) { + // We get here if `to` is the exact base path for `from`. + // For example: from='/foo/bar/baz'; to='/foo/bar' + lastCommonSep = i; + } else if (i === 0) { + // We get here if `to` is the root. + // For example: from='/foo'; to='/' + lastCommonSep = 0; + } + } + break; + } + var fromCode = from.charCodeAt(fromStart + i); + var toCode = to.charCodeAt(toStart + i); + if (fromCode !== toCode) + break; + else if (fromCode === 47/*/*/) + lastCommonSep = i; + } + + var out = ''; + // Generate the relative path based on the path difference between `to` + // and `from` + for (i = fromStart + lastCommonSep + 1; i <= fromEnd; ++i) { + if (i === fromEnd || from.charCodeAt(i) === 47/*/*/) { + if (out.length === 0) + out += '..'; + else + out += '/..'; + } + } + + // Lastly, append the rest of the destination (`to`) path that comes after + // the common path parts + if (out.length > 0) + return out + to.slice(toStart + lastCommonSep); + else { + toStart += lastCommonSep; + if (to.charCodeAt(toStart) === 47/*/*/) + ++toStart; + return to.slice(toStart); + } + }, + + + _makeLong: function _makeLong(path) { + return path; + }, + + + dirname: function dirname(path) { + assertPath(path); + if (path.length === 0) + return '.'; + var code = path.charCodeAt(0); + var hasRoot = (code === 47/*/*/); + var end = -1; + var matchedSlash = true; + for (var i = path.length - 1; i >= 1; --i) { + code = path.charCodeAt(i); + if (code === 47/*/*/) { + if (!matchedSlash) { + end = i; + break; + } + } else { + // We saw the first non-path separator + matchedSlash = false; + } + } + + if (end === -1) + return hasRoot ? '/' : '.'; + if (hasRoot && end === 1) + return '//'; + return path.slice(0, end); + }, + + + basename: function basename(path, ext) { + if (ext !== undefined && typeof ext !== 'string') + throw new TypeError('"ext" argument must be a string'); + assertPath(path); + + var start = 0; + var end = -1; + var matchedSlash = true; + var i; + + if (ext !== undefined && ext.length > 0 && ext.length <= path.length) { + if (ext.length === path.length && ext === path) + return ''; + var extIdx = ext.length - 1; + var firstNonSlashEnd = -1; + for (i = path.length - 1; i >= 0; --i) { + var code = path.charCodeAt(i); + if (code === 47/*/*/) { + // If we reached a path separator that was not part of a set of path + // separators at the end of the string, stop now + if (!matchedSlash) { + start = i + 1; + break; + } + } else { + if (firstNonSlashEnd === -1) { + // We saw the first non-path separator, remember this index in case + // we need it if the extension ends up not matching + matchedSlash = false; + firstNonSlashEnd = i + 1; + } + if (extIdx >= 0) { + // Try to match the explicit extension + if (code === ext.charCodeAt(extIdx)) { + if (--extIdx === -1) { + // We matched the extension, so mark this as the end of our path + // component + end = i; + } + } else { + // Extension does not match, so our result is the entire path + // component + extIdx = -1; + end = firstNonSlashEnd; + } + } + } + } + + if (start === end) + end = firstNonSlashEnd; + else if (end === -1) + end = path.length; + return path.slice(start, end); + } else { + for (i = path.length - 1; i >= 0; --i) { + if (path.charCodeAt(i) === 47/*/*/) { + // If we reached a path separator that was not part of a set of path + // separators at the end of the string, stop now + if (!matchedSlash) { + start = i + 1; + break; + } + } else if (end === -1) { + // We saw the first non-path separator, mark this as the end of our + // path component + matchedSlash = false; + end = i + 1; + } + } + + if (end === -1) + return ''; + return path.slice(start, end); + } + }, + + + extname: function extname(path) { + assertPath(path); + var startDot = -1; + var startPart = 0; + var end = -1; + var matchedSlash = true; + // Track the state of characters (if any) we see before our first dot and + // after any path separator we find + var preDotState = 0; + for (var i = path.length - 1; i >= 0; --i) { + var code = path.charCodeAt(i); + if (code === 47/*/*/) { + // If we reached a path separator that was not part of a set of path + // separators at the end of the string, stop now + if (!matchedSlash) { + startPart = i + 1; + break; + } + continue; + } + if (end === -1) { + // We saw the first non-path separator, mark this as the end of our + // extension + matchedSlash = false; + end = i + 1; + } + if (code === 46/*.*/) { + // If this is our first dot, mark it as the start of our extension + if (startDot === -1) + startDot = i; + else if (preDotState !== 1) + preDotState = 1; + } else if (startDot !== -1) { + // We saw a non-dot and non-path separator before our dot, so we should + // have a good chance at having a non-empty extension + preDotState = -1; + } + } + + if (startDot === -1 || + end === -1 || + // We saw a non-dot character immediately before the dot + preDotState === 0 || + // The (right-most) trimmed path component is exactly '..' + (preDotState === 1 && + startDot === end - 1 && + startDot === startPart + 1)) { + return ''; + } + return path.slice(startDot, end); + }, + + + format: function format(pathObject) { + if (pathObject === null || typeof pathObject !== 'object') { + throw new TypeError( + 'Parameter "pathObject" must be an object, not ' + typeof(pathObject) + ); + } + return _format('/', pathObject); + }, + + + parse: function parse(path) { + assertPath(path); + + var ret = { root: '', dir: '', base: '', ext: '', name: '' }; + if (path.length === 0) + return ret; + var code = path.charCodeAt(0); + var isAbsolute = (code === 47/*/*/); + var start; + if (isAbsolute) { + ret.root = '/'; + start = 1; + } else { + start = 0; + } + var startDot = -1; + var startPart = 0; + var end = -1; + var matchedSlash = true; + var i = path.length - 1; + + // Track the state of characters (if any) we see before our first dot and + // after any path separator we find + var preDotState = 0; + + // Get non-dir info + for (; i >= start; --i) { + code = path.charCodeAt(i); + if (code === 47/*/*/) { + // If we reached a path separator that was not part of a set of path + // separators at the end of the string, stop now + if (!matchedSlash) { + startPart = i + 1; + break; + } + continue; + } + if (end === -1) { + // We saw the first non-path separator, mark this as the end of our + // extension + matchedSlash = false; + end = i + 1; + } + if (code === 46/*.*/) { + // If this is our first dot, mark it as the start of our extension + if (startDot === -1) + startDot = i; + else if (preDotState !== 1) + preDotState = 1; + } else if (startDot !== -1) { + // We saw a non-dot and non-path separator before our dot, so we should + // have a good chance at having a non-empty extension + preDotState = -1; + } + } + + if (startDot === -1 || + end === -1 || + // We saw a non-dot character immediately before the dot + preDotState === 0 || + // The (right-most) trimmed path component is exactly '..' + (preDotState === 1 && + startDot === end - 1 && + startDot === startPart + 1)) { + if (end !== -1) { + if (startPart === 0 && isAbsolute) + ret.base = ret.name = path.slice(1, end); + else + ret.base = ret.name = path.slice(startPart, end); + } + } else { + if (startPart === 0 && isAbsolute) { + ret.name = path.slice(1, startDot); + ret.base = path.slice(1, end); + } else { + ret.name = path.slice(startPart, startDot); + ret.base = path.slice(startPart, end); + } + ret.ext = path.slice(startDot, end); + } + + if (startPart > 0) + ret.dir = path.slice(0, startPart - 1); + else if (isAbsolute) + ret.dir = '/'; + + return ret; + }, + + + sep: '/', + delimiter: ':', + posix: null +}; + + +module.exports = posix; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.replaceBase = replaceBase; +exports.replaceCanonical = replaceCanonical; +exports.replaceMeta = replaceMeta; +exports.replaceLinks = replaceLinks; +exports.substitute = substitute; + +var _core = __webpack_require__(0); + +var _url = __webpack_require__(6); + +var _url2 = _interopRequireDefault(_url); + +var _path = __webpack_require__(4); + +var _path2 = _interopRequireDefault(_path); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function replaceBase(doc, section) { + var base; + var head; + var url = section.url; + var absolute = url.indexOf("://") > -1; + + if (!doc) { + return; + } + + head = (0, _core.qs)(doc, "head"); + base = (0, _core.qs)(head, "base"); + + if (!base) { + base = doc.createElement("base"); + head.insertBefore(base, head.firstChild); + } + + // Fix for Safari crashing if the url doesn't have an origin + if (!absolute && window && window.location) { + url = window.location.origin + url; + } + + base.setAttribute("href", url); +} + +function replaceCanonical(doc, section) { + var head; + var link; + var url = section.canonical; + + if (!doc) { + return; + } + + head = (0, _core.qs)(doc, "head"); + link = (0, _core.qs)(head, "link[rel='canonical']"); + + if (link) { + link.setAttribute("href", url); + } else { + link = doc.createElement("link"); + link.setAttribute("rel", "canonical"); + link.setAttribute("href", url); + head.appendChild(link); + } +} + +function replaceMeta(doc, section) { + var head; + var meta; + var id = section.idref; + if (!doc) { + return; + } + + head = (0, _core.qs)(doc, "head"); + meta = (0, _core.qs)(head, "link[property='dc.identifier']"); + + if (meta) { + meta.setAttribute("content", id); + } else { + meta = doc.createElement("meta"); + meta.setAttribute("name", "dc.identifier"); + meta.setAttribute("content", id); + head.appendChild(meta); + } +} + +// TODO: move me to Contents +function replaceLinks(contents, fn) { + + var links = contents.querySelectorAll("a[href]"); + + if (!links.length) { + return; + } + + var base = (0, _core.qs)(contents.ownerDocument, "base"); + var location = base ? base.getAttribute("href") : undefined; + var replaceLink = function (link) { + var href = link.getAttribute("href"); + + if (href.indexOf("mailto:") === 0) { + return; + } + + var absolute = href.indexOf("://") > -1; + + if (absolute) { + + link.setAttribute("target", "_blank"); + } else { + var linkUrl; + try { + linkUrl = new _url2.default(href, location); + } catch (error) { + // NOOP + } + + link.onclick = function () { + + if (linkUrl && linkUrl.hash) { + fn(linkUrl.Path.path + linkUrl.hash); + } else if (linkUrl) { + fn(linkUrl.Path.path); + } else { + fn(href); + } + + return false; + }; + } + }.bind(this); + + for (var i = 0; i < links.length; i++) { + replaceLink(links[i]); + } +} + +function substitute(content, urls, replacements) { + urls.forEach(function (url, i) { + if (url && replacements[i]) { + content = content.replace(new RegExp(url, "g"), replacements[i]); + } + }); + return content; +} + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _core = __webpack_require__(0); + +var _path = __webpack_require__(4); + +var _path2 = _interopRequireDefault(_path); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function request(url, type, withCredentials, headers) { + var supportsURL = typeof window != "undefined" ? window.URL : false; // TODO: fallback for url if window isn't defined + var BLOB_RESPONSE = supportsURL ? "blob" : "arraybuffer"; + + var deferred = new _core.defer(); + + var xhr = new XMLHttpRequest(); + + //-- Check from PDF.js: + // https://github.com/mozilla/pdf.js/blob/master/web/compatibility.js + var xhrPrototype = XMLHttpRequest.prototype; + + var header; + + if (!("overrideMimeType" in xhrPrototype)) { + // IE10 might have response, but not overrideMimeType + Object.defineProperty(xhrPrototype, "overrideMimeType", { + value: function xmlHttpRequestOverrideMimeType() {} + }); + } + + if (withCredentials) { + xhr.withCredentials = true; + } + + xhr.onreadystatechange = handler; + xhr.onerror = err; + + xhr.open("GET", url, true); + + for (header in headers) { + xhr.setRequestHeader(header, headers[header]); + } + + if (type == "json") { + xhr.setRequestHeader("Accept", "application/json"); + } + + // If type isn"t set, determine it from the file extension + if (!type) { + type = new _path2.default(url).extension; + } + + if (type == "blob") { + xhr.responseType = BLOB_RESPONSE; + } + + if ((0, _core.isXml)(type)) { + // xhr.responseType = "document"; + xhr.overrideMimeType("text/xml"); // for OPF parsing + } + + if (type == "xhtml") { + // xhr.responseType = "document"; + } + + if (type == "html" || type == "htm") { + // xhr.responseType = "document"; + } + + if (type == "binary") { + xhr.responseType = "arraybuffer"; + } + + xhr.send(); + + function err(e) { + deferred.reject(e); + } + + function handler() { + if (this.readyState === XMLHttpRequest.DONE) { + var responseXML = false; + + if (this.responseType === "" || this.responseType === "document") { + responseXML = this.responseXML; + } + + if (this.status === 200 || this.status === 0 || responseXML) { + //-- Firefox is reporting 0 for blob urls + var r; + + if (!this.response && !responseXML) { + deferred.reject({ + status: this.status, + message: "Empty Response", + stack: new Error().stack + }); + return deferred.promise; + } + + if (this.status === 403) { + deferred.reject({ + status: this.status, + response: this.response, + message: "Forbidden", + stack: new Error().stack + }); + return deferred.promise; + } + if (responseXML) { + r = this.responseXML; + } else if ((0, _core.isXml)(type)) { + // xhr.overrideMimeType("text/xml"); // for OPF parsing + // If this.responseXML wasn't set, try to parse using a DOMParser from text + r = (0, _core.parse)(this.response, "text/xml"); + } else if (type == "xhtml") { + r = (0, _core.parse)(this.response, "application/xhtml+xml"); + } else if (type == "html" || type == "htm") { + r = (0, _core.parse)(this.response, "text/html"); + } else if (type == "json") { + r = JSON.parse(this.response); + } else if (type == "blob") { + + if (supportsURL) { + r = this.response; + } else { + //-- Safari doesn't support responseType blob, so create a blob from arraybuffer + r = new Blob([this.response]); + } + } else { + r = this.response; + } + + deferred.resolve(r); + } else { + + deferred.reject({ + status: this.status, + message: this.response, + stack: new Error().stack + }); + } + } + } + + return deferred.promise; +} + +exports.default = request; +module.exports = exports["default"]; + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var _undefined = __webpack_require__(34)(); // Support ES3 engines + +module.exports = function (val) { + return (val !== _undefined) && (val !== null); +}; + + +/***/ }), +/* 11 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Hooks allow for injecting functions that must all complete in order before finishing + * They will execute in parallel but all must finish before continuing + * Functions may return a promise if they are asycn. + * @param {any} context scope of this + * @example this.content = new EPUBJS.Hook(this); + */ +var Hook = function () { + function Hook(context) { + _classCallCheck(this, Hook); + + this.context = context || this; + this.hooks = []; + } + + /** + * Adds a function to be run before a hook completes + * @example this.content.register(function(){...}); + */ + + + _createClass(Hook, [{ + key: "register", + value: function register() { + for (var i = 0; i < arguments.length; ++i) { + if (typeof arguments[i] === "function") { + this.hooks.push(arguments[i]); + } else { + // unpack array + for (var j = 0; j < arguments[i].length; ++j) { + this.hooks.push(arguments[i][j]); + } + } + } + } + + /** + * Removes a function + * @example this.content.deregister(function(){...}); + */ + + }, { + key: "deregister", + value: function deregister(func) { + var hook = void 0; + for (var i = 0; i < this.hooks.length; i++) { + hook = this.hooks[i]; + if (hook === func) { + this.hooks.splice(i, 1); + break; + } + } + } + + /** + * Triggers a hook to run all functions + * @example this.content.trigger(args).then(function(){...}); + */ + + }, { + key: "trigger", + value: function trigger() { + var args = arguments; + var context = this.context; + var promises = []; + + this.hooks.forEach(function (task) { + var executing = task.apply(context, args); + + if (executing && typeof executing["then"] === "function") { + // Task is a function that returns a promise + promises.push(executing); + } + // Otherwise Task resolves immediately, continue + }); + + return Promise.all(promises); + } + + // Adds a function to be run before a hook completes + + }, { + key: "list", + value: function list() { + return this.hooks; + } + }, { + key: "clear", + value: function clear() { + return this.hooks = []; + } + }]); + + return Hook; +}(); + +exports.default = Hook; +module.exports = exports["default"]; + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.Task = undefined; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _core = __webpack_require__(0); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Queue for handling tasks one at a time + * @class + * @param {scope} context what this will resolve to in the tasks + */ +var Queue = function () { + function Queue(context) { + _classCallCheck(this, Queue); + + this._q = []; + this.context = context; + this.tick = _core.requestAnimationFrame; + this.running = false; + this.paused = false; + } + + /** + * Add an item to the queue + * @return {Promise} + */ + + + _createClass(Queue, [{ + key: "enqueue", + value: function enqueue() { + var deferred, promise; + var queued; + var task = [].shift.call(arguments); + var args = arguments; + + // Handle single args without context + // if(args && !Array.isArray(args)) { + // args = [args]; + // } + if (!task) { + throw new Error("No Task Provided"); + } + + if (typeof task === "function") { + + deferred = new _core.defer(); + promise = deferred.promise; + + queued = { + "task": task, + "args": args, + //"context" : context, + "deferred": deferred, + "promise": promise + }; + } else { + // Task is a promise + queued = { + "promise": task + }; + } + + this._q.push(queued); + + // Wait to start queue flush + if (this.paused == false && !this.running) { + // setTimeout(this.flush.bind(this), 0); + // this.tick.call(window, this.run.bind(this)); + this.run(); + } + + return queued.promise; + } + + /** + * Run one item + * @return {Promise} + */ + + }, { + key: "dequeue", + value: function dequeue() { + var inwait, task, result; + + if (this._q.length && !this.paused) { + inwait = this._q.shift(); + task = inwait.task; + if (task) { + // console.log(task) + + result = task.apply(this.context, inwait.args); + + if (result && typeof result["then"] === "function") { + // Task is a function that returns a promise + return result.then(function () { + inwait.deferred.resolve.apply(this.context, arguments); + }.bind(this), function () { + inwait.deferred.reject.apply(this.context, arguments); + }.bind(this)); + } else { + // Task resolves immediately + inwait.deferred.resolve.apply(this.context, result); + return inwait.promise; + } + } else if (inwait.promise) { + // Task is a promise + return inwait.promise; + } + } else { + inwait = new _core.defer(); + inwait.deferred.resolve(); + return inwait.promise; + } + } + + // Run All Immediately + + }, { + key: "dump", + value: function dump() { + while (this._q.length) { + this.dequeue(); + } + } + + /** + * Run all tasks sequentially, at convince + * @return {Promise} + */ + + }, { + key: "run", + value: function run() { + var _this = this; + + if (!this.running) { + this.running = true; + this.defered = new _core.defer(); + } + + this.tick.call(window, function () { + + if (_this._q.length) { + + _this.dequeue().then(function () { + this.run(); + }.bind(_this)); + } else { + _this.defered.resolve(); + _this.running = undefined; + } + }); + + // Unpause + if (this.paused == true) { + this.paused = false; + } + + return this.defered.promise; + } + + /** + * Flush all, as quickly as possible + * @return {Promise} + */ + + }, { + key: "flush", + value: function flush() { + + if (this.running) { + return this.running; + } + + if (this._q.length) { + this.running = this.dequeue().then(function () { + this.running = undefined; + return this.flush(); + }.bind(this)); + + return this.running; + } + } + + /** + * Clear all items in wait + */ + + }, { + key: "clear", + value: function clear() { + this._q = []; + } + + /** + * Get the number of tasks in the queue + * @return {number} tasks + */ + + }, { + key: "length", + value: function length() { + return this._q.length; + } + + /** + * Pause a running queue + */ + + }, { + key: "pause", + value: function pause() { + this.paused = true; + } + + /** + * End the queue + */ + + }, { + key: "stop", + value: function stop() { + this._q = []; + this.running = false; + this.paused = true; + } + }]); + + return Queue; +}(); + +/** + * Create a new task from a callback + * @class + * @private + * @param {function} task + * @param {array} args + * @param {scope} context + * @return {function} task + */ + + +var Task = function Task(task, args, context) { + _classCallCheck(this, Task); + + return function () { + var _this2 = this; + + var toApply = arguments || []; + + return new Promise(function (resolve, reject) { + var callback = function callback(value, err) { + if (!value && err) { + reject(err); + } else { + resolve(value); + } + }; + // Add the callback to the arguments list + toApply.push(callback); + + // Apply all arguments to the functions + task.apply(context || _this2, toApply); + }); + }; +}; + +exports.default = Queue; +exports.Task = Task; + +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +/* + From Zip.js, by Gildas Lormeau +edited down + */ + +var table = { + "application": { + "ecmascript": ["es", "ecma"], + "javascript": "js", + "ogg": "ogx", + "pdf": "pdf", + "postscript": ["ps", "ai", "eps", "epsi", "epsf", "eps2", "eps3"], + "rdf+xml": "rdf", + "smil": ["smi", "smil"], + "xhtml+xml": ["xhtml", "xht"], + "xml": ["xml", "xsl", "xsd", "opf", "ncx"], + "zip": "zip", + "x-httpd-eruby": "rhtml", + "x-latex": "latex", + "x-maker": ["frm", "maker", "frame", "fm", "fb", "book", "fbdoc"], + "x-object": "o", + "x-shockwave-flash": ["swf", "swfl"], + "x-silverlight": "scr", + "epub+zip": "epub", + "font-tdpfr": "pfr", + "inkml+xml": ["ink", "inkml"], + "json": "json", + "jsonml+json": "jsonml", + "mathml+xml": "mathml", + "metalink+xml": "metalink", + "mp4": "mp4s", + // "oebps-package+xml" : "opf", + "omdoc+xml": "omdoc", + "oxps": "oxps", + "vnd.amazon.ebook": "azw", + "widget": "wgt", + // "x-dtbncx+xml" : "ncx", + "x-dtbook+xml": "dtb", + "x-dtbresource+xml": "res", + "x-font-bdf": "bdf", + "x-font-ghostscript": "gsf", + "x-font-linux-psf": "psf", + "x-font-otf": "otf", + "x-font-pcf": "pcf", + "x-font-snf": "snf", + "x-font-ttf": ["ttf", "ttc"], + "x-font-type1": ["pfa", "pfb", "pfm", "afm"], + "x-font-woff": "woff", + "x-mobipocket-ebook": ["prc", "mobi"], + "x-mspublisher": "pub", + "x-nzb": "nzb", + "x-tgif": "obj", + "xaml+xml": "xaml", + "xml-dtd": "dtd", + "xproc+xml": "xpl", + "xslt+xml": "xslt", + "internet-property-stream": "acx", + "x-compress": "z", + "x-compressed": "tgz", + "x-gzip": "gz" + }, + "audio": { + "flac": "flac", + "midi": ["mid", "midi", "kar", "rmi"], + "mpeg": ["mpga", "mpega", "mp2", "mp3", "m4a", "mp2a", "m2a", "m3a"], + "mpegurl": "m3u", + "ogg": ["oga", "ogg", "spx"], + "x-aiff": ["aif", "aiff", "aifc"], + "x-ms-wma": "wma", + "x-wav": "wav", + "adpcm": "adp", + "mp4": "mp4a", + "webm": "weba", + "x-aac": "aac", + "x-caf": "caf", + "x-matroska": "mka", + "x-pn-realaudio-plugin": "rmp", + "xm": "xm", + "mid": ["mid", "rmi"] + }, + "image": { + "gif": "gif", + "ief": "ief", + "jpeg": ["jpeg", "jpg", "jpe"], + "pcx": "pcx", + "png": "png", + "svg+xml": ["svg", "svgz"], + "tiff": ["tiff", "tif"], + "x-icon": "ico", + "bmp": "bmp", + "webp": "webp", + "x-pict": ["pic", "pct"], + "x-tga": "tga", + "cis-cod": "cod" + }, + "text": { + "cache-manifest": ["manifest", "appcache"], + "css": "css", + "csv": "csv", + "html": ["html", "htm", "shtml", "stm"], + "mathml": "mml", + "plain": ["txt", "text", "brf", "conf", "def", "list", "log", "in", "bas"], + "richtext": "rtx", + "tab-separated-values": "tsv", + "x-bibtex": "bib" + }, + "video": { + "mpeg": ["mpeg", "mpg", "mpe", "m1v", "m2v", "mp2", "mpa", "mpv2"], + "mp4": ["mp4", "mp4v", "mpg4"], + "quicktime": ["qt", "mov"], + "ogg": "ogv", + "vnd.mpegurl": ["mxu", "m4u"], + "x-flv": "flv", + "x-la-asf": ["lsf", "lsx"], + "x-mng": "mng", + "x-ms-asf": ["asf", "asx", "asr"], + "x-ms-wm": "wm", + "x-ms-wmv": "wmv", + "x-ms-wmx": "wmx", + "x-ms-wvx": "wvx", + "x-msvideo": "avi", + "x-sgi-movie": "movie", + "x-matroska": ["mpv", "mkv", "mk3d", "mks"], + "3gpp2": "3g2", + "h261": "h261", + "h263": "h263", + "h264": "h264", + "jpeg": "jpgv", + "jpm": ["jpm", "jpgm"], + "mj2": ["mj2", "mjp2"], + "vnd.ms-playready.media.pyv": "pyv", + "vnd.uvvu.mp4": ["uvu", "uvvu"], + "vnd.vivo": "viv", + "webm": "webm", + "x-f4v": "f4v", + "x-m4v": "m4v", + "x-ms-vob": "vob", + "x-smv": "smv" + } +}; + +var mimeTypes = function () { + var type, + subtype, + val, + index, + mimeTypes = {}; + for (type in table) { + if (table.hasOwnProperty(type)) { + for (subtype in table[type]) { + if (table[type].hasOwnProperty(subtype)) { + val = table[type][subtype]; + if (typeof val == "string") { + mimeTypes[val] = type + "/" + subtype; + } else { + for (index = 0; index < val.length; index++) { + mimeTypes[val[index]] = type + "/" + subtype; + } + } + } + } + } + } + return mimeTypes; +}(); + +var defaultValue = "text/plain"; //"application/octet-stream"; + +function lookup(filename) { + return filename && mimeTypes[filename.split(".").pop().toLowerCase()] || defaultValue; +}; + +module.exports = { + 'lookup': lookup +}; + +/***/ }), +/* 14 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _eventEmitter = __webpack_require__(3); + +var _eventEmitter2 = _interopRequireDefault(_eventEmitter); + +var _core = __webpack_require__(0); + +var _epubcfi = __webpack_require__(1); + +var _epubcfi2 = _interopRequireDefault(_epubcfi); + +var _mapping = __webpack_require__(19); + +var _mapping2 = _interopRequireDefault(_mapping); + +var _replacements = __webpack_require__(8); + +var _constants = __webpack_require__(2); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +var hasNavigator = typeof navigator !== "undefined"; + +var isChrome = hasNavigator && /Chrome/.test(navigator.userAgent); +var isWebkit = hasNavigator && !isChrome && /AppleWebKit/.test(navigator.userAgent); + +var ELEMENT_NODE = 1; +var TEXT_NODE = 3; + +/** + * Handles DOM manipulation, queries and events for View contents + * @class + * @param {document} doc Document + * @param {element} content Parent Element (typically Body) + * @param {string} cfiBase Section component of CFIs + * @param {number} sectionIndex Index in Spine of Conntent's Section + */ + +var Contents = function () { + function Contents(doc, content, cfiBase, sectionIndex) { + _classCallCheck(this, Contents); + + // Blank Cfi for Parsing + this.epubcfi = new _epubcfi2.default(); + + this.document = doc; + this.documentElement = this.document.documentElement; + this.content = content || this.document.body; + this.window = this.document.defaultView; + + this._size = { + width: 0, + height: 0 + }; + + this.sectionIndex = sectionIndex || 0; + this.cfiBase = cfiBase || ""; + + this.epubReadingSystem("epub.js", _constants.EPUBJS_VERSION); + + this.listeners(); + } + + /** + * Get DOM events that are listened for and passed along + */ + + + _createClass(Contents, [{ + key: "width", + + + /** + * Get or Set width + * @param {number} [w] + * @returns {number} width + */ + value: function width(w) { + // var frame = this.documentElement; + var frame = this.content; + + if (w && (0, _core.isNumber)(w)) { + w = w + "px"; + } + + if (w) { + frame.style.width = w; + // this.content.style.width = w; + } + + return this.window.getComputedStyle(frame)["width"]; + } + + /** + * Get or Set height + * @param {number} [h] + * @returns {number} height + */ + + }, { + key: "height", + value: function height(h) { + // var frame = this.documentElement; + var frame = this.content; + + if (h && (0, _core.isNumber)(h)) { + h = h + "px"; + } + + if (h) { + frame.style.height = h; + // this.content.style.height = h; + } + + return this.window.getComputedStyle(frame)["height"]; + } + + /** + * Get or Set width of the contents + * @param {number} [w] + * @returns {number} width + */ + + }, { + key: "contentWidth", + value: function contentWidth(w) { + + var content = this.content || this.document.body; + + if (w && (0, _core.isNumber)(w)) { + w = w + "px"; + } + + if (w) { + content.style.width = w; + } + + return this.window.getComputedStyle(content)["width"]; + } + + /** + * Get or Set height of the contents + * @param {number} [h] + * @returns {number} height + */ + + }, { + key: "contentHeight", + value: function contentHeight(h) { + + var content = this.content || this.document.body; + + if (h && (0, _core.isNumber)(h)) { + h = h + "px"; + } + + if (h) { + content.style.height = h; + } + + return this.window.getComputedStyle(content)["height"]; + } + + /** + * Get the width of the text using Range + * @returns {number} width + */ + + }, { + key: "textWidth", + value: function textWidth() { + var rect = void 0; + var width = void 0; + var range = this.document.createRange(); + var content = this.content || this.document.body; + var border = (0, _core.borders)(content); + + // Select the contents of frame + range.selectNodeContents(content); + + // get the width of the text content + rect = range.getBoundingClientRect(); + width = rect.width; + + if (border && border.width) { + width += border.width; + } + + return Math.round(width); + } + + /** + * Get the height of the text using Range + * @returns {number} height + */ + + }, { + key: "textHeight", + value: function textHeight() { + var rect = void 0; + var height = void 0; + var range = this.document.createRange(); + var content = this.content || this.document.body; + var border = (0, _core.borders)(content); + + range.selectNodeContents(content); + + rect = range.getBoundingClientRect(); + height = rect.height; + + if (height && border.height) { + height += border.height; + } + + if (height && rect.top) { + height += rect.top; + } + + return Math.round(height); + } + + /** + * Get documentElement scrollWidth + * @returns {number} width + */ + + }, { + key: "scrollWidth", + value: function scrollWidth() { + var width = this.documentElement.scrollWidth; + + return width; + } + + /** + * Get documentElement scrollHeight + * @returns {number} height + */ + + }, { + key: "scrollHeight", + value: function scrollHeight() { + var height = this.documentElement.scrollHeight; + + return height; + } + + /** + * Set overflow css style of the contents + * @param {string} [overflow] + */ + + }, { + key: "overflow", + value: function overflow(_overflow) { + + if (_overflow) { + this.documentElement.style.overflow = _overflow; + } + + return this.window.getComputedStyle(this.documentElement)["overflow"]; + } + + /** + * Set overflowX css style of the documentElement + * @param {string} [overflow] + */ + + }, { + key: "overflowX", + value: function overflowX(overflow) { + + if (overflow) { + this.documentElement.style.overflowX = overflow; + } + + return this.window.getComputedStyle(this.documentElement)["overflowX"]; + } + + /** + * Set overflowY css style of the documentElement + * @param {string} [overflow] + */ + + }, { + key: "overflowY", + value: function overflowY(overflow) { + + if (overflow) { + this.documentElement.style.overflowY = overflow; + } + + return this.window.getComputedStyle(this.documentElement)["overflowY"]; + } + + /** + * Set Css styles on the contents element (typically Body) + * @param {string} property + * @param {string} value + * @param {boolean} [priority] set as "important" + */ + + }, { + key: "css", + value: function css(property, value, priority) { + var content = this.content || this.document.body; + + if (value) { + content.style.setProperty(property, value, priority ? "important" : ""); + } + + return this.window.getComputedStyle(content)[property]; + } + + /** + * Get or Set the viewport element + * @param {object} [options] + * @param {string} [options.width] + * @param {string} [options.height] + * @param {string} [options.scale] + * @param {string} [options.minimum] + * @param {string} [options.maximum] + * @param {string} [options.scalable] + */ + + }, { + key: "viewport", + value: function viewport(options) { + var _width, _height, _scale, _minimum, _maximum, _scalable; + // var width, height, scale, minimum, maximum, scalable; + var $viewport = this.document.querySelector("meta[name='viewport']"); + var parsed = { + "width": undefined, + "height": undefined, + "scale": undefined, + "minimum": undefined, + "maximum": undefined, + "scalable": undefined + }; + var newContent = []; + var settings = {}; + + /* + * check for the viewport size + * + */ + if ($viewport && $viewport.hasAttribute("content")) { + var content = $viewport.getAttribute("content"); + var _width2 = content.match(/width\s*=\s*([^,]*)/); + var _height2 = content.match(/height\s*=\s*([^,]*)/); + var _scale2 = content.match(/initial-scale\s*=\s*([^,]*)/); + var _minimum2 = content.match(/minimum-scale\s*=\s*([^,]*)/); + var _maximum2 = content.match(/maximum-scale\s*=\s*([^,]*)/); + var _scalable2 = content.match(/user-scalable\s*=\s*([^,]*)/); + + if (_width2 && _width2.length && typeof _width2[1] !== "undefined") { + parsed.width = _width2[1]; + } + if (_height2 && _height2.length && typeof _height2[1] !== "undefined") { + parsed.height = _height2[1]; + } + if (_scale2 && _scale2.length && typeof _scale2[1] !== "undefined") { + parsed.scale = _scale2[1]; + } + if (_minimum2 && _minimum2.length && typeof _minimum2[1] !== "undefined") { + parsed.minimum = _minimum2[1]; + } + if (_maximum2 && _maximum2.length && typeof _maximum2[1] !== "undefined") { + parsed.maximum = _maximum2[1]; + } + if (_scalable2 && _scalable2.length && typeof _scalable2[1] !== "undefined") { + parsed.scalable = _scalable2[1]; + } + } + + settings = (0, _core.defaults)(options || {}, parsed); + + if (options) { + if (settings.width) { + newContent.push("width=" + settings.width); + } + + if (settings.height) { + newContent.push("height=" + settings.height); + } + + if (settings.scale) { + newContent.push("initial-scale=" + settings.scale); + } + + if (settings.scalable === "no") { + newContent.push("minimum-scale=" + settings.scale); + newContent.push("maximum-scale=" + settings.scale); + newContent.push("user-scalable=" + settings.scalable); + } else { + + if (settings.scalable) { + newContent.push("user-scalable=" + settings.scalable); + } + + if (settings.minimum) { + newContent.push("minimum-scale=" + settings.minimum); + } + + if (settings.maximum) { + newContent.push("minimum-scale=" + settings.maximum); + } + } + + if (!$viewport) { + $viewport = this.document.createElement("meta"); + $viewport.setAttribute("name", "viewport"); + this.document.querySelector("head").appendChild($viewport); + } + + $viewport.setAttribute("content", newContent.join(", ")); + + this.window.scrollTo(0, 0); + } + + return settings; + } + + /** + * Event emitter for when the contents has expanded + * @private + */ + + }, { + key: "expand", + value: function expand() { + this.emit(_constants.EVENTS.CONTENTS.EXPAND); + } + + /** + * Add DOM listeners + * @private + */ + + }, { + key: "listeners", + value: function listeners() { + + this.imageLoadListeners(); + + this.mediaQueryListeners(); + + // this.fontLoadListeners(); + + this.addEventListeners(); + + this.addSelectionListeners(); + + // this.transitionListeners(); + + this.resizeListeners(); + + // this.resizeObservers(); + + this.linksHandler(); + } + + /** + * Remove DOM listeners + * @private + */ + + }, { + key: "removeListeners", + value: function removeListeners() { + + this.removeEventListeners(); + + this.removeSelectionListeners(); + + clearTimeout(this.expanding); + } + + /** + * Check if size of contents has changed and + * emit 'resize' event if it has. + * @private + */ + + }, { + key: "resizeCheck", + value: function resizeCheck() { + var width = this.textWidth(); + var height = this.textHeight(); + + if (width != this._size.width || height != this._size.height) { + + this._size = { + width: width, + height: height + }; + + this.onResize && this.onResize(this._size); + this.emit(_constants.EVENTS.CONTENTS.RESIZE, this._size); + } + } + + /** + * Poll for resize detection + * @private + */ + + }, { + key: "resizeListeners", + value: function resizeListeners() { + var width, height; + // Test size again + clearTimeout(this.expanding); + + requestAnimationFrame(this.resizeCheck.bind(this)); + this.expanding = setTimeout(this.resizeListeners.bind(this), 350); + } + + /** + * Use css transitions to detect resize + * @private + */ + + }, { + key: "transitionListeners", + value: function transitionListeners() { + var body = this.content; + + body.style['transitionProperty'] = "font, font-size, font-size-adjust, font-stretch, font-variation-settings, font-weight, width, height"; + body.style['transitionDuration'] = "0.001ms"; + body.style['transitionTimingFunction'] = "linear"; + body.style['transitionDelay'] = "0"; + + this._resizeCheck = this.resizeCheck.bind(this); + this.document.addEventListener('transitionend', this._resizeCheck); + } + + /** + * Listen for media query changes and emit 'expand' event + * Adapted from: https://github.com/tylergaw/media-query-events/blob/master/js/mq-events.js + * @private + */ + + }, { + key: "mediaQueryListeners", + value: function mediaQueryListeners() { + var sheets = this.document.styleSheets; + var mediaChangeHandler = function (m) { + if (m.matches && !this._expanding) { + setTimeout(this.expand.bind(this), 1); + } + }.bind(this); + + for (var i = 0; i < sheets.length; i += 1) { + var rules; + // Firefox errors if we access cssRules cross-domain + try { + rules = sheets[i].cssRules; + } catch (e) { + return; + } + if (!rules) return; // Stylesheets changed + for (var j = 0; j < rules.length; j += 1) { + //if (rules[j].constructor === CSSMediaRule) { + if (rules[j].media) { + var mql = this.window.matchMedia(rules[j].media.mediaText); + mql.addListener(mediaChangeHandler); + //mql.onchange = mediaChangeHandler; + } + } + } + } + + /** + * Use MutationObserver to listen for changes in the DOM and check for resize + * @private + */ + + }, { + key: "resizeObservers", + value: function resizeObservers() { + var _this = this; + + // create an observer instance + this.observer = new MutationObserver(function (mutations) { + _this.resizeCheck(); + }); + + // configuration of the observer: + var config = { attributes: true, childList: true, characterData: true, subtree: true }; + + // pass in the target node, as well as the observer options + this.observer.observe(this.document, config); + } + + /** + * Test if images are loaded or add listener for when they load + * @private + */ + + }, { + key: "imageLoadListeners", + value: function imageLoadListeners() { + var images = this.document.querySelectorAll("img"); + var img; + for (var i = 0; i < images.length; i++) { + img = images[i]; + + if (typeof img.naturalWidth !== "undefined" && img.naturalWidth === 0) { + img.onload = this.expand.bind(this); + } + } + } + + /** + * Listen for font load and check for resize when loaded + * @private + */ + + }, { + key: "fontLoadListeners", + value: function fontLoadListeners() { + if (!this.document || !this.document.fonts) { + return; + } + + this.document.fonts.ready.then(function () { + this.resizeCheck(); + }.bind(this)); + } + + /** + * Get the documentElement + * @returns {element} documentElement + */ + + }, { + key: "root", + value: function root() { + if (!this.document) return null; + return this.document.documentElement; + } + + /** + * Get the location offset of a EpubCFI or an #id + * @param {string | EpubCFI} target + * @param {string} [ignoreClass] for the cfi + * @returns { {left: Number, top: Number } + */ + + }, { + key: "locationOf", + value: function locationOf(target, ignoreClass) { + var position; + var targetPos = { "left": 0, "top": 0 }; + + if (!this.document) return targetPos; + + if (this.epubcfi.isCfiString(target)) { + var range = new _epubcfi2.default(target).toRange(this.document, ignoreClass); + + if (range) { + if (range.startContainer.nodeType === Node.ELEMENT_NODE) { + position = range.startContainer.getBoundingClientRect(); + targetPos.left = position.left; + targetPos.top = position.top; + } else { + // Webkit does not handle collapsed range bounds correctly + // https://bugs.webkit.org/show_bug.cgi?id=138949 + + // Construct a new non-collapsed range + if (isWebkit) { + var container = range.startContainer; + var newRange = new Range(); + try { + if (container.nodeType === ELEMENT_NODE) { + position = container.getBoundingClientRect(); + } else if (range.startOffset + 2 < container.length) { + newRange.setStart(container, range.startOffset); + newRange.setEnd(container, range.startOffset + 2); + position = newRange.getBoundingClientRect(); + } else if (range.startOffset - 2 > 0) { + newRange.setStart(container, range.startOffset - 2); + newRange.setEnd(container, range.startOffset); + position = newRange.getBoundingClientRect(); + } else { + // empty, return the parent element + position = container.parentNode.getBoundingClientRect(); + } + } catch (e) { + console.error(e, e.stack); + } + } else { + position = range.getBoundingClientRect(); + } + } + } + } else if (typeof target === "string" && target.indexOf("#") > -1) { + + var id = target.substring(target.indexOf("#") + 1); + var el = this.document.getElementById(id); + if (el) { + if (isWebkit) { + // Webkit reports incorrect bounding rects in Columns + var _newRange = new Range(); + _newRange.selectNode(el); + position = _newRange.getBoundingClientRect(); + } else { + position = el.getBoundingClientRect(); + } + } + } + + if (position) { + targetPos.left = position.left; + targetPos.top = position.top; + } + + return targetPos; + } + + /** + * Append a stylesheet link to the document head + * @param {string} src url + */ + + }, { + key: "addStylesheet", + value: function addStylesheet(src) { + return new Promise(function (resolve, reject) { + var $stylesheet; + var ready = false; + + if (!this.document) { + resolve(false); + return; + } + + // Check if link already exists + $stylesheet = this.document.querySelector("link[href='" + src + "']"); + if ($stylesheet) { + resolve(true); + return; // already present + } + + $stylesheet = this.document.createElement("link"); + $stylesheet.type = "text/css"; + $stylesheet.rel = "stylesheet"; + $stylesheet.href = src; + $stylesheet.onload = $stylesheet.onreadystatechange = function () { + if (!ready && (!this.readyState || this.readyState == "complete")) { + ready = true; + // Let apply + setTimeout(function () { + resolve(true); + }, 1); + } + }; + + this.document.head.appendChild($stylesheet); + }.bind(this)); + } + + /** + * Append stylesheet rules to a generate stylesheet + * Array: https://developer.mozilla.org/en-US/docs/Web/API/CSSStyleSheet/insertRule + * Object: https://github.com/desirable-objects/json-to-css + * @param {array | object} rules + */ + + }, { + key: "addStylesheetRules", + value: function addStylesheetRules(rules) { + var styleEl; + var styleSheet; + var key = "epubjs-inserted-css"; + + if (!this.document || !rules || rules.length === 0) return; + + // Check if link already exists + styleEl = this.document.getElementById("#" + key); + if (!styleEl) { + styleEl = this.document.createElement("style"); + styleEl.id = key; + } + + // Append style element to head + this.document.head.appendChild(styleEl); + + // Grab style sheet + styleSheet = styleEl.sheet; + + if (Object.prototype.toString.call(rules) === "[object Array]") { + for (var i = 0, rl = rules.length; i < rl; i++) { + var j = 1, + rule = rules[i], + selector = rules[i][0], + propStr = ""; + // If the second argument of a rule is an array of arrays, correct our variables. + if (Object.prototype.toString.call(rule[1][0]) === "[object Array]") { + rule = rule[1]; + j = 0; + } + + for (var pl = rule.length; j < pl; j++) { + var prop = rule[j]; + propStr += prop[0] + ":" + prop[1] + (prop[2] ? " !important" : "") + ";\n"; + } + + // Insert CSS Rule + styleSheet.insertRule(selector + "{" + propStr + "}", styleSheet.cssRules.length); + } + } else { + var selectors = Object.keys(rules); + selectors.forEach(function (selector) { + var definition = rules[selector]; + if (Array.isArray(definition)) { + definition.forEach(function (item) { + var _rules = Object.keys(item); + var result = _rules.map(function (rule) { + return rule + ":" + item[rule]; + }).join(';'); + styleSheet.insertRule(selector + "{" + result + "}", styleSheet.cssRules.length); + }); + } else { + var _rules = Object.keys(definition); + var result = _rules.map(function (rule) { + return rule + ":" + definition[rule]; + }).join(';'); + styleSheet.insertRule(selector + "{" + result + "}", styleSheet.cssRules.length); + } + }); + } + } + + /** + * Append a script tag to the document head + * @param {string} src url + * @returns {Promise} loaded + */ + + }, { + key: "addScript", + value: function addScript(src) { + + return new Promise(function (resolve, reject) { + var $script; + var ready = false; + + if (!this.document) { + resolve(false); + return; + } + + $script = this.document.createElement("script"); + $script.type = "text/javascript"; + $script.async = true; + $script.src = src; + $script.onload = $script.onreadystatechange = function () { + if (!ready && (!this.readyState || this.readyState == "complete")) { + ready = true; + setTimeout(function () { + resolve(true); + }, 1); + } + }; + + this.document.head.appendChild($script); + }.bind(this)); + } + + /** + * Add a class to the contents container + * @param {string} className + */ + + }, { + key: "addClass", + value: function addClass(className) { + var content; + + if (!this.document) return; + + content = this.content || this.document.body; + + if (content) { + content.classList.add(className); + } + } + + /** + * Remove a class from the contents container + * @param {string} removeClass + */ + + }, { + key: "removeClass", + value: function removeClass(className) { + var content; + + if (!this.document) return; + + content = this.content || this.document.body; + + if (content) { + content.classList.remove(className); + } + } + + /** + * Add DOM event listeners + * @private + */ + + }, { + key: "addEventListeners", + value: function addEventListeners() { + if (!this.document) { + return; + } + + this._triggerEvent = this.triggerEvent.bind(this); + + _constants.DOM_EVENTS.forEach(function (eventName) { + this.document.addEventListener(eventName, this._triggerEvent, { passive: true }); + }, this); + } + + /** + * Remove DOM event listeners + * @private + */ + + }, { + key: "removeEventListeners", + value: function removeEventListeners() { + if (!this.document) { + return; + } + _constants.DOM_EVENTS.forEach(function (eventName) { + this.document.removeEventListener(eventName, this._triggerEvent, { passive: true }); + }, this); + this._triggerEvent = undefined; + } + + /** + * Emit passed browser events + * @private + */ + + }, { + key: "triggerEvent", + value: function triggerEvent(e) { + this.emit(e.type, e); + } + + /** + * Add listener for text selection + * @private + */ + + }, { + key: "addSelectionListeners", + value: function addSelectionListeners() { + if (!this.document) { + return; + } + this._onSelectionChange = this.onSelectionChange.bind(this); + this.document.addEventListener("selectionchange", this._onSelectionChange, { passive: true }); + } + + /** + * Remove listener for text selection + * @private + */ + + }, { + key: "removeSelectionListeners", + value: function removeSelectionListeners() { + if (!this.document) { + return; + } + this.document.removeEventListener("selectionchange", this._onSelectionChange, { passive: true }); + this._onSelectionChange = undefined; + } + + /** + * Handle getting text on selection + * @private + */ + + }, { + key: "onSelectionChange", + value: function onSelectionChange(e) { + if (this.selectionEndTimeout) { + clearTimeout(this.selectionEndTimeout); + } + this.selectionEndTimeout = setTimeout(function () { + var selection = this.window.getSelection(); + this.triggerSelectedEvent(selection); + }.bind(this), 250); + } + + /** + * Emit event on text selection + * @private + */ + + }, { + key: "triggerSelectedEvent", + value: function triggerSelectedEvent(selection) { + var range, cfirange; + + if (selection && selection.rangeCount > 0) { + range = selection.getRangeAt(0); + if (!range.collapsed) { + // cfirange = this.section.cfiFromRange(range); + cfirange = new _epubcfi2.default(range, this.cfiBase).toString(); + this.emit(_constants.EVENTS.CONTENTS.SELECTED, cfirange); + this.emit(_constants.EVENTS.CONTENTS.SELECTED_RANGE, range); + } + } + } + + /** + * Get a Dom Range from EpubCFI + * @param {EpubCFI} _cfi + * @param {string} [ignoreClass] + * @returns {Range} range + */ + + }, { + key: "range", + value: function range(_cfi, ignoreClass) { + var cfi = new _epubcfi2.default(_cfi); + return cfi.toRange(this.document, ignoreClass); + } + + /** + * Get an EpubCFI from a Dom Range + * @param {Range} range + * @param {string} [ignoreClass] + * @returns {EpubCFI} cfi + */ + + }, { + key: "cfiFromRange", + value: function cfiFromRange(range, ignoreClass) { + return new _epubcfi2.default(range, this.cfiBase, ignoreClass).toString(); + } + + /** + * Get an EpubCFI from a Dom node + * @param {node} node + * @param {string} [ignoreClass] + * @returns {EpubCFI} cfi + */ + + }, { + key: "cfiFromNode", + value: function cfiFromNode(node, ignoreClass) { + return new _epubcfi2.default(node, this.cfiBase, ignoreClass).toString(); + } + + // TODO: find where this is used - remove? + + }, { + key: "map", + value: function map(layout) { + var map = new _mapping2.default(layout); + return map.section(); + } + + /** + * Size the contents to a given width and height + * @param {number} [width] + * @param {number} [height] + */ + + }, { + key: "size", + value: function size(width, height) { + var viewport = { scale: 1.0, scalable: "no" }; + + this.layoutStyle("scrolling"); + + if (width >= 0) { + this.width(width); + viewport.width = width; + this.css("padding", "0 " + width / 12 + "px"); + } + + if (height >= 0) { + this.height(height); + viewport.height = height; + } + + this.css("margin", "0"); + this.css("box-sizing", "border-box"); + + this.viewport(viewport); + } + + /** + * Apply columns to the contents for pagination + * @param {number} width + * @param {number} height + * @param {number} columnWidth + * @param {number} gap + */ + + }, { + key: "columns", + value: function columns(width, height, columnWidth, gap) { + var COLUMN_AXIS = (0, _core.prefixed)("column-axis"); + var COLUMN_GAP = (0, _core.prefixed)("column-gap"); + var COLUMN_WIDTH = (0, _core.prefixed)("column-width"); + var COLUMN_FILL = (0, _core.prefixed)("column-fill"); + + var writingMode = this.writingMode(); + var axis = writingMode.indexOf("vertical") === 0 ? "vertical" : "horizontal"; + + this.layoutStyle("paginated"); + + // Fix body width issues if rtl is only set on body element + if (this.content.dir === "rtl") { + this.direction("rtl"); + } + + this.width(width); + this.height(height); + + // Deal with Mobile trying to scale to viewport + this.viewport({ width: width, height: height, scale: 1.0, scalable: "no" }); + + // TODO: inline-block needs more testing + // Fixes Safari column cut offs, but causes RTL issues + // this.css("display", "inline-block"); + + this.css("overflow-y", "hidden"); + this.css("margin", "0", true); + + if (axis === "vertical") { + this.css("padding-top", gap / 2 + "px", true); + this.css("padding-bottom", gap / 2 + "px", true); + this.css("padding-left", "20px"); + this.css("padding-right", "20px"); + } else { + this.css("padding-top", "20px"); + this.css("padding-bottom", "20px"); + this.css("padding-left", gap / 2 + "px", true); + this.css("padding-right", gap / 2 + "px", true); + } + + this.css("box-sizing", "border-box"); + this.css("max-width", "inherit"); + + this.css(COLUMN_AXIS, "horizontal"); + this.css(COLUMN_FILL, "auto"); + + this.css(COLUMN_GAP, gap + "px"); + this.css(COLUMN_WIDTH, columnWidth + "px"); + } + + /** + * Scale contents from center + * @param {number} scale + * @param {number} offsetX + * @param {number} offsetY + */ + + }, { + key: "scaler", + value: function scaler(scale, offsetX, offsetY) { + var scaleStr = "scale(" + scale + ")"; + var translateStr = ""; + // this.css("position", "absolute")); + this.css("transform-origin", "top left"); + + if (offsetX >= 0 || offsetY >= 0) { + translateStr = " translate(" + (offsetX || 0) + "px, " + (offsetY || 0) + "px )"; + } + + this.css("transform", scaleStr + translateStr); + } + + /** + * Fit contents into a fixed width and height + * @param {number} width + * @param {number} height + */ + + }, { + key: "fit", + value: function fit(width, height) { + var viewport = this.viewport(); + var viewportWidth = parseInt(viewport.width); + var viewportHeight = parseInt(viewport.height); + var widthScale = width / viewportWidth; + var heightScale = height / viewportHeight; + var scale = widthScale < heightScale ? widthScale : heightScale; + + // the translate does not work as intended, elements can end up unaligned + // var offsetY = (height - (viewportHeight * scale)) / 2; + // var offsetX = 0; + // if (this.sectionIndex % 2 === 1) { + // offsetX = width - (viewportWidth * scale); + // } + + this.layoutStyle("paginated"); + + // scale needs width and height to be set + this.width(viewportWidth); + this.height(viewportHeight); + this.overflow("hidden"); + + // Scale to the correct size + this.scaler(scale, 0, 0); + // this.scaler(scale, offsetX > 0 ? offsetX : 0, offsetY); + + // background images are not scaled by transform + this.css("background-size", viewportWidth * scale + "px " + viewportHeight * scale + "px"); + + this.css("background-color", "transparent"); + } + + /** + * Set the direction of the text + * @param {string} [dir="ltr"] "rtl" | "ltr" + */ + + }, { + key: "direction", + value: function direction(dir) { + if (this.documentElement) { + this.documentElement.style["direction"] = dir; + } + } + }, { + key: "mapPage", + value: function mapPage(cfiBase, layout, start, end, dev) { + var mapping = new _mapping2.default(layout, dev); + + return mapping.page(this, cfiBase, start, end); + } + + /** + * Emit event when link in content is clicked + * @private + */ + + }, { + key: "linksHandler", + value: function linksHandler() { + var _this2 = this; + + (0, _replacements.replaceLinks)(this.content, function (href) { + _this2.emit(_constants.EVENTS.CONTENTS.LINK_CLICKED, href); + }); + } + + /** + * Set the writingMode of the text + * @param {string} [mode="horizontal-tb"] "horizontal-tb" | "vertical-rl" | "vertical-lr" + */ + + }, { + key: "writingMode", + value: function writingMode(mode) { + var WRITING_MODE = (0, _core.prefixed)("writing-mode"); + + if (mode && this.documentElement) { + this.documentElement.style[WRITING_MODE] = mode; + } + + return this.window.getComputedStyle(this.documentElement)[WRITING_MODE] || ''; + } + + /** + * Set the layoutStyle of the content + * @param {string} [style="paginated"] "scrolling" | "paginated" + * @private + */ + + }, { + key: "layoutStyle", + value: function layoutStyle(style) { + + if (style) { + this._layoutStyle = style; + navigator.epubReadingSystem.layoutStyle = this._layoutStyle; + } + + return this._layoutStyle || "paginated"; + } + + /** + * Add the epubReadingSystem object to the navigator + * @param {string} name + * @param {string} version + * @private + */ + + }, { + key: "epubReadingSystem", + value: function epubReadingSystem(name, version) { + navigator.epubReadingSystem = { + name: name, + version: version, + layoutStyle: this.layoutStyle(), + hasFeature: function hasFeature(feature) { + switch (feature) { + case "dom-manipulation": + return true; + case "layout-changes": + return true; + case "touch-events": + return true; + case "mouse-events": + return true; + case "keyboard-events": + return true; + case "spine-scripting": + return false; + default: + return false; + } + } + }; + return navigator.epubReadingSystem; + } + }, { + key: "destroy", + value: function destroy() { + // Stop observing + if (this.observer) { + this.observer.disconnect(); + } + + this.document.removeEventListener('transitionend', this._resizeCheck); + + this.removeListeners(); + } + }], [{ + key: "listenedEvents", + get: function get() { + return _constants.DOM_EVENTS; + } + }]); + + return Contents; +}(); + +(0, _eventEmitter2.default)(Contents.prototype); + +exports.default = Contents; +module.exports = exports["default"]; + +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _eventEmitter = __webpack_require__(3); + +var _eventEmitter2 = _interopRequireDefault(_eventEmitter); + +var _core = __webpack_require__(0); + +var _mapping = __webpack_require__(19); + +var _mapping2 = _interopRequireDefault(_mapping); + +var _queue = __webpack_require__(12); + +var _queue2 = _interopRequireDefault(_queue); + +var _stage = __webpack_require__(59); + +var _stage2 = _interopRequireDefault(_stage); + +var _views = __webpack_require__(69); + +var _views2 = _interopRequireDefault(_views); + +var _constants = __webpack_require__(2); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +var DefaultViewManager = function () { + function DefaultViewManager(options) { + _classCallCheck(this, DefaultViewManager); + + this.name = "default"; + this.optsSettings = options.settings; + this.View = options.view; + this.request = options.request; + this.renditionQueue = options.queue; + this.q = new _queue2.default(this); + + this.settings = (0, _core.extend)(this.settings || {}, { + infinite: true, + hidden: false, + width: undefined, + height: undefined, + axis: undefined, + flow: "scrolled", + ignoreClass: "", + fullsize: undefined + }); + + (0, _core.extend)(this.settings, options.settings || {}); + + this.viewSettings = { + ignoreClass: this.settings.ignoreClass, + axis: this.settings.axis, + flow: this.settings.flow, + layout: this.layout, + method: this.settings.method, // srcdoc, blobUrl, write + width: 0, + height: 0, + forceEvenPages: true + }; + + this.rendered = false; + } + + _createClass(DefaultViewManager, [{ + key: "render", + value: function render(element, size) { + var tag = element.tagName; + + if (typeof this.settings.fullsize === "undefined" && tag && (tag.toLowerCase() == "body" || tag.toLowerCase() == "html")) { + this.settings.fullsize = true; + } + + if (this.settings.fullsize) { + this.settings.overflow = "visible"; + this.overflow = this.settings.overflow; + } + + this.settings.size = size; + + // Save the stage + this.stage = new _stage2.default({ + width: size.width, + height: size.height, + overflow: this.overflow, + hidden: this.settings.hidden, + axis: this.settings.axis, + fullsize: this.settings.fullsize, + direction: this.settings.direction + }); + + this.stage.attachTo(element); + + // Get this stage container div + this.container = this.stage.getContainer(); + + // Views array methods + this.views = new _views2.default(this.container); + + // Calculate Stage Size + this._bounds = this.bounds(); + this._stageSize = this.stage.size(); + + // Set the dimensions for views + this.viewSettings.width = this._stageSize.width; + this.viewSettings.height = this._stageSize.height; + + // Function to handle a resize event. + // Will only attach if width and height are both fixed. + this.stage.onResize(this.onResized.bind(this)); + + this.stage.onOrientationChange(this.onOrientationChange.bind(this)); + + // Add Event Listeners + this.addEventListeners(); + + // Add Layout method + // this.applyLayoutMethod(); + if (this.layout) { + this.updateLayout(); + } + + this.rendered = true; + } + }, { + key: "addEventListeners", + value: function addEventListeners() { + var scroller; + + window.addEventListener("unload", function (e) { + this.destroy(); + }.bind(this)); + + if (!this.settings.fullsize) { + scroller = this.container; + } else { + scroller = window; + } + + this._onScroll = this.onScroll.bind(this); + scroller.addEventListener("scroll", this._onScroll); + } + }, { + key: "removeEventListeners", + value: function removeEventListeners() { + var scroller; + + if (!this.settings.fullsize) { + scroller = this.container; + } else { + scroller = window; + } + + scroller.removeEventListener("scroll", this._onScroll); + this._onScroll = undefined; + } + }, { + key: "destroy", + value: function destroy() { + clearTimeout(this.orientationTimeout); + clearTimeout(this.resizeTimeout); + clearTimeout(this.afterScrolled); + + this.clear(); + + this.removeEventListeners(); + + this.stage.destroy(); + + this.rendered = false; + + /* + clearTimeout(this.trimTimeout); + if(this.settings.hidden) { + this.element.removeChild(this.wrapper); + } else { + this.element.removeChild(this.container); + } + */ + } + }, { + key: "onOrientationChange", + value: function onOrientationChange(e) { + var _window = window, + orientation = _window.orientation; + + + if (this.optsSettings.resizeOnOrientationChange) { + this.resize(); + } + + // Per ampproject: + // In IOS 10.3, the measured size of an element is incorrect if the + // element size depends on window size directly and the measurement + // happens in window.resize event. Adding a timeout for correct + // measurement. See https://github.com/ampproject/amphtml/issues/8479 + clearTimeout(this.orientationTimeout); + this.orientationTimeout = setTimeout(function () { + this.orientationTimeout = undefined; + + if (this.optsSettings.resizeOnOrientationChange) { + this.resize(); + } + + this.emit(_constants.EVENTS.MANAGERS.ORIENTATION_CHANGE, orientation); + }.bind(this), 500); + } + }, { + key: "onResized", + value: function onResized(e) { + this.resize(); + } + }, { + key: "resize", + value: function resize(width, height) { + var stageSize = this.stage.size(width, height); + + // For Safari, wait for orientation to catch up + // if the window is a square + this.winBounds = (0, _core.windowBounds)(); + if (this.orientationTimeout && this.winBounds.width === this.winBounds.height) { + // reset the stage size for next resize + this._stageSize = undefined; + return; + } + + if (this._stageSize && this._stageSize.width === stageSize.width && this._stageSize.height === stageSize.height) { + // Size is the same, no need to resize + return; + } + + this._stageSize = stageSize; + + this._bounds = this.bounds(); + + // Clear current views + this.clear(); + + // Update for new views + this.viewSettings.width = this._stageSize.width; + this.viewSettings.height = this._stageSize.height; + + this.updateLayout(); + + this.emit(_constants.EVENTS.MANAGERS.RESIZED, { + width: this._stageSize.width, + height: this._stageSize.height + }); + } + }, { + key: "createView", + value: function createView(section) { + return new this.View(section, this.viewSettings); + } + }, { + key: "display", + value: function display(section, target) { + + var displaying = new _core.defer(); + var displayed = displaying.promise; + + // Check if moving to target is needed + if (target === section.href || (0, _core.isNumber)(target)) { + target = undefined; + } + + // Check to make sure the section we want isn't already shown + var visible = this.views.find(section); + + // View is already shown, just move to correct location in view + if (visible && section) { + var offset = visible.offset(); + + if (this.settings.direction === "ltr") { + this.scrollTo(offset.left, offset.top, true); + } else { + var width = visible.width(); + this.scrollTo(offset.left + width, offset.top, true); + } + + if (target) { + var _offset = visible.locationOf(target); + this.moveTo(_offset); + } + + displaying.resolve(); + return displayed; + } + + // Hide all current views + this.clear(); + + this.add(section).then(function (view) { + + // Move to correct place within the section, if needed + if (target) { + var _offset2 = view.locationOf(target); + this.moveTo(_offset2); + } + }.bind(this), function (err) { + displaying.reject(err); + }).then(function () { + var next; + if (this.layout.name === "pre-paginated" && this.layout.divisor > 1 && section.index > 0) { + // First page (cover) should stand alone for pre-paginated books + next = section.next(); + if (next) { + return this.add(next); + } + } + }.bind(this)).then(function () { + + this.views.show(); + + displaying.resolve(); + }.bind(this)); + // .then(function(){ + // return this.hooks.display.trigger(view); + // }.bind(this)) + // .then(function(){ + // this.views.show(); + // }.bind(this)); + return displayed; + } + }, { + key: "afterDisplayed", + value: function afterDisplayed(view) { + this.emit(_constants.EVENTS.MANAGERS.ADDED, view); + } + }, { + key: "afterResized", + value: function afterResized(view) { + this.emit(_constants.EVENTS.MANAGERS.RESIZE, view.section); + } + }, { + key: "moveTo", + value: function moveTo(offset) { + var distX = 0, + distY = 0; + + if (!this.isPaginated) { + distY = offset.top; + } else { + distX = Math.floor(offset.left / this.layout.delta) * this.layout.delta; + + if (distX + this.layout.delta > this.container.scrollWidth) { + distX = this.container.scrollWidth - this.layout.delta; + } + } + this.scrollTo(distX, distY, true); + } + }, { + key: "add", + value: function add(section) { + var _this = this; + + var view = this.createView(section); + + this.views.append(view); + + // view.on(EVENTS.VIEWS.SHOWN, this.afterDisplayed.bind(this)); + view.onDisplayed = this.afterDisplayed.bind(this); + view.onResize = this.afterResized.bind(this); + + view.on(_constants.EVENTS.VIEWS.AXIS, function (axis) { + _this.updateAxis(axis); + }); + + return view.display(this.request); + } + }, { + key: "append", + value: function append(section) { + var _this2 = this; + + var view = this.createView(section); + this.views.append(view); + + view.onDisplayed = this.afterDisplayed.bind(this); + view.onResize = this.afterResized.bind(this); + + view.on(_constants.EVENTS.VIEWS.AXIS, function (axis) { + _this2.updateAxis(axis); + }); + + return view.display(this.request); + } + }, { + key: "prepend", + value: function prepend(section) { + var _this3 = this; + + var view = this.createView(section); + + view.on(_constants.EVENTS.VIEWS.RESIZED, function (bounds) { + _this3.counter(bounds); + }); + + this.views.prepend(view); + + view.onDisplayed = this.afterDisplayed.bind(this); + view.onResize = this.afterResized.bind(this); + + view.on(_constants.EVENTS.VIEWS.AXIS, function (axis) { + _this3.updateAxis(axis); + }); + + return view.display(this.request); + } + }, { + key: "counter", + value: function counter(bounds) { + if (this.settings.axis === "vertical") { + this.scrollBy(0, bounds.heightDelta, true); + } else { + this.scrollBy(bounds.widthDelta, 0, true); + } + } + + // resizeView(view) { + // + // if(this.settings.globalLayoutProperties.layout === "pre-paginated") { + // view.lock("both", this.bounds.width, this.bounds.height); + // } else { + // view.lock("width", this.bounds.width, this.bounds.height); + // } + // + // }; + + }, { + key: "next", + value: function next() { + var next; + var left; + + var dir = this.settings.direction; + + if (!this.views.length) return; + + if (this.isPaginated && this.settings.axis === "horizontal" && (!dir || dir === "ltr")) { + + this.scrollLeft = this.container.scrollLeft; + + left = this.container.scrollLeft + this.container.offsetWidth + this.layout.delta; + + if (left <= this.container.scrollWidth) { + this.scrollBy(this.layout.delta, 0, true); + } else { + next = this.views.last().section.next(); + } + } else if (this.isPaginated && this.settings.axis === "horizontal" && dir === "rtl") { + + this.scrollLeft = this.container.scrollLeft; + + left = this.container.scrollLeft; + + if (left > 0) { + this.scrollBy(this.layout.delta, 0, true); + } else { + next = this.views.last().section.next(); + } + } else if (this.isPaginated && this.settings.axis === "vertical") { + + this.scrollTop = this.container.scrollTop; + + var top = this.container.scrollTop + this.container.offsetHeight; + + if (top < this.container.scrollHeight) { + this.scrollBy(0, this.layout.height, true); + } else { + next = this.views.last().section.next(); + } + } else { + next = this.views.last().section.next(); + } + + if (next) { + this.clear(); + + return this.append(next).then(function () { + var right; + if (this.layout.name === "pre-paginated" && this.layout.divisor > 1) { + right = next.next(); + if (right) { + return this.append(right); + } + } + }.bind(this), function (err) { + return err; + }).then(function () { + this.views.show(); + }.bind(this)); + } + } + }, { + key: "prev", + value: function prev() { + var prev; + var left; + var dir = this.settings.direction; + + if (!this.views.length) return; + + if (this.isPaginated && this.settings.axis === "horizontal" && (!dir || dir === "ltr")) { + + this.scrollLeft = this.container.scrollLeft; + + left = this.container.scrollLeft; + + if (left > 0) { + this.scrollBy(-this.layout.delta, 0, true); + } else { + prev = this.views.first().section.prev(); + } + } else if (this.isPaginated && this.settings.axis === "horizontal" && dir === "rtl") { + + this.scrollLeft = this.container.scrollLeft; + + left = this.container.scrollLeft + this.container.offsetWidth + this.layout.delta; + + if (left <= this.container.scrollWidth) { + this.scrollBy(-this.layout.delta, 0, true); + } else { + prev = this.views.first().section.prev(); + } + } else if (this.isPaginated && this.settings.axis === "vertical") { + + this.scrollTop = this.container.scrollTop; + + var top = this.container.scrollTop; + + if (top > 0) { + this.scrollBy(0, -this.layout.height, true); + } else { + prev = this.views.first().section.prev(); + } + } else { + + prev = this.views.first().section.prev(); + } + + if (prev) { + this.clear(); + + return this.prepend(prev).then(function () { + var left; + if (this.layout.name === "pre-paginated" && this.layout.divisor > 1) { + left = prev.prev(); + if (left) { + return this.prepend(left); + } + } + }.bind(this), function (err) { + return err; + }).then(function () { + if (this.isPaginated && this.settings.axis === "horizontal") { + if (this.settings.direction === "rtl") { + this.scrollTo(0, 0, true); + } else { + this.scrollTo(this.container.scrollWidth - this.layout.delta, 0, true); + } + } + this.views.show(); + }.bind(this)); + } + } + }, { + key: "current", + value: function current() { + var visible = this.visible(); + if (visible.length) { + // Current is the last visible view + return visible[visible.length - 1]; + } + return null; + } + }, { + key: "clear", + value: function clear() { + + // this.q.clear(); + + if (this.views) { + this.views.hide(); + this.scrollTo(0, 0, true); + this.views.clear(); + } + } + }, { + key: "currentLocation", + value: function currentLocation() { + + if (this.settings.axis === "vertical") { + this.location = this.scrolledLocation(); + } else { + this.location = this.paginatedLocation(); + } + return this.location; + } + }, { + key: "scrolledLocation", + value: function scrolledLocation() { + var _this4 = this; + + var visible = this.visible(); + var container = this.container.getBoundingClientRect(); + var pageHeight = container.height < window.innerHeight ? container.height : window.innerHeight; + + var offset = 0; + var used = 0; + + if (this.settings.fullsize) { + offset = window.scrollY; + } + + var sections = visible.map(function (view) { + var _view$section = view.section, + index = _view$section.index, + href = _view$section.href; + + var position = view.position(); + var height = view.height(); + + var startPos = offset + container.top - position.top + used; + var endPos = startPos + pageHeight - used; + if (endPos > height) { + endPos = height; + used = endPos - startPos; + } + + var totalPages = _this4.layout.count(height, pageHeight).pages; + + var currPage = Math.ceil(startPos / pageHeight); + var pages = []; + var endPage = Math.ceil(endPos / pageHeight); + + pages = []; + for (var i = currPage; i <= endPage; i++) { + var pg = i + 1; + pages.push(pg); + } + + var mapping = _this4.mapping.page(view.contents, view.section.cfiBase, startPos, endPos); + + return { + index: index, + href: href, + pages: pages, + totalPages: totalPages, + mapping: mapping + }; + }); + + return sections; + } + }, { + key: "paginatedLocation", + value: function paginatedLocation() { + var _this5 = this; + + var visible = this.visible(); + var container = this.container.getBoundingClientRect(); + + var left = 0; + var used = 0; + + if (this.settings.fullsize) { + left = window.scrollX; + } + + var sections = visible.map(function (view) { + var _view$section2 = view.section, + index = _view$section2.index, + href = _view$section2.href; + + var offset = view.offset().left; + var position = view.position().left; + var width = view.width(); + + // Find mapping + var start = left + container.left - position + used; + var end = start + _this5.layout.width - used; + + var mapping = _this5.mapping.page(view.contents, view.section.cfiBase, start, end); + + // Find displayed pages + //console.log("pre", end, offset + width); + // if (end > offset + width) { + // end = offset + width; + // used = this.layout.pageWidth; + // } + // console.log("post", end); + + var totalPages = _this5.layout.count(width).pages; + var startPage = Math.floor(start / _this5.layout.pageWidth); + var pages = []; + var endPage = Math.floor(end / _this5.layout.pageWidth); + + // start page should not be negative + if (startPage < 0) { + startPage = 0; + endPage = endPage + 1; + } + + // Reverse page counts for rtl + if (_this5.settings.direction === "rtl") { + var tempStartPage = startPage; + startPage = totalPages - endPage; + endPage = totalPages - tempStartPage; + } + + for (var i = startPage + 1; i <= endPage; i++) { + var pg = i; + pages.push(pg); + } + + return { + index: index, + href: href, + pages: pages, + totalPages: totalPages, + mapping: mapping + }; + }); + + return sections; + } + }, { + key: "isVisible", + value: function isVisible(view, offsetPrev, offsetNext, _container) { + var position = view.position(); + var container = _container || this.bounds(); + + if (this.settings.axis === "horizontal" && position.right > container.left - offsetPrev && position.left < container.right + offsetNext) { + + return true; + } else if (this.settings.axis === "vertical" && position.bottom > container.top - offsetPrev && position.top < container.bottom + offsetNext) { + + return true; + } + + return false; + } + }, { + key: "visible", + value: function visible() { + var container = this.bounds(); + var views = this.views.displayed(); + var viewsLength = views.length; + var visible = []; + var isVisible; + var view; + + for (var i = 0; i < viewsLength; i++) { + view = views[i]; + isVisible = this.isVisible(view, 0, 0, container); + + if (isVisible === true) { + visible.push(view); + } + } + return visible; + } + }, { + key: "scrollBy", + value: function scrollBy(x, y, silent) { + var dir = this.settings.direction === "rtl" ? -1 : 1; + + if (silent) { + this.ignore = true; + } + + if (!this.settings.fullsize) { + if (x) this.container.scrollLeft += x * dir; + if (y) this.container.scrollTop += y; + } else { + window.scrollBy(x * dir, y * dir); + } + this.scrolled = true; + } + }, { + key: "scrollTo", + value: function scrollTo(x, y, silent) { + if (silent) { + this.ignore = true; + } + + if (!this.settings.fullsize) { + this.container.scrollLeft = x; + this.container.scrollTop = y; + } else { + window.scrollTo(x, y); + } + this.scrolled = true; + } + }, { + key: "onScroll", + value: function onScroll() { + var scrollTop = void 0; + var scrollLeft = void 0; + + if (!this.settings.fullsize) { + scrollTop = this.container.scrollTop; + scrollLeft = this.container.scrollLeft; + } else { + scrollTop = window.scrollY; + scrollLeft = window.scrollX; + } + + this.scrollTop = scrollTop; + this.scrollLeft = scrollLeft; + + if (!this.ignore) { + this.emit(_constants.EVENTS.MANAGERS.SCROLL, { + top: scrollTop, + left: scrollLeft + }); + + clearTimeout(this.afterScrolled); + this.afterScrolled = setTimeout(function () { + this.emit(_constants.EVENTS.MANAGERS.SCROLLED, { + top: this.scrollTop, + left: this.scrollLeft + }); + }.bind(this), 20); + } else { + this.ignore = false; + } + } + }, { + key: "bounds", + value: function bounds() { + var bounds; + + bounds = this.stage.bounds(); + + return bounds; + } + }, { + key: "applyLayout", + value: function applyLayout(layout) { + + this.layout = layout; + this.updateLayout(); + // this.manager.layout(this.layout.format); + } + }, { + key: "updateLayout", + value: function updateLayout() { + + if (!this.stage) { + return; + } + + this._stageSize = this.stage.size(); + + if (!this.isPaginated) { + this.layout.calculate(this._stageSize.width, this._stageSize.height); + } else { + this.layout.calculate(this._stageSize.width, this._stageSize.height, this.settings.gap); + + // Set the look ahead offset for what is visible + this.settings.offset = this.layout.delta; + + // this.stage.addStyleRules("iframe", [{"margin-right" : this.layout.gap + "px"}]); + } + + // Set the dimensions for views + this.viewSettings.width = this.layout.width; + this.viewSettings.height = this.layout.height; + + this.setLayout(this.layout); + } + }, { + key: "setLayout", + value: function setLayout(layout) { + + this.viewSettings.layout = layout; + + this.mapping = new _mapping2.default(layout.props, this.settings.direction, this.settings.axis); + + if (this.views) { + + this.views.forEach(function (view) { + if (view) { + view.setLayout(layout); + } + }); + } + } + }, { + key: "updateAxis", + value: function updateAxis(axis, forceUpdate) { + + if (!this.isPaginated) { + axis = "vertical"; + } + + if (!forceUpdate && axis === this.settings.axis) { + return; + } + + this.settings.axis = axis; + + this.stage && this.stage.axis(axis); + + this.viewSettings.axis = axis; + + if (this.mapping) { + this.mapping = new _mapping2.default(this.layout.props, this.settings.direction, this.settings.axis); + } + + if (this.layout) { + if (axis === "vertical") { + this.layout.spread("none"); + } else { + this.layout.spread(this.layout.settings.spread); + } + } + } + }, { + key: "updateFlow", + value: function updateFlow(flow) { + var defaultScrolledOverflow = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : "auto"; + + var isPaginated = flow === "paginated" || flow === "auto"; + + this.isPaginated = isPaginated; + + if (flow === "scrolled-doc" || flow === "scrolled-continuous" || flow === "scrolled") { + this.updateAxis("vertical"); + } else { + this.updateAxis("horizontal"); + } + + this.viewSettings.flow = flow; + + if (!this.settings.overflow) { + this.overflow = isPaginated ? "hidden" : defaultScrolledOverflow; + } else { + this.overflow = this.settings.overflow; + } + + this.stage && this.stage.overflow(this.overflow); + + this.updateLayout(); + } + }, { + key: "getContents", + value: function getContents() { + var contents = []; + if (!this.views) { + return contents; + } + this.views.forEach(function (view) { + var viewContents = view && view.contents; + if (viewContents) { + contents.push(viewContents); + } + }); + return contents; + } + }, { + key: "direction", + value: function direction() { + var dir = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : "ltr"; + + this.settings.direction = dir; + + this.stage && this.stage.direction(dir); + + this.viewSettings.direction = dir; + + this.updateLayout(); + } + }, { + key: "isRendered", + value: function isRendered() { + return this.rendered; + } + }]); + + return DefaultViewManager; +}(); + +//-- Enable binding events to Manager + + +(0, _eventEmitter2.default)(DefaultViewManager.prototype); + +exports.default = DefaultViewManager; +module.exports = exports["default"]; + +/***/ }), +/* 16 */ +/***/ (function(module, exports) { + +/** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + var type = typeof value; + return value != null && (type == 'object' || type == 'function'); +} + +module.exports = isObject; + + +/***/ }), +/* 17 */ +/***/ (function(module, exports) { + +/* + * DOM Level 2 + * Object DOMException + * @see http://www.w3.org/TR/REC-DOM-Level-1/ecma-script-language-binding.html + * @see http://www.w3.org/TR/2000/REC-DOM-Level-2-Core-20001113/ecma-script-binding.html + */ + +function copy(src,dest){ + for(var p in src){ + dest[p] = src[p]; + } +} +/** +^\w+\.prototype\.([_\w]+)\s*=\s*((?:.*\{\s*?[\r\n][\s\S]*?^})|\S.*?(?=[;\r\n]));? +^\w+\.prototype\.([_\w]+)\s*=\s*(\S.*?(?=[;\r\n]));? + */ +function _extends(Class,Super){ + var pt = Class.prototype; + if(Object.create){ + var ppt = Object.create(Super.prototype) + pt.__proto__ = ppt; + } + if(!(pt instanceof Super)){ + function t(){}; + t.prototype = Super.prototype; + t = new t(); + copy(pt,t); + Class.prototype = pt = t; + } + if(pt.constructor != Class){ + if(typeof Class != 'function'){ + console.error("unknow Class:"+Class) + } + pt.constructor = Class + } +} +var htmlns = 'http://www.w3.org/1999/xhtml' ; +// Node Types +var NodeType = {} +var ELEMENT_NODE = NodeType.ELEMENT_NODE = 1; +var ATTRIBUTE_NODE = NodeType.ATTRIBUTE_NODE = 2; +var TEXT_NODE = NodeType.TEXT_NODE = 3; +var CDATA_SECTION_NODE = NodeType.CDATA_SECTION_NODE = 4; +var ENTITY_REFERENCE_NODE = NodeType.ENTITY_REFERENCE_NODE = 5; +var ENTITY_NODE = NodeType.ENTITY_NODE = 6; +var PROCESSING_INSTRUCTION_NODE = NodeType.PROCESSING_INSTRUCTION_NODE = 7; +var COMMENT_NODE = NodeType.COMMENT_NODE = 8; +var DOCUMENT_NODE = NodeType.DOCUMENT_NODE = 9; +var DOCUMENT_TYPE_NODE = NodeType.DOCUMENT_TYPE_NODE = 10; +var DOCUMENT_FRAGMENT_NODE = NodeType.DOCUMENT_FRAGMENT_NODE = 11; +var NOTATION_NODE = NodeType.NOTATION_NODE = 12; + +// ExceptionCode +var ExceptionCode = {} +var ExceptionMessage = {}; +var INDEX_SIZE_ERR = ExceptionCode.INDEX_SIZE_ERR = ((ExceptionMessage[1]="Index size error"),1); +var DOMSTRING_SIZE_ERR = ExceptionCode.DOMSTRING_SIZE_ERR = ((ExceptionMessage[2]="DOMString size error"),2); +var HIERARCHY_REQUEST_ERR = ExceptionCode.HIERARCHY_REQUEST_ERR = ((ExceptionMessage[3]="Hierarchy request error"),3); +var WRONG_DOCUMENT_ERR = ExceptionCode.WRONG_DOCUMENT_ERR = ((ExceptionMessage[4]="Wrong document"),4); +var INVALID_CHARACTER_ERR = ExceptionCode.INVALID_CHARACTER_ERR = ((ExceptionMessage[5]="Invalid character"),5); +var NO_DATA_ALLOWED_ERR = ExceptionCode.NO_DATA_ALLOWED_ERR = ((ExceptionMessage[6]="No data allowed"),6); +var NO_MODIFICATION_ALLOWED_ERR = ExceptionCode.NO_MODIFICATION_ALLOWED_ERR = ((ExceptionMessage[7]="No modification allowed"),7); +var NOT_FOUND_ERR = ExceptionCode.NOT_FOUND_ERR = ((ExceptionMessage[8]="Not found"),8); +var NOT_SUPPORTED_ERR = ExceptionCode.NOT_SUPPORTED_ERR = ((ExceptionMessage[9]="Not supported"),9); +var INUSE_ATTRIBUTE_ERR = ExceptionCode.INUSE_ATTRIBUTE_ERR = ((ExceptionMessage[10]="Attribute in use"),10); +//level2 +var INVALID_STATE_ERR = ExceptionCode.INVALID_STATE_ERR = ((ExceptionMessage[11]="Invalid state"),11); +var SYNTAX_ERR = ExceptionCode.SYNTAX_ERR = ((ExceptionMessage[12]="Syntax error"),12); +var INVALID_MODIFICATION_ERR = ExceptionCode.INVALID_MODIFICATION_ERR = ((ExceptionMessage[13]="Invalid modification"),13); +var NAMESPACE_ERR = ExceptionCode.NAMESPACE_ERR = ((ExceptionMessage[14]="Invalid namespace"),14); +var INVALID_ACCESS_ERR = ExceptionCode.INVALID_ACCESS_ERR = ((ExceptionMessage[15]="Invalid access"),15); + + +function DOMException(code, message) { + if(message instanceof Error){ + var error = message; + }else{ + error = this; + Error.call(this, ExceptionMessage[code]); + this.message = ExceptionMessage[code]; + if(Error.captureStackTrace) Error.captureStackTrace(this, DOMException); + } + error.code = code; + if(message) this.message = this.message + ": " + message; + return error; +}; +DOMException.prototype = Error.prototype; +copy(ExceptionCode,DOMException) +/** + * @see http://www.w3.org/TR/2000/REC-DOM-Level-2-Core-20001113/core.html#ID-536297177 + * The NodeList interface provides the abstraction of an ordered collection of nodes, without defining or constraining how this collection is implemented. NodeList objects in the DOM are live. + * The items in the NodeList are accessible via an integral index, starting from 0. + */ +function NodeList() { +}; +NodeList.prototype = { + /** + * The number of nodes in the list. The range of valid child node indices is 0 to length-1 inclusive. + * @standard level1 + */ + length:0, + /** + * Returns the indexth item in the collection. If index is greater than or equal to the number of nodes in the list, this returns null. + * @standard level1 + * @param index unsigned long + * Index into the collection. + * @return Node + * The node at the indexth position in the NodeList, or null if that is not a valid index. + */ + item: function(index) { + return this[index] || null; + }, + toString:function(isHTML,nodeFilter){ + for(var buf = [], i = 0;i=0){ + var lastIndex = list.length-1 + while(i0 || key == 'xmlns'){ +// return null; +// } + //console.log() + var i = this.length; + while(i--){ + var attr = this[i]; + //console.log(attr.nodeName,key) + if(attr.nodeName == key){ + return attr; + } + } + }, + setNamedItem: function(attr) { + var el = attr.ownerElement; + if(el && el!=this._ownerElement){ + throw new DOMException(INUSE_ATTRIBUTE_ERR); + } + var oldAttr = this.getNamedItem(attr.nodeName); + _addNamedNode(this._ownerElement,this,attr,oldAttr); + return oldAttr; + }, + /* returns Node */ + setNamedItemNS: function(attr) {// raises: WRONG_DOCUMENT_ERR,NO_MODIFICATION_ALLOWED_ERR,INUSE_ATTRIBUTE_ERR + var el = attr.ownerElement, oldAttr; + if(el && el!=this._ownerElement){ + throw new DOMException(INUSE_ATTRIBUTE_ERR); + } + oldAttr = this.getNamedItemNS(attr.namespaceURI,attr.localName); + _addNamedNode(this._ownerElement,this,attr,oldAttr); + return oldAttr; + }, + + /* returns Node */ + removeNamedItem: function(key) { + var attr = this.getNamedItem(key); + _removeNamedNode(this._ownerElement,this,attr); + return attr; + + + },// raises: NOT_FOUND_ERR,NO_MODIFICATION_ALLOWED_ERR + + //for level2 + removeNamedItemNS:function(namespaceURI,localName){ + var attr = this.getNamedItemNS(namespaceURI,localName); + _removeNamedNode(this._ownerElement,this,attr); + return attr; + }, + getNamedItemNS: function(namespaceURI, localName) { + var i = this.length; + while(i--){ + var node = this[i]; + if(node.localName == localName && node.namespaceURI == namespaceURI){ + return node; + } + } + return null; + } +}; +/** + * @see http://www.w3.org/TR/REC-DOM-Level-1/level-one-core.html#ID-102161490 + */ +function DOMImplementation(/* Object */ features) { + this._features = {}; + if (features) { + for (var feature in features) { + this._features = features[feature]; + } + } +}; + +DOMImplementation.prototype = { + hasFeature: function(/* string */ feature, /* string */ version) { + var versions = this._features[feature.toLowerCase()]; + if (versions && (!version || version in versions)) { + return true; + } else { + return false; + } + }, + // Introduced in DOM Level 2: + createDocument:function(namespaceURI, qualifiedName, doctype){// raises:INVALID_CHARACTER_ERR,NAMESPACE_ERR,WRONG_DOCUMENT_ERR + var doc = new Document(); + doc.implementation = this; + doc.childNodes = new NodeList(); + doc.doctype = doctype; + if(doctype){ + doc.appendChild(doctype); + } + if(qualifiedName){ + var root = doc.createElementNS(namespaceURI,qualifiedName); + doc.appendChild(root); + } + return doc; + }, + // Introduced in DOM Level 2: + createDocumentType:function(qualifiedName, publicId, systemId){// raises:INVALID_CHARACTER_ERR,NAMESPACE_ERR + var node = new DocumentType(); + node.name = qualifiedName; + node.nodeName = qualifiedName; + node.publicId = publicId; + node.systemId = systemId; + // Introduced in DOM Level 2: + //readonly attribute DOMString internalSubset; + + //TODO:.. + // readonly attribute NamedNodeMap entities; + // readonly attribute NamedNodeMap notations; + return node; + } +}; + + +/** + * @see http://www.w3.org/TR/2000/REC-DOM-Level-2-Core-20001113/core.html#ID-1950641247 + */ + +function Node() { +}; + +Node.prototype = { + firstChild : null, + lastChild : null, + previousSibling : null, + nextSibling : null, + attributes : null, + parentNode : null, + childNodes : null, + ownerDocument : null, + nodeValue : null, + namespaceURI : null, + prefix : null, + localName : null, + // Modified in DOM Level 2: + insertBefore:function(newChild, refChild){//raises + return _insertBefore(this,newChild,refChild); + }, + replaceChild:function(newChild, oldChild){//raises + this.insertBefore(newChild,oldChild); + if(oldChild){ + this.removeChild(oldChild); + } + }, + removeChild:function(oldChild){ + return _removeChild(this,oldChild); + }, + appendChild:function(newChild){ + return this.insertBefore(newChild,null); + }, + hasChildNodes:function(){ + return this.firstChild != null; + }, + cloneNode:function(deep){ + return cloneNode(this.ownerDocument||this,this,deep); + }, + // Modified in DOM Level 2: + normalize:function(){ + var child = this.firstChild; + while(child){ + var next = child.nextSibling; + if(next && next.nodeType == TEXT_NODE && child.nodeType == TEXT_NODE){ + this.removeChild(next); + child.appendData(next.data); + }else{ + child.normalize(); + child = next; + } + } + }, + // Introduced in DOM Level 2: + isSupported:function(feature, version){ + return this.ownerDocument.implementation.hasFeature(feature,version); + }, + // Introduced in DOM Level 2: + hasAttributes:function(){ + return this.attributes.length>0; + }, + lookupPrefix:function(namespaceURI){ + var el = this; + while(el){ + var map = el._nsMap; + //console.dir(map) + if(map){ + for(var n in map){ + if(map[n] == namespaceURI){ + return n; + } + } + } + el = el.nodeType == ATTRIBUTE_NODE?el.ownerDocument : el.parentNode; + } + return null; + }, + // Introduced in DOM Level 3: + lookupNamespaceURI:function(prefix){ + var el = this; + while(el){ + var map = el._nsMap; + //console.dir(map) + if(map){ + if(prefix in map){ + return map[prefix] ; + } + } + el = el.nodeType == ATTRIBUTE_NODE?el.ownerDocument : el.parentNode; + } + return null; + }, + // Introduced in DOM Level 3: + isDefaultNamespace:function(namespaceURI){ + var prefix = this.lookupPrefix(namespaceURI); + return prefix == null; + } +}; + + +function _xmlEncoder(c){ + return c == '<' && '<' || + c == '>' && '>' || + c == '&' && '&' || + c == '"' && '"' || + '&#'+c.charCodeAt()+';' +} + + +copy(NodeType,Node); +copy(NodeType,Node.prototype); + +/** + * @param callback return true for continue,false for break + * @return boolean true: break visit; + */ +function _visitNode(node,callback){ + if(callback(node)){ + return true; + } + if(node = node.firstChild){ + do{ + if(_visitNode(node,callback)){return true} + }while(node=node.nextSibling) + } +} + + + +function Document(){ +} +function _onAddAttribute(doc,el,newAttr){ + doc && doc._inc++; + var ns = newAttr.namespaceURI ; + if(ns == 'http://www.w3.org/2000/xmlns/'){ + //update namespace + el._nsMap[newAttr.prefix?newAttr.localName:''] = newAttr.value + } +} +function _onRemoveAttribute(doc,el,newAttr,remove){ + doc && doc._inc++; + var ns = newAttr.namespaceURI ; + if(ns == 'http://www.w3.org/2000/xmlns/'){ + //update namespace + delete el._nsMap[newAttr.prefix?newAttr.localName:''] + } +} +function _onUpdateChild(doc,el,newChild){ + if(doc && doc._inc){ + doc._inc++; + //update childNodes + var cs = el.childNodes; + if(newChild){ + cs[cs.length++] = newChild; + }else{ + //console.log(1) + var child = el.firstChild; + var i = 0; + while(child){ + cs[i++] = child; + child =child.nextSibling; + } + cs.length = i; + } + } +} + +/** + * attributes; + * children; + * + * writeable properties: + * nodeValue,Attr:value,CharacterData:data + * prefix + */ +function _removeChild(parentNode,child){ + var previous = child.previousSibling; + var next = child.nextSibling; + if(previous){ + previous.nextSibling = next; + }else{ + parentNode.firstChild = next + } + if(next){ + next.previousSibling = previous; + }else{ + parentNode.lastChild = previous; + } + _onUpdateChild(parentNode.ownerDocument,parentNode); + return child; +} +/** + * preformance key(refChild == null) + */ +function _insertBefore(parentNode,newChild,nextChild){ + var cp = newChild.parentNode; + if(cp){ + cp.removeChild(newChild);//remove and update + } + if(newChild.nodeType === DOCUMENT_FRAGMENT_NODE){ + var newFirst = newChild.firstChild; + if (newFirst == null) { + return newChild; + } + var newLast = newChild.lastChild; + }else{ + newFirst = newLast = newChild; + } + var pre = nextChild ? nextChild.previousSibling : parentNode.lastChild; + + newFirst.previousSibling = pre; + newLast.nextSibling = nextChild; + + + if(pre){ + pre.nextSibling = newFirst; + }else{ + parentNode.firstChild = newFirst; + } + if(nextChild == null){ + parentNode.lastChild = newLast; + }else{ + nextChild.previousSibling = newLast; + } + do{ + newFirst.parentNode = parentNode; + }while(newFirst !== newLast && (newFirst= newFirst.nextSibling)) + _onUpdateChild(parentNode.ownerDocument||parentNode,parentNode); + //console.log(parentNode.lastChild.nextSibling == null) + if (newChild.nodeType == DOCUMENT_FRAGMENT_NODE) { + newChild.firstChild = newChild.lastChild = null; + } + return newChild; +} +function _appendSingleChild(parentNode,newChild){ + var cp = newChild.parentNode; + if(cp){ + var pre = parentNode.lastChild; + cp.removeChild(newChild);//remove and update + var pre = parentNode.lastChild; + } + var pre = parentNode.lastChild; + newChild.parentNode = parentNode; + newChild.previousSibling = pre; + newChild.nextSibling = null; + if(pre){ + pre.nextSibling = newChild; + }else{ + parentNode.firstChild = newChild; + } + parentNode.lastChild = newChild; + _onUpdateChild(parentNode.ownerDocument,parentNode,newChild); + return newChild; + //console.log("__aa",parentNode.lastChild.nextSibling == null) +} +Document.prototype = { + //implementation : null, + nodeName : '#document', + nodeType : DOCUMENT_NODE, + doctype : null, + documentElement : null, + _inc : 1, + + insertBefore : function(newChild, refChild){//raises + if(newChild.nodeType == DOCUMENT_FRAGMENT_NODE){ + var child = newChild.firstChild; + while(child){ + var next = child.nextSibling; + this.insertBefore(child,refChild); + child = next; + } + return newChild; + } + if(this.documentElement == null && newChild.nodeType == ELEMENT_NODE){ + this.documentElement = newChild; + } + + return _insertBefore(this,newChild,refChild),(newChild.ownerDocument = this),newChild; + }, + removeChild : function(oldChild){ + if(this.documentElement == oldChild){ + this.documentElement = null; + } + return _removeChild(this,oldChild); + }, + // Introduced in DOM Level 2: + importNode : function(importedNode,deep){ + return importNode(this,importedNode,deep); + }, + // Introduced in DOM Level 2: + getElementById : function(id){ + var rtv = null; + _visitNode(this.documentElement,function(node){ + if(node.nodeType == ELEMENT_NODE){ + if(node.getAttribute('id') == id){ + rtv = node; + return true; + } + } + }) + return rtv; + }, + + //document factory method: + createElement : function(tagName){ + var node = new Element(); + node.ownerDocument = this; + node.nodeName = tagName; + node.tagName = tagName; + node.childNodes = new NodeList(); + var attrs = node.attributes = new NamedNodeMap(); + attrs._ownerElement = node; + return node; + }, + createDocumentFragment : function(){ + var node = new DocumentFragment(); + node.ownerDocument = this; + node.childNodes = new NodeList(); + return node; + }, + createTextNode : function(data){ + var node = new Text(); + node.ownerDocument = this; + node.appendData(data) + return node; + }, + createComment : function(data){ + var node = new Comment(); + node.ownerDocument = this; + node.appendData(data) + return node; + }, + createCDATASection : function(data){ + var node = new CDATASection(); + node.ownerDocument = this; + node.appendData(data) + return node; + }, + createProcessingInstruction : function(target,data){ + var node = new ProcessingInstruction(); + node.ownerDocument = this; + node.tagName = node.target = target; + node.nodeValue= node.data = data; + return node; + }, + createAttribute : function(name){ + var node = new Attr(); + node.ownerDocument = this; + node.name = name; + node.nodeName = name; + node.localName = name; + node.specified = true; + return node; + }, + createEntityReference : function(name){ + var node = new EntityReference(); + node.ownerDocument = this; + node.nodeName = name; + return node; + }, + // Introduced in DOM Level 2: + createElementNS : function(namespaceURI,qualifiedName){ + var node = new Element(); + var pl = qualifiedName.split(':'); + var attrs = node.attributes = new NamedNodeMap(); + node.childNodes = new NodeList(); + node.ownerDocument = this; + node.nodeName = qualifiedName; + node.tagName = qualifiedName; + node.namespaceURI = namespaceURI; + if(pl.length == 2){ + node.prefix = pl[0]; + node.localName = pl[1]; + }else{ + //el.prefix = null; + node.localName = qualifiedName; + } + attrs._ownerElement = node; + return node; + }, + // Introduced in DOM Level 2: + createAttributeNS : function(namespaceURI,qualifiedName){ + var node = new Attr(); + var pl = qualifiedName.split(':'); + node.ownerDocument = this; + node.nodeName = qualifiedName; + node.name = qualifiedName; + node.namespaceURI = namespaceURI; + node.specified = true; + if(pl.length == 2){ + node.prefix = pl[0]; + node.localName = pl[1]; + }else{ + //el.prefix = null; + node.localName = qualifiedName; + } + return node; + } +}; +_extends(Document,Node); + + +function Element() { + this._nsMap = {}; +}; +Element.prototype = { + nodeType : ELEMENT_NODE, + hasAttribute : function(name){ + return this.getAttributeNode(name)!=null; + }, + getAttribute : function(name){ + var attr = this.getAttributeNode(name); + return attr && attr.value || ''; + }, + getAttributeNode : function(name){ + return this.attributes.getNamedItem(name); + }, + setAttribute : function(name, value){ + var attr = this.ownerDocument.createAttribute(name); + attr.value = attr.nodeValue = "" + value; + this.setAttributeNode(attr) + }, + removeAttribute : function(name){ + var attr = this.getAttributeNode(name) + attr && this.removeAttributeNode(attr); + }, + + //four real opeartion method + appendChild:function(newChild){ + if(newChild.nodeType === DOCUMENT_FRAGMENT_NODE){ + return this.insertBefore(newChild,null); + }else{ + return _appendSingleChild(this,newChild); + } + }, + setAttributeNode : function(newAttr){ + return this.attributes.setNamedItem(newAttr); + }, + setAttributeNodeNS : function(newAttr){ + return this.attributes.setNamedItemNS(newAttr); + }, + removeAttributeNode : function(oldAttr){ + //console.log(this == oldAttr.ownerElement) + return this.attributes.removeNamedItem(oldAttr.nodeName); + }, + //get real attribute name,and remove it by removeAttributeNode + removeAttributeNS : function(namespaceURI, localName){ + var old = this.getAttributeNodeNS(namespaceURI, localName); + old && this.removeAttributeNode(old); + }, + + hasAttributeNS : function(namespaceURI, localName){ + return this.getAttributeNodeNS(namespaceURI, localName)!=null; + }, + getAttributeNS : function(namespaceURI, localName){ + var attr = this.getAttributeNodeNS(namespaceURI, localName); + return attr && attr.value || ''; + }, + setAttributeNS : function(namespaceURI, qualifiedName, value){ + var attr = this.ownerDocument.createAttributeNS(namespaceURI, qualifiedName); + attr.value = attr.nodeValue = "" + value; + this.setAttributeNode(attr) + }, + getAttributeNodeNS : function(namespaceURI, localName){ + return this.attributes.getNamedItemNS(namespaceURI, localName); + }, + + getElementsByTagName : function(tagName){ + return new LiveNodeList(this,function(base){ + var ls = []; + _visitNode(base,function(node){ + if(node !== base && node.nodeType == ELEMENT_NODE && (tagName === '*' || node.tagName == tagName)){ + ls.push(node); + } + }); + return ls; + }); + }, + getElementsByTagNameNS : function(namespaceURI, localName){ + return new LiveNodeList(this,function(base){ + var ls = []; + _visitNode(base,function(node){ + if(node !== base && node.nodeType === ELEMENT_NODE && (namespaceURI === '*' || node.namespaceURI === namespaceURI) && (localName === '*' || node.localName == localName)){ + ls.push(node); + } + }); + return ls; + + }); + } +}; +Document.prototype.getElementsByTagName = Element.prototype.getElementsByTagName; +Document.prototype.getElementsByTagNameNS = Element.prototype.getElementsByTagNameNS; + + +_extends(Element,Node); +function Attr() { +}; +Attr.prototype.nodeType = ATTRIBUTE_NODE; +_extends(Attr,Node); + + +function CharacterData() { +}; +CharacterData.prototype = { + data : '', + substringData : function(offset, count) { + return this.data.substring(offset, offset+count); + }, + appendData: function(text) { + text = this.data+text; + this.nodeValue = this.data = text; + this.length = text.length; + }, + insertData: function(offset,text) { + this.replaceData(offset,0,text); + + }, + appendChild:function(newChild){ + throw new Error(ExceptionMessage[HIERARCHY_REQUEST_ERR]) + }, + deleteData: function(offset, count) { + this.replaceData(offset,count,""); + }, + replaceData: function(offset, count, text) { + var start = this.data.substring(0,offset); + var end = this.data.substring(offset+count); + text = start + text + end; + this.nodeValue = this.data = text; + this.length = text.length; + } +} +_extends(CharacterData,Node); +function Text() { +}; +Text.prototype = { + nodeName : "#text", + nodeType : TEXT_NODE, + splitText : function(offset) { + var text = this.data; + var newText = text.substring(offset); + text = text.substring(0, offset); + this.data = this.nodeValue = text; + this.length = text.length; + var newNode = this.ownerDocument.createTextNode(newText); + if(this.parentNode){ + this.parentNode.insertBefore(newNode, this.nextSibling); + } + return newNode; + } +} +_extends(Text,CharacterData); +function Comment() { +}; +Comment.prototype = { + nodeName : "#comment", + nodeType : COMMENT_NODE +} +_extends(Comment,CharacterData); + +function CDATASection() { +}; +CDATASection.prototype = { + nodeName : "#cdata-section", + nodeType : CDATA_SECTION_NODE +} +_extends(CDATASection,CharacterData); + + +function DocumentType() { +}; +DocumentType.prototype.nodeType = DOCUMENT_TYPE_NODE; +_extends(DocumentType,Node); + +function Notation() { +}; +Notation.prototype.nodeType = NOTATION_NODE; +_extends(Notation,Node); + +function Entity() { +}; +Entity.prototype.nodeType = ENTITY_NODE; +_extends(Entity,Node); + +function EntityReference() { +}; +EntityReference.prototype.nodeType = ENTITY_REFERENCE_NODE; +_extends(EntityReference,Node); + +function DocumentFragment() { +}; +DocumentFragment.prototype.nodeName = "#document-fragment"; +DocumentFragment.prototype.nodeType = DOCUMENT_FRAGMENT_NODE; +_extends(DocumentFragment,Node); + + +function ProcessingInstruction() { +} +ProcessingInstruction.prototype.nodeType = PROCESSING_INSTRUCTION_NODE; +_extends(ProcessingInstruction,Node); +function XMLSerializer(){} +XMLSerializer.prototype.serializeToString = function(node,isHtml,nodeFilter){ + return nodeSerializeToString.call(node,isHtml,nodeFilter); +} +Node.prototype.toString = nodeSerializeToString; +function nodeSerializeToString(isHtml,nodeFilter){ + var buf = []; + var refNode = this.nodeType == 9?this.documentElement:this; + var prefix = refNode.prefix; + var uri = refNode.namespaceURI; + + if(uri && prefix == null){ + //console.log(prefix) + var prefix = refNode.lookupPrefix(uri); + if(prefix == null){ + //isHTML = true; + var visibleNamespaces=[ + {namespace:uri,prefix:null} + //{namespace:uri,prefix:''} + ] + } + } + serializeToString(this,buf,isHtml,nodeFilter,visibleNamespaces); + //console.log('###',this.nodeType,uri,prefix,buf.join('')) + return buf.join(''); +} +function needNamespaceDefine(node,isHTML, visibleNamespaces) { + var prefix = node.prefix||''; + var uri = node.namespaceURI; + if (!prefix && !uri){ + return false; + } + if (prefix === "xml" && uri === "http://www.w3.org/XML/1998/namespace" + || uri == 'http://www.w3.org/2000/xmlns/'){ + return false; + } + + var i = visibleNamespaces.length + //console.log('@@@@',node.tagName,prefix,uri,visibleNamespaces) + while (i--) { + var ns = visibleNamespaces[i]; + // get namespace prefix + //console.log(node.nodeType,node.tagName,ns.prefix,prefix) + if (ns.prefix == prefix){ + return ns.namespace != uri; + } + } + //console.log(isHTML,uri,prefix=='') + //if(isHTML && prefix ==null && uri == 'http://www.w3.org/1999/xhtml'){ + // return false; + //} + //node.flag = '11111' + //console.error(3,true,node.flag,node.prefix,node.namespaceURI) + return true; +} +function serializeToString(node,buf,isHTML,nodeFilter,visibleNamespaces){ + if(nodeFilter){ + node = nodeFilter(node); + if(node){ + if(typeof node == 'string'){ + buf.push(node); + return; + } + }else{ + return; + } + //buf.sort.apply(attrs, attributeSorter); + } + switch(node.nodeType){ + case ELEMENT_NODE: + if (!visibleNamespaces) visibleNamespaces = []; + var startVisibleNamespaces = visibleNamespaces.length; + var attrs = node.attributes; + var len = attrs.length; + var child = node.firstChild; + var nodeName = node.tagName; + + isHTML = (htmlns === node.namespaceURI) ||isHTML + buf.push('<',nodeName); + + + + for(var i=0;i'); + //if is cdata child node + if(isHTML && /^script$/i.test(nodeName)){ + while(child){ + if(child.data){ + buf.push(child.data); + }else{ + serializeToString(child,buf,isHTML,nodeFilter,visibleNamespaces); + } + child = child.nextSibling; + } + }else + { + while(child){ + serializeToString(child,buf,isHTML,nodeFilter,visibleNamespaces); + child = child.nextSibling; + } + } + buf.push(''); + }else{ + buf.push('/>'); + } + // remove added visible namespaces + //visibleNamespaces.length = startVisibleNamespaces; + return; + case DOCUMENT_NODE: + case DOCUMENT_FRAGMENT_NODE: + var child = node.firstChild; + while(child){ + serializeToString(child,buf,isHTML,nodeFilter,visibleNamespaces); + child = child.nextSibling; + } + return; + case ATTRIBUTE_NODE: + return buf.push(' ',node.name,'="',node.value.replace(/[<&"]/g,_xmlEncoder),'"'); + case TEXT_NODE: + return buf.push(node.data.replace(/[<&]/g,_xmlEncoder)); + case CDATA_SECTION_NODE: + return buf.push( ''); + case COMMENT_NODE: + return buf.push( ""); + case DOCUMENT_TYPE_NODE: + var pubid = node.publicId; + var sysid = node.systemId; + buf.push(''); + }else if(sysid && sysid!='.'){ + buf.push(' SYSTEM "',sysid,'">'); + }else{ + var sub = node.internalSubset; + if(sub){ + buf.push(" [",sub,"]"); + } + buf.push(">"); + } + return; + case PROCESSING_INSTRUCTION_NODE: + return buf.push( ""); + case ENTITY_REFERENCE_NODE: + return buf.push( '&',node.nodeName,';'); + //case ENTITY_NODE: + //case NOTATION_NODE: + default: + buf.push('??',node.nodeName); + } +} +function importNode(doc,node,deep){ + var node2; + switch (node.nodeType) { + case ELEMENT_NODE: + node2 = node.cloneNode(false); + node2.ownerDocument = doc; + //var attrs = node2.attributes; + //var len = attrs.length; + //for(var i=0;i 0) && (this.settings.height === 0 || this.settings.height > 0)) { + // viewport = "width="+this.settings.width+", height="+this.settings.height+""; + } + + properties = { + layout: layout, + spread: spread, + orientation: orientation, + flow: flow, + viewport: viewport, + minSpreadWidth: minSpreadWidth, + direction: direction + }; + + return properties; + } + + /** + * Adjust the flow of the rendition to paginated or scrolled + * (scrolled-continuous vs scrolled-doc are handled by different view managers) + * @param {string} flow + */ + + }, { + key: "flow", + value: function flow(_flow2) { + var _flow = _flow2; + if (_flow2 === "scrolled" || _flow2 === "scrolled-doc" || _flow2 === "scrolled-continuous") { + _flow = "scrolled"; + } + + if (_flow2 === "auto" || _flow2 === "paginated") { + _flow = "paginated"; + } + + this.settings.flow = _flow2; + + if (this._layout) { + this._layout.flow(_flow); + } + + if (this.manager && this._layout) { + this.manager.applyLayout(this._layout); + } + + if (this.manager) { + this.manager.updateFlow(_flow); + } + + if (this.manager && this.manager.isRendered() && this.location) { + this.manager.clear(); + this.display(this.location.start.cfi); + } + } + + /** + * Adjust the layout of the rendition to reflowable or pre-paginated + * @param {object} settings + */ + + }, { + key: "layout", + value: function layout(settings) { + var _this4 = this; + + if (settings) { + this._layout = new _layout2.default(settings); + this._layout.spread(settings.spread, this.settings.minSpreadWidth); + + // this.mapping = new Mapping(this._layout.props); + + this._layout.on(_constants.EVENTS.LAYOUT.UPDATED, function (props, changed) { + _this4.emit(_constants.EVENTS.RENDITION.LAYOUT, props, changed); + }); + } + + if (this.manager && this._layout) { + this.manager.applyLayout(this._layout); + } + + return this._layout; + } + + /** + * Adjust if the rendition uses spreads + * @param {string} spread none | auto (TODO: implement landscape, portrait, both) + * @param {int} [min] min width to use spreads at + */ + + }, { + key: "spread", + value: function spread(_spread, min) { + + this.settings.spread = _spread; + + if (min) { + this.settings.minSpreadWidth = min; + } + + if (this._layout) { + this._layout.spread(_spread, min); + } + + if (this.manager && this.manager.isRendered()) { + this.manager.updateLayout(); + } + } + + /** + * Adjust the direction of the rendition + * @param {string} dir + */ + + }, { + key: "direction", + value: function direction(dir) { + + this.settings.direction = dir || "ltr"; + + if (this.manager) { + this.manager.direction(this.settings.direction); + } + + if (this.manager && this.manager.isRendered() && this.location) { + this.manager.clear(); + this.display(this.location.start.cfi); + } + } + + /** + * Report the current location + * @fires relocated + * @fires locationChanged + */ + + }, { + key: "reportLocation", + value: function reportLocation() { + return this.q.enqueue(function reportedLocation() { + requestAnimationFrame(function reportedLocationAfterRAF() { + var location = this.manager.currentLocation(); + if (location && location.then && typeof location.then === "function") { + location.then(function (result) { + var located = this.located(result); + + if (!located || !located.start || !located.end) { + return; + } + + this.location = located; + + this.emit(_constants.EVENTS.RENDITION.LOCATION_CHANGED, { + index: this.location.start.index, + href: this.location.start.href, + start: this.location.start.cfi, + end: this.location.end.cfi, + percentage: this.location.start.percentage + }); + + this.emit(_constants.EVENTS.RENDITION.RELOCATED, this.location); + }.bind(this)); + } else if (location) { + var located = this.located(location); + + if (!located || !located.start || !located.end) { + return; + } + + this.location = located; + + /** + * @event locationChanged + * @deprecated + * @type {object} + * @property {number} index + * @property {string} href + * @property {EpubCFI} start + * @property {EpubCFI} end + * @property {number} percentage + * @memberof Rendition + */ + this.emit(_constants.EVENTS.RENDITION.LOCATION_CHANGED, { + index: this.location.start.index, + href: this.location.start.href, + start: this.location.start.cfi, + end: this.location.end.cfi, + percentage: this.location.start.percentage + }); + + /** + * @event relocated + * @type {displayedLocation} + * @memberof Rendition + */ + this.emit(_constants.EVENTS.RENDITION.RELOCATED, this.location); + } + }.bind(this)); + }.bind(this)); + } + + /** + * Get the Current Location object + * @return {displayedLocation | promise} location (may be a promise) + */ + + }, { + key: "currentLocation", + value: function currentLocation() { + var location = this.manager.currentLocation(); + if (location && location.then && typeof location.then === "function") { + location.then(function (result) { + var located = this.located(result); + return located; + }.bind(this)); + } else if (location) { + var located = this.located(location); + return located; + } + } + + /** + * Creates a Rendition#locationRange from location + * passed by the Manager + * @returns {displayedLocation} + * @private + */ + + }, { + key: "located", + value: function located(location) { + if (!location.length) { + return {}; + } + var start = location[0]; + var end = location[location.length - 1]; + + var located = { + start: { + index: start.index, + href: start.href, + cfi: start.mapping.start, + displayed: { + page: start.pages[0] || 1, + total: start.totalPages + } + }, + end: { + index: end.index, + href: end.href, + cfi: end.mapping.end, + displayed: { + page: end.pages[end.pages.length - 1] || 1, + total: end.totalPages + } + } + }; + + var locationStart = this.book.locations.locationFromCfi(start.mapping.start); + var locationEnd = this.book.locations.locationFromCfi(end.mapping.end); + + if (locationStart != null) { + located.start.location = locationStart; + located.start.percentage = this.book.locations.percentageFromLocation(locationStart); + } + if (locationEnd != null) { + located.end.location = locationEnd; + located.end.percentage = this.book.locations.percentageFromLocation(locationEnd); + } + + var pageStart = this.book.pageList.pageFromCfi(start.mapping.start); + var pageEnd = this.book.pageList.pageFromCfi(end.mapping.end); + + if (pageStart != -1) { + located.start.page = pageStart; + } + if (pageEnd != -1) { + located.end.page = pageEnd; + } + + if (end.index === this.book.spine.last().index && located.end.displayed.page >= located.end.displayed.total) { + located.atEnd = true; + } + + if (start.index === this.book.spine.first().index && located.start.displayed.page === 1) { + located.atStart = true; + } + + return located; + } + + /** + * Remove and Clean Up the Rendition + */ + + }, { + key: "destroy", + value: function destroy() { + // Clear the queue + // this.q.clear(); + // this.q = undefined; + + this.manager && this.manager.destroy(); + + this.book = undefined; + + // this.views = null; + + // this.hooks.display.clear(); + // this.hooks.serialize.clear(); + // this.hooks.content.clear(); + // this.hooks.layout.clear(); + // this.hooks.render.clear(); + // this.hooks.show.clear(); + // this.hooks = {}; + + // this.themes.destroy(); + // this.themes = undefined; + + // this.epubcfi = undefined; + + // this.starting = undefined; + // this.started = undefined; + + } + + /** + * Pass the events from a view's Contents + * @private + * @param {Contents} view contents + */ + + }, { + key: "passEvents", + value: function passEvents(contents) { + var _this5 = this; + + _constants.DOM_EVENTS.forEach(function (e) { + contents.on(e, function (ev) { + return _this5.triggerViewEvent(ev, contents); + }); + }); + + contents.on(_constants.EVENTS.CONTENTS.SELECTED, function (e) { + return _this5.triggerSelectedEvent(e, contents); + }); + } + + /** + * Emit events passed by a view + * @private + * @param {event} e + */ + + }, { + key: "triggerViewEvent", + value: function triggerViewEvent(e, contents) { + this.emit(e.type, e, contents); + } + + /** + * Emit a selection event's CFI Range passed from a a view + * @private + * @param {EpubCFI} cfirange + */ + + }, { + key: "triggerSelectedEvent", + value: function triggerSelectedEvent(cfirange, contents) { + /** + * Emit that a text selection has occured + * @event selected + * @param {EpubCFI} cfirange + * @param {Contents} contents + * @memberof Rendition + */ + this.emit(_constants.EVENTS.RENDITION.SELECTED, cfirange, contents); + } + + /** + * Emit a markClicked event with the cfiRange and data from a mark + * @private + * @param {EpubCFI} cfirange + */ + + }, { + key: "triggerMarkEvent", + value: function triggerMarkEvent(cfiRange, data, contents) { + /** + * Emit that a mark was clicked + * @event markClicked + * @param {EpubCFI} cfirange + * @param {object} data + * @param {Contents} contents + * @memberof Rendition + */ + this.emit(_constants.EVENTS.RENDITION.MARK_CLICKED, cfiRange, data, contents); + } + + /** + * Get a Range from a Visible CFI + * @param {string} cfi EpubCfi String + * @param {string} ignoreClass + * @return {range} + */ + + }, { + key: "getRange", + value: function getRange(cfi, ignoreClass) { + var _cfi = new _epubcfi2.default(cfi); + var found = this.manager.visible().filter(function (view) { + if (_cfi.spinePos === view.index) return true; + }); + + // Should only every return 1 item + if (found.length) { + return found[0].contents.range(_cfi, ignoreClass); + } + } + + /** + * Hook to adjust images to fit in columns + * @param {Contents} contents + * @private + */ + + }, { + key: "adjustImages", + value: function adjustImages(contents) { + + if (this._layout.name === "pre-paginated") { + return new Promise(function (resolve) { + resolve(); + }); + } + + var computed = contents.window.getComputedStyle(contents.content, null); + var height = (contents.content.offsetHeight - (parseFloat(computed.paddingTop) + parseFloat(computed.paddingBottom))) * .95; + var verticalPadding = parseFloat(computed.verticalPadding); + + contents.addStylesheetRules({ + "img": { + "max-width": (this._layout.columnWidth ? this._layout.columnWidth - verticalPadding + "px" : "100%") + "!important", + "max-height": height + "px" + "!important", + "object-fit": "contain", + "page-break-inside": "avoid", + "break-inside": "avoid", + "box-sizing": "border-box" + }, + "svg": { + "max-width": (this._layout.columnWidth ? this._layout.columnWidth - verticalPadding + "px" : "100%") + "!important", + "max-height": height + "px" + "!important", + "page-break-inside": "avoid", + "break-inside": "avoid" + } + }); + + return new Promise(function (resolve, reject) { + // Wait to apply + setTimeout(function () { + resolve(); + }, 1); + }); + } + + /** + * Get the Contents object of each rendered view + * @returns {Contents[]} + */ + + }, { + key: "getContents", + value: function getContents() { + return this.manager ? this.manager.getContents() : []; + } + + /** + * Get the views member from the manager + * @returns {Views} + */ + + }, { + key: "views", + value: function views() { + var views = this.manager ? this.manager.views : undefined; + return views || []; + } + + /** + * Hook to handle link clicks in rendered content + * @param {Contents} contents + * @private + */ + + }, { + key: "handleLinks", + value: function handleLinks(contents) { + var _this6 = this; + + if (contents) { + contents.on(_constants.EVENTS.CONTENTS.LINK_CLICKED, function (href) { + var relative = _this6.book.path.relative(href); + _this6.display(relative); + }); + } + } + + /** + * Hook to handle injecting stylesheet before + * a Section is serialized + * @param {document} doc + * @param {Section} section + * @private + */ + + }, { + key: "injectStylesheet", + value: function injectStylesheet(doc, section) { + var style = doc.createElement("link"); + style.setAttribute("type", "text/css"); + style.setAttribute("rel", "stylesheet"); + style.setAttribute("href", this.settings.stylesheet); + doc.getElementsByTagName("head")[0].appendChild(style); + } + + /** + * Hook to handle injecting scripts before + * a Section is serialized + * @param {document} doc + * @param {Section} section + * @private + */ + + }, { + key: "injectScript", + value: function injectScript(doc, section) { + var script = doc.createElement("script"); + script.setAttribute("type", "text/javascript"); + script.setAttribute("src", this.settings.script); + script.textContent = " "; // Needed to prevent self closing tag + doc.getElementsByTagName("head")[0].appendChild(script); + } + + /** + * Hook to handle the document identifier before + * a Section is serialized + * @param {document} doc + * @param {Section} section + * @private + */ + + }, { + key: "injectIdentifier", + value: function injectIdentifier(doc, section) { + var ident = this.book.packaging.metadata.identifier; + var meta = doc.createElement("meta"); + meta.setAttribute("name", "dc.relation.ispartof"); + if (ident) { + meta.setAttribute("content", ident); + } + doc.getElementsByTagName("head")[0].appendChild(meta); + } + }]); + + return Rendition; +}(); + +//-- Enable binding events to Renderer + + +(0, _eventEmitter2.default)(Rendition.prototype); + +exports.default = Rendition; +module.exports = exports["default"]; + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _epubcfi = __webpack_require__(1); + +var _epubcfi2 = _interopRequireDefault(_epubcfi); + +var _core = __webpack_require__(0); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Map text locations to CFI ranges + * @class + * @param {Layout} layout Layout to apply + * @param {string} [direction="ltr"] Text direction + * @param {string} [axis="horizontal"] vertical or horizontal axis + * @param {boolean} [dev] toggle developer highlighting + */ +var Mapping = function () { + function Mapping(layout, direction, axis, dev) { + _classCallCheck(this, Mapping); + + this.layout = layout; + this.horizontal = axis === "horizontal" ? true : false; + this.direction = direction || "ltr"; + this._dev = dev; + } + + /** + * Find CFI pairs for entire section at once + */ + + + _createClass(Mapping, [{ + key: "section", + value: function section(view) { + var ranges = this.findRanges(view); + var map = this.rangeListToCfiList(view.section.cfiBase, ranges); + + return map; + } + + /** + * Find CFI pairs for a page + * @param {Contents} contents Contents from view + * @param {string} cfiBase string of the base for a cfi + * @param {number} start position to start at + * @param {number} end position to end at + */ + + }, { + key: "page", + value: function page(contents, cfiBase, start, end) { + var root = contents && contents.document ? contents.document.body : false; + var result; + + if (!root) { + return; + } + + result = this.rangePairToCfiPair(cfiBase, { + start: this.findStart(root, start, end), + end: this.findEnd(root, start, end) + }); + + if (this._dev === true) { + var doc = contents.document; + var startRange = new _epubcfi2.default(result.start).toRange(doc); + var endRange = new _epubcfi2.default(result.end).toRange(doc); + + var selection = doc.defaultView.getSelection(); + var r = doc.createRange(); + selection.removeAllRanges(); + r.setStart(startRange.startContainer, startRange.startOffset); + r.setEnd(endRange.endContainer, endRange.endOffset); + selection.addRange(r); + } + + return result; + } + + /** + * Walk a node, preforming a function on each node it finds + * @private + * @param {Node} root Node to walkToNode + * @param {function} func walk function + * @return {*} returns the result of the walk function + */ + + }, { + key: "walk", + value: function walk(root, func) { + // IE11 has strange issue, if root is text node IE throws exception on + // calling treeWalker.nextNode(), saying + // Unexpected call to method or property access instead of returing null value + if (root && root.nodeType === Node.TEXT_NODE) { + return; + } + // safeFilter is required so that it can work in IE as filter is a function for IE + // and for other browser filter is an object. + var filter = { + acceptNode: function acceptNode(node) { + if (node.data.trim().length > 0) { + return NodeFilter.FILTER_ACCEPT; + } else { + return NodeFilter.FILTER_REJECT; + } + } + }; + var safeFilter = filter.acceptNode; + safeFilter.acceptNode = filter.acceptNode; + + var treeWalker = document.createTreeWalker(root, NodeFilter.SHOW_TEXT, safeFilter, false); + var node; + var result; + while (node = treeWalker.nextNode()) { + result = func(node); + if (result) break; + } + + return result; + } + }, { + key: "findRanges", + value: function findRanges(view) { + var columns = []; + var scrollWidth = view.contents.scrollWidth(); + var spreads = Math.ceil(scrollWidth / this.layout.spreadWidth); + var count = spreads * this.layout.divisor; + var columnWidth = this.layout.columnWidth; + var gap = this.layout.gap; + var start, end; + + for (var i = 0; i < count.pages; i++) { + start = (columnWidth + gap) * i; + end = columnWidth * (i + 1) + gap * i; + columns.push({ + start: this.findStart(view.document.body, start, end), + end: this.findEnd(view.document.body, start, end) + }); + } + + return columns; + } + + /** + * Find Start Range + * @private + * @param {Node} root root node + * @param {number} start position to start at + * @param {number} end position to end at + * @return {Range} + */ + + }, { + key: "findStart", + value: function findStart(root, start, end) { + var _this = this; + + var stack = [root]; + var $el; + var found; + var $prev = root; + + while (stack.length) { + + $el = stack.shift(); + + found = this.walk($el, function (node) { + var left, right, top, bottom; + var elPos; + var elRange; + + elPos = (0, _core.nodeBounds)(node); + + if (_this.horizontal && _this.direction === "ltr") { + + left = _this.horizontal ? elPos.left : elPos.top; + right = _this.horizontal ? elPos.right : elPos.bottom; + + if (left >= start && left <= end) { + return node; + } else if (right > start) { + return node; + } else { + $prev = node; + stack.push(node); + } + } else if (_this.horizontal && _this.direction === "rtl") { + + left = elPos.left; + right = elPos.right; + + if (right <= end && right >= start) { + return node; + } else if (left < end) { + return node; + } else { + $prev = node; + stack.push(node); + } + } else { + + top = elPos.top; + bottom = elPos.bottom; + + if (top >= start && top <= end) { + return node; + } else if (bottom > start) { + return node; + } else { + $prev = node; + stack.push(node); + } + } + }); + + if (found) { + return this.findTextStartRange(found, start, end); + } + } + + // Return last element + return this.findTextStartRange($prev, start, end); + } + + /** + * Find End Range + * @private + * @param {Node} root root node + * @param {number} start position to start at + * @param {number} end position to end at + * @return {Range} + */ + + }, { + key: "findEnd", + value: function findEnd(root, start, end) { + var _this2 = this; + + var stack = [root]; + var $el; + var $prev = root; + var found; + + while (stack.length) { + + $el = stack.shift(); + + found = this.walk($el, function (node) { + + var left, right, top, bottom; + var elPos; + var elRange; + + elPos = (0, _core.nodeBounds)(node); + + if (_this2.horizontal && _this2.direction === "ltr") { + + left = Math.round(elPos.left); + right = Math.round(elPos.right); + + if (left > end && $prev) { + return $prev; + } else if (right > end) { + return node; + } else { + $prev = node; + stack.push(node); + } + } else if (_this2.horizontal && _this2.direction === "rtl") { + + left = Math.round(_this2.horizontal ? elPos.left : elPos.top); + right = Math.round(_this2.horizontal ? elPos.right : elPos.bottom); + + if (right < start && $prev) { + return $prev; + } else if (left < start) { + return node; + } else { + $prev = node; + stack.push(node); + } + } else { + + top = Math.round(elPos.top); + bottom = Math.round(elPos.bottom); + + if (top > end && $prev) { + return $prev; + } else if (bottom > end) { + return node; + } else { + $prev = node; + stack.push(node); + } + } + }); + + if (found) { + return this.findTextEndRange(found, start, end); + } + } + + // end of chapter + return this.findTextEndRange($prev, start, end); + } + + /** + * Find Text Start Range + * @private + * @param {Node} root root node + * @param {number} start position to start at + * @param {number} end position to end at + * @return {Range} + */ + + }, { + key: "findTextStartRange", + value: function findTextStartRange(node, start, end) { + var ranges = this.splitTextNodeIntoRanges(node); + var range; + var pos; + var left, top, right; + + for (var i = 0; i < ranges.length; i++) { + range = ranges[i]; + + pos = range.getBoundingClientRect(); + + if (this.horizontal && this.direction === "ltr") { + + left = pos.left; + if (left >= start) { + return range; + } + } else if (this.horizontal && this.direction === "rtl") { + + right = pos.right; + if (right <= end) { + return range; + } + } else { + + top = pos.top; + if (top >= start) { + return range; + } + } + + // prev = range; + } + + return ranges[0]; + } + + /** + * Find Text End Range + * @private + * @param {Node} root root node + * @param {number} start position to start at + * @param {number} end position to end at + * @return {Range} + */ + + }, { + key: "findTextEndRange", + value: function findTextEndRange(node, start, end) { + var ranges = this.splitTextNodeIntoRanges(node); + var prev; + var range; + var pos; + var left, right, top, bottom; + + for (var i = 0; i < ranges.length; i++) { + range = ranges[i]; + + pos = range.getBoundingClientRect(); + + if (this.horizontal && this.direction === "ltr") { + + left = pos.left; + right = pos.right; + + if (left > end && prev) { + return prev; + } else if (right > end) { + return range; + } + } else if (this.horizontal && this.direction === "rtl") { + + left = pos.left; + right = pos.right; + + if (right < start && prev) { + return prev; + } else if (left < start) { + return range; + } + } else { + + top = pos.top; + bottom = pos.bottom; + + if (top > end && prev) { + return prev; + } else if (bottom > end) { + return range; + } + } + + prev = range; + } + + // Ends before limit + return ranges[ranges.length - 1]; + } + + /** + * Split up a text node into ranges for each word + * @private + * @param {Node} root root node + * @param {string} [_splitter] what to split on + * @return {Range[]} + */ + + }, { + key: "splitTextNodeIntoRanges", + value: function splitTextNodeIntoRanges(node, _splitter) { + var ranges = []; + var textContent = node.textContent || ""; + var text = textContent.trim(); + var range; + var doc = node.ownerDocument; + var splitter = _splitter || " "; + + var pos = text.indexOf(splitter); + + if (pos === -1 || node.nodeType != Node.TEXT_NODE) { + range = doc.createRange(); + range.selectNodeContents(node); + return [range]; + } + + range = doc.createRange(); + range.setStart(node, 0); + range.setEnd(node, pos); + ranges.push(range); + range = false; + + while (pos != -1) { + + pos = text.indexOf(splitter, pos + 1); + if (pos > 0) { + + if (range) { + range.setEnd(node, pos); + ranges.push(range); + } + + range = doc.createRange(); + range.setStart(node, pos + 1); + } + } + + if (range) { + range.setEnd(node, text.length); + ranges.push(range); + } + + return ranges; + } + + /** + * Turn a pair of ranges into a pair of CFIs + * @private + * @param {string} cfiBase base string for an EpubCFI + * @param {object} rangePair { start: Range, end: Range } + * @return {object} { start: "epubcfi(...)", end: "epubcfi(...)" } + */ + + }, { + key: "rangePairToCfiPair", + value: function rangePairToCfiPair(cfiBase, rangePair) { + + var startRange = rangePair.start; + var endRange = rangePair.end; + + startRange.collapse(true); + endRange.collapse(false); + + var startCfi = new _epubcfi2.default(startRange, cfiBase).toString(); + var endCfi = new _epubcfi2.default(endRange, cfiBase).toString(); + + return { + start: startCfi, + end: endCfi + }; + } + }, { + key: "rangeListToCfiList", + value: function rangeListToCfiList(cfiBase, columns) { + var map = []; + var cifPair; + + for (var i = 0; i < columns.length; i++) { + cifPair = this.rangePairToCfiPair(cfiBase, columns[i]); + + map.push(cifPair); + } + + return map; + } + + /** + * Set the axis for mapping + * @param {string} axis horizontal | vertical + * @return {boolean} is it horizontal? + */ + + }, { + key: "axis", + value: function axis(_axis) { + if (_axis) { + this.horizontal = _axis === "horizontal" ? true : false; + } + return this.horizontal; + } + }]); + + return Mapping; +}(); + +exports.default = Mapping; +module.exports = exports["default"]; + +/***/ }), +/* 20 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _eventEmitter = __webpack_require__(3); + +var _eventEmitter2 = _interopRequireDefault(_eventEmitter); + +var _core = __webpack_require__(0); + +var _epubcfi = __webpack_require__(1); + +var _epubcfi2 = _interopRequireDefault(_epubcfi); + +var _contents = __webpack_require__(14); + +var _contents2 = _interopRequireDefault(_contents); + +var _constants = __webpack_require__(2); + +var _marksPane = __webpack_require__(56); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +var IframeView = function () { + function IframeView(section, options) { + _classCallCheck(this, IframeView); + + this.settings = (0, _core.extend)({ + ignoreClass: "", + axis: options.layout && options.layout.props.flow === "scrolled" ? "vertical" : "horizontal", + direction: undefined, + width: 0, + height: 0, + layout: undefined, + globalLayoutProperties: {}, + method: undefined + }, options || {}); + + this.id = "epubjs-view-" + (0, _core.uuid)(); + this.section = section; + this.index = section.index; + + this.element = this.container(this.settings.axis); + + this.added = false; + this.displayed = false; + this.rendered = false; + + // this.width = this.settings.width; + // this.height = this.settings.height; + + this.fixedWidth = 0; + this.fixedHeight = 0; + + // Blank Cfi for Parsing + this.epubcfi = new _epubcfi2.default(); + + this.layout = this.settings.layout; + // Dom events to listen for + // this.listenedEvents = ["keydown", "keyup", "keypressed", "mouseup", "mousedown", "click", "touchend", "touchstart"]; + + this.pane = undefined; + this.highlights = {}; + this.underlines = {}; + this.marks = {}; + } + + _createClass(IframeView, [{ + key: "container", + value: function container(axis) { + var element = document.createElement("div"); + + element.classList.add("epub-view"); + + // this.element.style.minHeight = "100px"; + element.style.height = "0px"; + element.style.width = "0px"; + element.style.overflow = "hidden"; + element.style.position = "relative"; + element.style.display = "block"; + + if (axis && axis == "horizontal") { + element.style.flex = "none"; + } else { + element.style.flex = "initial"; + } + + return element; + } + }, { + key: "create", + value: function create() { + + if (this.iframe) { + return this.iframe; + } + + if (!this.element) { + this.element = this.createContainer(); + } + + this.iframe = document.createElement("iframe"); + this.iframe.id = this.id; + this.iframe.scrolling = "no"; // Might need to be removed: breaks ios width calculations + this.iframe.style.overflow = "hidden"; + this.iframe.seamless = "seamless"; + // Back up if seamless isn't supported + this.iframe.style.border = "none"; + + this.iframe.setAttribute("enable-annotation", "true"); + + this.resizing = true; + + // this.iframe.style.display = "none"; + this.element.style.visibility = "hidden"; + this.iframe.style.visibility = "hidden"; + + this.iframe.style.width = "0"; + this.iframe.style.height = "0"; + this._width = 0; + this._height = 0; + + this.element.setAttribute("ref", this.index); + + this.added = true; + + this.elementBounds = (0, _core.bounds)(this.element); + + // if(width || height){ + // this.resize(width, height); + // } else if(this.width && this.height){ + // this.resize(this.width, this.height); + // } else { + // this.iframeBounds = bounds(this.iframe); + // } + + + if ("srcdoc" in this.iframe) { + this.supportsSrcdoc = true; + } else { + this.supportsSrcdoc = false; + } + + if (!this.settings.method) { + this.settings.method = this.supportsSrcdoc ? "srcdoc" : "write"; + } + + return this.iframe; + } + }, { + key: "render", + value: function render(request, show) { + + // view.onLayout = this.layout.format.bind(this.layout); + this.create(); + + // Fit to size of the container, apply padding + this.size(); + + if (!this.sectionRender) { + this.sectionRender = this.section.render(request); + } + + // Render Chain + return this.sectionRender.then(function (contents) { + return this.load(contents); + }.bind(this)).then(function () { + var _this = this; + + // apply the layout function to the contents + this.layout.format(this.contents); + + // find and report the writingMode axis + var writingMode = this.contents.writingMode(); + var axis = writingMode.indexOf("vertical") === 0 ? "vertical" : "horizontal"; + + this.setAxis(axis); + this.emit(_constants.EVENTS.VIEWS.AXIS, axis); + + // Listen for events that require an expansion of the iframe + this.addListeners(); + + return new Promise(function (resolve, reject) { + // Expand the iframe to the full size of the content + _this.expand(); + resolve(); + }); + }.bind(this), function (e) { + this.emit(_constants.EVENTS.VIEWS.LOAD_ERROR, e); + return new Promise(function (resolve, reject) { + reject(e); + }); + }.bind(this)).then(function () { + this.emit(_constants.EVENTS.VIEWS.RENDERED, this.section); + }.bind(this)); + } + }, { + key: "reset", + value: function reset() { + if (this.iframe) { + this.iframe.style.width = "0"; + this.iframe.style.height = "0"; + this._width = 0; + this._height = 0; + this._textWidth = undefined; + this._contentWidth = undefined; + this._textHeight = undefined; + this._contentHeight = undefined; + } + this._needsReframe = true; + } + + // Determine locks base on settings + + }, { + key: "size", + value: function size(_width, _height) { + var width = _width || this.settings.width; + var height = _height || this.settings.height; + + if (this.layout.name === "pre-paginated") { + this.lock("both", width, height); + } else if (this.settings.axis === "horizontal") { + this.lock("height", width, height); + } else { + this.lock("width", width, height); + } + + this.settings.width = width; + this.settings.height = height; + } + + // Lock an axis to element dimensions, taking borders into account + + }, { + key: "lock", + value: function lock(what, width, height) { + var elBorders = (0, _core.borders)(this.element); + var iframeBorders; + + if (this.iframe) { + iframeBorders = (0, _core.borders)(this.iframe); + } else { + iframeBorders = { width: 0, height: 0 }; + } + + if (what == "width" && (0, _core.isNumber)(width)) { + this.lockedWidth = width - elBorders.width - iframeBorders.width; + // this.resize(this.lockedWidth, width); // width keeps ratio correct + } + + if (what == "height" && (0, _core.isNumber)(height)) { + this.lockedHeight = height - elBorders.height - iframeBorders.height; + // this.resize(width, this.lockedHeight); + } + + if (what === "both" && (0, _core.isNumber)(width) && (0, _core.isNumber)(height)) { + + this.lockedWidth = width - elBorders.width - iframeBorders.width; + this.lockedHeight = height - elBorders.height - iframeBorders.height; + // this.resize(this.lockedWidth, this.lockedHeight); + } + + if (this.displayed && this.iframe) { + + // this.contents.layout(); + this.expand(); + } + } + + // Resize a single axis based on content dimensions + + }, { + key: "expand", + value: function expand(force) { + var width = this.lockedWidth; + var height = this.lockedHeight; + var columns; + + var textWidth, textHeight; + + if (!this.iframe || this._expanding) return; + + this._expanding = true; + + if (this.layout.name === "pre-paginated") { + width = this.layout.columnWidth; + height = this.layout.height; + } + // Expand Horizontally + else if (this.settings.axis === "horizontal") { + // Get the width of the text + width = this.contents.textWidth(); + + if (width % this.layout.pageWidth > 0) { + width = Math.ceil(width / this.layout.pageWidth) * this.layout.pageWidth; + } + + if (this.settings.forceEvenPages) { + columns = width / this.layout.pageWidth; + if (this.layout.divisor > 1 && this.layout.name === "reflowable" && columns % 2 > 0) { + // add a blank page + width += this.layout.pageWidth; + } + } + } // Expand Vertically + else if (this.settings.axis === "vertical") { + height = this.contents.textHeight(); + } + + // Only Resize if dimensions have changed or + // if Frame is still hidden, so needs reframing + if (this._needsReframe || width != this._width || height != this._height) { + this.reframe(width, height); + } + + this._expanding = false; + } + }, { + key: "reframe", + value: function reframe(width, height) { + var _this2 = this; + + var size; + + if ((0, _core.isNumber)(width)) { + this.element.style.width = width + "px"; + this.iframe.style.width = width + "px"; + this._width = width; + } + + if ((0, _core.isNumber)(height)) { + this.element.style.height = height + "px"; + this.iframe.style.height = height + "px"; + this._height = height; + } + + var widthDelta = this.prevBounds ? width - this.prevBounds.width : width; + var heightDelta = this.prevBounds ? height - this.prevBounds.height : height; + + size = { + width: width, + height: height, + widthDelta: widthDelta, + heightDelta: heightDelta + }; + + this.pane && this.pane.render(); + + requestAnimationFrame(function () { + var mark = void 0; + for (var m in _this2.marks) { + if (_this2.marks.hasOwnProperty(m)) { + mark = _this2.marks[m]; + _this2.placeMark(mark.element, mark.range); + } + } + }); + + this.onResize(this, size); + + this.emit(_constants.EVENTS.VIEWS.RESIZED, size); + + this.prevBounds = size; + + this.elementBounds = (0, _core.bounds)(this.element); + } + }, { + key: "load", + value: function load(contents) { + var loading = new _core.defer(); + var loaded = loading.promise; + + if (!this.iframe) { + loading.reject(new Error("No Iframe Available")); + return loaded; + } + + this.iframe.onload = function (event) { + + this.onLoad(event, loading); + }.bind(this); + + if (this.settings.method === "blobUrl") { + this.blobUrl = (0, _core.createBlobUrl)(contents, "application/xhtml+xml"); + this.iframe.src = this.blobUrl; + this.element.appendChild(this.iframe); + } else if (this.settings.method === "srcdoc") { + this.iframe.srcdoc = contents; + this.element.appendChild(this.iframe); + } else { + + this.element.appendChild(this.iframe); + + this.document = this.iframe.contentDocument; + + if (!this.document) { + loading.reject(new Error("No Document Available")); + return loaded; + } + + this.iframe.contentDocument.open(); + this.iframe.contentDocument.write(contents); + this.iframe.contentDocument.close(); + } + + return loaded; + } + }, { + key: "onLoad", + value: function onLoad(event, promise) { + var _this3 = this; + + this.window = this.iframe.contentWindow; + this.document = this.iframe.contentDocument; + + this.contents = new _contents2.default(this.document, this.document.body, this.section.cfiBase, this.section.index); + + this.rendering = false; + + var link = this.document.querySelector("link[rel='canonical']"); + if (link) { + link.setAttribute("href", this.section.canonical); + } else { + link = this.document.createElement("link"); + link.setAttribute("rel", "canonical"); + link.setAttribute("href", this.section.canonical); + this.document.querySelector("head").appendChild(link); + } + + this.contents.on(_constants.EVENTS.CONTENTS.EXPAND, function () { + if (_this3.displayed && _this3.iframe) { + _this3.expand(); + if (_this3.contents) { + _this3.layout.format(_this3.contents); + } + } + }); + + this.contents.on(_constants.EVENTS.CONTENTS.RESIZE, function (e) { + if (_this3.displayed && _this3.iframe) { + _this3.expand(); + if (_this3.contents) { + _this3.layout.format(_this3.contents); + } + } + }); + + promise.resolve(this.contents); + } + }, { + key: "setLayout", + value: function setLayout(layout) { + this.layout = layout; + + if (this.contents) { + this.layout.format(this.contents); + this.expand(); + } + } + }, { + key: "setAxis", + value: function setAxis(axis) { + + // Force vertical for scrolled + if (this.layout.props.flow === "scrolled") { + axis = "vertical"; + } + + this.settings.axis = axis; + + if (axis == "horizontal") { + this.element.style.flex = "none"; + } else { + this.element.style.flex = "initial"; + } + + this.size(); + } + }, { + key: "addListeners", + value: function addListeners() { + //TODO: Add content listeners for expanding + } + }, { + key: "removeListeners", + value: function removeListeners(layoutFunc) { + //TODO: remove content listeners for expanding + } + }, { + key: "display", + value: function display(request) { + var displayed = new _core.defer(); + + if (!this.displayed) { + + this.render(request).then(function () { + + this.emit(_constants.EVENTS.VIEWS.DISPLAYED, this); + this.onDisplayed(this); + + this.displayed = true; + displayed.resolve(this); + }.bind(this), function (err) { + displayed.reject(err, this); + }); + } else { + displayed.resolve(this); + } + + return displayed.promise; + } + }, { + key: "show", + value: function show() { + + this.element.style.visibility = "visible"; + + if (this.iframe) { + this.iframe.style.visibility = "visible"; + + // Remind Safari to redraw the iframe + this.iframe.style.transform = "translateZ(0)"; + this.iframe.offsetWidth; + this.iframe.style.transform = null; + } + + this.emit(_constants.EVENTS.VIEWS.SHOWN, this); + } + }, { + key: "hide", + value: function hide() { + // this.iframe.style.display = "none"; + this.element.style.visibility = "hidden"; + this.iframe.style.visibility = "hidden"; + + this.stopExpanding = true; + this.emit(_constants.EVENTS.VIEWS.HIDDEN, this); + } + }, { + key: "offset", + value: function offset() { + return { + top: this.element.offsetTop, + left: this.element.offsetLeft + }; + } + }, { + key: "width", + value: function width() { + return this._width; + } + }, { + key: "height", + value: function height() { + return this._height; + } + }, { + key: "position", + value: function position() { + return this.element.getBoundingClientRect(); + } + }, { + key: "locationOf", + value: function locationOf(target) { + var parentPos = this.iframe.getBoundingClientRect(); + var targetPos = this.contents.locationOf(target, this.settings.ignoreClass); + + return { + "left": targetPos.left, + "top": targetPos.top + }; + } + }, { + key: "onDisplayed", + value: function onDisplayed(view) { + // Stub, override with a custom functions + } + }, { + key: "onResize", + value: function onResize(view, e) { + // Stub, override with a custom functions + } + }, { + key: "bounds", + value: function bounds(force) { + if (force || !this.elementBounds) { + this.elementBounds = (0, _core.bounds)(this.element); + } + + return this.elementBounds; + } + }, { + key: "highlight", + value: function highlight(cfiRange) { + var data = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var cb = arguments[2]; + + var _this4 = this; + + var className = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : "epubjs-hl"; + var styles = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : {}; + + if (!this.contents) { + return; + } + var attributes = Object.assign({ "fill": "yellow", "fill-opacity": "0.3", "mix-blend-mode": "multiply" }, styles); + var range = this.contents.range(cfiRange); + + var emitter = function emitter() { + _this4.emit(_constants.EVENTS.VIEWS.MARK_CLICKED, cfiRange, data); + }; + + data["epubcfi"] = cfiRange; + + if (!this.pane) { + this.pane = new _marksPane.Pane(this.iframe, this.element); + } + + var m = new _marksPane.Highlight(range, className, data, attributes); + var h = this.pane.addMark(m); + + this.highlights[cfiRange] = { "mark": h, "element": h.element, "listeners": [emitter, cb] }; + + h.element.setAttribute("ref", className); + h.element.addEventListener("click", emitter); + h.element.addEventListener("touchstart", emitter); + + if (cb) { + h.element.addEventListener("click", cb); + h.element.addEventListener("touchstart", cb); + } + return h; + } + }, { + key: "underline", + value: function underline(cfiRange) { + var data = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var cb = arguments[2]; + + var _this5 = this; + + var className = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : "epubjs-ul"; + var styles = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : {}; + + if (!this.contents) { + return; + } + var attributes = Object.assign({ "stroke": "black", "stroke-opacity": "0.3", "mix-blend-mode": "multiply" }, styles); + var range = this.contents.range(cfiRange); + var emitter = function emitter() { + _this5.emit(_constants.EVENTS.VIEWS.MARK_CLICKED, cfiRange, data); + }; + + data["epubcfi"] = cfiRange; + + if (!this.pane) { + this.pane = new _marksPane.Pane(this.iframe, this.element); + } + + var m = new _marksPane.Underline(range, className, data, attributes); + var h = this.pane.addMark(m); + + this.underlines[cfiRange] = { "mark": h, "element": h.element, "listeners": [emitter, cb] }; + + h.element.setAttribute("ref", className); + h.element.addEventListener("click", emitter); + h.element.addEventListener("touchstart", emitter); + + if (cb) { + h.element.addEventListener("click", cb); + h.element.addEventListener("touchstart", cb); + } + return h; + } + }, { + key: "mark", + value: function mark(cfiRange) { + var _this6 = this; + + var data = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var cb = arguments[2]; + + if (!this.contents) { + return; + } + + if (cfiRange in this.marks) { + var item = this.marks[cfiRange]; + return item; + } + + var range = this.contents.range(cfiRange); + if (!range) { + return; + } + var container = range.commonAncestorContainer; + var parent = container.nodeType === 1 ? container : container.parentNode; + + var emitter = function emitter(e) { + _this6.emit(_constants.EVENTS.VIEWS.MARK_CLICKED, cfiRange, data); + }; + + if (range.collapsed && container.nodeType === 1) { + range = new Range(); + range.selectNodeContents(container); + } else if (range.collapsed) { + // Webkit doesn't like collapsed ranges + range = new Range(); + range.selectNodeContents(parent); + } + + var mark = this.document.createElement("a"); + mark.setAttribute("ref", "epubjs-mk"); + mark.style.position = "absolute"; + + mark.dataset["epubcfi"] = cfiRange; + + if (data) { + Object.keys(data).forEach(function (key) { + mark.dataset[key] = data[key]; + }); + } + + if (cb) { + mark.addEventListener("click", cb); + mark.addEventListener("touchstart", cb); + } + + mark.addEventListener("click", emitter); + mark.addEventListener("touchstart", emitter); + + this.placeMark(mark, range); + + this.element.appendChild(mark); + + this.marks[cfiRange] = { "element": mark, "range": range, "listeners": [emitter, cb] }; + + return parent; + } + }, { + key: "placeMark", + value: function placeMark(element, range) { + var top = void 0, + right = void 0, + left = void 0; + + if (this.layout.name === "pre-paginated" || this.settings.axis !== "horizontal") { + var pos = range.getBoundingClientRect(); + top = pos.top; + right = pos.right; + } else { + // Element might break columns, so find the left most element + var rects = range.getClientRects(); + + var rect = void 0; + for (var i = 0; i != rects.length; i++) { + rect = rects[i]; + if (!left || rect.left < left) { + left = rect.left; + // right = rect.right; + right = Math.ceil(left / this.layout.props.pageWidth) * this.layout.props.pageWidth - this.layout.gap / 2; + top = rect.top; + } + } + } + + element.style.top = top + "px"; + element.style.left = right + "px"; + } + }, { + key: "unhighlight", + value: function unhighlight(cfiRange) { + var item = void 0; + if (cfiRange in this.highlights) { + item = this.highlights[cfiRange]; + + this.pane.removeMark(item.mark); + item.listeners.forEach(function (l) { + if (l) { + item.element.removeEventListener("click", l); + item.element.removeEventListener("touchstart", l); + }; + }); + delete this.highlights[cfiRange]; + } + } + }, { + key: "ununderline", + value: function ununderline(cfiRange) { + var item = void 0; + if (cfiRange in this.underlines) { + item = this.underlines[cfiRange]; + this.pane.removeMark(item.mark); + item.listeners.forEach(function (l) { + if (l) { + item.element.removeEventListener("click", l); + item.element.removeEventListener("touchstart", l); + }; + }); + delete this.underlines[cfiRange]; + } + } + }, { + key: "unmark", + value: function unmark(cfiRange) { + var item = void 0; + if (cfiRange in this.marks) { + item = this.marks[cfiRange]; + this.element.removeChild(item.element); + item.listeners.forEach(function (l) { + if (l) { + item.element.removeEventListener("click", l); + item.element.removeEventListener("touchstart", l); + }; + }); + delete this.marks[cfiRange]; + } + } + }, { + key: "destroy", + value: function destroy() { + + for (var cfiRange in this.highlights) { + this.unhighlight(cfiRange); + } + + for (var _cfiRange in this.underlines) { + this.ununderline(_cfiRange); + } + + for (var _cfiRange2 in this.marks) { + this.unmark(_cfiRange2); + } + + if (this.blobUrl) { + (0, _core.revokeBlobUrl)(this.blobUrl); + } + + if (this.displayed) { + this.displayed = false; + + this.removeListeners(); + this.contents.destroy(); + + this.stopExpanding = true; + this.element.removeChild(this.iframe); + + this.iframe = undefined; + this.contents = undefined; + + this._textWidth = null; + this._textHeight = null; + this._width = null; + this._height = null; + } + + // this.element.style.height = "0px"; + // this.element.style.width = "0px"; + } + }]); + + return IframeView; +}(); + +(0, _eventEmitter2.default)(IframeView.prototype); + +exports.default = IframeView; +module.exports = exports["default"]; + +/***/ }), +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { + +var isObject = __webpack_require__(16), + now = __webpack_require__(61), + toNumber = __webpack_require__(63); + +/** Error message constants. */ +var FUNC_ERROR_TEXT = 'Expected a function'; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeMax = Math.max, + nativeMin = Math.min; + +/** + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide `options` to indicate whether `func` should be invoked on the + * leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent + * calls to the debounced function return the result of the last `func` + * invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the debounced function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); + * + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); + */ +function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; + } + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + timeWaiting = wait - timeSinceLastCall; + + return maxing + ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) + : timeWaiting; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return (lastCallTime === undefined || (timeSinceLastCall >= wait) || + (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); + } + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); + } + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; +} + +module.exports = debounce; + + +/***/ }), +/* 22 */ +/***/ (function(module, exports, __webpack_require__) { + +var freeGlobal = __webpack_require__(62); + +/** Detect free variable `self`. */ +var freeSelf = typeof self == 'object' && self && self.Object === Object && self; + +/** Used as a reference to the global object. */ +var root = freeGlobal || freeSelf || Function('return this')(); + +module.exports = root; + + +/***/ }), +/* 23 */ +/***/ (function(module, exports, __webpack_require__) { + +var root = __webpack_require__(22); + +/** Built-in value references. */ +var Symbol = root.Symbol; + +module.exports = Symbol; + + +/***/ }), +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _get = function get(object, property, receiver) { if (object === null) object = Function.prototype; var desc = Object.getOwnPropertyDescriptor(object, property); if (desc === undefined) { var parent = Object.getPrototypeOf(object); if (parent === null) { return undefined; } else { return get(parent, property, receiver); } } else if ("value" in desc) { return desc.value; } else { var getter = desc.get; if (getter === undefined) { return undefined; } return getter.call(receiver); } }; + +var _core = __webpack_require__(0); + +var _default = __webpack_require__(15); + +var _default2 = _interopRequireDefault(_default); + +var _snap = __webpack_require__(70); + +var _snap2 = _interopRequireDefault(_snap); + +var _constants = __webpack_require__(2); + +var _debounce = __webpack_require__(21); + +var _debounce2 = _interopRequireDefault(_debounce); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var ContinuousViewManager = function (_DefaultViewManager) { + _inherits(ContinuousViewManager, _DefaultViewManager); + + function ContinuousViewManager(options) { + _classCallCheck(this, ContinuousViewManager); + + var _this = _possibleConstructorReturn(this, (ContinuousViewManager.__proto__ || Object.getPrototypeOf(ContinuousViewManager)).call(this, options)); + + _this.name = "continuous"; + + _this.settings = (0, _core.extend)(_this.settings || {}, { + infinite: true, + overflow: undefined, + axis: undefined, + flow: "scrolled", + offset: 500, + offsetDelta: 250, + width: undefined, + height: undefined, + snap: false, + afterScrolledTimeout: 10 + }); + + (0, _core.extend)(_this.settings, options.settings || {}); + + // Gap can be 0, but defaults doesn't handle that + if (options.settings.gap != "undefined" && options.settings.gap === 0) { + _this.settings.gap = options.settings.gap; + } + + _this.viewSettings = { + ignoreClass: _this.settings.ignoreClass, + axis: _this.settings.axis, + flow: _this.settings.flow, + layout: _this.layout, + width: 0, + height: 0, + forceEvenPages: false + }; + + _this.scrollTop = 0; + _this.scrollLeft = 0; + return _this; + } + + _createClass(ContinuousViewManager, [{ + key: "display", + value: function display(section, target) { + return _default2.default.prototype.display.call(this, section, target).then(function () { + return this.fill(); + }.bind(this)); + } + }, { + key: "fill", + value: function fill(_full) { + var _this2 = this; + + var full = _full || new _core.defer(); + + this.q.enqueue(function () { + return _this2.check(); + }).then(function (result) { + if (result) { + _this2.fill(full); + } else { + full.resolve(); + } + }); + + return full.promise; + } + }, { + key: "moveTo", + value: function moveTo(offset) { + // var bounds = this.stage.bounds(); + // var dist = Math.floor(offset.top / bounds.height) * bounds.height; + var distX = 0, + distY = 0; + + var offsetX = 0, + offsetY = 0; + + if (!this.isPaginated) { + distY = offset.top; + offsetY = offset.top + this.settings.offsetDelta; + } else { + distX = Math.floor(offset.left / this.layout.delta) * this.layout.delta; + offsetX = distX + this.settings.offsetDelta; + } + + if (distX > 0 || distY > 0) { + this.scrollBy(distX, distY, true); + } + } + }, { + key: "afterResized", + value: function afterResized(view) { + this.emit(_constants.EVENTS.MANAGERS.RESIZE, view.section); + } + + // Remove Previous Listeners if present + + }, { + key: "removeShownListeners", + value: function removeShownListeners(view) { + + // view.off("shown", this.afterDisplayed); + // view.off("shown", this.afterDisplayedAbove); + view.onDisplayed = function () {}; + } + }, { + key: "add", + value: function add(section) { + var _this3 = this; + + var view = this.createView(section); + + this.views.append(view); + + view.on(_constants.EVENTS.VIEWS.RESIZED, function (bounds) { + view.expanded = true; + }); + + view.on(_constants.EVENTS.VIEWS.AXIS, function (axis) { + _this3.updateAxis(axis); + }); + + // view.on(EVENTS.VIEWS.SHOWN, this.afterDisplayed.bind(this)); + view.onDisplayed = this.afterDisplayed.bind(this); + view.onResize = this.afterResized.bind(this); + + return view.display(this.request); + } + }, { + key: "append", + value: function append(section) { + var _this4 = this; + + var view = this.createView(section); + + view.on(_constants.EVENTS.VIEWS.RESIZED, function (bounds) { + view.expanded = true; + }); + + view.on(_constants.EVENTS.VIEWS.AXIS, function (axis) { + _this4.updateAxis(axis); + }); + + this.views.append(view); + + view.onDisplayed = this.afterDisplayed.bind(this); + + return view; + } + }, { + key: "prepend", + value: function prepend(section) { + var _this5 = this; + + var view = this.createView(section); + + view.on(_constants.EVENTS.VIEWS.RESIZED, function (bounds) { + _this5.counter(bounds); + view.expanded = true; + }); + + view.on(_constants.EVENTS.VIEWS.AXIS, function (axis) { + _this5.updateAxis(axis); + }); + + this.views.prepend(view); + + view.onDisplayed = this.afterDisplayed.bind(this); + + return view; + } + }, { + key: "counter", + value: function counter(bounds) { + if (this.settings.axis === "vertical") { + this.scrollBy(0, bounds.heightDelta, true); + } else { + this.scrollBy(bounds.widthDelta, 0, true); + } + } + }, { + key: "update", + value: function update(_offset) { + var container = this.bounds(); + var views = this.views.all(); + var viewsLength = views.length; + var visible = []; + var offset = typeof _offset != "undefined" ? _offset : this.settings.offset || 0; + var isVisible; + var view; + + var updating = new _core.defer(); + var promises = []; + for (var i = 0; i < viewsLength; i++) { + view = views[i]; + + isVisible = this.isVisible(view, offset, offset, container); + + if (isVisible === true) { + // console.log("visible " + view.index); + + if (!view.displayed) { + var displayed = view.display(this.request).then(function (view) { + view.show(); + }, function (err) { + view.hide(); + }); + promises.push(displayed); + } else { + view.show(); + } + visible.push(view); + } else { + this.q.enqueue(view.destroy.bind(view)); + // console.log("hidden " + view.index); + + clearTimeout(this.trimTimeout); + this.trimTimeout = setTimeout(function () { + this.q.enqueue(this.trim.bind(this)); + }.bind(this), 250); + } + } + + if (promises.length) { + return Promise.all(promises).catch(function (err) { + updating.reject(err); + }); + } else { + updating.resolve(); + return updating.promise; + } + } + }, { + key: "check", + value: function check(_offsetLeft, _offsetTop) { + var _this6 = this; + + var checking = new _core.defer(); + var newViews = []; + + var horizontal = this.settings.axis === "horizontal"; + var delta = this.settings.offset || 0; + + if (_offsetLeft && horizontal) { + delta = _offsetLeft; + } + + if (_offsetTop && !horizontal) { + delta = _offsetTop; + } + + var bounds = this._bounds; // bounds saved this until resize + + var rtl = this.settings.direction === "rtl"; + var dir = horizontal && rtl ? -1 : 1; //RTL reverses scrollTop + + var offset = horizontal ? this.scrollLeft : this.scrollTop * dir; + var visibleLength = horizontal ? Math.floor(bounds.width) : bounds.height; + var contentLength = horizontal ? this.container.scrollWidth : this.container.scrollHeight; + + var prepend = function prepend() { + var first = _this6.views.first(); + var prev = first && first.section.prev(); + + if (prev) { + newViews.push(_this6.prepend(prev)); + } + }; + + var append = function append() { + var last = _this6.views.last(); + var next = last && last.section.next(); + + if (next) { + newViews.push(_this6.append(next)); + } + }; + + if (offset + visibleLength + delta >= contentLength) { + if (horizontal && rtl) { + prepend(); + } else { + append(); + } + } + + if (offset - delta < 0) { + if (horizontal && rtl) { + append(); + } else { + prepend(); + } + } + + var promises = newViews.map(function (view) { + return view.displayed; + }); + + if (newViews.length) { + return Promise.all(promises).then(function () { + if (_this6.layout.name === "pre-paginated" && _this6.layout.props.spread) { + return _this6.check(); + } + }).then(function () { + // Check to see if anything new is on screen after rendering + return _this6.update(delta); + }, function (err) { + return err; + }); + } else { + this.q.enqueue(function () { + this.update(); + }.bind(this)); + checking.resolve(false); + return checking.promise; + } + } + }, { + key: "trim", + value: function trim() { + var task = new _core.defer(); + var displayed = this.views.displayed(); + var first = displayed[0]; + var last = displayed[displayed.length - 1]; + var firstIndex = this.views.indexOf(first); + var lastIndex = this.views.indexOf(last); + var above = this.views.slice(0, firstIndex); + var below = this.views.slice(lastIndex + 1); + + // Erase all but last above + for (var i = 0; i < above.length - 1; i++) { + this.erase(above[i], above); + } + + // Erase all except first below + for (var j = 1; j < below.length; j++) { + this.erase(below[j]); + } + + task.resolve(); + return task.promise; + } + }, { + key: "erase", + value: function erase(view, above) { + //Trim + + var prevTop; + var prevLeft; + + if (!this.settings.fullsize) { + prevTop = this.container.scrollTop; + prevLeft = this.container.scrollLeft; + } else { + prevTop = window.scrollY; + prevLeft = window.scrollX; + } + + var bounds = view.bounds(); + + this.views.remove(view); + + if (above) { + if (this.settings.axis === "vertical") { + this.scrollTo(0, prevTop - bounds.height, true); + } else { + this.scrollTo(prevLeft - Math.floor(bounds.width), 0, true); + } + } + } + }, { + key: "addEventListeners", + value: function addEventListeners(stage) { + + window.addEventListener("unload", function (e) { + this.ignore = true; + // this.scrollTo(0,0); + this.destroy(); + }.bind(this)); + + this.addScrollListeners(); + + if (this.isPaginated && this.settings.snap) { + this.snapper = new _snap2.default(this, this.settings.snap && _typeof(this.settings.snap) === "object" && this.settings.snap); + } + } + }, { + key: "addScrollListeners", + value: function addScrollListeners() { + var scroller; + + this.tick = _core.requestAnimationFrame; + + if (!this.settings.fullsize) { + this.prevScrollTop = this.container.scrollTop; + this.prevScrollLeft = this.container.scrollLeft; + } else { + this.prevScrollTop = window.scrollY; + this.prevScrollLeft = window.scrollX; + } + + this.scrollDeltaVert = 0; + this.scrollDeltaHorz = 0; + + if (!this.settings.fullsize) { + scroller = this.container; + this.scrollTop = this.container.scrollTop; + this.scrollLeft = this.container.scrollLeft; + } else { + scroller = window; + this.scrollTop = window.scrollY; + this.scrollLeft = window.scrollX; + } + + this._onScroll = this.onScroll.bind(this); + scroller.addEventListener("scroll", this._onScroll); + this._scrolled = (0, _debounce2.default)(this.scrolled.bind(this), 30); + // this.tick.call(window, this.onScroll.bind(this)); + + this.didScroll = false; + } + }, { + key: "removeEventListeners", + value: function removeEventListeners() { + var scroller; + + if (!this.settings.fullsize) { + scroller = this.container; + } else { + scroller = window; + } + + scroller.removeEventListener("scroll", this._onScroll); + this._onScroll = undefined; + } + }, { + key: "onScroll", + value: function onScroll() { + var scrollTop = void 0; + var scrollLeft = void 0; + var dir = this.settings.direction === "rtl" ? -1 : 1; + + if (!this.settings.fullsize) { + scrollTop = this.container.scrollTop; + scrollLeft = this.container.scrollLeft; + } else { + scrollTop = window.scrollY * dir; + scrollLeft = window.scrollX * dir; + } + + this.scrollTop = scrollTop; + this.scrollLeft = scrollLeft; + + if (!this.ignore) { + + this._scrolled(); + } else { + this.ignore = false; + } + + this.scrollDeltaVert += Math.abs(scrollTop - this.prevScrollTop); + this.scrollDeltaHorz += Math.abs(scrollLeft - this.prevScrollLeft); + + this.prevScrollTop = scrollTop; + this.prevScrollLeft = scrollLeft; + + clearTimeout(this.scrollTimeout); + this.scrollTimeout = setTimeout(function () { + this.scrollDeltaVert = 0; + this.scrollDeltaHorz = 0; + }.bind(this), 150); + + clearTimeout(this.afterScrolled); + + this.didScroll = false; + } + }, { + key: "scrolled", + value: function scrolled() { + + this.q.enqueue(function () { + this.check(); + }.bind(this)); + + this.emit(_constants.EVENTS.MANAGERS.SCROLL, { + top: this.scrollTop, + left: this.scrollLeft + }); + + clearTimeout(this.afterScrolled); + this.afterScrolled = setTimeout(function () { + + // Don't report scroll if we are about the snap + if (this.snapper && this.snapper.supportsTouch && this.snapper.needsSnap()) { + return; + } + + this.emit(_constants.EVENTS.MANAGERS.SCROLLED, { + top: this.scrollTop, + left: this.scrollLeft + }); + }.bind(this), this.settings.afterScrolledTimeout); + } + }, { + key: "next", + value: function next() { + + var dir = this.settings.direction; + var delta = this.layout.props.name === "pre-paginated" && this.layout.props.spread ? this.layout.props.delta * 2 : this.layout.props.delta; + + if (!this.views.length) return; + + if (this.isPaginated && this.settings.axis === "horizontal") { + + this.scrollBy(delta, 0, true); + } else { + + this.scrollBy(0, this.layout.height, true); + } + + this.q.enqueue(function () { + this.check(); + }.bind(this)); + } + }, { + key: "prev", + value: function prev() { + + var dir = this.settings.direction; + var delta = this.layout.props.name === "pre-paginated" && this.layout.props.spread ? this.layout.props.delta * 2 : this.layout.props.delta; + + if (!this.views.length) return; + + if (this.isPaginated && this.settings.axis === "horizontal") { + + this.scrollBy(-delta, 0, true); + } else { + + this.scrollBy(0, -this.layout.height, true); + } + + this.q.enqueue(function () { + this.check(); + }.bind(this)); + } + + // updateAxis(axis, forceUpdate){ + // + // super.updateAxis(axis, forceUpdate); + // + // if (axis === "vertical") { + // this.settings.infinite = true; + // } else { + // this.settings.infinite = false; + // } + // } + + }, { + key: "updateFlow", + value: function updateFlow(flow) { + if (this.rendered && this.snapper) { + this.snapper.destroy(); + this.snapper = undefined; + } + + _get(ContinuousViewManager.prototype.__proto__ || Object.getPrototypeOf(ContinuousViewManager.prototype), "updateFlow", this).call(this, flow, "scroll"); + + if (this.rendered && this.isPaginated && this.settings.snap) { + this.snapper = new _snap2.default(this, this.settings.snap && _typeof(this.settings.snap) === "object" && this.settings.snap); + } + } + }, { + key: "destroy", + value: function destroy() { + _get(ContinuousViewManager.prototype.__proto__ || Object.getPrototypeOf(ContinuousViewManager.prototype), "destroy", this).call(this); + + if (this.snapper) { + this.snapper.destroy(); + } + } + }]); + + return ContinuousViewManager; +}(_default2.default); + +exports.default = ContinuousViewManager; +module.exports = exports["default"]; + +/***/ }), +/* 25 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +/* WEBPACK VAR INJECTION */(function(global) { + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _book = __webpack_require__(26); + +var _book2 = _interopRequireDefault(_book); + +var _rendition = __webpack_require__(18); + +var _rendition2 = _interopRequireDefault(_rendition); + +var _epubcfi = __webpack_require__(1); + +var _epubcfi2 = _interopRequireDefault(_epubcfi); + +var _contents = __webpack_require__(14); + +var _contents2 = _interopRequireDefault(_contents); + +var _core = __webpack_require__(0); + +var utils = _interopRequireWildcard(_core); + +var _constants = __webpack_require__(2); + +var _urlPolyfill = __webpack_require__(76); + +var URLpolyfill = _interopRequireWildcard(_urlPolyfill); + +var _iframe = __webpack_require__(20); + +var _iframe2 = _interopRequireDefault(_iframe); + +var _default = __webpack_require__(15); + +var _default2 = _interopRequireDefault(_default); + +var _continuous = __webpack_require__(24); + +var _continuous2 = _interopRequireDefault(_continuous); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/** + * Creates a new Book + * @param {string|ArrayBuffer} url URL, Path or ArrayBuffer + * @param {object} options to pass to the book + * @returns {Book} a new Book object + * @example ePub("/path/to/book.epub", {}) + */ +function ePub(url, options) { + return new _book2.default(url, options); +} + +ePub.VERSION = _constants.EPUBJS_VERSION; + +if (typeof global !== "undefined") { + global.EPUBJS_VERSION = _constants.EPUBJS_VERSION; +} + +ePub.Book = _book2.default; +ePub.Rendition = _rendition2.default; +ePub.Contents = _contents2.default; +ePub.CFI = _epubcfi2.default; +ePub.utils = utils; + +exports.default = ePub; +module.exports = exports["default"]; +/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(5))) + +/***/ }), +/* 26 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _eventEmitter = __webpack_require__(3); + +var _eventEmitter2 = _interopRequireDefault(_eventEmitter); + +var _core = __webpack_require__(0); + +var _url = __webpack_require__(6); + +var _url2 = _interopRequireDefault(_url); + +var _path = __webpack_require__(4); + +var _path2 = _interopRequireDefault(_path); + +var _spine = __webpack_require__(43); + +var _spine2 = _interopRequireDefault(_spine); + +var _locations = __webpack_require__(47); + +var _locations2 = _interopRequireDefault(_locations); + +var _container = __webpack_require__(48); + +var _container2 = _interopRequireDefault(_container); + +var _packaging = __webpack_require__(49); + +var _packaging2 = _interopRequireDefault(_packaging); + +var _navigation = __webpack_require__(50); + +var _navigation2 = _interopRequireDefault(_navigation); + +var _resources = __webpack_require__(51); + +var _resources2 = _interopRequireDefault(_resources); + +var _pagelist = __webpack_require__(52); + +var _pagelist2 = _interopRequireDefault(_pagelist); + +var _rendition = __webpack_require__(18); + +var _rendition2 = _interopRequireDefault(_rendition); + +var _archive = __webpack_require__(71); + +var _archive2 = _interopRequireDefault(_archive); + +var _request2 = __webpack_require__(9); + +var _request3 = _interopRequireDefault(_request2); + +var _epubcfi = __webpack_require__(1); + +var _epubcfi2 = _interopRequireDefault(_epubcfi); + +var _store = __webpack_require__(73); + +var _store2 = _interopRequireDefault(_store); + +var _displayoptions = __webpack_require__(75); + +var _displayoptions2 = _interopRequireDefault(_displayoptions); + +var _constants = __webpack_require__(2); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +var CONTAINER_PATH = "META-INF/container.xml"; +var IBOOKS_DISPLAY_OPTIONS_PATH = "META-INF/com.apple.ibooks.display-options.xml"; + +var INPUT_TYPE = { + BINARY: "binary", + BASE64: "base64", + EPUB: "epub", + OPF: "opf", + MANIFEST: "json", + DIRECTORY: "directory" +}; + +/** + * An Epub representation with methods for the loading, parsing and manipulation + * of its contents. + * @class + * @param {string} [url] + * @param {object} [options] + * @param {method} [options.requestMethod] a request function to use instead of the default + * @param {boolean} [options.requestCredentials=undefined] send the xhr request withCredentials + * @param {object} [options.requestHeaders=undefined] send the xhr request headers + * @param {string} [options.encoding=binary] optional to pass 'binary' or base64' for archived Epubs + * @param {string} [options.replacements=none] use base64, blobUrl, or none for replacing assets in archived Epubs + * @param {method} [options.canonical] optional function to determine canonical urls for a path + * @param {string} [options.openAs] optional string to determine the input type + * @param {string} [options.store=false] cache the contents in local storage, value should be the name of the reader + * @returns {Book} + * @example new Book("/path/to/book.epub", {}) + * @example new Book({ replacements: "blobUrl" }) + */ + +var Book = function () { + function Book(url, options) { + var _this = this; + + _classCallCheck(this, Book); + + // Allow passing just options to the Book + if (typeof options === "undefined" && typeof url !== "string" && url instanceof Blob === false) { + options = url; + url = undefined; + } + + this.settings = (0, _core.extend)(this.settings || {}, { + requestMethod: undefined, + requestCredentials: undefined, + requestHeaders: undefined, + encoding: undefined, + replacements: undefined, + canonical: undefined, + openAs: undefined, + store: undefined + }); + + (0, _core.extend)(this.settings, options); + + // Promises + this.opening = new _core.defer(); + /** + * @member {promise} opened returns after the book is loaded + * @memberof Book + */ + this.opened = this.opening.promise; + this.isOpen = false; + + this.loading = { + manifest: new _core.defer(), + spine: new _core.defer(), + metadata: new _core.defer(), + cover: new _core.defer(), + navigation: new _core.defer(), + pageList: new _core.defer(), + resources: new _core.defer(), + displayOptions: new _core.defer() + }; + + this.loaded = { + manifest: this.loading.manifest.promise, + spine: this.loading.spine.promise, + metadata: this.loading.metadata.promise, + cover: this.loading.cover.promise, + navigation: this.loading.navigation.promise, + pageList: this.loading.pageList.promise, + resources: this.loading.resources.promise, + displayOptions: this.loading.displayOptions.promise + }; + + /** + * @member {promise} ready returns after the book is loaded and parsed + * @memberof Book + * @private + */ + this.ready = Promise.all([this.loaded.manifest, this.loaded.spine, this.loaded.metadata, this.loaded.cover, this.loaded.navigation, this.loaded.resources, this.loaded.displayOptions]); + + // Queue for methods used before opening + this.isRendered = false; + // this._q = queue(this); + + /** + * @member {method} request + * @memberof Book + * @private + */ + this.request = this.settings.requestMethod || _request3.default; + + /** + * @member {Spine} spine + * @memberof Book + */ + this.spine = new _spine2.default(); + + /** + * @member {Locations} locations + * @memberof Book + */ + this.locations = new _locations2.default(this.spine, this.load.bind(this)); + + /** + * @member {Navigation} navigation + * @memberof Book + */ + this.navigation = undefined; + + /** + * @member {PageList} pagelist + * @memberof Book + */ + this.pageList = undefined; + + /** + * @member {Url} url + * @memberof Book + * @private + */ + this.url = undefined; + + /** + * @member {Path} path + * @memberof Book + * @private + */ + this.path = undefined; + + /** + * @member {boolean} archived + * @memberof Book + * @private + */ + this.archived = false; + + /** + * @member {Archive} archive + * @memberof Book + * @private + */ + this.archive = undefined; + + /** + * @member {Store} storage + * @memberof Book + * @private + */ + this.storage = undefined; + + /** + * @member {Resources} resources + * @memberof Book + * @private + */ + this.resources = undefined; + + /** + * @member {Rendition} rendition + * @memberof Book + * @private + */ + this.rendition = undefined; + + /** + * @member {Container} container + * @memberof Book + * @private + */ + this.container = undefined; + + /** + * @member {Packaging} packaging + * @memberof Book + * @private + */ + this.packaging = undefined; + + /** + * @member {DisplayOptions} displayOptions + * @memberof DisplayOptions + * @private + */ + this.displayOptions = undefined; + + // this.toc = undefined; + if (this.settings.store) { + this.store(this.settings.store); + } + + if (url) { + this.open(url, this.settings.openAs).catch(function (error) { + var err = new Error("Cannot load book at " + url); + _this.emit(_constants.EVENTS.BOOK.OPEN_FAILED, err); + }); + } + } + + /** + * Open a epub or url + * @param {string | ArrayBuffer} input Url, Path or ArrayBuffer + * @param {string} [what="binary", "base64", "epub", "opf", "json", "directory"] force opening as a certain type + * @returns {Promise} of when the book has been loaded + * @example book.open("/path/to/book.epub") + */ + + + _createClass(Book, [{ + key: "open", + value: function open(input, what) { + var opening; + var type = what || this.determineType(input); + + if (type === INPUT_TYPE.BINARY) { + this.archived = true; + this.url = new _url2.default("/", ""); + opening = this.openEpub(input); + } else if (type === INPUT_TYPE.BASE64) { + this.archived = true; + this.url = new _url2.default("/", ""); + opening = this.openEpub(input, type); + } else if (type === INPUT_TYPE.EPUB) { + this.archived = true; + this.url = new _url2.default("/", ""); + opening = this.request(input, "binary", this.settings.requestCredentials).then(this.openEpub.bind(this)); + } else if (type == INPUT_TYPE.OPF) { + this.url = new _url2.default(input); + opening = this.openPackaging(this.url.Path.toString()); + } else if (type == INPUT_TYPE.MANIFEST) { + this.url = new _url2.default(input); + opening = this.openManifest(this.url.Path.toString()); + } else { + this.url = new _url2.default(input); + opening = this.openContainer(CONTAINER_PATH).then(this.openPackaging.bind(this)); + } + + return opening; + } + + /** + * Open an archived epub + * @private + * @param {binary} data + * @param {string} [encoding] + * @return {Promise} + */ + + }, { + key: "openEpub", + value: function openEpub(data, encoding) { + var _this2 = this; + + return this.unarchive(data, encoding || this.settings.encoding).then(function () { + return _this2.openContainer(CONTAINER_PATH); + }).then(function (packagePath) { + return _this2.openPackaging(packagePath); + }); + } + + /** + * Open the epub container + * @private + * @param {string} url + * @return {string} packagePath + */ + + }, { + key: "openContainer", + value: function openContainer(url) { + var _this3 = this; + + return this.load(url).then(function (xml) { + _this3.container = new _container2.default(xml); + return _this3.resolve(_this3.container.packagePath); + }); + } + + /** + * Open the Open Packaging Format Xml + * @private + * @param {string} url + * @return {Promise} + */ + + }, { + key: "openPackaging", + value: function openPackaging(url) { + var _this4 = this; + + this.path = new _path2.default(url); + return this.load(url).then(function (xml) { + _this4.packaging = new _packaging2.default(xml); + return _this4.unpack(_this4.packaging); + }); + } + + /** + * Open the manifest JSON + * @private + * @param {string} url + * @return {Promise} + */ + + }, { + key: "openManifest", + value: function openManifest(url) { + var _this5 = this; + + this.path = new _path2.default(url); + return this.load(url).then(function (json) { + _this5.packaging = new _packaging2.default(); + _this5.packaging.load(json); + return _this5.unpack(_this5.packaging); + }); + } + + /** + * Load a resource from the Book + * @param {string} path path to the resource to load + * @return {Promise} returns a promise with the requested resource + */ + + }, { + key: "load", + value: function load(path) { + var resolved = this.resolve(path); + if (this.archived) { + return this.archive.request(resolved); + } else { + return this.request(resolved, null, this.settings.requestCredentials, this.settings.requestHeaders); + } + } + + /** + * Resolve a path to it's absolute position in the Book + * @param {string} path + * @param {boolean} [absolute] force resolving the full URL + * @return {string} the resolved path string + */ + + }, { + key: "resolve", + value: function resolve(path, absolute) { + if (!path) { + return; + } + var resolved = path; + var isAbsolute = path.indexOf("://") > -1; + + if (isAbsolute) { + return path; + } + + if (this.path) { + resolved = this.path.resolve(path); + } + + if (absolute != false && this.url) { + resolved = this.url.resolve(resolved); + } + + return resolved; + } + + /** + * Get a canonical link to a path + * @param {string} path + * @return {string} the canonical path string + */ + + }, { + key: "canonical", + value: function canonical(path) { + var url = path; + + if (!path) { + return ""; + } + + if (this.settings.canonical) { + url = this.settings.canonical(path); + } else { + url = this.resolve(path, true); + } + + return url; + } + + /** + * Determine the type of they input passed to open + * @private + * @param {string} input + * @return {string} binary | directory | epub | opf + */ + + }, { + key: "determineType", + value: function determineType(input) { + var url; + var path; + var extension; + + if (this.settings.encoding === "base64") { + return INPUT_TYPE.BASE64; + } + + if (typeof input != "string") { + return INPUT_TYPE.BINARY; + } + + url = new _url2.default(input); + path = url.path(); + extension = path.extension; + + if (!extension) { + return INPUT_TYPE.DIRECTORY; + } + + if (extension === "epub") { + return INPUT_TYPE.EPUB; + } + + if (extension === "opf") { + return INPUT_TYPE.OPF; + } + + if (extension === "json") { + return INPUT_TYPE.MANIFEST; + } + } + + /** + * unpack the contents of the Books packaging + * @private + * @param {Packaging} packaging object + */ + + }, { + key: "unpack", + value: function unpack(packaging) { + var _this6 = this; + + this.package = packaging; //TODO: deprecated this + + if (this.packaging.metadata.layout === "") { + // rendition:layout not set - check display options if book is pre-paginated + this.load(this.url.resolve(IBOOKS_DISPLAY_OPTIONS_PATH)).then(function (xml) { + _this6.displayOptions = new _displayoptions2.default(xml); + _this6.loading.displayOptions.resolve(_this6.displayOptions); + }).catch(function (err) { + _this6.displayOptions = new _displayoptions2.default(); + _this6.loading.displayOptions.resolve(_this6.displayOptions); + }); + } else { + this.displayOptions = new _displayoptions2.default(); + this.loading.displayOptions.resolve(this.displayOptions); + } + + this.spine.unpack(this.packaging, this.resolve.bind(this), this.canonical.bind(this)); + + this.resources = new _resources2.default(this.packaging.manifest, { + archive: this.archive, + resolver: this.resolve.bind(this), + request: this.request.bind(this), + replacements: this.settings.replacements || (this.archived ? "blobUrl" : "base64") + }); + + this.loadNavigation(this.packaging).then(function () { + // this.toc = this.navigation.toc; + _this6.loading.navigation.resolve(_this6.navigation); + }); + + if (this.packaging.coverPath) { + this.cover = this.resolve(this.packaging.coverPath); + } + // Resolve promises + this.loading.manifest.resolve(this.packaging.manifest); + this.loading.metadata.resolve(this.packaging.metadata); + this.loading.spine.resolve(this.spine); + this.loading.cover.resolve(this.cover); + this.loading.resources.resolve(this.resources); + this.loading.pageList.resolve(this.pageList); + + this.isOpen = true; + + if (this.archived || this.settings.replacements && this.settings.replacements != "none") { + this.replacements().then(function () { + _this6.loaded.displayOptions.then(function () { + _this6.opening.resolve(_this6); + }); + }).catch(function (err) { + console.error(err); + }); + } else { + // Resolve book opened promise + this.loaded.displayOptions.then(function () { + _this6.opening.resolve(_this6); + }); + } + } + + /** + * Load Navigation and PageList from package + * @private + * @param {Packaging} packaging + */ + + }, { + key: "loadNavigation", + value: function loadNavigation(packaging) { + var _this7 = this; + + var navPath = packaging.navPath || packaging.ncxPath; + var toc = packaging.toc; + + // From json manifest + if (toc) { + return new Promise(function (resolve, reject) { + _this7.navigation = new _navigation2.default(toc); + + if (packaging.pageList) { + _this7.pageList = new _pagelist2.default(packaging.pageList); // TODO: handle page lists from Manifest + } + + resolve(_this7.navigation); + }); + } + + if (!navPath) { + return new Promise(function (resolve, reject) { + _this7.navigation = new _navigation2.default(); + _this7.pageList = new _pagelist2.default(); + + resolve(_this7.navigation); + }); + } + + return this.load(navPath, "xml").then(function (xml) { + _this7.navigation = new _navigation2.default(xml); + _this7.pageList = new _pagelist2.default(xml); + return _this7.navigation; + }); + } + + /** + * Gets a Section of the Book from the Spine + * Alias for `book.spine.get` + * @param {string} target + * @return {Section} + */ + + }, { + key: "section", + value: function section(target) { + return this.spine.get(target); + } + + /** + * Sugar to render a book to an element + * @param {element | string} element element or string to add a rendition to + * @param {object} [options] + * @return {Rendition} + */ + + }, { + key: "renderTo", + value: function renderTo(element, options) { + this.rendition = new _rendition2.default(this, options); + this.rendition.attachTo(element); + + return this.rendition; + } + + /** + * Set if request should use withCredentials + * @param {boolean} credentials + */ + + }, { + key: "setRequestCredentials", + value: function setRequestCredentials(credentials) { + this.settings.requestCredentials = credentials; + } + + /** + * Set headers request should use + * @param {object} headers + */ + + }, { + key: "setRequestHeaders", + value: function setRequestHeaders(headers) { + this.settings.requestHeaders = headers; + } + + /** + * Unarchive a zipped epub + * @private + * @param {binary} input epub data + * @param {string} [encoding] + * @return {Archive} + */ + + }, { + key: "unarchive", + value: function unarchive(input, encoding) { + this.archive = new _archive2.default(); + return this.archive.open(input, encoding); + } + + /** + * Store the epubs contents + * @private + * @param {binary} input epub data + * @param {string} [encoding] + * @return {Store} + */ + + }, { + key: "store", + value: function store(name) { + var _this8 = this; + + // Use "blobUrl" or "base64" for replacements + var replacementsSetting = this.settings.replacements && this.settings.replacements !== "none"; + // Save original url + var originalUrl = this.url; + // Save original request method + var requester = this.settings.requestMethod || _request3.default.bind(this); + // Create new Store + this.storage = new _store2.default(name, requester, this.resolve.bind(this)); + // Replace request method to go through store + this.request = this.storage.request.bind(this.storage); + + this.opened.then(function () { + if (_this8.archived) { + _this8.storage.requester = _this8.archive.request.bind(_this8.archive); + } + // Substitute hook + var substituteResources = function substituteResources(output, section) { + section.output = _this8.resources.substitute(output, section.url); + }; + + // Set to use replacements + _this8.resources.settings.replacements = replacementsSetting || "blobUrl"; + // Create replacement urls + _this8.resources.replacements().then(function () { + return _this8.resources.replaceCss(); + }); + + _this8.storage.on("offline", function () { + // Remove url to use relative resolving for hrefs + _this8.url = new _url2.default("/", ""); + // Add hook to replace resources in contents + _this8.spine.hooks.serialize.register(substituteResources); + }); + + _this8.storage.on("online", function () { + // Restore original url + _this8.url = originalUrl; + // Remove hook + _this8.spine.hooks.serialize.deregister(substituteResources); + }); + }); + + return this.storage; + } + + /** + * Get the cover url + * @return {string} coverUrl + */ + + }, { + key: "coverUrl", + value: function coverUrl() { + var _this9 = this; + + var retrieved = this.loaded.cover.then(function (url) { + if (_this9.archived) { + // return this.archive.createUrl(this.cover); + return _this9.resources.get(_this9.cover); + } else { + return _this9.cover; + } + }); + + return retrieved; + } + + /** + * Load replacement urls + * @private + * @return {Promise} completed loading urls + */ + + }, { + key: "replacements", + value: function replacements() { + var _this10 = this; + + this.spine.hooks.serialize.register(function (output, section) { + section.output = _this10.resources.substitute(output, section.url); + }); + + return this.resources.replacements().then(function () { + return _this10.resources.replaceCss(); + }); + } + + /** + * Find a DOM Range for a given CFI Range + * @param {EpubCFI} cfiRange a epub cfi range + * @return {Range} + */ + + }, { + key: "getRange", + value: function getRange(cfiRange) { + var cfi = new _epubcfi2.default(cfiRange); + var item = this.spine.get(cfi.spinePos); + var _request = this.load.bind(this); + if (!item) { + return new Promise(function (resolve, reject) { + reject("CFI could not be found"); + }); + } + return item.load(_request).then(function (contents) { + var range = cfi.toRange(item.document); + return range; + }); + } + + /** + * Generates the Book Key using the identifer in the manifest or other string provided + * @param {string} [identifier] to use instead of metadata identifier + * @return {string} key + */ + + }, { + key: "key", + value: function key(identifier) { + var ident = identifier || this.packaging.metadata.identifier || this.url.filename; + return "epubjs:" + _constants.EPUBJS_VERSION + ":" + ident; + } + + /** + * Destroy the Book and all associated objects + */ + + }, { + key: "destroy", + value: function destroy() { + this.opened = undefined; + this.loading = undefined; + this.loaded = undefined; + this.ready = undefined; + + this.isOpen = false; + this.isRendered = false; + + this.spine && this.spine.destroy(); + this.locations && this.locations.destroy(); + this.pageList && this.pageList.destroy(); + this.archive && this.archive.destroy(); + this.resources && this.resources.destroy(); + this.container && this.container.destroy(); + this.packaging && this.packaging.destroy(); + this.rendition && this.rendition.destroy(); + this.displayOptions && this.displayOptions.destroy(); + + this.spine = undefined; + this.locations = undefined; + this.pageList = undefined; + this.archive = undefined; + this.resources = undefined; + this.container = undefined; + this.packaging = undefined; + this.rendition = undefined; + + this.navigation = undefined; + this.url = undefined; + this.path = undefined; + this.archived = false; + } + }]); + + return Book; +}(); + +//-- Enable binding events to book + + +(0, _eventEmitter2.default)(Book.prototype); + +exports.default = Book; +module.exports = exports["default"]; + +/***/ }), +/* 27 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var assign = __webpack_require__(28) + , normalizeOpts = __webpack_require__(36) + , isCallable = __webpack_require__(37) + , contains = __webpack_require__(38) + + , d; + +d = module.exports = function (dscr, value/*, options*/) { + var c, e, w, options, desc; + if ((arguments.length < 2) || (typeof dscr !== 'string')) { + options = value; + value = dscr; + dscr = null; + } else { + options = arguments[2]; + } + if (dscr == null) { + c = w = true; + e = false; + } else { + c = contains.call(dscr, 'c'); + e = contains.call(dscr, 'e'); + w = contains.call(dscr, 'w'); + } + + desc = { value: value, configurable: c, enumerable: e, writable: w }; + return !options ? desc : assign(normalizeOpts(options), desc); +}; + +d.gs = function (dscr, get, set/*, options*/) { + var c, e, options, desc; + if (typeof dscr !== 'string') { + options = set; + set = get; + get = dscr; + dscr = null; + } else { + options = arguments[3]; + } + if (get == null) { + get = undefined; + } else if (!isCallable(get)) { + options = get; + get = set = undefined; + } else if (set == null) { + set = undefined; + } else if (!isCallable(set)) { + options = set; + set = undefined; + } + if (dscr == null) { + c = true; + e = false; + } else { + c = contains.call(dscr, 'c'); + e = contains.call(dscr, 'e'); + } + + desc = { get: get, set: set, configurable: c, enumerable: e }; + return !options ? desc : assign(normalizeOpts(options), desc); +}; + + +/***/ }), +/* 28 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = __webpack_require__(29)() + ? Object.assign + : __webpack_require__(30); + + +/***/ }), +/* 29 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = function () { + var assign = Object.assign, obj; + if (typeof assign !== "function") return false; + obj = { foo: "raz" }; + assign(obj, { bar: "dwa" }, { trzy: "trzy" }); + return (obj.foo + obj.bar + obj.trzy) === "razdwatrzy"; +}; + + +/***/ }), +/* 30 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var keys = __webpack_require__(31) + , value = __webpack_require__(35) + , max = Math.max; + +module.exports = function (dest, src /*, …srcn*/) { + var error, i, length = max(arguments.length, 2), assign; + dest = Object(value(dest)); + assign = function (key) { + try { + dest[key] = src[key]; + } catch (e) { + if (!error) error = e; + } + }; + for (i = 1; i < length; ++i) { + src = arguments[i]; + keys(src).forEach(assign); + } + if (error !== undefined) throw error; + return dest; +}; + + +/***/ }), +/* 31 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = __webpack_require__(32)() ? Object.keys : __webpack_require__(33); + + +/***/ }), +/* 32 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = function () { + try { + Object.keys("primitive"); + return true; + } catch (e) { + return false; + } +}; + + +/***/ }), +/* 33 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var isValue = __webpack_require__(10); + +var keys = Object.keys; + +module.exports = function (object) { return keys(isValue(object) ? Object(object) : object); }; + + +/***/ }), +/* 34 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +// eslint-disable-next-line no-empty-function +module.exports = function () {}; + + +/***/ }), +/* 35 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var isValue = __webpack_require__(10); + +module.exports = function (value) { + if (!isValue(value)) throw new TypeError("Cannot use null or undefined"); + return value; +}; + + +/***/ }), +/* 36 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var isValue = __webpack_require__(10); + +var forEach = Array.prototype.forEach, create = Object.create; + +var process = function (src, obj) { + var key; + for (key in src) obj[key] = src[key]; +}; + +// eslint-disable-next-line no-unused-vars +module.exports = function (opts1 /*, …options*/) { + var result = create(null); + forEach.call(arguments, function (options) { + if (!isValue(options)) return; + process(Object(options), result); + }); + return result; +}; + + +/***/ }), +/* 37 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +// Deprecated + + + +module.exports = function (obj) { + return typeof obj === "function"; +}; + + +/***/ }), +/* 38 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = __webpack_require__(39)() + ? String.prototype.contains + : __webpack_require__(40); + + +/***/ }), +/* 39 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var str = "razdwatrzy"; + +module.exports = function () { + if (typeof str.contains !== "function") return false; + return (str.contains("dwa") === true) && (str.contains("foo") === false); +}; + + +/***/ }), +/* 40 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var indexOf = String.prototype.indexOf; + +module.exports = function (searchString/*, position*/) { + return indexOf.call(this, searchString, arguments[1]) > -1; +}; + + +/***/ }), +/* 41 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +module.exports = function (fn) { + if (typeof fn !== "function") throw new TypeError(fn + " is not a function"); + return fn; +}; + + +/***/ }), +/* 42 */ +/***/ (function(module, exports) { + +module.exports = __WEBPACK_EXTERNAL_MODULE_42__; + +/***/ }), +/* 43 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _epubcfi = __webpack_require__(1); + +var _epubcfi2 = _interopRequireDefault(_epubcfi); + +var _hook = __webpack_require__(11); + +var _hook2 = _interopRequireDefault(_hook); + +var _section = __webpack_require__(44); + +var _section2 = _interopRequireDefault(_section); + +var _replacements = __webpack_require__(8); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * A collection of Spine Items + */ +var Spine = function () { + function Spine() { + _classCallCheck(this, Spine); + + this.spineItems = []; + this.spineByHref = {}; + this.spineById = {}; + + this.hooks = {}; + this.hooks.serialize = new _hook2.default(); + this.hooks.content = new _hook2.default(); + + // Register replacements + this.hooks.content.register(_replacements.replaceBase); + this.hooks.content.register(_replacements.replaceCanonical); + this.hooks.content.register(_replacements.replaceMeta); + + this.epubcfi = new _epubcfi2.default(); + + this.loaded = false; + + this.items = undefined; + this.manifest = undefined; + this.spineNodeIndex = undefined; + this.baseUrl = undefined; + this.length = undefined; + } + + /** + * Unpack items from a opf into spine items + * @param {Packaging} _package + * @param {method} resolver URL resolver + * @param {method} canonical Resolve canonical url + */ + + + _createClass(Spine, [{ + key: "unpack", + value: function unpack(_package, resolver, canonical) { + var _this = this; + + this.items = _package.spine; + this.manifest = _package.manifest; + this.spineNodeIndex = _package.spineNodeIndex; + this.baseUrl = _package.baseUrl || _package.basePath || ""; + this.length = this.items.length; + + this.items.forEach(function (item, index) { + var manifestItem = _this.manifest[item.idref]; + var spineItem; + + item.index = index; + item.cfiBase = _this.epubcfi.generateChapterComponent(_this.spineNodeIndex, item.index, item.idref); + + if (item.href) { + item.url = resolver(item.href, true); + item.canonical = canonical(item.href); + } + + if (manifestItem) { + item.href = manifestItem.href; + item.url = resolver(item.href, true); + item.canonical = canonical(item.href); + + if (manifestItem.properties.length) { + item.properties.push.apply(item.properties, manifestItem.properties); + } + } + + if (item.linear === "yes") { + item.prev = function () { + var prevIndex = item.index; + while (prevIndex > 0) { + var prev = this.get(prevIndex - 1); + if (prev && prev.linear) { + return prev; + } + prevIndex -= 1; + } + return; + }.bind(_this); + item.next = function () { + var nextIndex = item.index; + while (nextIndex < this.spineItems.length - 1) { + var next = this.get(nextIndex + 1); + if (next && next.linear) { + return next; + } + nextIndex += 1; + } + return; + }.bind(_this); + } else { + item.prev = function () { + return; + }; + item.next = function () { + return; + }; + } + + spineItem = new _section2.default(item, _this.hooks); + + _this.append(spineItem); + }); + + this.loaded = true; + } + + /** + * Get an item from the spine + * @param {string|number} [target] + * @return {Section} section + * @example spine.get(); + * @example spine.get(1); + * @example spine.get("chap1.html"); + * @example spine.get("#id1234"); + */ + + }, { + key: "get", + value: function get(target) { + var index = 0; + + if (typeof target === "undefined") { + while (index < this.spineItems.length) { + var next = this.spineItems[index]; + if (next && next.linear) { + break; + } + index += 1; + } + } else if (this.epubcfi.isCfiString(target)) { + var cfi = new _epubcfi2.default(target); + index = cfi.spinePos; + } else if (typeof target === "number" || isNaN(target) === false) { + index = target; + } else if (typeof target === "string" && target.indexOf("#") === 0) { + index = this.spineById[target.substring(1)]; + } else if (typeof target === "string") { + // Remove fragments + target = target.split("#")[0]; + index = this.spineByHref[target] || this.spineByHref[encodeURI(target)]; + } + + return this.spineItems[index] || null; + } + + /** + * Append a Section to the Spine + * @private + * @param {Section} section + */ + + }, { + key: "append", + value: function append(section) { + var index = this.spineItems.length; + section.index = index; + + this.spineItems.push(section); + + // Encode and Decode href lookups + // see pr for details: https://github.com/futurepress/epub.js/pull/358 + this.spineByHref[decodeURI(section.href)] = index; + this.spineByHref[encodeURI(section.href)] = index; + this.spineByHref[section.href] = index; + + this.spineById[section.idref] = index; + + return index; + } + + /** + * Prepend a Section to the Spine + * @private + * @param {Section} section + */ + + }, { + key: "prepend", + value: function prepend(section) { + // var index = this.spineItems.unshift(section); + this.spineByHref[section.href] = 0; + this.spineById[section.idref] = 0; + + // Re-index + this.spineItems.forEach(function (item, index) { + item.index = index; + }); + + return 0; + } + + // insert(section, index) { + // + // }; + + /** + * Remove a Section from the Spine + * @private + * @param {Section} section + */ + + }, { + key: "remove", + value: function remove(section) { + var index = this.spineItems.indexOf(section); + + if (index > -1) { + delete this.spineByHref[section.href]; + delete this.spineById[section.idref]; + + return this.spineItems.splice(index, 1); + } + } + + /** + * Loop over the Sections in the Spine + * @return {method} forEach + */ + + }, { + key: "each", + value: function each() { + return this.spineItems.forEach.apply(this.spineItems, arguments); + } + + /** + * Find the first Section in the Spine + * @return {Section} first section + */ + + }, { + key: "first", + value: function first() { + var index = 0; + + do { + var next = this.get(index); + + if (next && next.linear) { + return next; + } + index += 1; + } while (index < this.spineItems.length); + } + + /** + * Find the last Section in the Spine + * @return {Section} last section + */ + + }, { + key: "last", + value: function last() { + var index = this.spineItems.length - 1; + + do { + var prev = this.get(index); + if (prev && prev.linear) { + return prev; + } + index -= 1; + } while (index >= 0); + } + }, { + key: "destroy", + value: function destroy() { + this.each(function (section) { + return section.destroy(); + }); + + this.spineItems = undefined; + this.spineByHref = undefined; + this.spineById = undefined; + + this.hooks.serialize.clear(); + this.hooks.content.clear(); + this.hooks = undefined; + + this.epubcfi = undefined; + + this.loaded = false; + + this.items = undefined; + this.manifest = undefined; + this.spineNodeIndex = undefined; + this.baseUrl = undefined; + this.length = undefined; + } + }]); + + return Spine; +}(); + +exports.default = Spine; +module.exports = exports["default"]; + +/***/ }), +/* 44 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _core = __webpack_require__(0); + +var _epubcfi = __webpack_require__(1); + +var _epubcfi2 = _interopRequireDefault(_epubcfi); + +var _hook = __webpack_require__(11); + +var _hook2 = _interopRequireDefault(_hook); + +var _replacements = __webpack_require__(8); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Represents a Section of the Book + * + * In most books this is equivelent to a Chapter + * @param {object} item The spine item representing the section + * @param {object} hooks hooks for serialize and content + */ +var Section = function () { + function Section(item, hooks) { + _classCallCheck(this, Section); + + this.idref = item.idref; + this.linear = item.linear === "yes"; + this.properties = item.properties; + this.index = item.index; + this.href = item.href; + this.url = item.url; + this.canonical = item.canonical; + this.next = item.next; + this.prev = item.prev; + + this.cfiBase = item.cfiBase; + + if (hooks) { + this.hooks = hooks; + } else { + this.hooks = {}; + this.hooks.serialize = new _hook2.default(this); + this.hooks.content = new _hook2.default(this); + } + + this.document = undefined; + this.contents = undefined; + this.output = undefined; + } + + /** + * Load the section from its url + * @param {method} [_request] a request method to use for loading + * @return {document} a promise with the xml document + */ + + + _createClass(Section, [{ + key: "load", + value: function load(_request) { + var request = _request || this.request || __webpack_require__(9); + var loading = new _core.defer(); + var loaded = loading.promise; + + if (this.contents) { + loading.resolve(this.contents); + } else { + request(this.url).then(function (xml) { + // var directory = new Url(this.url).directory; + + this.document = xml; + this.contents = xml.documentElement; + + return this.hooks.content.trigger(this.document, this); + }.bind(this)).then(function () { + loading.resolve(this.contents); + }.bind(this)).catch(function (error) { + loading.reject(error); + }); + } + + return loaded; + } + + /** + * Adds a base tag for resolving urls in the section + * @private + */ + + }, { + key: "base", + value: function base() { + return (0, _replacements.replaceBase)(this.document, this); + } + + /** + * Render the contents of a section + * @param {method} [_request] a request method to use for loading + * @return {string} output a serialized XML Document + */ + + }, { + key: "render", + value: function render(_request) { + var rendering = new _core.defer(); + var rendered = rendering.promise; + this.output; // TODO: better way to return this from hooks? + + this.load(_request).then(function (contents) { + var userAgent = typeof navigator !== 'undefined' && navigator.userAgent || ''; + var isIE = userAgent.indexOf('Trident') >= 0; + var Serializer; + if (typeof XMLSerializer === "undefined" || isIE) { + Serializer = __webpack_require__(45).XMLSerializer; + } else { + Serializer = XMLSerializer; + } + var serializer = new Serializer(); + this.output = serializer.serializeToString(contents); + return this.output; + }.bind(this)).then(function () { + return this.hooks.serialize.trigger(this.output, this); + }.bind(this)).then(function () { + rendering.resolve(this.output); + }.bind(this)).catch(function (error) { + rendering.reject(error); + }); + + return rendered; + } + + /** + * Find a string in a section + * @param {string} _query The query string to find + * @return {object[]} A list of matches, with form {cfi, excerpt} + */ + + }, { + key: "find", + value: function find(_query) { + var section = this; + var matches = []; + var query = _query.toLowerCase(); + var find = function find(node) { + var text = node.textContent.toLowerCase(); + var range = section.document.createRange(); + var cfi; + var pos; + var last = -1; + var excerpt; + var limit = 150; + + while (pos != -1) { + // Search for the query + pos = text.indexOf(query, last + 1); + + if (pos != -1) { + // We found it! Generate a CFI + range = section.document.createRange(); + range.setStart(node, pos); + range.setEnd(node, pos + query.length); + + cfi = section.cfiFromRange(range); + + // Generate the excerpt + if (node.textContent.length < limit) { + excerpt = node.textContent; + } else { + excerpt = node.textContent.substring(pos - limit / 2, pos + limit / 2); + excerpt = "..." + excerpt + "..."; + } + + // Add the CFI to the matches list + matches.push({ + cfi: cfi, + excerpt: excerpt + }); + } + + last = pos; + } + }; + + (0, _core.sprint)(section.document, function (node) { + find(node); + }); + + return matches; + } + }, { + key: "reconcileLayoutSettings", + + + /** + * Reconciles the current chapters layout properies with + * the global layout properities. + * @param {object} globalLayout The global layout settings object, chapter properties string + * @return {object} layoutProperties Object with layout properties + */ + value: function reconcileLayoutSettings(globalLayout) { + //-- Get the global defaults + var settings = { + layout: globalLayout.layout, + spread: globalLayout.spread, + orientation: globalLayout.orientation + }; + + //-- Get the chapter's display type + this.properties.forEach(function (prop) { + var rendition = prop.replace("rendition:", ""); + var split = rendition.indexOf("-"); + var property, value; + + if (split != -1) { + property = rendition.slice(0, split); + value = rendition.slice(split + 1); + + settings[property] = value; + } + }); + return settings; + } + + /** + * Get a CFI from a Range in the Section + * @param {range} _range + * @return {string} cfi an EpubCFI string + */ + + }, { + key: "cfiFromRange", + value: function cfiFromRange(_range) { + return new _epubcfi2.default(_range, this.cfiBase).toString(); + } + + /** + * Get a CFI from an Element in the Section + * @param {element} el + * @return {string} cfi an EpubCFI string + */ + + }, { + key: "cfiFromElement", + value: function cfiFromElement(el) { + return new _epubcfi2.default(el, this.cfiBase).toString(); + } + + /** + * Unload the section document + */ + + }, { + key: "unload", + value: function unload() { + this.document = undefined; + this.contents = undefined; + this.output = undefined; + } + }, { + key: "destroy", + value: function destroy() { + this.unload(); + this.hooks.serialize.clear(); + this.hooks.content.clear(); + + this.hooks = undefined; + this.idref = undefined; + this.linear = undefined; + this.properties = undefined; + this.index = undefined; + this.href = undefined; + this.url = undefined; + this.next = undefined; + this.prev = undefined; + + this.cfiBase = undefined; + } + }]); + + return Section; +}(); + +exports.default = Section; +module.exports = exports["default"]; + +/***/ }), +/* 45 */ +/***/ (function(module, exports, __webpack_require__) { + +function DOMParser(options){ + this.options = options ||{locator:{}}; + +} +DOMParser.prototype.parseFromString = function(source,mimeType){ + var options = this.options; + var sax = new XMLReader(); + var domBuilder = options.domBuilder || new DOMHandler();//contentHandler and LexicalHandler + var errorHandler = options.errorHandler; + var locator = options.locator; + var defaultNSMap = options.xmlns||{}; + var entityMap = {'lt':'<','gt':'>','amp':'&','quot':'"','apos':"'"} + if(locator){ + domBuilder.setDocumentLocator(locator) + } + + sax.errorHandler = buildErrorHandler(errorHandler,domBuilder,locator); + sax.domBuilder = options.domBuilder || domBuilder; + if(/\/x?html?$/.test(mimeType)){ + entityMap.nbsp = '\xa0'; + entityMap.copy = '\xa9'; + defaultNSMap['']= 'http://www.w3.org/1999/xhtml'; + } + defaultNSMap.xml = defaultNSMap.xml || 'http://www.w3.org/XML/1998/namespace'; + if(source){ + sax.parse(source,defaultNSMap,entityMap); + }else{ + sax.errorHandler.error("invalid doc source"); + } + return domBuilder.doc; +} +function buildErrorHandler(errorImpl,domBuilder,locator){ + if(!errorImpl){ + if(domBuilder instanceof DOMHandler){ + return domBuilder; + } + errorImpl = domBuilder ; + } + var errorHandler = {} + var isCallback = errorImpl instanceof Function; + locator = locator||{} + function build(key){ + var fn = errorImpl[key]; + if(!fn && isCallback){ + fn = errorImpl.length == 2?function(msg){errorImpl(key,msg)}:errorImpl; + } + errorHandler[key] = fn && function(msg){ + fn('[xmldom '+key+']\t'+msg+_locator(locator)); + }||function(){}; + } + build('warning'); + build('error'); + build('fatalError'); + return errorHandler; +} + +//console.log('#\n\n\n\n\n\n\n####') +/** + * +ContentHandler+ErrorHandler + * +LexicalHandler+EntityResolver2 + * -DeclHandler-DTDHandler + * + * DefaultHandler:EntityResolver, DTDHandler, ContentHandler, ErrorHandler + * DefaultHandler2:DefaultHandler,LexicalHandler, DeclHandler, EntityResolver2 + * @link http://www.saxproject.org/apidoc/org/xml/sax/helpers/DefaultHandler.html + */ +function DOMHandler() { + this.cdata = false; +} +function position(locator,node){ + node.lineNumber = locator.lineNumber; + node.columnNumber = locator.columnNumber; +} +/** + * @see org.xml.sax.ContentHandler#startDocument + * @link http://www.saxproject.org/apidoc/org/xml/sax/ContentHandler.html + */ +DOMHandler.prototype = { + startDocument : function() { + this.doc = new DOMImplementation().createDocument(null, null, null); + if (this.locator) { + this.doc.documentURI = this.locator.systemId; + } + }, + startElement:function(namespaceURI, localName, qName, attrs) { + var doc = this.doc; + var el = doc.createElementNS(namespaceURI, qName||localName); + var len = attrs.length; + appendElement(this, el); + this.currentElement = el; + + this.locator && position(this.locator,el) + for (var i = 0 ; i < len; i++) { + var namespaceURI = attrs.getURI(i); + var value = attrs.getValue(i); + var qName = attrs.getQName(i); + var attr = doc.createAttributeNS(namespaceURI, qName); + this.locator &&position(attrs.getLocator(i),attr); + attr.value = attr.nodeValue = value; + el.setAttributeNode(attr) + } + }, + endElement:function(namespaceURI, localName, qName) { + var current = this.currentElement + var tagName = current.tagName; + this.currentElement = current.parentNode; + }, + startPrefixMapping:function(prefix, uri) { + }, + endPrefixMapping:function(prefix) { + }, + processingInstruction:function(target, data) { + var ins = this.doc.createProcessingInstruction(target, data); + this.locator && position(this.locator,ins) + appendElement(this, ins); + }, + ignorableWhitespace:function(ch, start, length) { + }, + characters:function(chars, start, length) { + chars = _toString.apply(this,arguments) + //console.log(chars) + if(chars){ + if (this.cdata) { + var charNode = this.doc.createCDATASection(chars); + } else { + var charNode = this.doc.createTextNode(chars); + } + if(this.currentElement){ + this.currentElement.appendChild(charNode); + }else if(/^\s*$/.test(chars)){ + this.doc.appendChild(charNode); + //process xml + } + this.locator && position(this.locator,charNode) + } + }, + skippedEntity:function(name) { + }, + endDocument:function() { + this.doc.normalize(); + }, + setDocumentLocator:function (locator) { + if(this.locator = locator){// && !('lineNumber' in locator)){ + locator.lineNumber = 0; + } + }, + //LexicalHandler + comment:function(chars, start, length) { + chars = _toString.apply(this,arguments) + var comm = this.doc.createComment(chars); + this.locator && position(this.locator,comm) + appendElement(this, comm); + }, + + startCDATA:function() { + //used in characters() methods + this.cdata = true; + }, + endCDATA:function() { + this.cdata = false; + }, + + startDTD:function(name, publicId, systemId) { + var impl = this.doc.implementation; + if (impl && impl.createDocumentType) { + var dt = impl.createDocumentType(name, publicId, systemId); + this.locator && position(this.locator,dt) + appendElement(this, dt); + } + }, + /** + * @see org.xml.sax.ErrorHandler + * @link http://www.saxproject.org/apidoc/org/xml/sax/ErrorHandler.html + */ + warning:function(error) { + console.warn('[xmldom warning]\t'+error,_locator(this.locator)); + }, + error:function(error) { + console.error('[xmldom error]\t'+error,_locator(this.locator)); + }, + fatalError:function(error) { + console.error('[xmldom fatalError]\t'+error,_locator(this.locator)); + throw error; + } +} +function _locator(l){ + if(l){ + return '\n@'+(l.systemId ||'')+'#[line:'+l.lineNumber+',col:'+l.columnNumber+']' + } +} +function _toString(chars,start,length){ + if(typeof chars == 'string'){ + return chars.substr(start,length) + }else{//java sax connect width xmldom on rhino(what about: "? && !(chars instanceof String)") + if(chars.length >= start+length || start){ + return new java.lang.String(chars,start,length)+''; + } + return chars; + } +} + +/* + * @link http://www.saxproject.org/apidoc/org/xml/sax/ext/LexicalHandler.html + * used method of org.xml.sax.ext.LexicalHandler: + * #comment(chars, start, length) + * #startCDATA() + * #endCDATA() + * #startDTD(name, publicId, systemId) + * + * + * IGNORED method of org.xml.sax.ext.LexicalHandler: + * #endDTD() + * #startEntity(name) + * #endEntity(name) + * + * + * @link http://www.saxproject.org/apidoc/org/xml/sax/ext/DeclHandler.html + * IGNORED method of org.xml.sax.ext.DeclHandler + * #attributeDecl(eName, aName, type, mode, value) + * #elementDecl(name, model) + * #externalEntityDecl(name, publicId, systemId) + * #internalEntityDecl(name, value) + * @link http://www.saxproject.org/apidoc/org/xml/sax/ext/EntityResolver2.html + * IGNORED method of org.xml.sax.EntityResolver2 + * #resolveEntity(String name,String publicId,String baseURI,String systemId) + * #resolveEntity(publicId, systemId) + * #getExternalSubset(name, baseURI) + * @link http://www.saxproject.org/apidoc/org/xml/sax/DTDHandler.html + * IGNORED method of org.xml.sax.DTDHandler + * #notationDecl(name, publicId, systemId) {}; + * #unparsedEntityDecl(name, publicId, systemId, notationName) {}; + */ +"endDTD,startEntity,endEntity,attributeDecl,elementDecl,externalEntityDecl,internalEntityDecl,resolveEntity,getExternalSubset,notationDecl,unparsedEntityDecl".replace(/\w+/g,function(key){ + DOMHandler.prototype[key] = function(){return null} +}) + +/* Private static helpers treated below as private instance methods, so don't need to add these to the public API; we might use a Relator to also get rid of non-standard public properties */ +function appendElement (hander,node) { + if (!hander.currentElement) { + hander.doc.appendChild(node); + } else { + hander.currentElement.appendChild(node); + } +}//appendChild and setAttributeNS are preformance key + +//if(typeof require == 'function'){ + var XMLReader = __webpack_require__(46).XMLReader; + var DOMImplementation = exports.DOMImplementation = __webpack_require__(17).DOMImplementation; + exports.XMLSerializer = __webpack_require__(17).XMLSerializer ; + exports.DOMParser = DOMParser; +//} + + +/***/ }), +/* 46 */ +/***/ (function(module, exports) { + +//[4] NameStartChar ::= ":" | [A-Z] | "_" | [a-z] | [#xC0-#xD6] | [#xD8-#xF6] | [#xF8-#x2FF] | [#x370-#x37D] | [#x37F-#x1FFF] | [#x200C-#x200D] | [#x2070-#x218F] | [#x2C00-#x2FEF] | [#x3001-#xD7FF] | [#xF900-#xFDCF] | [#xFDF0-#xFFFD] | [#x10000-#xEFFFF] +//[4a] NameChar ::= NameStartChar | "-" | "." | [0-9] | #xB7 | [#x0300-#x036F] | [#x203F-#x2040] +//[5] Name ::= NameStartChar (NameChar)* +var nameStartChar = /[A-Z_a-z\xC0-\xD6\xD8-\xF6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD]///\u10000-\uEFFFF +var nameChar = new RegExp("[\\-\\.0-9"+nameStartChar.source.slice(1,-1)+"\\u00B7\\u0300-\\u036F\\u203F-\\u2040]"); +var tagNamePattern = new RegExp('^'+nameStartChar.source+nameChar.source+'*(?:\:'+nameStartChar.source+nameChar.source+'*)?$'); +//var tagNamePattern = /^[a-zA-Z_][\w\-\.]*(?:\:[a-zA-Z_][\w\-\.]*)?$/ +//var handlers = 'resolveEntity,getExternalSubset,characters,endDocument,endElement,endPrefixMapping,ignorableWhitespace,processingInstruction,setDocumentLocator,skippedEntity,startDocument,startElement,startPrefixMapping,notationDecl,unparsedEntityDecl,error,fatalError,warning,attributeDecl,elementDecl,externalEntityDecl,internalEntityDecl,comment,endCDATA,endDTD,endEntity,startCDATA,startDTD,startEntity'.split(',') + +//S_TAG, S_ATTR, S_EQ, S_ATTR_NOQUOT_VALUE +//S_ATTR_SPACE, S_ATTR_END, S_TAG_SPACE, S_TAG_CLOSE +var S_TAG = 0;//tag name offerring +var S_ATTR = 1;//attr name offerring +var S_ATTR_SPACE=2;//attr name end and space offer +var S_EQ = 3;//=space? +var S_ATTR_NOQUOT_VALUE = 4;//attr value(no quot value only) +var S_ATTR_END = 5;//attr value end and no space(quot end) +var S_TAG_SPACE = 6;//(attr value end || tag end ) && (space offer) +var S_TAG_CLOSE = 7;//closed el + +function XMLReader(){ + +} + +XMLReader.prototype = { + parse:function(source,defaultNSMap,entityMap){ + var domBuilder = this.domBuilder; + domBuilder.startDocument(); + _copy(defaultNSMap ,defaultNSMap = {}) + parse(source,defaultNSMap,entityMap, + domBuilder,this.errorHandler); + domBuilder.endDocument(); + } +} +function parse(source,defaultNSMapCopy,entityMap,domBuilder,errorHandler){ + function fixedFromCharCode(code) { + // String.prototype.fromCharCode does not supports + // > 2 bytes unicode chars directly + if (code > 0xffff) { + code -= 0x10000; + var surrogate1 = 0xd800 + (code >> 10) + , surrogate2 = 0xdc00 + (code & 0x3ff); + + return String.fromCharCode(surrogate1, surrogate2); + } else { + return String.fromCharCode(code); + } + } + function entityReplacer(a){ + var k = a.slice(1,-1); + if(k in entityMap){ + return entityMap[k]; + }else if(k.charAt(0) === '#'){ + return fixedFromCharCode(parseInt(k.substr(1).replace('x','0x'))) + }else{ + errorHandler.error('entity not found:'+a); + return a; + } + } + function appendText(end){//has some bugs + if(end>start){ + var xt = source.substring(start,end).replace(/&#?\w+;/g,entityReplacer); + locator&&position(start); + domBuilder.characters(xt,0,end-start); + start = end + } + } + function position(p,m){ + while(p>=lineEnd && (m = linePattern.exec(source))){ + lineStart = m.index; + lineEnd = lineStart + m[0].length; + locator.lineNumber++; + //console.log('line++:',locator,startPos,endPos) + } + locator.columnNumber = p-lineStart+1; + } + var lineStart = 0; + var lineEnd = 0; + var linePattern = /.*(?:\r\n?|\n)|.*$/g + var locator = domBuilder.locator; + + var parseStack = [{currentNSMap:defaultNSMapCopy}] + var closeMap = {}; + var start = 0; + while(true){ + try{ + var tagStart = source.indexOf('<',start); + if(tagStart<0){ + if(!source.substr(start).match(/^\s*$/)){ + var doc = domBuilder.doc; + var text = doc.createTextNode(source.substr(start)); + doc.appendChild(text); + domBuilder.currentElement = text; + } + return; + } + if(tagStart>start){ + appendText(tagStart); + } + switch(source.charAt(tagStart+1)){ + case '/': + var end = source.indexOf('>',tagStart+3); + var tagName = source.substring(tagStart+2,end); + var config = parseStack.pop(); + if(end<0){ + + tagName = source.substring(tagStart+2).replace(/[\s<].*/,''); + //console.error('#@@@@@@'+tagName) + errorHandler.error("end tag name: "+tagName+' is not complete:'+config.tagName); + end = tagStart+1+tagName.length; + }else if(tagName.match(/\s + locator&&position(tagStart); + end = parseInstruction(source,tagStart,domBuilder); + break; + case '!':// start){ + start = end; + }else{ + //TODO: 这里有可能sax回退，有位置错误风险 + appendText(Math.max(tagStart,start)+1); + } + } +} +function copyLocator(f,t){ + t.lineNumber = f.lineNumber; + t.columnNumber = f.columnNumber; + return t; +} + +/** + * @see #appendElement(source,elStartEnd,el,selfClosed,entityReplacer,domBuilder,parseStack); + * @return end of the elementStartPart(end of elementEndPart for selfClosed el) + */ +function parseElementStartPart(source,start,el,currentNSMap,entityReplacer,errorHandler){ + var attrName; + var value; + var p = ++start; + var s = S_TAG;//status + while(true){ + var c = source.charAt(p); + switch(c){ + case '=': + if(s === S_ATTR){//attrName + attrName = source.slice(start,p); + s = S_EQ; + }else if(s === S_ATTR_SPACE){ + s = S_EQ; + }else{ + //fatalError: equal must after attrName or space after attrName + throw new Error('attribute equal must after attrName'); + } + break; + case '\'': + case '"': + if(s === S_EQ || s === S_ATTR //|| s == S_ATTR_SPACE + ){//equal + if(s === S_ATTR){ + errorHandler.warning('attribute value must after "="') + attrName = source.slice(start,p) + } + start = p+1; + p = source.indexOf(c,start) + if(p>0){ + value = source.slice(start,p).replace(/&#?\w+;/g,entityReplacer); + el.add(attrName,value,start-1); + s = S_ATTR_END; + }else{ + //fatalError: no end quot match + throw new Error('attribute value no end \''+c+'\' match'); + } + }else if(s == S_ATTR_NOQUOT_VALUE){ + value = source.slice(start,p).replace(/&#?\w+;/g,entityReplacer); + //console.log(attrName,value,start,p) + el.add(attrName,value,start); + //console.dir(el) + errorHandler.warning('attribute "'+attrName+'" missed start quot('+c+')!!'); + start = p+1; + s = S_ATTR_END + }else{ + //fatalError: no equal before + throw new Error('attribute value must after "="'); + } + break; + case '/': + switch(s){ + case S_TAG: + el.setTagName(source.slice(start,p)); + case S_ATTR_END: + case S_TAG_SPACE: + case S_TAG_CLOSE: + s =S_TAG_CLOSE; + el.closed = true; + case S_ATTR_NOQUOT_VALUE: + case S_ATTR: + case S_ATTR_SPACE: + break; + //case S_EQ: + default: + throw new Error("attribute invalid close char('/')") + } + break; + case ''://end document + //throw new Error('unexpected end of input') + errorHandler.error('unexpected end of input'); + if(s == S_TAG){ + el.setTagName(source.slice(start,p)); + } + return p; + case '>': + switch(s){ + case S_TAG: + el.setTagName(source.slice(start,p)); + case S_ATTR_END: + case S_TAG_SPACE: + case S_TAG_CLOSE: + break;//normal + case S_ATTR_NOQUOT_VALUE://Compatible state + case S_ATTR: + value = source.slice(start,p); + if(value.slice(-1) === '/'){ + el.closed = true; + value = value.slice(0,-1) + } + case S_ATTR_SPACE: + if(s === S_ATTR_SPACE){ + value = attrName; + } + if(s == S_ATTR_NOQUOT_VALUE){ + errorHandler.warning('attribute "'+value+'" missed quot(")!!'); + el.add(attrName,value.replace(/&#?\w+;/g,entityReplacer),start) + }else{ + if(currentNSMap[''] !== 'http://www.w3.org/1999/xhtml' || !value.match(/^(?:disabled|checked|selected)$/i)){ + errorHandler.warning('attribute "'+value+'" missed value!! "'+value+'" instead!!') + } + el.add(value,value,start) + } + break; + case S_EQ: + throw new Error('attribute value missed!!'); + } +// console.log(tagName,tagNamePattern,tagNamePattern.test(tagName)) + return p; + /*xml space '\x20' | #x9 | #xD | #xA; */ + case '\u0080': + c = ' '; + default: + if(c<= ' '){//space + switch(s){ + case S_TAG: + el.setTagName(source.slice(start,p));//tagName + s = S_TAG_SPACE; + break; + case S_ATTR: + attrName = source.slice(start,p) + s = S_ATTR_SPACE; + break; + case S_ATTR_NOQUOT_VALUE: + var value = source.slice(start,p).replace(/&#?\w+;/g,entityReplacer); + errorHandler.warning('attribute "'+value+'" missed quot(")!!'); + el.add(attrName,value,start) + case S_ATTR_END: + s = S_TAG_SPACE; + break; + //case S_TAG_SPACE: + //case S_EQ: + //case S_ATTR_SPACE: + // void();break; + //case S_TAG_CLOSE: + //ignore warning + } + }else{//not space +//S_TAG, S_ATTR, S_EQ, S_ATTR_NOQUOT_VALUE +//S_ATTR_SPACE, S_ATTR_END, S_TAG_SPACE, S_TAG_CLOSE + switch(s){ + //case S_TAG:void();break; + //case S_ATTR:void();break; + //case S_ATTR_NOQUOT_VALUE:void();break; + case S_ATTR_SPACE: + var tagName = el.tagName; + if(currentNSMap[''] !== 'http://www.w3.org/1999/xhtml' || !attrName.match(/^(?:disabled|checked|selected)$/i)){ + errorHandler.warning('attribute "'+attrName+'" missed value!! "'+attrName+'" instead2!!') + } + el.add(attrName,attrName,start); + start = p; + s = S_ATTR; + break; + case S_ATTR_END: + errorHandler.warning('attribute space is required"'+attrName+'"!!') + case S_TAG_SPACE: + s = S_ATTR; + start = p; + break; + case S_EQ: + s = S_ATTR_NOQUOT_VALUE; + start = p; + break; + case S_TAG_CLOSE: + throw new Error("elements closed character '/' and '>' must be connected to"); + } + } + }//end outer switch + //console.log('p++',p) + p++; + } +} +/** + * @return true if has new namespace define + */ +function appendElement(el,domBuilder,currentNSMap){ + var tagName = el.tagName; + var localNSMap = null; + //var currentNSMap = parseStack[parseStack.length-1].currentNSMap; + var i = el.length; + while(i--){ + var a = el[i]; + var qName = a.qName; + var value = a.value; + var nsp = qName.indexOf(':'); + if(nsp>0){ + var prefix = a.prefix = qName.slice(0,nsp); + var localName = qName.slice(nsp+1); + var nsPrefix = prefix === 'xmlns' && localName + }else{ + localName = qName; + prefix = null + nsPrefix = qName === 'xmlns' && '' + } + //can not set prefix,because prefix !== '' + a.localName = localName ; + //prefix == null for no ns prefix attribute + if(nsPrefix !== false){//hack!! + if(localNSMap == null){ + localNSMap = {} + //console.log(currentNSMap,0) + _copy(currentNSMap,currentNSMap={}) + //console.log(currentNSMap,1) + } + currentNSMap[nsPrefix] = localNSMap[nsPrefix] = value; + a.uri = 'http://www.w3.org/2000/xmlns/' + domBuilder.startPrefixMapping(nsPrefix, value) + } + } + var i = el.length; + while(i--){ + a = el[i]; + var prefix = a.prefix; + if(prefix){//no prefix attribute has no namespace + if(prefix === 'xml'){ + a.uri = 'http://www.w3.org/XML/1998/namespace'; + }if(prefix !== 'xmlns'){ + a.uri = currentNSMap[prefix || ''] + + //{console.log('###'+a.qName,domBuilder.locator.systemId+'',currentNSMap,a.uri)} + } + } + } + var nsp = tagName.indexOf(':'); + if(nsp>0){ + prefix = el.prefix = tagName.slice(0,nsp); + localName = el.localName = tagName.slice(nsp+1); + }else{ + prefix = null;//important!! + localName = el.localName = tagName; + } + //no prefix element has default namespace + var ns = el.uri = currentNSMap[prefix || '']; + domBuilder.startElement(ns,localName,tagName,el); + //endPrefixMapping and startPrefixMapping have not any help for dom builder + //localNSMap = null + if(el.closed){ + domBuilder.endElement(ns,localName,tagName); + if(localNSMap){ + for(prefix in localNSMap){ + domBuilder.endPrefixMapping(prefix) + } + } + }else{ + el.currentNSMap = currentNSMap; + el.localNSMap = localNSMap; + //parseStack.push(el); + return true; + } +} +function parseHtmlSpecialContent(source,elStartEnd,tagName,entityReplacer,domBuilder){ + if(/^(?:script|textarea)$/i.test(tagName)){ + var elEndStart = source.indexOf('',elStartEnd); + var text = source.substring(elStartEnd+1,elEndStart); + if(/[&<]/.test(text)){ + if(/^script$/i.test(tagName)){ + //if(!/\]\]>/.test(text)){ + //lexHandler.startCDATA(); + domBuilder.characters(text,0,text.length); + //lexHandler.endCDATA(); + return elEndStart; + //} + }//}else{//text area + text = text.replace(/&#?\w+;/g,entityReplacer); + domBuilder.characters(text,0,text.length); + return elEndStart; + //} + + } + } + return elStartEnd+1; +} +function fixSelfClosed(source,elStartEnd,tagName,closeMap){ + //if(tagName in closeMap){ + var pos = closeMap[tagName]; + if(pos == null){ + //console.log(tagName) + pos = source.lastIndexOf('') + if(pos',start+4); + //append comment source.substring(4,end)// https://davidwalsh.name/add-rules-stylesheets + style.appendChild(document.createTextNode("")); + + document.head.appendChild(style); + + return style.sheet; + } + }, { + key: "addStyleRules", + value: function addStyleRules(selector, rulesArray) { + var scope = "#" + this.id + " "; + var rules = ""; + + if (!this.sheet) { + this.sheet = this.getSheet(); + } + + rulesArray.forEach(function (set) { + for (var prop in set) { + if (set.hasOwnProperty(prop)) { + rules += prop + ":" + set[prop] + ";"; + } + } + }); + + this.sheet.insertRule(scope + selector + " {" + rules + "}", 0); + } + }, { + key: "axis", + value: function axis(_axis) { + if (_axis === "horizontal") { + this.container.style.display = "flex"; + this.container.style.flexDirection = "row"; + this.container.style.flexWrap = "nowrap"; + } else { + this.container.style.display = "block"; + } + this.settings.axis = _axis; + } + + // orientation(orientation) { + // if (orientation === "landscape") { + // + // } else { + // + // } + // + // this.orientation = orientation; + // } + + }, { + key: "direction", + value: function direction(dir) { + if (this.container) { + this.container.dir = dir; + this.container.style["direction"] = dir; + } + + if (this.settings.fullsize) { + document.body.style["direction"] = dir; + } + this.settings.dir = dir; + } + }, { + key: "overflow", + value: function overflow(_overflow) { + if (this.container) { + if (_overflow === "scroll" && this.settings.axis === "vertical") { + this.container.style["overflow-y"] = _overflow; + this.container.style["overflow-x"] = "hidden"; + } else if (_overflow === "scroll" && this.settings.axis === "horizontal") { + this.container.style["overflow-y"] = "hidden"; + this.container.style["overflow-x"] = _overflow; + } else { + this.container.style["overflow"] = _overflow; + } + } + this.settings.overflow = _overflow; + } + }, { + key: "destroy", + value: function destroy() { + var base; + + if (this.element) { + + if (this.settings.hidden) { + base = this.wrapper; + } else { + base = this.container; + } + + if (this.element.contains(this.container)) { + this.element.removeChild(this.container); + } + + window.removeEventListener("resize", this.resizeFunc); + window.removeEventListener("orientationChange", this.orientationChangeFunc); + } + } + }]); + + return Stage; +}(); + +exports.default = Stage; +module.exports = exports["default"]; + +/***/ }), +/* 60 */ +/***/ (function(module, exports, __webpack_require__) { + +var debounce = __webpack_require__(21), + isObject = __webpack_require__(16); + +/** Error message constants. */ +var FUNC_ERROR_TEXT = 'Expected a function'; + +/** + * Creates a throttled function that only invokes `func` at most once per + * every `wait` milliseconds. The throttled function comes with a `cancel` + * method to cancel delayed `func` invocations and a `flush` method to + * immediately invoke them. Provide `options` to indicate whether `func` + * should be invoked on the leading and/or trailing edge of the `wait` + * timeout. The `func` is invoked with the last arguments provided to the + * throttled function. Subsequent calls to the throttled function return the + * result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the throttled function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.throttle` and `_.debounce`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to throttle. + * @param {number} [wait=0] The number of milliseconds to throttle invocations to. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=true] + * Specify invoking on the leading edge of the timeout. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new throttled function. + * @example + * + * // Avoid excessively updating the position while scrolling. + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * + * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); + * jQuery(element).on('click', throttled); + * + * // Cancel the trailing throttled invocation. + * jQuery(window).on('popstate', throttled.cancel); + */ +function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + return debounce(func, wait, { + 'leading': leading, + 'maxWait': wait, + 'trailing': trailing + }); +} + +module.exports = throttle; + + +/***/ }), +/* 61 */ +/***/ (function(module, exports, __webpack_require__) { + +var root = __webpack_require__(22); + +/** + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. + * @example + * + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. + */ +var now = function() { + return root.Date.now(); +}; + +module.exports = now; + + +/***/ }), +/* 62 */ +/***/ (function(module, exports, __webpack_require__) { + +/* WEBPACK VAR INJECTION */(function(global) {/** Detect free variable `global` from Node.js. */ +var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; + +module.exports = freeGlobal; + +/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(5))) + +/***/ }), +/* 63 */ +/***/ (function(module, exports, __webpack_require__) { + +var isObject = __webpack_require__(16), + isSymbol = __webpack_require__(64); + +/** Used as references for various `Number` constants. */ +var NAN = 0 / 0; + +/** Used to match leading and trailing whitespace. */ +var reTrim = /^\s+|\s+$/g; + +/** Used to detect bad signed hexadecimal string values. */ +var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + +/** Used to detect binary string values. */ +var reIsBinary = /^0b[01]+$/i; + +/** Used to detect octal string values. */ +var reIsOctal = /^0o[0-7]+$/i; + +/** Built-in method references without a dependency on `root`. */ +var freeParseInt = parseInt; + +/** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3.2); + * // => 3.2 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3.2'); + * // => 3.2 + */ +function toNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + if (isObject(value)) { + var other = typeof value.valueOf == 'function' ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); +} + +module.exports = toNumber; + + +/***/ }), +/* 64 */ +/***/ (function(module, exports, __webpack_require__) { + +var baseGetTag = __webpack_require__(65), + isObjectLike = __webpack_require__(68); + +/** `Object#toString` result references. */ +var symbolTag = '[object Symbol]'; + +/** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ +function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && baseGetTag(value) == symbolTag); +} + +module.exports = isSymbol; + + +/***/ }), +/* 65 */ +/***/ (function(module, exports, __webpack_require__) { + +var Symbol = __webpack_require__(23), + getRawTag = __webpack_require__(66), + objectToString = __webpack_require__(67); + +/** `Object#toString` result references. */ +var nullTag = '[object Null]', + undefinedTag = '[object Undefined]'; + +/** Built-in value references. */ +var symToStringTag = Symbol ? Symbol.toStringTag : undefined; + +/** + * The base implementation of `getTag` without fallbacks for buggy environments. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ +function baseGetTag(value) { + if (value == null) { + return value === undefined ? undefinedTag : nullTag; + } + return (symToStringTag && symToStringTag in Object(value)) + ? getRawTag(value) + : objectToString(value); +} + +module.exports = baseGetTag; + + +/***/ }), +/* 66 */ +/***/ (function(module, exports, __webpack_require__) { + +var Symbol = __webpack_require__(23); + +/** Used for built-in method references. */ +var objectProto = Object.prototype; + +/** Used to check objects for own properties. */ +var hasOwnProperty = objectProto.hasOwnProperty; + +/** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ +var nativeObjectToString = objectProto.toString; + +/** Built-in value references. */ +var symToStringTag = Symbol ? Symbol.toStringTag : undefined; + +/** + * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the raw `toStringTag`. + */ +function getRawTag(value) { + var isOwn = hasOwnProperty.call(value, symToStringTag), + tag = value[symToStringTag]; + + try { + value[symToStringTag] = undefined; + var unmasked = true; + } catch (e) {} + + var result = nativeObjectToString.call(value); + if (unmasked) { + if (isOwn) { + value[symToStringTag] = tag; + } else { + delete value[symToStringTag]; + } + } + return result; +} + +module.exports = getRawTag; + + +/***/ }), +/* 67 */ +/***/ (function(module, exports) { + +/** Used for built-in method references. */ +var objectProto = Object.prototype; + +/** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ +var nativeObjectToString = objectProto.toString; + +/** + * Converts `value` to a string using `Object.prototype.toString`. + * + * @private + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + */ +function objectToString(value) { + return nativeObjectToString.call(value); +} + +module.exports = objectToString; + + +/***/ }), +/* 68 */ +/***/ (function(module, exports) { + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return value != null && typeof value == 'object'; +} + +module.exports = isObjectLike; + + +/***/ }), +/* 69 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +var Views = function () { + function Views(container) { + _classCallCheck(this, Views); + + this.container = container; + this._views = []; + this.length = 0; + this.hidden = false; + } + + _createClass(Views, [{ + key: "all", + value: function all() { + return this._views; + } + }, { + key: "first", + value: function first() { + return this._views[0]; + } + }, { + key: "last", + value: function last() { + return this._views[this._views.length - 1]; + } + }, { + key: "indexOf", + value: function indexOf(view) { + return this._views.indexOf(view); + } + }, { + key: "slice", + value: function slice() { + return this._views.slice.apply(this._views, arguments); + } + }, { + key: "get", + value: function get(i) { + return this._views[i]; + } + }, { + key: "append", + value: function append(view) { + this._views.push(view); + if (this.container) { + this.container.appendChild(view.element); + } + this.length++; + return view; + } + }, { + key: "prepend", + value: function prepend(view) { + this._views.unshift(view); + if (this.container) { + this.container.insertBefore(view.element, this.container.firstChild); + } + this.length++; + return view; + } + }, { + key: "insert", + value: function insert(view, index) { + this._views.splice(index, 0, view); + + if (this.container) { + if (index < this.container.children.length) { + this.container.insertBefore(view.element, this.container.children[index]); + } else { + this.container.appendChild(view.element); + } + } + + this.length++; + return view; + } + }, { + key: "remove", + value: function remove(view) { + var index = this._views.indexOf(view); + + if (index > -1) { + this._views.splice(index, 1); + } + + this.destroy(view); + + this.length--; + } + }, { + key: "destroy", + value: function destroy(view) { + if (view.displayed) { + view.destroy(); + } + + if (this.container) { + this.container.removeChild(view.element); + } + view = null; + } + + // Iterators + + }, { + key: "forEach", + value: function forEach() { + return this._views.forEach.apply(this._views, arguments); + } + }, { + key: "clear", + value: function clear() { + // Remove all views + var view; + var len = this.length; + + if (!this.length) return; + + for (var i = 0; i < len; i++) { + view = this._views[i]; + this.destroy(view); + } + + this._views = []; + this.length = 0; + } + }, { + key: "find", + value: function find(section) { + + var view; + var len = this.length; + + for (var i = 0; i < len; i++) { + view = this._views[i]; + if (view.displayed && view.section.index == section.index) { + return view; + } + } + } + }, { + key: "displayed", + value: function displayed() { + var displayed = []; + var view; + var len = this.length; + + for (var i = 0; i < len; i++) { + view = this._views[i]; + if (view.displayed) { + displayed.push(view); + } + } + return displayed; + } + }, { + key: "show", + value: function show() { + var view; + var len = this.length; + + for (var i = 0; i < len; i++) { + view = this._views[i]; + if (view.displayed) { + view.show(); + } + } + this.hidden = false; + } + }, { + key: "hide", + value: function hide() { + var view; + var len = this.length; + + for (var i = 0; i < len; i++) { + view = this._views[i]; + if (view.displayed) { + view.hide(); + } + } + this.hidden = true; + } + }]); + + return Views; +}(); + +exports.default = Views; +module.exports = exports["default"]; + +/***/ }), +/* 70 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _core = __webpack_require__(0); + +var _constants = __webpack_require__(2); + +var _eventEmitter = __webpack_require__(3); + +var _eventEmitter2 = _interopRequireDefault(_eventEmitter); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +// easing equations from https://github.com/danro/easing-js/blob/master/easing.js +var PI_D2 = Math.PI / 2; +var EASING_EQUATIONS = { + easeOutSine: function easeOutSine(pos) { + return Math.sin(pos * PI_D2); + }, + easeInOutSine: function easeInOutSine(pos) { + return -0.5 * (Math.cos(Math.PI * pos) - 1); + }, + easeInOutQuint: function easeInOutQuint(pos) { + if ((pos /= 0.5) < 1) { + return 0.5 * Math.pow(pos, 5); + } + return 0.5 * (Math.pow(pos - 2, 5) + 2); + }, + easeInCubic: function easeInCubic(pos) { + return Math.pow(pos, 3); + } +}; + +var Snap = function () { + function Snap(manager, options) { + _classCallCheck(this, Snap); + + this.settings = (0, _core.extend)({ + duration: 80, + minVelocity: 0.2, + minDistance: 10, + easing: EASING_EQUATIONS['easeInCubic'] + }, options || {}); + + this.supportsTouch = this.supportsTouch(); + + if (this.supportsTouch) { + this.setup(manager); + } + } + + _createClass(Snap, [{ + key: "setup", + value: function setup(manager) { + this.manager = manager; + + this.layout = this.manager.layout; + + this.fullsize = this.manager.settings.fullsize; + if (this.fullsize) { + this.element = this.manager.stage.element; + this.scroller = window; + this.disableScroll(); + } else { + this.element = this.manager.stage.container; + this.scroller = this.element; + this.element.style["WebkitOverflowScrolling"] = "touch"; + } + + // this.overflow = this.manager.overflow; + + // set lookahead offset to page width + this.manager.settings.offset = this.layout.width; + this.manager.settings.afterScrolledTimeout = this.settings.duration * 2; + + this.isVertical = this.manager.settings.axis === "vertical"; + + // disable snapping if not paginated or axis in not horizontal + if (!this.manager.isPaginated || this.isVertical) { + return; + } + + this.touchCanceler = false; + this.resizeCanceler = false; + this.snapping = false; + + this.scrollLeft; + this.scrollTop; + + this.startTouchX = undefined; + this.startTouchY = undefined; + this.startTime = undefined; + this.endTouchX = undefined; + this.endTouchY = undefined; + this.endTime = undefined; + + this.addListeners(); + } + }, { + key: "supportsTouch", + value: function supportsTouch() { + if ('ontouchstart' in window || window.DocumentTouch && document instanceof DocumentTouch) { + return true; + } + + return false; + } + }, { + key: "disableScroll", + value: function disableScroll() { + this.element.style.overflow = "hidden"; + } + }, { + key: "enableScroll", + value: function enableScroll() { + this.element.style.overflow = ""; + } + }, { + key: "addListeners", + value: function addListeners() { + this._onResize = this.onResize.bind(this); + window.addEventListener('resize', this._onResize); + + this._onScroll = this.onScroll.bind(this); + this.scroller.addEventListener('scroll', this._onScroll); + + this._onTouchStart = this.onTouchStart.bind(this); + this.scroller.addEventListener('touchstart', this._onTouchStart, { passive: true }); + this.on('touchstart', this._onTouchStart); + + this._onTouchMove = this.onTouchMove.bind(this); + this.scroller.addEventListener('touchmove', this._onTouchMove, { passive: true }); + this.on('touchmove', this._onTouchMove); + + this._onTouchEnd = this.onTouchEnd.bind(this); + this.scroller.addEventListener('touchend', this._onTouchEnd, { passive: true }); + this.on('touchend', this._onTouchEnd); + + this._afterDisplayed = this.afterDisplayed.bind(this); + this.manager.on(_constants.EVENTS.MANAGERS.ADDED, this._afterDisplayed); + } + }, { + key: "removeListeners", + value: function removeListeners() { + window.removeEventListener('resize', this._onResize); + this._onResize = undefined; + + this.scroller.removeEventListener('scroll', this._onScroll); + this._onScroll = undefined; + + this.scroller.removeEventListener('touchstart', this._onTouchStart, { passive: true }); + this.off('touchstart', this._onTouchStart); + this._onTouchStart = undefined; + + this.scroller.removeEventListener('touchmove', this._onTouchMove, { passive: true }); + this.off('touchmove', this._onTouchMove); + this._onTouchMove = undefined; + + this.scroller.removeEventListener('touchend', this._onTouchEnd, { passive: true }); + this.off('touchend', this._onTouchEnd); + this._onTouchEnd = undefined; + + this.manager.off(_constants.EVENTS.MANAGERS.ADDED, this._afterDisplayed); + this._afterDisplayed = undefined; + } + }, { + key: "afterDisplayed", + value: function afterDisplayed(view) { + var _this = this; + + var contents = view.contents; + ["touchstart", "touchmove", "touchend"].forEach(function (e) { + contents.on(e, function (ev) { + return _this.triggerViewEvent(ev, contents); + }); + }); + } + }, { + key: "triggerViewEvent", + value: function triggerViewEvent(e, contents) { + this.emit(e.type, e, contents); + } + }, { + key: "onScroll", + value: function onScroll(e) { + this.scrollLeft = this.fullsize ? window.scrollX : this.scroller.scrollLeft; + this.scrollTop = this.fullsize ? window.scrollY : this.scroller.scrollTop; + } + }, { + key: "onResize", + value: function onResize(e) { + this.resizeCanceler = true; + } + }, { + key: "onTouchStart", + value: function onTouchStart(e) { + var _e$touches$ = e.touches[0], + screenX = _e$touches$.screenX, + screenY = _e$touches$.screenY; + + + if (this.fullsize) { + this.enableScroll(); + } + + this.touchCanceler = true; + + if (!this.startTouchX) { + this.startTouchX = screenX; + this.startTouchY = screenY; + this.startTime = this.now(); + } + + this.endTouchX = screenX; + this.endTouchY = screenY; + this.endTime = this.now(); + } + }, { + key: "onTouchMove", + value: function onTouchMove(e) { + var _e$touches$2 = e.touches[0], + screenX = _e$touches$2.screenX, + screenY = _e$touches$2.screenY; + + var deltaY = Math.abs(screenY - this.endTouchY); + + this.touchCanceler = true; + + if (!this.fullsize && deltaY < 10) { + this.element.scrollLeft -= screenX - this.endTouchX; + } + + this.endTouchX = screenX; + this.endTouchY = screenY; + this.endTime = this.now(); + } + }, { + key: "onTouchEnd", + value: function onTouchEnd(e) { + if (this.fullsize) { + this.disableScroll(); + } + + this.touchCanceler = false; + + var swipped = this.wasSwiped(); + + if (swipped !== 0) { + this.snap(swipped); + } else { + this.snap(); + } + + this.startTouchX = undefined; + this.startTouchY = undefined; + this.startTime = undefined; + this.endTouchX = undefined; + this.endTouchY = undefined; + this.endTime = undefined; + } + }, { + key: "wasSwiped", + value: function wasSwiped() { + var snapWidth = this.layout.pageWidth * this.layout.divisor; + var distance = this.endTouchX - this.startTouchX; + var absolute = Math.abs(distance); + var time = this.endTime - this.startTime; + var velocity = distance / time; + var minVelocity = this.settings.minVelocity; + + if (absolute <= this.settings.minDistance || absolute >= snapWidth) { + return 0; + } + + if (velocity > minVelocity) { + // previous + return -1; + } else if (velocity < -minVelocity) { + // next + return 1; + } + } + }, { + key: "needsSnap", + value: function needsSnap() { + var left = this.scrollLeft; + var snapWidth = this.layout.pageWidth * this.layout.divisor; + return left % snapWidth !== 0; + } + }, { + key: "snap", + value: function snap() { + var howMany = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + + var left = this.scrollLeft; + var snapWidth = this.layout.pageWidth * this.layout.divisor; + var snapTo = Math.round(left / snapWidth) * snapWidth; + + if (howMany) { + snapTo += howMany * snapWidth; + } + + return this.smoothScrollTo(snapTo); + } + }, { + key: "smoothScrollTo", + value: function smoothScrollTo(destination) { + var deferred = new _core.defer(); + var start = this.scrollLeft; + var startTime = this.now(); + + var duration = this.settings.duration; + var easing = this.settings.easing; + + this.snapping = true; + + // add animation loop + function tick() { + var now = this.now(); + var time = Math.min(1, (now - startTime) / duration); + var timeFunction = easing(time); + + if (this.touchCanceler || this.resizeCanceler) { + this.resizeCanceler = false; + this.snapping = false; + deferred.resolve(); + return; + } + + if (time < 1) { + window.requestAnimationFrame(tick.bind(this)); + this.scrollTo(start + (destination - start) * time, 0); + } else { + this.scrollTo(destination, 0); + this.snapping = false; + deferred.resolve(); + } + } + + tick.call(this); + + return deferred.promise; + } + }, { + key: "scrollTo", + value: function scrollTo() { + var left = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + var top = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0; + + if (this.fullsize) { + window.scroll(left, top); + } else { + this.scroller.scrollLeft = left; + this.scroller.scrollTop = top; + } + } + }, { + key: "now", + value: function now() { + return 'now' in window.performance ? performance.now() : new Date().getTime(); + } + }, { + key: "destroy", + value: function destroy() { + if (!this.scroller) { + return; + } + + if (this.fullsize) { + this.enableScroll(); + } + + this.removeListeners(); + + this.scroller = undefined; + } + }]); + + return Snap; +}(); + +(0, _eventEmitter2.default)(Snap.prototype); + +exports.default = Snap; +module.exports = exports["default"]; + +/***/ }), +/* 71 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _core = __webpack_require__(0); + +var _request = __webpack_require__(9); + +var _request2 = _interopRequireDefault(_request); + +var _mime = __webpack_require__(13); + +var _mime2 = _interopRequireDefault(_mime); + +var _path = __webpack_require__(4); + +var _path2 = _interopRequireDefault(_path); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Handles Unzipping a requesting files from an Epub Archive + * @class + */ +var Archive = function () { + function Archive() { + _classCallCheck(this, Archive); + + this.zip = undefined; + this.urlCache = {}; + + this.checkRequirements(); + } + + /** + * Checks to see if JSZip exists in global namspace, + * Requires JSZip if it isn't there + * @private + */ + + + _createClass(Archive, [{ + key: "checkRequirements", + value: function checkRequirements() { + try { + if (typeof JSZip === "undefined") { + var _JSZip = __webpack_require__(72); + this.zip = new _JSZip(); + } else { + this.zip = new JSZip(); + } + } catch (e) { + throw new Error("JSZip lib not loaded"); + } + } + + /** + * Open an archive + * @param {binary} input + * @param {boolean} [isBase64] tells JSZip if the input data is base64 encoded + * @return {Promise} zipfile + */ + + }, { + key: "open", + value: function open(input, isBase64) { + return this.zip.loadAsync(input, { "base64": isBase64 }); + } + + /** + * Load and Open an archive + * @param {string} zipUrl + * @param {boolean} [isBase64] tells JSZip if the input data is base64 encoded + * @return {Promise} zipfile + */ + + }, { + key: "openUrl", + value: function openUrl(zipUrl, isBase64) { + return (0, _request2.default)(zipUrl, "binary").then(function (data) { + return this.zip.loadAsync(data, { "base64": isBase64 }); + }.bind(this)); + } + + /** + * Request a url from the archive + * @param {string} url a url to request from the archive + * @param {string} [type] specify the type of the returned result + * @return {Promise} + */ + + }, { + key: "request", + value: function request(url, type) { + var deferred = new _core.defer(); + var response; + var path = new _path2.default(url); + + // If type isn't set, determine it from the file extension + if (!type) { + type = path.extension; + } + + if (type == "blob") { + response = this.getBlob(url); + } else { + response = this.getText(url); + } + + if (response) { + response.then(function (r) { + var result = this.handleResponse(r, type); + deferred.resolve(result); + }.bind(this)); + } else { + deferred.reject({ + message: "File not found in the epub: " + url, + stack: new Error().stack + }); + } + return deferred.promise; + } + + /** + * Handle the response from request + * @private + * @param {any} response + * @param {string} [type] + * @return {any} the parsed result + */ + + }, { + key: "handleResponse", + value: function handleResponse(response, type) { + var r; + + if (type == "json") { + r = JSON.parse(response); + } else if ((0, _core.isXml)(type)) { + r = (0, _core.parse)(response, "text/xml"); + } else if (type == "xhtml") { + r = (0, _core.parse)(response, "application/xhtml+xml"); + } else if (type == "html" || type == "htm") { + r = (0, _core.parse)(response, "text/html"); + } else { + r = response; + } + + return r; + } + + /** + * Get a Blob from Archive by Url + * @param {string} url + * @param {string} [mimeType] + * @return {Blob} + */ + + }, { + key: "getBlob", + value: function getBlob(url, mimeType) { + var decodededUrl = window.decodeURIComponent(url.substr(1)); // Remove first slash + var entry = this.zip.file(decodededUrl); + + if (entry) { + mimeType = mimeType || _mime2.default.lookup(entry.name); + return entry.async("uint8array").then(function (uint8array) { + return new Blob([uint8array], { type: mimeType }); + }); + } + } + + /** + * Get Text from Archive by Url + * @param {string} url + * @param {string} [encoding] + * @return {string} + */ + + }, { + key: "getText", + value: function getText(url, encoding) { + var decodededUrl = window.decodeURIComponent(url.substr(1)); // Remove first slash + var entry = this.zip.file(decodededUrl); + + if (entry) { + return entry.async("string").then(function (text) { + return text; + }); + } + } + + /** + * Get a base64 encoded result from Archive by Url + * @param {string} url + * @param {string} [mimeType] + * @return {string} base64 encoded + */ + + }, { + key: "getBase64", + value: function getBase64(url, mimeType) { + var decodededUrl = window.decodeURIComponent(url.substr(1)); // Remove first slash + var entry = this.zip.file(decodededUrl); + + if (entry) { + mimeType = mimeType || _mime2.default.lookup(entry.name); + return entry.async("base64").then(function (data) { + return "data:" + mimeType + ";base64," + data; + }); + } + } + + /** + * Create a Url from an unarchived item + * @param {string} url + * @param {object} [options.base64] use base64 encoding or blob url + * @return {Promise} url promise with Url string + */ + + }, { + key: "createUrl", + value: function createUrl(url, options) { + var deferred = new _core.defer(); + var _URL = window.URL || window.webkitURL || window.mozURL; + var tempUrl; + var response; + var useBase64 = options && options.base64; + + if (url in this.urlCache) { + deferred.resolve(this.urlCache[url]); + return deferred.promise; + } + + if (useBase64) { + response = this.getBase64(url); + + if (response) { + response.then(function (tempUrl) { + + this.urlCache[url] = tempUrl; + deferred.resolve(tempUrl); + }.bind(this)); + } + } else { + + response = this.getBlob(url); + + if (response) { + response.then(function (blob) { + + tempUrl = _URL.createObjectURL(blob); + this.urlCache[url] = tempUrl; + deferred.resolve(tempUrl); + }.bind(this)); + } + } + + if (!response) { + deferred.reject({ + message: "File not found in the epub: " + url, + stack: new Error().stack + }); + } + + return deferred.promise; + } + + /** + * Revoke Temp Url for a achive item + * @param {string} url url of the item in the archive + */ + + }, { + key: "revokeUrl", + value: function revokeUrl(url) { + var _URL = window.URL || window.webkitURL || window.mozURL; + var fromCache = this.urlCache[url]; + if (fromCache) _URL.revokeObjectURL(fromCache); + } + }, { + key: "destroy", + value: function destroy() { + var _URL = window.URL || window.webkitURL || window.mozURL; + for (var fromCache in this.urlCache) { + _URL.revokeObjectURL(fromCache); + } + this.zip = undefined; + this.urlCache = {}; + } + }]); + + return Archive; +}(); + +exports.default = Archive; +module.exports = exports["default"]; + +/***/ }), +/* 72 */ +/***/ (function(module, exports) { + +if(typeof __WEBPACK_EXTERNAL_MODULE_72__ === 'undefined') {var e = new Error("Cannot find module \"jszip\""); e.code = 'MODULE_NOT_FOUND'; throw e;} +module.exports = __WEBPACK_EXTERNAL_MODULE_72__; + +/***/ }), +/* 73 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _core = __webpack_require__(0); + +var _request = __webpack_require__(9); + +var _request2 = _interopRequireDefault(_request); + +var _mime = __webpack_require__(13); + +var _mime2 = _interopRequireDefault(_mime); + +var _path = __webpack_require__(4); + +var _path2 = _interopRequireDefault(_path); + +var _eventEmitter = __webpack_require__(3); + +var _eventEmitter2 = _interopRequireDefault(_eventEmitter); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Handles saving and requesting files from local storage + * @class + * @param {string} name This should be the name of the application for modals + * @param {function} [requester] + * @param {function} [resolver] + */ +var Store = function () { + function Store(name, requester, resolver) { + _classCallCheck(this, Store); + + this.urlCache = {}; + + this.storage = undefined; + + this.name = name; + this.requester = requester || _request2.default; + this.resolver = resolver; + + this.online = true; + + this.checkRequirements(); + + this.addListeners(); + } + + /** + * Checks to see if localForage exists in global namspace, + * Requires localForage if it isn't there + * @private + */ + + + _createClass(Store, [{ + key: "checkRequirements", + value: function checkRequirements() { + try { + var store = void 0; + if (typeof localforage === "undefined") { + store = __webpack_require__(74); + } else { + store = localforage; + } + this.storage = store.createInstance({ + name: this.name + }); + } catch (e) { + throw new Error("localForage lib not loaded"); + } + } + + /** + * Add online and offline event listeners + * @private + */ + + }, { + key: "addListeners", + value: function addListeners() { + this._status = this.status.bind(this); + window.addEventListener('online', this._status); + window.addEventListener('offline', this._status); + } + + /** + * Remove online and offline event listeners + * @private + */ + + }, { + key: "removeListeners", + value: function removeListeners() { + window.removeEventListener('online', this._status); + window.removeEventListener('offline', this._status); + this._status = undefined; + } + + /** + * Update the online / offline status + * @private + */ + + }, { + key: "status", + value: function status(event) { + var online = navigator.onLine; + this.online = online; + if (online) { + this.emit("online", this); + } else { + this.emit("offline", this); + } + } + + /** + * Add all of a book resources to the store + * @param {Resources} resources book resources + * @param {boolean} [force] force resaving resources + * @return {Promise} store objects + */ + + }, { + key: "add", + value: function add(resources, force) { + var _this = this; + + var mapped = resources.resources.map(function (item) { + var href = item.href; + + var url = _this.resolver(href); + var encodedUrl = window.encodeURIComponent(url); + + return _this.storage.getItem(encodedUrl).then(function (item) { + if (!item || force) { + return _this.requester(url, "binary").then(function (data) { + return _this.storage.setItem(encodedUrl, data); + }); + } else { + return item; + } + }); + }); + return Promise.all(mapped); + } + + /** + * Put binary data from a url to storage + * @param {string} url a url to request from storage + * @param {boolean} [withCredentials] + * @param {object} [headers] + * @return {Promise} + */ + + }, { + key: "put", + value: function put(url, withCredentials, headers) { + var _this2 = this; + + var encodedUrl = window.encodeURIComponent(url); + + return this.storage.getItem(encodedUrl).then(function (result) { + if (!result) { + return _this2.requester(url, "binary", withCredentials, headers).then(function (data) { + return _this2.storage.setItem(encodedUrl, data); + }); + } + return result; + }); + } + + /** + * Request a url + * @param {string} url a url to request from storage + * @param {string} [type] specify the type of the returned result + * @param {boolean} [withCredentials] + * @param {object} [headers] + * @return {Promise} + */ + + }, { + key: "request", + value: function request(url, type, withCredentials, headers) { + var _this3 = this; + + if (this.online) { + // From network + return this.requester(url, type, withCredentials, headers).then(function (data) { + // save to store if not present + _this3.put(url); + return data; + }); + } else { + // From store + return this.retrieve(url, type); + } + } + + /** + * Request a url from storage + * @param {string} url a url to request from storage + * @param {string} [type] specify the type of the returned result + * @return {Promise} + */ + + }, { + key: "retrieve", + value: function retrieve(url, type) { + var _this4 = this; + + var deferred = new _core.defer(); + var response; + var path = new _path2.default(url); + + // If type isn't set, determine it from the file extension + if (!type) { + type = path.extension; + } + + if (type == "blob") { + response = this.getBlob(url); + } else { + response = this.getText(url); + } + + return response.then(function (r) { + var deferred = new _core.defer(); + var result; + if (r) { + result = _this4.handleResponse(r, type); + deferred.resolve(result); + } else { + deferred.reject({ + message: "File not found in storage: " + url, + stack: new Error().stack + }); + } + return deferred.promise; + }); + } + + /** + * Handle the response from request + * @private + * @param {any} response + * @param {string} [type] + * @return {any} the parsed result + */ + + }, { + key: "handleResponse", + value: function handleResponse(response, type) { + var r; + + if (type == "json") { + r = JSON.parse(response); + } else if ((0, _core.isXml)(type)) { + r = (0, _core.parse)(response, "text/xml"); + } else if (type == "xhtml") { + r = (0, _core.parse)(response, "application/xhtml+xml"); + } else if (type == "html" || type == "htm") { + r = (0, _core.parse)(response, "text/html"); + } else { + r = response; + } + + return r; + } + + /** + * Get a Blob from Storage by Url + * @param {string} url + * @param {string} [mimeType] + * @return {Blob} + */ + + }, { + key: "getBlob", + value: function getBlob(url, mimeType) { + var encodedUrl = window.encodeURIComponent(url); + + return this.storage.getItem(encodedUrl).then(function (uint8array) { + if (!uint8array) return; + + mimeType = mimeType || _mime2.default.lookup(url); + + return new Blob([uint8array], { type: mimeType }); + }); + } + + /** + * Get Text from Storage by Url + * @param {string} url + * @param {string} [mimeType] + * @return {string} + */ + + }, { + key: "getText", + value: function getText(url, mimeType) { + var encodedUrl = window.encodeURIComponent(url); + + mimeType = mimeType || _mime2.default.lookup(url); + + return this.storage.getItem(encodedUrl).then(function (uint8array) { + var deferred = new _core.defer(); + var reader = new FileReader(); + var blob; + + if (!uint8array) return; + + blob = new Blob([uint8array], { type: mimeType }); + + reader.addEventListener("loadend", function () { + deferred.resolve(reader.result); + }); + + reader.readAsText(blob, mimeType); + + return deferred.promise; + }); + } + + /** + * Get a base64 encoded result from Storage by Url + * @param {string} url + * @param {string} [mimeType] + * @return {string} base64 encoded + */ + + }, { + key: "getBase64", + value: function getBase64(url, mimeType) { + var encodedUrl = window.encodeURIComponent(url); + + mimeType = mimeType || _mime2.default.lookup(url); + + return this.storage.getItem(encodedUrl).then(function (uint8array) { + var deferred = new _core.defer(); + var reader = new FileReader(); + var blob; + + if (!uint8array) return; + + blob = new Blob([uint8array], { type: mimeType }); + + reader.addEventListener("loadend", function () { + deferred.resolve(reader.result); + }); + reader.readAsDataURL(blob, mimeType); + + return deferred.promise; + }); + } + + /** + * Create a Url from a stored item + * @param {string} url + * @param {object} [options.base64] use base64 encoding or blob url + * @return {Promise} url promise with Url string + */ + + }, { + key: "createUrl", + value: function createUrl(url, options) { + var deferred = new _core.defer(); + var _URL = window.URL || window.webkitURL || window.mozURL; + var tempUrl; + var response; + var useBase64 = options && options.base64; + + if (url in this.urlCache) { + deferred.resolve(this.urlCache[url]); + return deferred.promise; + } + + if (useBase64) { + response = this.getBase64(url); + + if (response) { + response.then(function (tempUrl) { + + this.urlCache[url] = tempUrl; + deferred.resolve(tempUrl); + }.bind(this)); + } + } else { + + response = this.getBlob(url); + + if (response) { + response.then(function (blob) { + + tempUrl = _URL.createObjectURL(blob); + this.urlCache[url] = tempUrl; + deferred.resolve(tempUrl); + }.bind(this)); + } + } + + if (!response) { + deferred.reject({ + message: "File not found in storage: " + url, + stack: new Error().stack + }); + } + + return deferred.promise; + } + + /** + * Revoke Temp Url for a achive item + * @param {string} url url of the item in the store + */ + + }, { + key: "revokeUrl", + value: function revokeUrl(url) { + var _URL = window.URL || window.webkitURL || window.mozURL; + var fromCache = this.urlCache[url]; + if (fromCache) _URL.revokeObjectURL(fromCache); + } + }, { + key: "destroy", + value: function destroy() { + var _URL = window.URL || window.webkitURL || window.mozURL; + for (var fromCache in this.urlCache) { + _URL.revokeObjectURL(fromCache); + } + this.urlCache = {}; + this.removeListeners(); + } + }]); + + return Store; +}(); + +(0, _eventEmitter2.default)(Store.prototype); + +exports.default = Store; +module.exports = exports["default"]; + +/***/ }), +/* 74 */ +/***/ (function(module, exports, __webpack_require__) { + +/* WEBPACK VAR INJECTION */(function(global) {var require;var require;/*! + localForage -- Offline Storage, Improved + Version 1.7.3 + https://localforage.github.io/localForage + (c) 2013-2017 Mozilla, Apache License 2.0 +*/ +(function(f){if(true){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.localforage = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return require(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw (f.code="MODULE_NOT_FOUND", f)}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o element; its readystatechange event will be fired asynchronously once it is inserted + // into the document. Do so, thus queuing up the task. Remember to clean up once it's been called. + var scriptEl = global.document.createElement('script'); + scriptEl.onreadystatechange = function () { + nextTick(); + + scriptEl.onreadystatechange = null; + scriptEl.parentNode.removeChild(scriptEl); + scriptEl = null; + }; + global.document.documentElement.appendChild(scriptEl); + }; + } else { + scheduleDrain = function () { + setTimeout(nextTick, 0); + }; + } +} + +var draining; +var queue = []; +//named nextTick for less confusing stack traces +function nextTick() { + draining = true; + var i, oldQueue; + var len = queue.length; + while (len) { + oldQueue = queue; + queue = []; + i = -1; + while (++i < len) { + oldQueue[i](); + } + len = queue.length; + } + draining = false; +} + +module.exports = immediate; +function immediate(task) { + if (queue.push(task) === 1 && !draining) { + scheduleDrain(); + } +} + +}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{}],2:[function(_dereq_,module,exports){ +'use strict'; +var immediate = _dereq_(1); + +/* istanbul ignore next */ +function INTERNAL() {} + +var handlers = {}; + +var REJECTED = ['REJECTED']; +var FULFILLED = ['FULFILLED']; +var PENDING = ['PENDING']; + +module.exports = Promise; + +function Promise(resolver) { + if (typeof resolver !== 'function') { + throw new TypeError('resolver must be a function'); + } + this.state = PENDING; + this.queue = []; + this.outcome = void 0; + if (resolver !== INTERNAL) { + safelyResolveThenable(this, resolver); + } +} + +Promise.prototype["catch"] = function (onRejected) { + return this.then(null, onRejected); +}; +Promise.prototype.then = function (onFulfilled, onRejected) { + if (typeof onFulfilled !== 'function' && this.state === FULFILLED || + typeof onRejected !== 'function' && this.state === REJECTED) { + return this; + } + var promise = new this.constructor(INTERNAL); + if (this.state !== PENDING) { + var resolver = this.state === FULFILLED ? onFulfilled : onRejected; + unwrap(promise, resolver, this.outcome); + } else { + this.queue.push(new QueueItem(promise, onFulfilled, onRejected)); + } + + return promise; +}; +function QueueItem(promise, onFulfilled, onRejected) { + this.promise = promise; + if (typeof onFulfilled === 'function') { + this.onFulfilled = onFulfilled; + this.callFulfilled = this.otherCallFulfilled; + } + if (typeof onRejected === 'function') { + this.onRejected = onRejected; + this.callRejected = this.otherCallRejected; + } +} +QueueItem.prototype.callFulfilled = function (value) { + handlers.resolve(this.promise, value); +}; +QueueItem.prototype.otherCallFulfilled = function (value) { + unwrap(this.promise, this.onFulfilled, value); +}; +QueueItem.prototype.callRejected = function (value) { + handlers.reject(this.promise, value); +}; +QueueItem.prototype.otherCallRejected = function (value) { + unwrap(this.promise, this.onRejected, value); +}; + +function unwrap(promise, func, value) { + immediate(function () { + var returnValue; + try { + returnValue = func(value); + } catch (e) { + return handlers.reject(promise, e); + } + if (returnValue === promise) { + handlers.reject(promise, new TypeError('Cannot resolve promise with itself')); + } else { + handlers.resolve(promise, returnValue); + } + }); +} + +handlers.resolve = function (self, value) { + var result = tryCatch(getThen, value); + if (result.status === 'error') { + return handlers.reject(self, result.value); + } + var thenable = result.value; + + if (thenable) { + safelyResolveThenable(self, thenable); + } else { + self.state = FULFILLED; + self.outcome = value; + var i = -1; + var len = self.queue.length; + while (++i < len) { + self.queue[i].callFulfilled(value); + } + } + return self; +}; +handlers.reject = function (self, error) { + self.state = REJECTED; + self.outcome = error; + var i = -1; + var len = self.queue.length; + while (++i < len) { + self.queue[i].callRejected(error); + } + return self; +}; + +function getThen(obj) { + // Make sure we only access the accessor once as required by the spec + var then = obj && obj.then; + if (obj && (typeof obj === 'object' || typeof obj === 'function') && typeof then === 'function') { + return function appyThen() { + then.apply(obj, arguments); + }; + } +} + +function safelyResolveThenable(self, thenable) { + // Either fulfill, reject or reject with error + var called = false; + function onError(value) { + if (called) { + return; + } + called = true; + handlers.reject(self, value); + } + + function onSuccess(value) { + if (called) { + return; + } + called = true; + handlers.resolve(self, value); + } + + function tryToUnwrap() { + thenable(onSuccess, onError); + } + + var result = tryCatch(tryToUnwrap); + if (result.status === 'error') { + onError(result.value); + } +} + +function tryCatch(func, value) { + var out = {}; + try { + out.value = func(value); + out.status = 'success'; + } catch (e) { + out.status = 'error'; + out.value = e; + } + return out; +} + +Promise.resolve = resolve; +function resolve(value) { + if (value instanceof this) { + return value; + } + return handlers.resolve(new this(INTERNAL), value); +} + +Promise.reject = reject; +function reject(reason) { + var promise = new this(INTERNAL); + return handlers.reject(promise, reason); +} + +Promise.all = all; +function all(iterable) { + var self = this; + if (Object.prototype.toString.call(iterable) !== '[object Array]') { + return this.reject(new TypeError('must be an array')); + } + + var len = iterable.length; + var called = false; + if (!len) { + return this.resolve([]); + } + + var values = new Array(len); + var resolved = 0; + var i = -1; + var promise = new this(INTERNAL); + + while (++i < len) { + allResolver(iterable[i], i); + } + return promise; + function allResolver(value, i) { + self.resolve(value).then(resolveFromAll, function (error) { + if (!called) { + called = true; + handlers.reject(promise, error); + } + }); + function resolveFromAll(outValue) { + values[i] = outValue; + if (++resolved === len && !called) { + called = true; + handlers.resolve(promise, values); + } + } + } +} + +Promise.race = race; +function race(iterable) { + var self = this; + if (Object.prototype.toString.call(iterable) !== '[object Array]') { + return this.reject(new TypeError('must be an array')); + } + + var len = iterable.length; + var called = false; + if (!len) { + return this.resolve([]); + } + + var i = -1; + var promise = new this(INTERNAL); + + while (++i < len) { + resolver(iterable[i]); + } + return promise; + function resolver(value) { + self.resolve(value).then(function (response) { + if (!called) { + called = true; + handlers.resolve(promise, response); + } + }, function (error) { + if (!called) { + called = true; + handlers.reject(promise, error); + } + }); + } +} + +},{"1":1}],3:[function(_dereq_,module,exports){ +(function (global){ +'use strict'; +if (typeof global.Promise !== 'function') { + global.Promise = _dereq_(2); +} + +}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{"2":2}],4:[function(_dereq_,module,exports){ +'use strict'; + +var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function getIDB() { + /* global indexedDB,webkitIndexedDB,mozIndexedDB,OIndexedDB,msIndexedDB */ + try { + if (typeof indexedDB !== 'undefined') { + return indexedDB; + } + if (typeof webkitIndexedDB !== 'undefined') { + return webkitIndexedDB; + } + if (typeof mozIndexedDB !== 'undefined') { + return mozIndexedDB; + } + if (typeof OIndexedDB !== 'undefined') { + return OIndexedDB; + } + if (typeof msIndexedDB !== 'undefined') { + return msIndexedDB; + } + } catch (e) { + return; + } +} + +var idb = getIDB(); + +function isIndexedDBValid() { + try { + // Initialize IndexedDB; fall back to vendor-prefixed versions + // if needed. + if (!idb) { + return false; + } + // We mimic PouchDB here; + // + // We test for openDatabase because IE Mobile identifies itself + // as Safari. Oh the lulz... + var isSafari = typeof openDatabase !== 'undefined' && /(Safari|iPhone|iPad|iPod)/.test(navigator.userAgent) && !/Chrome/.test(navigator.userAgent) && !/BlackBerry/.test(navigator.platform); + + var hasFetch = typeof fetch === 'function' && fetch.toString().indexOf('[native code') !== -1; + + // Safari <10.1 does not meet our requirements for IDB support (#5572) + // since Safari 10.1 shipped with fetch, we can use that to detect it + return (!isSafari || hasFetch) && typeof indexedDB !== 'undefined' && + // some outdated implementations of IDB that appear on Samsung + // and HTC Android devices <4.4 are missing IDBKeyRange + // See: https://github.com/mozilla/localForage/issues/128 + // See: https://github.com/mozilla/localForage/issues/272 + typeof IDBKeyRange !== 'undefined'; + } catch (e) { + return false; + } +} + +// Abstracts constructing a Blob object, so it also works in older +// browsers that don't support the native Blob constructor. (i.e. +// old QtWebKit versions, at least). +// Abstracts constructing a Blob object, so it also works in older +// browsers that don't support the native Blob constructor. (i.e. +// old QtWebKit versions, at least). +function createBlob(parts, properties) { + /* global BlobBuilder,MSBlobBuilder,MozBlobBuilder,WebKitBlobBuilder */ + parts = parts || []; + properties = properties || {}; + try { + return new Blob(parts, properties); + } catch (e) { + if (e.name !== 'TypeError') { + throw e; + } + var Builder = typeof BlobBuilder !== 'undefined' ? BlobBuilder : typeof MSBlobBuilder !== 'undefined' ? MSBlobBuilder : typeof MozBlobBuilder !== 'undefined' ? MozBlobBuilder : WebKitBlobBuilder; + var builder = new Builder(); + for (var i = 0; i < parts.length; i += 1) { + builder.append(parts[i]); + } + return builder.getBlob(properties.type); + } +} + +// This is CommonJS because lie is an external dependency, so Rollup +// can just ignore it. +if (typeof Promise === 'undefined') { + // In the "nopromises" build this will just throw if you don't have + // a global promise object, but it would throw anyway later. + _dereq_(3); +} +var Promise$1 = Promise; + +function executeCallback(promise, callback) { + if (callback) { + promise.then(function (result) { + callback(null, result); + }, function (error) { + callback(error); + }); + } +} + +function executeTwoCallbacks(promise, callback, errorCallback) { + if (typeof callback === 'function') { + promise.then(callback); + } + + if (typeof errorCallback === 'function') { + promise["catch"](errorCallback); + } +} + +function normalizeKey(key) { + // Cast the key to a string, as that's all we can set as a key. + if (typeof key !== 'string') { + console.warn(key + ' used as a key, but it is not a string.'); + key = String(key); + } + + return key; +} + +function getCallback() { + if (arguments.length && typeof arguments[arguments.length - 1] === 'function') { + return arguments[arguments.length - 1]; + } +} + +// Some code originally from async_storage.js in +// [Gaia](https://github.com/mozilla-b2g/gaia). + +var DETECT_BLOB_SUPPORT_STORE = 'local-forage-detect-blob-support'; +var supportsBlobs = void 0; +var dbContexts = {}; +var toString = Object.prototype.toString; + +// Transaction Modes +var READ_ONLY = 'readonly'; +var READ_WRITE = 'readwrite'; + +// Transform a binary string to an array buffer, because otherwise +// weird stuff happens when you try to work with the binary string directly. +// It is known. +// From http://stackoverflow.com/questions/14967647/ (continues on next line) +// encode-decode-image-with-base64-breaks-image (2013-04-21) +function _binStringToArrayBuffer(bin) { + var length = bin.length; + var buf = new ArrayBuffer(length); + var arr = new Uint8Array(buf); + for (var i = 0; i < length; i++) { + arr[i] = bin.charCodeAt(i); + } + return buf; +} + +// +// Blobs are not supported in all versions of IndexedDB, notably +// Chrome <37 and Android <5. In those versions, storing a blob will throw. +// +// Various other blob bugs exist in Chrome v37-42 (inclusive). +// Detecting them is expensive and confusing to users, and Chrome 37-42 +// is at very low usage worldwide, so we do a hacky userAgent check instead. +// +// content-type bug: https://code.google.com/p/chromium/issues/detail?id=408120 +// 404 bug: https://code.google.com/p/chromium/issues/detail?id=447916 +// FileReader bug: https://code.google.com/p/chromium/issues/detail?id=447836 +// +// Code borrowed from PouchDB. See: +// https://github.com/pouchdb/pouchdb/blob/master/packages/node_modules/pouchdb-adapter-idb/src/blobSupport.js +// +function _checkBlobSupportWithoutCaching(idb) { + return new Promise$1(function (resolve) { + var txn = idb.transaction(DETECT_BLOB_SUPPORT_STORE, READ_WRITE); + var blob = createBlob(['']); + txn.objectStore(DETECT_BLOB_SUPPORT_STORE).put(blob, 'key'); + + txn.onabort = function (e) { + // If the transaction aborts now its due to not being able to + // write to the database, likely due to the disk being full + e.preventDefault(); + e.stopPropagation(); + resolve(false); + }; + + txn.oncomplete = function () { + var matchedChrome = navigator.userAgent.match(/Chrome\/(\d+)/); + var matchedEdge = navigator.userAgent.match(/Edge\//); + // MS Edge pretends to be Chrome 42: + // https://msdn.microsoft.com/en-us/library/hh869301%28v=vs.85%29.aspx + resolve(matchedEdge || !matchedChrome || parseInt(matchedChrome[1], 10) >= 43); + }; + })["catch"](function () { + return false; // error, so assume unsupported + }); +} + +function _checkBlobSupport(idb) { + if (typeof supportsBlobs === 'boolean') { + return Promise$1.resolve(supportsBlobs); + } + return _checkBlobSupportWithoutCaching(idb).then(function (value) { + supportsBlobs = value; + return supportsBlobs; + }); +} + +function _deferReadiness(dbInfo) { + var dbContext = dbContexts[dbInfo.name]; + + // Create a deferred object representing the current database operation. + var deferredOperation = {}; + + deferredOperation.promise = new Promise$1(function (resolve, reject) { + deferredOperation.resolve = resolve; + deferredOperation.reject = reject; + }); + + // Enqueue the deferred operation. + dbContext.deferredOperations.push(deferredOperation); + + // Chain its promise to the database readiness. + if (!dbContext.dbReady) { + dbContext.dbReady = deferredOperation.promise; + } else { + dbContext.dbReady = dbContext.dbReady.then(function () { + return deferredOperation.promise; + }); + } +} + +function _advanceReadiness(dbInfo) { + var dbContext = dbContexts[dbInfo.name]; + + // Dequeue a deferred operation. + var deferredOperation = dbContext.deferredOperations.pop(); + + // Resolve its promise (which is part of the database readiness + // chain of promises). + if (deferredOperation) { + deferredOperation.resolve(); + return deferredOperation.promise; + } +} + +function _rejectReadiness(dbInfo, err) { + var dbContext = dbContexts[dbInfo.name]; + + // Dequeue a deferred operation. + var deferredOperation = dbContext.deferredOperations.pop(); + + // Reject its promise (which is part of the database readiness + // chain of promises). + if (deferredOperation) { + deferredOperation.reject(err); + return deferredOperation.promise; + } +} + +function _getConnection(dbInfo, upgradeNeeded) { + return new Promise$1(function (resolve, reject) { + dbContexts[dbInfo.name] = dbContexts[dbInfo.name] || createDbContext(); + + if (dbInfo.db) { + if (upgradeNeeded) { + _deferReadiness(dbInfo); + dbInfo.db.close(); + } else { + return resolve(dbInfo.db); + } + } + + var dbArgs = [dbInfo.name]; + + if (upgradeNeeded) { + dbArgs.push(dbInfo.version); + } + + var openreq = idb.open.apply(idb, dbArgs); + + if (upgradeNeeded) { + openreq.onupgradeneeded = function (e) { + var db = openreq.result; + try { + db.createObjectStore(dbInfo.storeName); + if (e.oldVersion <= 1) { + // Added when support for blob shims was added + db.createObjectStore(DETECT_BLOB_SUPPORT_STORE); + } + } catch (ex) { + if (ex.name === 'ConstraintError') { + console.warn('The database "' + dbInfo.name + '"' + ' has been upgraded from version ' + e.oldVersion + ' to version ' + e.newVersion + ', but the storage "' + dbInfo.storeName + '" already exists.'); + } else { + throw ex; + } + } + }; + } + + openreq.onerror = function (e) { + e.preventDefault(); + reject(openreq.error); + }; + + openreq.onsuccess = function () { + resolve(openreq.result); + _advanceReadiness(dbInfo); + }; + }); +} + +function _getOriginalConnection(dbInfo) { + return _getConnection(dbInfo, false); +} + +function _getUpgradedConnection(dbInfo) { + return _getConnection(dbInfo, true); +} + +function _isUpgradeNeeded(dbInfo, defaultVersion) { + if (!dbInfo.db) { + return true; + } + + var isNewStore = !dbInfo.db.objectStoreNames.contains(dbInfo.storeName); + var isDowngrade = dbInfo.version < dbInfo.db.version; + var isUpgrade = dbInfo.version > dbInfo.db.version; + + if (isDowngrade) { + // If the version is not the default one + // then warn for impossible downgrade. + if (dbInfo.version !== defaultVersion) { + console.warn('The database "' + dbInfo.name + '"' + " can't be downgraded from version " + dbInfo.db.version + ' to version ' + dbInfo.version + '.'); + } + // Align the versions to prevent errors. + dbInfo.version = dbInfo.db.version; + } + + if (isUpgrade || isNewStore) { + // If the store is new then increment the version (if needed). + // This will trigger an "upgradeneeded" event which is required + // for creating a store. + if (isNewStore) { + var incVersion = dbInfo.db.version + 1; + if (incVersion > dbInfo.version) { + dbInfo.version = incVersion; + } + } + + return true; + } + + return false; +} + +// encode a blob for indexeddb engines that don't support blobs +function _encodeBlob(blob) { + return new Promise$1(function (resolve, reject) { + var reader = new FileReader(); + reader.onerror = reject; + reader.onloadend = function (e) { + var base64 = btoa(e.target.result || ''); + resolve({ + __local_forage_encoded_blob: true, + data: base64, + type: blob.type + }); + }; + reader.readAsBinaryString(blob); + }); +} + +// decode an encoded blob +function _decodeBlob(encodedBlob) { + var arrayBuff = _binStringToArrayBuffer(atob(encodedBlob.data)); + return createBlob([arrayBuff], { type: encodedBlob.type }); +} + +// is this one of our fancy encoded blobs? +function _isEncodedBlob(value) { + return value && value.__local_forage_encoded_blob; +} + +// Specialize the default `ready()` function by making it dependent +// on the current database operations. Thus, the driver will be actually +// ready when it's been initialized (default) *and* there are no pending +// operations on the database (initiated by some other instances). +function _fullyReady(callback) { + var self = this; + + var promise = self._initReady().then(function () { + var dbContext = dbContexts[self._dbInfo.name]; + + if (dbContext && dbContext.dbReady) { + return dbContext.dbReady; + } + }); + + executeTwoCallbacks(promise, callback, callback); + return promise; +} + +// Try to establish a new db connection to replace the +// current one which is broken (i.e. experiencing +// InvalidStateError while creating a transaction). +function _tryReconnect(dbInfo) { + _deferReadiness(dbInfo); + + var dbContext = dbContexts[dbInfo.name]; + var forages = dbContext.forages; + + for (var i = 0; i < forages.length; i++) { + var forage = forages[i]; + if (forage._dbInfo.db) { + forage._dbInfo.db.close(); + forage._dbInfo.db = null; + } + } + dbInfo.db = null; + + return _getOriginalConnection(dbInfo).then(function (db) { + dbInfo.db = db; + if (_isUpgradeNeeded(dbInfo)) { + // Reopen the database for upgrading. + return _getUpgradedConnection(dbInfo); + } + return db; + }).then(function (db) { + // store the latest db reference + // in case the db was upgraded + dbInfo.db = dbContext.db = db; + for (var i = 0; i < forages.length; i++) { + forages[i]._dbInfo.db = db; + } + })["catch"](function (err) { + _rejectReadiness(dbInfo, err); + throw err; + }); +} + +// FF doesn't like Promises (micro-tasks) and IDDB store operations, +// so we have to do it with callbacks +function createTransaction(dbInfo, mode, callback, retries) { + if (retries === undefined) { + retries = 1; + } + + try { + var tx = dbInfo.db.transaction(dbInfo.storeName, mode); + callback(null, tx); + } catch (err) { + if (retries > 0 && (!dbInfo.db || err.name === 'InvalidStateError' || err.name === 'NotFoundError')) { + return Promise$1.resolve().then(function () { + if (!dbInfo.db || err.name === 'NotFoundError' && !dbInfo.db.objectStoreNames.contains(dbInfo.storeName) && dbInfo.version <= dbInfo.db.version) { + // increase the db version, to create the new ObjectStore + if (dbInfo.db) { + dbInfo.version = dbInfo.db.version + 1; + } + // Reopen the database for upgrading. + return _getUpgradedConnection(dbInfo); + } + }).then(function () { + return _tryReconnect(dbInfo).then(function () { + createTransaction(dbInfo, mode, callback, retries - 1); + }); + })["catch"](callback); + } + + callback(err); + } +} + +function createDbContext() { + return { + // Running localForages sharing a database. + forages: [], + // Shared database. + db: null, + // Database readiness (promise). + dbReady: null, + // Deferred operations on the database. + deferredOperations: [] + }; +} + +// Open the IndexedDB database (automatically creates one if one didn't +// previously exist), using any options set in the config. +function _initStorage(options) { + var self = this; + var dbInfo = { + db: null + }; + + if (options) { + for (var i in options) { + dbInfo[i] = options[i]; + } + } + + // Get the current context of the database; + var dbContext = dbContexts[dbInfo.name]; + + // ...or create a new context. + if (!dbContext) { + dbContext = createDbContext(); + // Register the new context in the global container. + dbContexts[dbInfo.name] = dbContext; + } + + // Register itself as a running localForage in the current context. + dbContext.forages.push(self); + + // Replace the default `ready()` function with the specialized one. + if (!self._initReady) { + self._initReady = self.ready; + self.ready = _fullyReady; + } + + // Create an array of initialization states of the related localForages. + var initPromises = []; + + function ignoreErrors() { + // Don't handle errors here, + // just makes sure related localForages aren't pending. + return Promise$1.resolve(); + } + + for (var j = 0; j < dbContext.forages.length; j++) { + var forage = dbContext.forages[j]; + if (forage !== self) { + // Don't wait for itself... + initPromises.push(forage._initReady()["catch"](ignoreErrors)); + } + } + + // Take a snapshot of the related localForages. + var forages = dbContext.forages.slice(0); + + // Initialize the connection process only when + // all the related localForages aren't pending. + return Promise$1.all(initPromises).then(function () { + dbInfo.db = dbContext.db; + // Get the connection or open a new one without upgrade. + return _getOriginalConnection(dbInfo); + }).then(function (db) { + dbInfo.db = db; + if (_isUpgradeNeeded(dbInfo, self._defaultConfig.version)) { + // Reopen the database for upgrading. + return _getUpgradedConnection(dbInfo); + } + return db; + }).then(function (db) { + dbInfo.db = dbContext.db = db; + self._dbInfo = dbInfo; + // Share the final connection amongst related localForages. + for (var k = 0; k < forages.length; k++) { + var forage = forages[k]; + if (forage !== self) { + // Self is already up-to-date. + forage._dbInfo.db = dbInfo.db; + forage._dbInfo.version = dbInfo.version; + } + } + }); +} + +function getItem(key, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + createTransaction(self._dbInfo, READ_ONLY, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + var req = store.get(key); + + req.onsuccess = function () { + var value = req.result; + if (value === undefined) { + value = null; + } + if (_isEncodedBlob(value)) { + value = _decodeBlob(value); + } + resolve(value); + }; + + req.onerror = function () { + reject(req.error); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +// Iterate over all items stored in database. +function iterate(iterator, callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + createTransaction(self._dbInfo, READ_ONLY, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + var req = store.openCursor(); + var iterationNumber = 1; + + req.onsuccess = function () { + var cursor = req.result; + + if (cursor) { + var value = cursor.value; + if (_isEncodedBlob(value)) { + value = _decodeBlob(value); + } + var result = iterator(value, cursor.key, iterationNumber++); + + // when the iterator callback retuns any + // (non-`undefined`) value, then we stop + // the iteration immediately + if (result !== void 0) { + resolve(result); + } else { + cursor["continue"](); + } + } else { + resolve(); + } + }; + + req.onerror = function () { + reject(req.error); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + + return promise; +} + +function setItem(key, value, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = new Promise$1(function (resolve, reject) { + var dbInfo; + self.ready().then(function () { + dbInfo = self._dbInfo; + if (toString.call(value) === '[object Blob]') { + return _checkBlobSupport(dbInfo.db).then(function (blobSupport) { + if (blobSupport) { + return value; + } + return _encodeBlob(value); + }); + } + return value; + }).then(function (value) { + createTransaction(self._dbInfo, READ_WRITE, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + + // The reason we don't _save_ null is because IE 10 does + // not support saving the `null` type in IndexedDB. How + // ironic, given the bug below! + // See: https://github.com/mozilla/localForage/issues/161 + if (value === null) { + value = undefined; + } + + var req = store.put(value, key); + + transaction.oncomplete = function () { + // Cast to undefined so the value passed to + // callback/promise is the same as what one would get out + // of `getItem()` later. This leads to some weirdness + // (setItem('foo', undefined) will return `null`), but + // it's not my fault localStorage is our baseline and that + // it's weird. + if (value === undefined) { + value = null; + } + + resolve(value); + }; + transaction.onabort = transaction.onerror = function () { + var err = req.error ? req.error : req.transaction.error; + reject(err); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function removeItem(key, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + createTransaction(self._dbInfo, READ_WRITE, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + // We use a Grunt task to make this safe for IE and some + // versions of Android (including those used by Cordova). + // Normally IE won't like `.delete()` and will insist on + // using `['delete']()`, but we have a build step that + // fixes this for us now. + var req = store["delete"](key); + transaction.oncomplete = function () { + resolve(); + }; + + transaction.onerror = function () { + reject(req.error); + }; + + // The request will be also be aborted if we've exceeded our storage + // space. + transaction.onabort = function () { + var err = req.error ? req.error : req.transaction.error; + reject(err); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function clear(callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + createTransaction(self._dbInfo, READ_WRITE, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + var req = store.clear(); + + transaction.oncomplete = function () { + resolve(); + }; + + transaction.onabort = transaction.onerror = function () { + var err = req.error ? req.error : req.transaction.error; + reject(err); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function length(callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + createTransaction(self._dbInfo, READ_ONLY, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + var req = store.count(); + + req.onsuccess = function () { + resolve(req.result); + }; + + req.onerror = function () { + reject(req.error); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function key(n, callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + if (n < 0) { + resolve(null); + + return; + } + + self.ready().then(function () { + createTransaction(self._dbInfo, READ_ONLY, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + var advanced = false; + var req = store.openCursor(); + + req.onsuccess = function () { + var cursor = req.result; + if (!cursor) { + // this means there weren't enough keys + resolve(null); + + return; + } + + if (n === 0) { + // We have the first key, return it if that's what they + // wanted. + resolve(cursor.key); + } else { + if (!advanced) { + // Otherwise, ask the cursor to skip ahead n + // records. + advanced = true; + cursor.advance(n); + } else { + // When we get here, we've got the nth key. + resolve(cursor.key); + } + } + }; + + req.onerror = function () { + reject(req.error); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function keys(callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + createTransaction(self._dbInfo, READ_ONLY, function (err, transaction) { + if (err) { + return reject(err); + } + + try { + var store = transaction.objectStore(self._dbInfo.storeName); + var req = store.openCursor(); + var keys = []; + + req.onsuccess = function () { + var cursor = req.result; + + if (!cursor) { + resolve(keys); + return; + } + + keys.push(cursor.key); + cursor["continue"](); + }; + + req.onerror = function () { + reject(req.error); + }; + } catch (e) { + reject(e); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function dropInstance(options, callback) { + callback = getCallback.apply(this, arguments); + + var currentConfig = this.config(); + options = typeof options !== 'function' && options || {}; + if (!options.name) { + options.name = options.name || currentConfig.name; + options.storeName = options.storeName || currentConfig.storeName; + } + + var self = this; + var promise; + if (!options.name) { + promise = Promise$1.reject('Invalid arguments'); + } else { + var isCurrentDb = options.name === currentConfig.name && self._dbInfo.db; + + var dbPromise = isCurrentDb ? Promise$1.resolve(self._dbInfo.db) : _getOriginalConnection(options).then(function (db) { + var dbContext = dbContexts[options.name]; + var forages = dbContext.forages; + dbContext.db = db; + for (var i = 0; i < forages.length; i++) { + forages[i]._dbInfo.db = db; + } + return db; + }); + + if (!options.storeName) { + promise = dbPromise.then(function (db) { + _deferReadiness(options); + + var dbContext = dbContexts[options.name]; + var forages = dbContext.forages; + + db.close(); + for (var i = 0; i < forages.length; i++) { + var forage = forages[i]; + forage._dbInfo.db = null; + } + + var dropDBPromise = new Promise$1(function (resolve, reject) { + var req = idb.deleteDatabase(options.name); + + req.onerror = req.onblocked = function (err) { + var db = req.result; + if (db) { + db.close(); + } + reject(err); + }; + + req.onsuccess = function () { + var db = req.result; + if (db) { + db.close(); + } + resolve(db); + }; + }); + + return dropDBPromise.then(function (db) { + dbContext.db = db; + for (var i = 0; i < forages.length; i++) { + var _forage = forages[i]; + _advanceReadiness(_forage._dbInfo); + } + })["catch"](function (err) { + (_rejectReadiness(options, err) || Promise$1.resolve())["catch"](function () {}); + throw err; + }); + }); + } else { + promise = dbPromise.then(function (db) { + if (!db.objectStoreNames.contains(options.storeName)) { + return; + } + + var newVersion = db.version + 1; + + _deferReadiness(options); + + var dbContext = dbContexts[options.name]; + var forages = dbContext.forages; + + db.close(); + for (var i = 0; i < forages.length; i++) { + var forage = forages[i]; + forage._dbInfo.db = null; + forage._dbInfo.version = newVersion; + } + + var dropObjectPromise = new Promise$1(function (resolve, reject) { + var req = idb.open(options.name, newVersion); + + req.onerror = function (err) { + var db = req.result; + db.close(); + reject(err); + }; + + req.onupgradeneeded = function () { + var db = req.result; + db.deleteObjectStore(options.storeName); + }; + + req.onsuccess = function () { + var db = req.result; + db.close(); + resolve(db); + }; + }); + + return dropObjectPromise.then(function (db) { + dbContext.db = db; + for (var j = 0; j < forages.length; j++) { + var _forage2 = forages[j]; + _forage2._dbInfo.db = db; + _advanceReadiness(_forage2._dbInfo); + } + })["catch"](function (err) { + (_rejectReadiness(options, err) || Promise$1.resolve())["catch"](function () {}); + throw err; + }); + }); + } + } + + executeCallback(promise, callback); + return promise; +} + +var asyncStorage = { + _driver: 'asyncStorage', + _initStorage: _initStorage, + _support: isIndexedDBValid(), + iterate: iterate, + getItem: getItem, + setItem: setItem, + removeItem: removeItem, + clear: clear, + length: length, + key: key, + keys: keys, + dropInstance: dropInstance +}; + +function isWebSQLValid() { + return typeof openDatabase === 'function'; +} + +// Sadly, the best way to save binary data in WebSQL/localStorage is serializing +// it to Base64, so this is how we store it to prevent very strange errors with less +// verbose ways of binary <-> string data storage. +var BASE_CHARS = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; + +var BLOB_TYPE_PREFIX = '~~local_forage_type~'; +var BLOB_TYPE_PREFIX_REGEX = /^~~local_forage_type~([^~]+)~/; + +var SERIALIZED_MARKER = '__lfsc__:'; +var SERIALIZED_MARKER_LENGTH = SERIALIZED_MARKER.length; + +// OMG the serializations! +var TYPE_ARRAYBUFFER = 'arbf'; +var TYPE_BLOB = 'blob'; +var TYPE_INT8ARRAY = 'si08'; +var TYPE_UINT8ARRAY = 'ui08'; +var TYPE_UINT8CLAMPEDARRAY = 'uic8'; +var TYPE_INT16ARRAY = 'si16'; +var TYPE_INT32ARRAY = 'si32'; +var TYPE_UINT16ARRAY = 'ur16'; +var TYPE_UINT32ARRAY = 'ui32'; +var TYPE_FLOAT32ARRAY = 'fl32'; +var TYPE_FLOAT64ARRAY = 'fl64'; +var TYPE_SERIALIZED_MARKER_LENGTH = SERIALIZED_MARKER_LENGTH + TYPE_ARRAYBUFFER.length; + +var toString$1 = Object.prototype.toString; + +function stringToBuffer(serializedString) { + // Fill the string into a ArrayBuffer. + var bufferLength = serializedString.length * 0.75; + var len = serializedString.length; + var i; + var p = 0; + var encoded1, encoded2, encoded3, encoded4; + + if (serializedString[serializedString.length - 1] === '=') { + bufferLength--; + if (serializedString[serializedString.length - 2] === '=') { + bufferLength--; + } + } + + var buffer = new ArrayBuffer(bufferLength); + var bytes = new Uint8Array(buffer); + + for (i = 0; i < len; i += 4) { + encoded1 = BASE_CHARS.indexOf(serializedString[i]); + encoded2 = BASE_CHARS.indexOf(serializedString[i + 1]); + encoded3 = BASE_CHARS.indexOf(serializedString[i + 2]); + encoded4 = BASE_CHARS.indexOf(serializedString[i + 3]); + + /*jslint bitwise: true */ + bytes[p++] = encoded1 << 2 | encoded2 >> 4; + bytes[p++] = (encoded2 & 15) << 4 | encoded3 >> 2; + bytes[p++] = (encoded3 & 3) << 6 | encoded4 & 63; + } + return buffer; +} + +// Converts a buffer to a string to store, serialized, in the backend +// storage library. +function bufferToString(buffer) { + // base64-arraybuffer + var bytes = new Uint8Array(buffer); + var base64String = ''; + var i; + + for (i = 0; i < bytes.length; i += 3) { + /*jslint bitwise: true */ + base64String += BASE_CHARS[bytes[i] >> 2]; + base64String += BASE_CHARS[(bytes[i] & 3) << 4 | bytes[i + 1] >> 4]; + base64String += BASE_CHARS[(bytes[i + 1] & 15) << 2 | bytes[i + 2] >> 6]; + base64String += BASE_CHARS[bytes[i + 2] & 63]; + } + + if (bytes.length % 3 === 2) { + base64String = base64String.substring(0, base64String.length - 1) + '='; + } else if (bytes.length % 3 === 1) { + base64String = base64String.substring(0, base64String.length - 2) + '=='; + } + + return base64String; +} + +// Serialize a value, afterwards executing a callback (which usually +// instructs the `setItem()` callback/promise to be executed). This is how +// we store binary data with localStorage. +function serialize(value, callback) { + var valueType = ''; + if (value) { + valueType = toString$1.call(value); + } + + // Cannot use `value instanceof ArrayBuffer` or such here, as these + // checks fail when running the tests using casper.js... + // + // TODO: See why those tests fail and use a better solution. + if (value && (valueType === '[object ArrayBuffer]' || value.buffer && toString$1.call(value.buffer) === '[object ArrayBuffer]')) { + // Convert binary arrays to a string and prefix the string with + // a special marker. + var buffer; + var marker = SERIALIZED_MARKER; + + if (value instanceof ArrayBuffer) { + buffer = value; + marker += TYPE_ARRAYBUFFER; + } else { + buffer = value.buffer; + + if (valueType === '[object Int8Array]') { + marker += TYPE_INT8ARRAY; + } else if (valueType === '[object Uint8Array]') { + marker += TYPE_UINT8ARRAY; + } else if (valueType === '[object Uint8ClampedArray]') { + marker += TYPE_UINT8CLAMPEDARRAY; + } else if (valueType === '[object Int16Array]') { + marker += TYPE_INT16ARRAY; + } else if (valueType === '[object Uint16Array]') { + marker += TYPE_UINT16ARRAY; + } else if (valueType === '[object Int32Array]') { + marker += TYPE_INT32ARRAY; + } else if (valueType === '[object Uint32Array]') { + marker += TYPE_UINT32ARRAY; + } else if (valueType === '[object Float32Array]') { + marker += TYPE_FLOAT32ARRAY; + } else if (valueType === '[object Float64Array]') { + marker += TYPE_FLOAT64ARRAY; + } else { + callback(new Error('Failed to get type for BinaryArray')); + } + } + + callback(marker + bufferToString(buffer)); + } else if (valueType === '[object Blob]') { + // Conver the blob to a binaryArray and then to a string. + var fileReader = new FileReader(); + + fileReader.onload = function () { + // Backwards-compatible prefix for the blob type. + var str = BLOB_TYPE_PREFIX + value.type + '~' + bufferToString(this.result); + + callback(SERIALIZED_MARKER + TYPE_BLOB + str); + }; + + fileReader.readAsArrayBuffer(value); + } else { + try { + callback(JSON.stringify(value)); + } catch (e) { + console.error("Couldn't convert value into a JSON string: ", value); + + callback(null, e); + } + } +} + +// Deserialize data we've inserted into a value column/field. We place +// special markers into our strings to mark them as encoded; this isn't +// as nice as a meta field, but it's the only sane thing we can do whilst +// keeping localStorage support intact. +// +// Oftentimes this will just deserialize JSON content, but if we have a +// special marker (SERIALIZED_MARKER, defined above), we will extract +// some kind of arraybuffer/binary data/typed array out of the string. +function deserialize(value) { + // If we haven't marked this string as being specially serialized (i.e. + // something other than serialized JSON), we can just return it and be + // done with it. + if (value.substring(0, SERIALIZED_MARKER_LENGTH) !== SERIALIZED_MARKER) { + return JSON.parse(value); + } + + // The following code deals with deserializing some kind of Blob or + // TypedArray. First we separate out the type of data we're dealing + // with from the data itself. + var serializedString = value.substring(TYPE_SERIALIZED_MARKER_LENGTH); + var type = value.substring(SERIALIZED_MARKER_LENGTH, TYPE_SERIALIZED_MARKER_LENGTH); + + var blobType; + // Backwards-compatible blob type serialization strategy. + // DBs created with older versions of localForage will simply not have the blob type. + if (type === TYPE_BLOB && BLOB_TYPE_PREFIX_REGEX.test(serializedString)) { + var matcher = serializedString.match(BLOB_TYPE_PREFIX_REGEX); + blobType = matcher[1]; + serializedString = serializedString.substring(matcher[0].length); + } + var buffer = stringToBuffer(serializedString); + + // Return the right type based on the code/type set during + // serialization. + switch (type) { + case TYPE_ARRAYBUFFER: + return buffer; + case TYPE_BLOB: + return createBlob([buffer], { type: blobType }); + case TYPE_INT8ARRAY: + return new Int8Array(buffer); + case TYPE_UINT8ARRAY: + return new Uint8Array(buffer); + case TYPE_UINT8CLAMPEDARRAY: + return new Uint8ClampedArray(buffer); + case TYPE_INT16ARRAY: + return new Int16Array(buffer); + case TYPE_UINT16ARRAY: + return new Uint16Array(buffer); + case TYPE_INT32ARRAY: + return new Int32Array(buffer); + case TYPE_UINT32ARRAY: + return new Uint32Array(buffer); + case TYPE_FLOAT32ARRAY: + return new Float32Array(buffer); + case TYPE_FLOAT64ARRAY: + return new Float64Array(buffer); + default: + throw new Error('Unkown type: ' + type); + } +} + +var localforageSerializer = { + serialize: serialize, + deserialize: deserialize, + stringToBuffer: stringToBuffer, + bufferToString: bufferToString +}; + +/* + * Includes code from: + * + * base64-arraybuffer + * https://github.com/niklasvh/base64-arraybuffer + * + * Copyright (c) 2012 Niklas von Hertzen + * Licensed under the MIT license. + */ + +function createDbTable(t, dbInfo, callback, errorCallback) { + t.executeSql('CREATE TABLE IF NOT EXISTS ' + dbInfo.storeName + ' ' + '(id INTEGER PRIMARY KEY, key unique, value)', [], callback, errorCallback); +} + +// Open the WebSQL database (automatically creates one if one didn't +// previously exist), using any options set in the config. +function _initStorage$1(options) { + var self = this; + var dbInfo = { + db: null + }; + + if (options) { + for (var i in options) { + dbInfo[i] = typeof options[i] !== 'string' ? options[i].toString() : options[i]; + } + } + + var dbInfoPromise = new Promise$1(function (resolve, reject) { + // Open the database; the openDatabase API will automatically + // create it for us if it doesn't exist. + try { + dbInfo.db = openDatabase(dbInfo.name, String(dbInfo.version), dbInfo.description, dbInfo.size); + } catch (e) { + return reject(e); + } + + // Create our key/value table if it doesn't exist. + dbInfo.db.transaction(function (t) { + createDbTable(t, dbInfo, function () { + self._dbInfo = dbInfo; + resolve(); + }, function (t, error) { + reject(error); + }); + }, reject); + }); + + dbInfo.serializer = localforageSerializer; + return dbInfoPromise; +} + +function tryExecuteSql(t, dbInfo, sqlStatement, args, callback, errorCallback) { + t.executeSql(sqlStatement, args, callback, function (t, error) { + if (error.code === error.SYNTAX_ERR) { + t.executeSql('SELECT name FROM sqlite_master ' + "WHERE type='table' AND name = ?", [dbInfo.storeName], function (t, results) { + if (!results.rows.length) { + // if the table is missing (was deleted) + // re-create it table and retry + createDbTable(t, dbInfo, function () { + t.executeSql(sqlStatement, args, callback, errorCallback); + }, errorCallback); + } else { + errorCallback(t, error); + } + }, errorCallback); + } else { + errorCallback(t, error); + } + }, errorCallback); +} + +function getItem$1(key, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + var dbInfo = self._dbInfo; + dbInfo.db.transaction(function (t) { + tryExecuteSql(t, dbInfo, 'SELECT * FROM ' + dbInfo.storeName + ' WHERE key = ? LIMIT 1', [key], function (t, results) { + var result = results.rows.length ? results.rows.item(0).value : null; + + // Check to see if this is serialized content we need to + // unpack. + if (result) { + result = dbInfo.serializer.deserialize(result); + } + + resolve(result); + }, function (t, error) { + reject(error); + }); + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function iterate$1(iterator, callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + var dbInfo = self._dbInfo; + + dbInfo.db.transaction(function (t) { + tryExecuteSql(t, dbInfo, 'SELECT * FROM ' + dbInfo.storeName, [], function (t, results) { + var rows = results.rows; + var length = rows.length; + + for (var i = 0; i < length; i++) { + var item = rows.item(i); + var result = item.value; + + // Check to see if this is serialized content + // we need to unpack. + if (result) { + result = dbInfo.serializer.deserialize(result); + } + + result = iterator(result, item.key, i + 1); + + // void(0) prevents problems with redefinition + // of `undefined`. + if (result !== void 0) { + resolve(result); + return; + } + } + + resolve(); + }, function (t, error) { + reject(error); + }); + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function _setItem(key, value, callback, retriesLeft) { + var self = this; + + key = normalizeKey(key); + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + // The localStorage API doesn't return undefined values in an + // "expected" way, so undefined is always cast to null in all + // drivers. See: https://github.com/mozilla/localForage/pull/42 + if (value === undefined) { + value = null; + } + + // Save the original value to pass to the callback. + var originalValue = value; + + var dbInfo = self._dbInfo; + dbInfo.serializer.serialize(value, function (value, error) { + if (error) { + reject(error); + } else { + dbInfo.db.transaction(function (t) { + tryExecuteSql(t, dbInfo, 'INSERT OR REPLACE INTO ' + dbInfo.storeName + ' ' + '(key, value) VALUES (?, ?)', [key, value], function () { + resolve(originalValue); + }, function (t, error) { + reject(error); + }); + }, function (sqlError) { + // The transaction failed; check + // to see if it's a quota error. + if (sqlError.code === sqlError.QUOTA_ERR) { + // We reject the callback outright for now, but + // it's worth trying to re-run the transaction. + // Even if the user accepts the prompt to use + // more storage on Safari, this error will + // be called. + // + // Try to re-run the transaction. + if (retriesLeft > 0) { + resolve(_setItem.apply(self, [key, originalValue, callback, retriesLeft - 1])); + return; + } + reject(sqlError); + } + }); + } + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function setItem$1(key, value, callback) { + return _setItem.apply(this, [key, value, callback, 1]); +} + +function removeItem$1(key, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + var dbInfo = self._dbInfo; + dbInfo.db.transaction(function (t) { + tryExecuteSql(t, dbInfo, 'DELETE FROM ' + dbInfo.storeName + ' WHERE key = ?', [key], function () { + resolve(); + }, function (t, error) { + reject(error); + }); + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +// Deletes every item in the table. +// TODO: Find out if this resets the AUTO_INCREMENT number. +function clear$1(callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + var dbInfo = self._dbInfo; + dbInfo.db.transaction(function (t) { + tryExecuteSql(t, dbInfo, 'DELETE FROM ' + dbInfo.storeName, [], function () { + resolve(); + }, function (t, error) { + reject(error); + }); + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +// Does a simple `COUNT(key)` to get the number of items stored in +// localForage. +function length$1(callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + var dbInfo = self._dbInfo; + dbInfo.db.transaction(function (t) { + // Ahhh, SQL makes this one soooooo easy. + tryExecuteSql(t, dbInfo, 'SELECT COUNT(key) as c FROM ' + dbInfo.storeName, [], function (t, results) { + var result = results.rows.item(0).c; + resolve(result); + }, function (t, error) { + reject(error); + }); + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +// Return the key located at key index X; essentially gets the key from a +// `WHERE id = ?`. This is the most efficient way I can think to implement +// this rarely-used (in my experience) part of the API, but it can seem +// inconsistent, because we do `INSERT OR REPLACE INTO` on `setItem()`, so +// the ID of each key will change every time it's updated. Perhaps a stored +// procedure for the `setItem()` SQL would solve this problem? +// TODO: Don't change ID on `setItem()`. +function key$1(n, callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + var dbInfo = self._dbInfo; + dbInfo.db.transaction(function (t) { + tryExecuteSql(t, dbInfo, 'SELECT key FROM ' + dbInfo.storeName + ' WHERE id = ? LIMIT 1', [n + 1], function (t, results) { + var result = results.rows.length ? results.rows.item(0).key : null; + resolve(result); + }, function (t, error) { + reject(error); + }); + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +function keys$1(callback) { + var self = this; + + var promise = new Promise$1(function (resolve, reject) { + self.ready().then(function () { + var dbInfo = self._dbInfo; + dbInfo.db.transaction(function (t) { + tryExecuteSql(t, dbInfo, 'SELECT key FROM ' + dbInfo.storeName, [], function (t, results) { + var keys = []; + + for (var i = 0; i < results.rows.length; i++) { + keys.push(results.rows.item(i).key); + } + + resolve(keys); + }, function (t, error) { + reject(error); + }); + }); + })["catch"](reject); + }); + + executeCallback(promise, callback); + return promise; +} + +// https://www.w3.org/TR/webdatabase/#databases +// > There is no way to enumerate or delete the databases available for an origin from this API. +function getAllStoreNames(db) { + return new Promise$1(function (resolve, reject) { + db.transaction(function (t) { + t.executeSql('SELECT name FROM sqlite_master ' + "WHERE type='table' AND name <> '__WebKitDatabaseInfoTable__'", [], function (t, results) { + var storeNames = []; + + for (var i = 0; i < results.rows.length; i++) { + storeNames.push(results.rows.item(i).name); + } + + resolve({ + db: db, + storeNames: storeNames + }); + }, function (t, error) { + reject(error); + }); + }, function (sqlError) { + reject(sqlError); + }); + }); +} + +function dropInstance$1(options, callback) { + callback = getCallback.apply(this, arguments); + + var currentConfig = this.config(); + options = typeof options !== 'function' && options || {}; + if (!options.name) { + options.name = options.name || currentConfig.name; + options.storeName = options.storeName || currentConfig.storeName; + } + + var self = this; + var promise; + if (!options.name) { + promise = Promise$1.reject('Invalid arguments'); + } else { + promise = new Promise$1(function (resolve) { + var db; + if (options.name === currentConfig.name) { + // use the db reference of the current instance + db = self._dbInfo.db; + } else { + db = openDatabase(options.name, '', '', 0); + } + + if (!options.storeName) { + // drop all database tables + resolve(getAllStoreNames(db)); + } else { + resolve({ + db: db, + storeNames: [options.storeName] + }); + } + }).then(function (operationInfo) { + return new Promise$1(function (resolve, reject) { + operationInfo.db.transaction(function (t) { + function dropTable(storeName) { + return new Promise$1(function (resolve, reject) { + t.executeSql('DROP TABLE IF EXISTS ' + storeName, [], function () { + resolve(); + }, function (t, error) { + reject(error); + }); + }); + } + + var operations = []; + for (var i = 0, len = operationInfo.storeNames.length; i < len; i++) { + operations.push(dropTable(operationInfo.storeNames[i])); + } + + Promise$1.all(operations).then(function () { + resolve(); + })["catch"](function (e) { + reject(e); + }); + }, function (sqlError) { + reject(sqlError); + }); + }); + }); + } + + executeCallback(promise, callback); + return promise; +} + +var webSQLStorage = { + _driver: 'webSQLStorage', + _initStorage: _initStorage$1, + _support: isWebSQLValid(), + iterate: iterate$1, + getItem: getItem$1, + setItem: setItem$1, + removeItem: removeItem$1, + clear: clear$1, + length: length$1, + key: key$1, + keys: keys$1, + dropInstance: dropInstance$1 +}; + +function isLocalStorageValid() { + try { + return typeof localStorage !== 'undefined' && 'setItem' in localStorage && + // in IE8 typeof localStorage.setItem === 'object' + !!localStorage.setItem; + } catch (e) { + return false; + } +} + +function _getKeyPrefix(options, defaultConfig) { + var keyPrefix = options.name + '/'; + + if (options.storeName !== defaultConfig.storeName) { + keyPrefix += options.storeName + '/'; + } + return keyPrefix; +} + +// Check if localStorage throws when saving an item +function checkIfLocalStorageThrows() { + var localStorageTestKey = '_localforage_support_test'; + + try { + localStorage.setItem(localStorageTestKey, true); + localStorage.removeItem(localStorageTestKey); + + return false; + } catch (e) { + return true; + } +} + +// Check if localStorage is usable and allows to save an item +// This method checks if localStorage is usable in Safari Private Browsing +// mode, or in any other case where the available quota for localStorage +// is 0 and there wasn't any saved items yet. +function _isLocalStorageUsable() { + return !checkIfLocalStorageThrows() || localStorage.length > 0; +} + +// Config the localStorage backend, using options set in the config. +function _initStorage$2(options) { + var self = this; + var dbInfo = {}; + if (options) { + for (var i in options) { + dbInfo[i] = options[i]; + } + } + + dbInfo.keyPrefix = _getKeyPrefix(options, self._defaultConfig); + + if (!_isLocalStorageUsable()) { + return Promise$1.reject(); + } + + self._dbInfo = dbInfo; + dbInfo.serializer = localforageSerializer; + + return Promise$1.resolve(); +} + +// Remove all keys from the datastore, effectively destroying all data in +// the app's key/value store! +function clear$2(callback) { + var self = this; + var promise = self.ready().then(function () { + var keyPrefix = self._dbInfo.keyPrefix; + + for (var i = localStorage.length - 1; i >= 0; i--) { + var key = localStorage.key(i); + + if (key.indexOf(keyPrefix) === 0) { + localStorage.removeItem(key); + } + } + }); + + executeCallback(promise, callback); + return promise; +} + +// Retrieve an item from the store. Unlike the original async_storage +// library in Gaia, we don't modify return values at all. If a key's value +// is `undefined`, we pass that value to the callback function. +function getItem$2(key, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = self.ready().then(function () { + var dbInfo = self._dbInfo; + var result = localStorage.getItem(dbInfo.keyPrefix + key); + + // If a result was found, parse it from the serialized + // string into a JS object. If result isn't truthy, the key + // is likely undefined and we'll pass it straight to the + // callback. + if (result) { + result = dbInfo.serializer.deserialize(result); + } + + return result; + }); + + executeCallback(promise, callback); + return promise; +} + +// Iterate over all items in the store. +function iterate$2(iterator, callback) { + var self = this; + + var promise = self.ready().then(function () { + var dbInfo = self._dbInfo; + var keyPrefix = dbInfo.keyPrefix; + var keyPrefixLength = keyPrefix.length; + var length = localStorage.length; + + // We use a dedicated iterator instead of the `i` variable below + // so other keys we fetch in localStorage aren't counted in + // the `iterationNumber` argument passed to the `iterate()` + // callback. + // + // See: github.com/mozilla/localForage/pull/435#discussion_r38061530 + var iterationNumber = 1; + + for (var i = 0; i < length; i++) { + var key = localStorage.key(i); + if (key.indexOf(keyPrefix) !== 0) { + continue; + } + var value = localStorage.getItem(key); + + // If a result was found, parse it from the serialized + // string into a JS object. If result isn't truthy, the + // key is likely undefined and we'll pass it straight + // to the iterator. + if (value) { + value = dbInfo.serializer.deserialize(value); + } + + value = iterator(value, key.substring(keyPrefixLength), iterationNumber++); + + if (value !== void 0) { + return value; + } + } + }); + + executeCallback(promise, callback); + return promise; +} + +// Same as localStorage's key() method, except takes a callback. +function key$2(n, callback) { + var self = this; + var promise = self.ready().then(function () { + var dbInfo = self._dbInfo; + var result; + try { + result = localStorage.key(n); + } catch (error) { + result = null; + } + + // Remove the prefix from the key, if a key is found. + if (result) { + result = result.substring(dbInfo.keyPrefix.length); + } + + return result; + }); + + executeCallback(promise, callback); + return promise; +} + +function keys$2(callback) { + var self = this; + var promise = self.ready().then(function () { + var dbInfo = self._dbInfo; + var length = localStorage.length; + var keys = []; + + for (var i = 0; i < length; i++) { + var itemKey = localStorage.key(i); + if (itemKey.indexOf(dbInfo.keyPrefix) === 0) { + keys.push(itemKey.substring(dbInfo.keyPrefix.length)); + } + } + + return keys; + }); + + executeCallback(promise, callback); + return promise; +} + +// Supply the number of keys in the datastore to the callback function. +function length$2(callback) { + var self = this; + var promise = self.keys().then(function (keys) { + return keys.length; + }); + + executeCallback(promise, callback); + return promise; +} + +// Remove an item from the store, nice and simple. +function removeItem$2(key, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = self.ready().then(function () { + var dbInfo = self._dbInfo; + localStorage.removeItem(dbInfo.keyPrefix + key); + }); + + executeCallback(promise, callback); + return promise; +} + +// Set a key's value and run an optional callback once the value is set. +// Unlike Gaia's implementation, the callback function is passed the value, +// in case you want to operate on that value only after you're sure it +// saved, or something like that. +function setItem$2(key, value, callback) { + var self = this; + + key = normalizeKey(key); + + var promise = self.ready().then(function () { + // Convert undefined values to null. + // https://github.com/mozilla/localForage/pull/42 + if (value === undefined) { + value = null; + } + + // Save the original value to pass to the callback. + var originalValue = value; + + return new Promise$1(function (resolve, reject) { + var dbInfo = self._dbInfo; + dbInfo.serializer.serialize(value, function (value, error) { + if (error) { + reject(error); + } else { + try { + localStorage.setItem(dbInfo.keyPrefix + key, value); + resolve(originalValue); + } catch (e) { + // localStorage capacity exceeded. + // TODO: Make this a specific error/event. + if (e.name === 'QuotaExceededError' || e.name === 'NS_ERROR_DOM_QUOTA_REACHED') { + reject(e); + } + reject(e); + } + } + }); + }); + }); + + executeCallback(promise, callback); + return promise; +} + +function dropInstance$2(options, callback) { + callback = getCallback.apply(this, arguments); + + options = typeof options !== 'function' && options || {}; + if (!options.name) { + var currentConfig = this.config(); + options.name = options.name || currentConfig.name; + options.storeName = options.storeName || currentConfig.storeName; + } + + var self = this; + var promise; + if (!options.name) { + promise = Promise$1.reject('Invalid arguments'); + } else { + promise = new Promise$1(function (resolve) { + if (!options.storeName) { + resolve(options.name + '/'); + } else { + resolve(_getKeyPrefix(options, self._defaultConfig)); + } + }).then(function (keyPrefix) { + for (var i = localStorage.length - 1; i >= 0; i--) { + var key = localStorage.key(i); + + if (key.indexOf(keyPrefix) === 0) { + localStorage.removeItem(key); + } + } + }); + } + + executeCallback(promise, callback); + return promise; +} + +var localStorageWrapper = { + _driver: 'localStorageWrapper', + _initStorage: _initStorage$2, + _support: isLocalStorageValid(), + iterate: iterate$2, + getItem: getItem$2, + setItem: setItem$2, + removeItem: removeItem$2, + clear: clear$2, + length: length$2, + key: key$2, + keys: keys$2, + dropInstance: dropInstance$2 +}; + +var sameValue = function sameValue(x, y) { + return x === y || typeof x === 'number' && typeof y === 'number' && isNaN(x) && isNaN(y); +}; + +var includes = function includes(array, searchElement) { + var len = array.length; + var i = 0; + while (i < len) { + if (sameValue(array[i], searchElement)) { + return true; + } + i++; + } + + return false; +}; + +var isArray = Array.isArray || function (arg) { + return Object.prototype.toString.call(arg) === '[object Array]'; +}; + +// Drivers are stored here when `defineDriver()` is called. +// They are shared across all instances of localForage. +var DefinedDrivers = {}; + +var DriverSupport = {}; + +var DefaultDrivers = { + INDEXEDDB: asyncStorage, + WEBSQL: webSQLStorage, + LOCALSTORAGE: localStorageWrapper +}; + +var DefaultDriverOrder = [DefaultDrivers.INDEXEDDB._driver, DefaultDrivers.WEBSQL._driver, DefaultDrivers.LOCALSTORAGE._driver]; + +var OptionalDriverMethods = ['dropInstance']; + +var LibraryMethods = ['clear', 'getItem', 'iterate', 'key', 'keys', 'length', 'removeItem', 'setItem'].concat(OptionalDriverMethods); + +var DefaultConfig = { + description: '', + driver: DefaultDriverOrder.slice(), + name: 'localforage', + // Default DB size is _JUST UNDER_ 5MB, as it's the highest size + // we can use without a prompt. + size: 4980736, + storeName: 'keyvaluepairs', + version: 1.0 +}; + +function callWhenReady(localForageInstance, libraryMethod) { + localForageInstance[libraryMethod] = function () { + var _args = arguments; + return localForageInstance.ready().then(function () { + return localForageInstance[libraryMethod].apply(localForageInstance, _args); + }); + }; +} + +function extend() { + for (var i = 1; i < arguments.length; i++) { + var arg = arguments[i]; + + if (arg) { + for (var _key in arg) { + if (arg.hasOwnProperty(_key)) { + if (isArray(arg[_key])) { + arguments[0][_key] = arg[_key].slice(); + } else { + arguments[0][_key] = arg[_key]; + } + } + } + } + } + + return arguments[0]; +} + +var LocalForage = function () { + function LocalForage(options) { + _classCallCheck(this, LocalForage); + + for (var driverTypeKey in DefaultDrivers) { + if (DefaultDrivers.hasOwnProperty(driverTypeKey)) { + var driver = DefaultDrivers[driverTypeKey]; + var driverName = driver._driver; + this[driverTypeKey] = driverName; + + if (!DefinedDrivers[driverName]) { + // we don't need to wait for the promise, + // since the default drivers can be defined + // in a blocking manner + this.defineDriver(driver); + } + } + } + + this._defaultConfig = extend({}, DefaultConfig); + this._config = extend({}, this._defaultConfig, options); + this._driverSet = null; + this._initDriver = null; + this._ready = false; + this._dbInfo = null; + + this._wrapLibraryMethodsWithReady(); + this.setDriver(this._config.driver)["catch"](function () {}); + } + + // Set any config values for localForage; can be called anytime before + // the first API call (e.g. `getItem`, `setItem`). + // We loop through options so we don't overwrite existing config + // values. + + + LocalForage.prototype.config = function config(options) { + // If the options argument is an object, we use it to set values. + // Otherwise, we return either a specified config value or all + // config values. + if ((typeof options === 'undefined' ? 'undefined' : _typeof(options)) === 'object') { + // If localforage is ready and fully initialized, we can't set + // any new configuration values. Instead, we return an error. + if (this._ready) { + return new Error("Can't call config() after localforage " + 'has been used.'); + } + + for (var i in options) { + if (i === 'storeName') { + options[i] = options[i].replace(/\W/g, '_'); + } + + if (i === 'version' && typeof options[i] !== 'number') { + return new Error('Database version must be a number.'); + } + + this._config[i] = options[i]; + } + + // after all config options are set and + // the driver option is used, try setting it + if ('driver' in options && options.driver) { + return this.setDriver(this._config.driver); + } + + return true; + } else if (typeof options === 'string') { + return this._config[options]; + } else { + return this._config; + } + }; + + // Used to define a custom driver, shared across all instances of + // localForage. + + + LocalForage.prototype.defineDriver = function defineDriver(driverObject, callback, errorCallback) { + var promise = new Promise$1(function (resolve, reject) { + try { + var driverName = driverObject._driver; + var complianceError = new Error('Custom driver not compliant; see ' + 'https://mozilla.github.io/localForage/#definedriver'); + + // A driver name should be defined and not overlap with the + // library-defined, default drivers. + if (!driverObject._driver) { + reject(complianceError); + return; + } + + var driverMethods = LibraryMethods.concat('_initStorage'); + for (var i = 0, len = driverMethods.length; i < len; i++) { + var driverMethodName = driverMethods[i]; + + // when the property is there, + // it should be a method even when optional + var isRequired = !includes(OptionalDriverMethods, driverMethodName); + if ((isRequired || driverObject[driverMethodName]) && typeof driverObject[driverMethodName] !== 'function') { + reject(complianceError); + return; + } + } + + var configureMissingMethods = function configureMissingMethods() { + var methodNotImplementedFactory = function methodNotImplementedFactory(methodName) { + return function () { + var error = new Error('Method ' + methodName + ' is not implemented by the current driver'); + var promise = Promise$1.reject(error); + executeCallback(promise, arguments[arguments.length - 1]); + return promise; + }; + }; + + for (var _i = 0, _len = OptionalDriverMethods.length; _i < _len; _i++) { + var optionalDriverMethod = OptionalDriverMethods[_i]; + if (!driverObject[optionalDriverMethod]) { + driverObject[optionalDriverMethod] = methodNotImplementedFactory(optionalDriverMethod); + } + } + }; + + configureMissingMethods(); + + var setDriverSupport = function setDriverSupport(support) { + if (DefinedDrivers[driverName]) { + console.info('Redefining LocalForage driver: ' + driverName); + } + DefinedDrivers[driverName] = driverObject; + DriverSupport[driverName] = support; + // don't use a then, so that we can define + // drivers that have simple _support methods + // in a blocking manner + resolve(); + }; + + if ('_support' in driverObject) { + if (driverObject._support && typeof driverObject._support === 'function') { + driverObject._support().then(setDriverSupport, reject); + } else { + setDriverSupport(!!driverObject._support); + } + } else { + setDriverSupport(true); + } + } catch (e) { + reject(e); + } + }); + + executeTwoCallbacks(promise, callback, errorCallback); + return promise; + }; + + LocalForage.prototype.driver = function driver() { + return this._driver || null; + }; + + LocalForage.prototype.getDriver = function getDriver(driverName, callback, errorCallback) { + var getDriverPromise = DefinedDrivers[driverName] ? Promise$1.resolve(DefinedDrivers[driverName]) : Promise$1.reject(new Error('Driver not found.')); + + executeTwoCallbacks(getDriverPromise, callback, errorCallback); + return getDriverPromise; + }; + + LocalForage.prototype.getSerializer = function getSerializer(callback) { + var serializerPromise = Promise$1.resolve(localforageSerializer); + executeTwoCallbacks(serializerPromise, callback); + return serializerPromise; + }; + + LocalForage.prototype.ready = function ready(callback) { + var self = this; + + var promise = self._driverSet.then(function () { + if (self._ready === null) { + self._ready = self._initDriver(); + } + + return self._ready; + }); + + executeTwoCallbacks(promise, callback, callback); + return promise; + }; + + LocalForage.prototype.setDriver = function setDriver(drivers, callback, errorCallback) { + var self = this; + + if (!isArray(drivers)) { + drivers = [drivers]; + } + + var supportedDrivers = this._getSupportedDrivers(drivers); + + function setDriverToConfig() { + self._config.driver = self.driver(); + } + + function extendSelfWithDriver(driver) { + self._extend(driver); + setDriverToConfig(); + + self._ready = self._initStorage(self._config); + return self._ready; + } + + function initDriver(supportedDrivers) { + return function () { + var currentDriverIndex = 0; + + function driverPromiseLoop() { + while (currentDriverIndex < supportedDrivers.length) { + var driverName = supportedDrivers[currentDriverIndex]; + currentDriverIndex++; + + self._dbInfo = null; + self._ready = null; + + return self.getDriver(driverName).then(extendSelfWithDriver)["catch"](driverPromiseLoop); + } + + setDriverToConfig(); + var error = new Error('No available storage method found.'); + self._driverSet = Promise$1.reject(error); + return self._driverSet; + } + + return driverPromiseLoop(); + }; + } + + // There might be a driver initialization in progress + // so wait for it to finish in order to avoid a possible + // race condition to set _dbInfo + var oldDriverSetDone = this._driverSet !== null ? this._driverSet["catch"](function () { + return Promise$1.resolve(); + }) : Promise$1.resolve(); + + this._driverSet = oldDriverSetDone.then(function () { + var driverName = supportedDrivers[0]; + self._dbInfo = null; + self._ready = null; + + return self.getDriver(driverName).then(function (driver) { + self._driver = driver._driver; + setDriverToConfig(); + self._wrapLibraryMethodsWithReady(); + self._initDriver = initDriver(supportedDrivers); + }); + })["catch"](function () { + setDriverToConfig(); + var error = new Error('No available storage method found.'); + self._driverSet = Promise$1.reject(error); + return self._driverSet; + }); + + executeTwoCallbacks(this._driverSet, callback, errorCallback); + return this._driverSet; + }; + + LocalForage.prototype.supports = function supports(driverName) { + return !!DriverSupport[driverName]; + }; + + LocalForage.prototype._extend = function _extend(libraryMethodsAndProperties) { + extend(this, libraryMethodsAndProperties); + }; + + LocalForage.prototype._getSupportedDrivers = function _getSupportedDrivers(drivers) { + var supportedDrivers = []; + for (var i = 0, len = drivers.length; i < len; i++) { + var driverName = drivers[i]; + if (this.supports(driverName)) { + supportedDrivers.push(driverName); + } + } + return supportedDrivers; + }; + + LocalForage.prototype._wrapLibraryMethodsWithReady = function _wrapLibraryMethodsWithReady() { + // Add a stub for each driver API method that delays the call to the + // corresponding driver method until localForage is ready. These stubs + // will be replaced by the driver methods as soon as the driver is + // loaded, so there is no performance impact. + for (var i = 0, len = LibraryMethods.length; i < len; i++) { + callWhenReady(this, LibraryMethods[i]); + } + }; + + LocalForage.prototype.createInstance = function createInstance(options) { + return new LocalForage(options); + }; + + return LocalForage; +}(); + +// The actual localForage object that we expose as a module or via a +// global. It's extended by pulling in one of our other libraries. + + +var localforage_js = new LocalForage(); + +module.exports = localforage_js; + +},{"3":3}]},{},[4])(4) +}); + +/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(5))) + +/***/ }), +/* 75 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _core = __webpack_require__(0); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +/** + * Open DisplayOptions Format Parser + * @class + * @param {document} displayOptionsDocument XML + */ +var DisplayOptions = function () { + function DisplayOptions(displayOptionsDocument) { + _classCallCheck(this, DisplayOptions); + + this.interactive = ""; + this.fixedLayout = ""; + this.openToSpread = ""; + this.orientationLock = ""; + + if (displayOptionsDocument) { + this.parse(displayOptionsDocument); + } + } + + /** + * Parse XML + * @param {document} displayOptionsDocument XML + * @return {DisplayOptions} self + */ + + + _createClass(DisplayOptions, [{ + key: "parse", + value: function parse(displayOptionsDocument) { + var _this = this; + + if (!displayOptionsDocument) { + return this; + } + + var displayOptionsNode = (0, _core.qs)(displayOptionsDocument, "display_options"); + if (!displayOptionsNode) { + return this; + } + + var options = (0, _core.qsa)(displayOptionsNode, "option"); + options.forEach(function (el) { + var value = ""; + + if (el.childNodes.length) { + value = el.childNodes[0].nodeValue; + } + + switch (el.attributes.name.value) { + case "interactive": + _this.interactive = value; + break; + case "fixed-layout": + _this.fixedLayout = value; + break; + case "open-to-spread": + _this.openToSpread = value; + break; + case "orientation-lock": + _this.orientationLock = value; + break; + } + }); + + return this; + } + }, { + key: "destroy", + value: function destroy() { + this.interactive = undefined; + this.fixedLayout = undefined; + this.openToSpread = undefined; + this.orientationLock = undefined; + } + }]); + + return DisplayOptions; +}(); + +exports.default = DisplayOptions; +module.exports = exports["default"]; + +/***/ }), +/* 76 */ +/***/ (function(module, exports, __webpack_require__) { + +/* WEBPACK VAR INJECTION */(function(global) {(function(global) { + /** + * Polyfill URLSearchParams + * + * Inspired from : https://github.com/WebReflection/url-search-params/blob/master/src/url-search-params.js + */ + + var checkIfIteratorIsSupported = function() { + try { + return !!Symbol.iterator; + } catch (error) { + return false; + } + }; + + + var iteratorSupported = checkIfIteratorIsSupported(); + + var createIterator = function(items) { + var iterator = { + next: function() { + var value = items.shift(); + return { done: value === void 0, value: value }; + } + }; + + if (iteratorSupported) { + iterator[Symbol.iterator] = function() { + return iterator; + }; + } + + return iterator; + }; + + /** + * Search param name and values should be encoded according to https://url.spec.whatwg.org/#urlencoded-serializing + * encodeURIComponent() produces the same result except encoding spaces as `%20` instead of `+`. + */ + var serializeParam = function(value) { + return encodeURIComponent(value).replace(/%20/g, '+'); + }; + + var deserializeParam = function(value) { + return decodeURIComponent(value).replace(/\+/g, ' '); + }; + + var polyfillURLSearchParams = function() { + + var URLSearchParams = function(searchString) { + Object.defineProperty(this, '_entries', { writable: true, value: {} }); + var typeofSearchString = typeof searchString; + + if (typeofSearchString === 'undefined') { + // do nothing + } else if (typeofSearchString === 'string') { + if (searchString !== '') { + this._fromString(searchString); + } + } else if (searchString instanceof URLSearchParams) { + var _this = this; + searchString.forEach(function(value, name) { + _this.append(name, value); + }); + } else if ((searchString !== null) && (typeofSearchString === 'object')) { + if (Object.prototype.toString.call(searchString) === '[object Array]') { + for (var i = 0; i < searchString.length; i++) { + var entry = searchString[i]; + if ((Object.prototype.toString.call(entry) === '[object Array]') || (entry.length !== 2)) { + this.append(entry[0], entry[1]); + } else { + throw new TypeError('Expected [string, any] as entry at index ' + i + ' of URLSearchParams\'s input'); + } + } + } else { + for (var key in searchString) { + if (searchString.hasOwnProperty(key)) { + this.append(key, searchString[key]); + } + } + } + } else { + throw new TypeError('Unsupported input\'s type for URLSearchParams'); + } + }; + + var proto = URLSearchParams.prototype; + + proto.append = function(name, value) { + if (name in this._entries) { + this._entries[name].push(String(value)); + } else { + this._entries[name] = [String(value)]; + } + }; + + proto.delete = function(name) { + delete this._entries[name]; + }; + + proto.get = function(name) { + return (name in this._entries) ? this._entries[name][0] : null; + }; + + proto.getAll = function(name) { + return (name in this._entries) ? this._entries[name].slice(0) : []; + }; + + proto.has = function(name) { + return (name in this._entries); + }; + + proto.set = function(name, value) { + this._entries[name] = [String(value)]; + }; + + proto.forEach = function(callback, thisArg) { + var entries; + for (var name in this._entries) { + if (this._entries.hasOwnProperty(name)) { + entries = this._entries[name]; + for (var i = 0; i < entries.length; i++) { + callback.call(thisArg, entries[i], name, this); + } + } + } + }; + + proto.keys = function() { + var items = []; + this.forEach(function(value, name) { + items.push(name); + }); + return createIterator(items); + }; + + proto.values = function() { + var items = []; + this.forEach(function(value) { + items.push(value); + }); + return createIterator(items); + }; + + proto.entries = function() { + var items = []; + this.forEach(function(value, name) { + items.push([name, value]); + }); + return createIterator(items); + }; + + if (iteratorSupported) { + proto[Symbol.iterator] = proto.entries; + } + + proto.toString = function() { + var searchArray = []; + this.forEach(function(value, name) { + searchArray.push(serializeParam(name) + '=' + serializeParam(value)); + }); + return searchArray.join('&'); + }; + + + global.URLSearchParams = URLSearchParams; + }; + + if (!('URLSearchParams' in global) || (new URLSearchParams('?a=1').toString() !== 'a=1')) { + polyfillURLSearchParams(); + } + + var proto = URLSearchParams.prototype; + + if (typeof proto.sort !== 'function') { + proto.sort = function() { + var _this = this; + var items = []; + this.forEach(function(value, name) { + items.push([name, value]); + if (!_this._entries) { + _this.delete(name); + } + }); + items.sort(function(a, b) { + if (a[0] < b[0]) { + return -1; + } else if (a[0] > b[0]) { + return +1; + } else { + return 0; + } + }); + if (_this._entries) { // force reset because IE keeps keys index + _this._entries = {}; + } + for (var i = 0; i < items.length; i++) { + this.append(items[i][0], items[i][1]); + } + }; + } + + if (typeof proto._fromString !== 'function') { + Object.defineProperty(proto, '_fromString', { + enumerable: false, + configurable: false, + writable: false, + value: function(searchString) { + if (this._entries) { + this._entries = {}; + } else { + var keys = []; + this.forEach(function(value, name) { + keys.push(name); + }); + for (var i = 0; i < keys.length; i++) { + this.delete(keys[i]); + } + } + + searchString = searchString.replace(/^\?/, ''); + var attributes = searchString.split('&'); + var attribute; + for (var i = 0; i < attributes.length; i++) { + attribute = attributes[i].split('='); + this.append( + deserializeParam(attribute[0]), + (attribute.length > 1) ? deserializeParam(attribute[1]) : '' + ); + } + } + }); + } + + // HTMLAnchorElement + +})( + (typeof global !== 'undefined') ? global + : ((typeof window !== 'undefined') ? window + : ((typeof self !== 'undefined') ? self : this)) +); + +(function(global) { + /** + * Polyfill URL + * + * Inspired from : https://github.com/arv/DOM-URL-Polyfill/blob/master/src/url.js + */ + + var checkIfURLIsSupported = function() { + try { + var u = new URL('b', 'http://a'); + u.pathname = 'c%20d'; + return (u.href === 'http://a/c%20d') && u.searchParams; + } catch (e) { + return false; + } + }; + + + var polyfillURL = function() { + var _URL = global.URL; + + var URL = function(url, base) { + if (typeof url !== 'string') url = String(url); + + // Only create another document if the base is different from current location. + var doc = document, baseElement; + if (base && (global.location === void 0 || base !== global.location.href)) { + doc = document.implementation.createHTMLDocument(''); + baseElement = doc.createElement('base'); + baseElement.href = base; + doc.head.appendChild(baseElement); + try { + if (baseElement.href.indexOf(base) !== 0) throw new Error(baseElement.href); + } catch (err) { + throw new Error('URL unable to set base ' + base + ' due to ' + err); + } + } + + var anchorElement = doc.createElement('a'); + anchorElement.href = url; + if (baseElement) { + doc.body.appendChild(anchorElement); + anchorElement.href = anchorElement.href; // force href to refresh + } + + if (anchorElement.protocol === ':' || !/:/.test(anchorElement.href)) { + throw new TypeError('Invalid URL'); + } + + Object.defineProperty(this, '_anchorElement', { + value: anchorElement + }); + + + // create a linked searchParams which reflect its changes on URL + var searchParams = new URLSearchParams(this.search); + var enableSearchUpdate = true; + var enableSearchParamsUpdate = true; + var _this = this; + ['append', 'delete', 'set'].forEach(function(methodName) { + var method = searchParams[methodName]; + searchParams[methodName] = function() { + method.apply(searchParams, arguments); + if (enableSearchUpdate) { + enableSearchParamsUpdate = false; + _this.search = searchParams.toString(); + enableSearchParamsUpdate = true; + } + }; + }); + + Object.defineProperty(this, 'searchParams', { + value: searchParams, + enumerable: true + }); + + var search = void 0; + Object.defineProperty(this, '_updateSearchParams', { + enumerable: false, + configurable: false, + writable: false, + value: function() { + if (this.search !== search) { + search = this.search; + if (enableSearchParamsUpdate) { + enableSearchUpdate = false; + this.searchParams._fromString(this.search); + enableSearchUpdate = true; + } + } + } + }); + }; + + var proto = URL.prototype; + + var linkURLWithAnchorAttribute = function(attributeName) { + Object.defineProperty(proto, attributeName, { + get: function() { + return this._anchorElement[attributeName]; + }, + set: function(value) { + this._anchorElement[attributeName] = value; + }, + enumerable: true + }); + }; + + ['hash', 'host', 'hostname', 'port', 'protocol'] + .forEach(function(attributeName) { + linkURLWithAnchorAttribute(attributeName); + }); + + Object.defineProperty(proto, 'search', { + get: function() { + return this._anchorElement['search']; + }, + set: function(value) { + this._anchorElement['search'] = value; + this._updateSearchParams(); + }, + enumerable: true + }); + + Object.defineProperties(proto, { + + 'toString': { + get: function() { + var _this = this; + return function() { + return _this.href; + }; + } + }, + + 'href': { + get: function() { + return this._anchorElement.href.replace(/\?$/, ''); + }, + set: function(value) { + this._anchorElement.href = value; + this._updateSearchParams(); + }, + enumerable: true + }, + + 'pathname': { + get: function() { + return this._anchorElement.pathname.replace(/(^\/?)/, '/'); + }, + set: function(value) { + this._anchorElement.pathname = value; + }, + enumerable: true + }, + + 'origin': { + get: function() { + // get expected port from protocol + var expectedPort = { 'http:': 80, 'https:': 443, 'ftp:': 21 }[this._anchorElement.protocol]; + // add port to origin if, expected port is different than actual port + // and it is not empty f.e http://foo:8080 + // 8080 != 80 && 8080 != '' + var addPortToOrigin = this._anchorElement.port != expectedPort && + this._anchorElement.port !== ''; + + return this._anchorElement.protocol + + '//' + + this._anchorElement.hostname + + (addPortToOrigin ? (':' + this._anchorElement.port) : ''); + }, + enumerable: true + }, + + 'password': { // TODO + get: function() { + return ''; + }, + set: function(value) { + }, + enumerable: true + }, + + 'username': { // TODO + get: function() { + return ''; + }, + set: function(value) { + }, + enumerable: true + }, + }); + + URL.createObjectURL = function(blob) { + return _URL.createObjectURL.apply(_URL, arguments); + }; + + URL.revokeObjectURL = function(url) { + return _URL.revokeObjectURL.apply(_URL, arguments); + }; + + global.URL = URL; + + }; + + if (!checkIfURLIsSupported()) { + polyfillURL(); + } + + if ((global.location !== void 0) && !('origin' in global.location)) { + var getOrigin = function() { + return global.location.protocol + '//' + global.location.hostname + (global.location.port ? (':' + global.location.port) : ''); + }; + + try { + Object.defineProperty(global.location, 'origin', { + get: getOrigin, + enumerable: true + }); + } catch (e) { + setInterval(function() { + global.location.origin = getOrigin(); + }, 100); + } + } + +})( + (typeof global !== 'undefined') ? global + : ((typeof window !== 'undefined') ? window + : ((typeof self !== 'undefined') ? self : this)) +); + +/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(5))) + +/***/ }) +/******/ ]); +}); diff --git a/static/epub.js/js/epub.min.js b/static/epub.js/js/epub.min.js new file mode 100644 index 00000000..708d146a --- /dev/null +++ b/static/epub.js/js/epub.min.js @@ -0,0 +1 @@ +(function(e,t){'object'==typeof exports&&'object'==typeof module?module.exports=t(require('xmldom'),function(){try{return require('jszip')}catch(t){}}()):'function'==typeof define&&define.amd?define(['xmldom','jszip'],t):'object'==typeof exports?exports.ePub=t(require('xmldom'),function(){try{return require('jszip')}catch(t){}}()):e.ePub=t(e.xmldom,e.jszip)})('undefined'==typeof self?this:self,function(e,t){var n=String.prototype,a=Math.abs,i=Math.min,o=Math.ceil,r=Math.round,s=Math.max,l=Math.floor;return function(e){function t(a){if(n[a])return n[a].exports;var i=n[a]={i:a,l:!1,exports:{}};return e[a].call(i.exports,i,i.exports,t),i.l=!0,i.exports}var n={};return t.m=e,t.c=n,t.d=function(e,n,a){t.o(e,n)||Object.defineProperty(e,n,{configurable:!1,enumerable:!0,get:a})},t.n=function(e){var n=e&&e.__esModule?function(){return e['default']}:function(){return e};return t.d(n,'a',n),n},t.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},t.p='/dist/',t(t.s=25)}([function(e,t,n){'use strict';function a(e,t){if(!(e instanceof t))throw new TypeError('Cannot call a class as a function')}function i(){var e=new Date().getTime(),t='xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g,function(t){var n=0|(e+16*Math.random())%16;return e=l(e/16),('x'==t?n:8|7&n).toString(16)});return t}function o(e){return!isNaN(parseFloat(e))&&isFinite(e)}function r(e,t,n,a,i){var o=a||0,s=i||t.length,l=parseInt(o+(s-o)/2),d;return(n||(n=function(e,t){return e>t?1:e=s-o)?l:(d=n(t[l],e),1==s-o?0<=d?l:l+1:0===d?l:-1===d?r(e,t,n,l,s):r(e,t,n,o,l))}function d(e,t,n,a,i){var o=a||0,r=i||t.length,s=parseInt(o+(r-o)/2),l;return(n||(n=function(e,t){return e>t?1:e=r-o)?-1:(l=n(t[s],e),1==r-o?0===l?s:-1:0===l?s:-1===l?d(e,t,n,s,r):d(e,t,n,o,s))}function u(e,t){for(var n=e.parentNode,a=n.childNodes,o=-1,r=0,i;rn.spinePos)return 1;if(t.spinePoso[d].index)return 1;if(a[d].indexs.offset?1:r.offset')}},{key:'textNodes',value:function(e,t){return Array.prototype.slice.call(e.childNodes).filter(function(e){return e.nodeType===l||t&&e.classList.contains(t)})}},{key:'walkToNode',value:function(e,t,n){var a=t||document,o=a.documentElement,s=e.length,l,d,u;for(u=0;uc)t-=c;else{i=u.nodeType===s?u.childNodes[0]:u;break}}return{container:i,offset:t}}},{key:'toRange',value:function(e,t){var n=e||document,a=this,i=!!t&&null!=n.querySelector('.'+t),o,s,l,d,u,c,p,g;if(o='undefined'==typeof n.createRange?new r.RangeObject:n.createRange(),a.range?(s=a.start,c=a.path.steps.concat(s.steps),d=this.findNode(c,n,i?t:null),l=a.end,p=a.path.steps.concat(l.steps),u=this.findNode(p,n,i?t:null)):(s=a.path,c=a.path.steps,d=this.findNode(a.path.steps,n,i?t:null)),d)try{null==s.terminal.offset?o.setStart(d,0):o.setStart(d,s.terminal.offset)}catch(a){g=this.fixMiss(c,s.terminal.offset,n,i?t:null),o.setStart(g.container,g.offset)}else return console.log('No startContainer found for',this.toString()),null;if(u)try{null==l.terminal.offset?o.setEnd(u,0):o.setEnd(u,l.terminal.offset)}catch(r){g=this.fixMiss(p,a.end.terminal.offset,n,i?t:null),o.setEnd(g.container,g.offset)}return o}},{key:'isCfiString',value:function(e){return'string'==typeof e&&0===e.indexOf('epubcfi(')&&')'===e[e.length-1]}},{key:'generateChapterComponent',value:function(e,t,n){var a=parseInt(t),i='/'+2*(e+1)+'/';return i+=2*(a+1),n&&(i+='['+n+']'),i}},{key:'collapse',value:function(e){this.range&&(this.range=!1,e?(this.path.steps=this.path.steps.concat(this.start.steps),this.path.terminal=this.start.terminal):(this.path.steps=this.path.steps.concat(this.end.steps),this.path.terminal=this.end.terminal))}}]),e}();t.default=d,e.exports=t['default']},function(e,t){'use strict';Object.defineProperty(t,'__esModule',{value:!0});var n=t.EPUBJS_VERSION='0.3',a=t.DOM_EVENTS=['keydown','keyup','keypressed','mouseup','mousedown','click','touchend','touchstart','touchmove'],i=t.EVENTS={BOOK:{OPEN_FAILED:'openFailed'},CONTENTS:{EXPAND:'expand',RESIZE:'resize',SELECTED:'selected',SELECTED_RANGE:'selectedRange',LINK_CLICKED:'linkClicked'},LOCATIONS:{CHANGED:'changed'},MANAGERS:{RESIZE:'resize',RESIZED:'resized',ORIENTATION_CHANGE:'orientationchange',ADDED:'added',SCROLL:'scroll',SCROLLED:'scrolled',REMOVED:'removed'},VIEWS:{AXIS:'axis',LOAD_ERROR:'loaderror',RENDERED:'rendered',RESIZED:'resized',DISPLAYED:'displayed',SHOWN:'shown',HIDDEN:'hidden',MARK_CLICKED:'markClicked'},RENDITION:{STARTED:'started',ATTACHED:'attached',DISPLAYED:'displayed',DISPLAY_ERROR:'displayerror',RENDERED:'rendered',REMOVED:'removed',RESIZED:'resized',ORIENTATION_CHANGE:'orientationchange',LOCATION_CHANGED:'locationChanged',RELOCATED:'relocated',MARK_CLICKED:'markClicked',SELECTED:'selected',LAYOUT:'layout'},LAYOUT:{UPDATED:'updated'},ANNOTATION:{ATTACH:'attach',DETACH:'detach'}}},function(e,t,n){'use strict';var a=n(27),o=n(41),r=Function.prototype.apply,s=Function.prototype.call,i=Object.create,l=Object.defineProperty,d=Object.defineProperties,u=Object.prototype.hasOwnProperty,c={configurable:!0,enumerable:!1,writable:!0},p,g,h,m,f,y,v;p=function(e,t){var n;return o(t),u.call(this,'__ee__')?n=this.__ee__:(n=c.value=i(null),l(this,'__ee__',c),c.value=null),n[e]?'object'==typeof n[e]?n[e].push(t):n[e]=[n[e],t]:n[e]=t,this},g=function(e,t){var n,a;return o(t),a=this,p.call(this,e,n=function(){h.call(a,e,n),r.call(t,this,arguments)}),n.__eeOnceListener__=t,this},h=function(e,t){var n,a,r,s;if(o(t),!u.call(this,'__ee__'))return this;if(n=this.__ee__,!n[e])return this;if(a=n[e],'object'==typeof a)for(s=0;r=a[s];++s)(r===t||r.__eeOnceListener__===t)&&(2===a.length?n[e]=a[s?0:1]:a.splice(s,1));else(a===t||a.__eeOnceListener__===t)&&delete n[e];return this},m=function(e){var t,n,a,i,o;if(u.call(this,'__ee__')&&(i=this.__ee__[e],!!i))if('object'==typeof i){for(n=arguments.length,o=Array(n-1),t=1;tn.length||46!==n.charCodeAt(n.length-1)||46!==n.charCodeAt(n.length-2))if(2c){if(47===n.charCodeAt(l+g))return n.slice(l+g+1);if(0==g)return n.slice(l+g)}else s>c&&(47===e.charCodeAt(a+g)?p=g:0==g&&(p=0));break}var i=e.charCodeAt(a+g),h=n.charCodeAt(l+g);if(i!==h)break;else 47===i&&(p=g)}var m='';for(g=a+p+1;g<=o;++g)(g===o||47===e.charCodeAt(g))&&(m+=0===m.length?'..':'/..');return 0=r;--c){if(a=e.charCodeAt(c),47===a){if(!u){l=c+1;break}continue}-1==d&&(u=!1,d=c+1),46===a?-1==s?s=c:1!=i&&(i=1):-1!=s&&(i=-1)}return-1==s||-1==d||0==i||1==i&&s==d-1&&s==l+1?-1!=d&&(0==l&&o?n.base=n.name=e.slice(1,d):n.base=n.name=e.slice(l,d)):(0==l&&o?(n.name=e.slice(1,s),n.base=e.slice(1,d)):(n.name=e.slice(l,s),n.base=e.slice(l,d)),n.ext=e.slice(s,d)),0this.container.scrollWidth&&(t=this.container.scrollWidth-this.layout.delta)):n=e.top,this.scrollTo(t,n,!0)}},{key:'add',value:function(e){var t=this,n=this.createView(e);return this.views.append(n),n.onDisplayed=this.afterDisplayed.bind(this),n.onResize=this.afterResized.bind(this),n.on(b.EVENTS.VIEWS.AXIS,function(e){t.updateAxis(e)}),n.display(this.request)}},{key:'append',value:function(e){var t=this,n=this.createView(e);return this.views.append(n),n.onDisplayed=this.afterDisplayed.bind(this),n.onResize=this.afterResized.bind(this),n.on(b.EVENTS.VIEWS.AXIS,function(e){t.updateAxis(e)}),n.display(this.request)}},{key:'prepend',value:function(e){var t=this,n=this.createView(e);return n.on(b.EVENTS.VIEWS.RESIZED,function(e){t.counter(e)}),this.views.prepend(n),n.onDisplayed=this.afterDisplayed.bind(this),n.onResize=this.afterResized.bind(this),n.on(b.EVENTS.VIEWS.AXIS,function(e){t.updateAxis(e)}),n.display(this.request)}},{key:'counter',value:function(e){'vertical'===this.settings.axis?this.scrollBy(0,e.heightDelta,!0):this.scrollBy(e.widthDelta,0,!0)}},{key:'next',value:function(){var e=this.settings.direction,t,n;if(this.views.length){if(this.isPaginated&&'horizontal'===this.settings.axis&&(!e||'ltr'===e))this.scrollLeft=this.container.scrollLeft,n=this.container.scrollLeft+this.container.offsetWidth+this.layout.delta,n<=this.container.scrollWidth?this.scrollBy(this.layout.delta,0,!0):t=this.views.last().section.next();else if(this.isPaginated&&'horizontal'===this.settings.axis&&'rtl'===e)this.scrollLeft=this.container.scrollLeft,n=this.container.scrollLeft,0p&&(h=p,s=h-g);var m=e.layout.count(p,a).pages,f=o(g/a),y=[],v=o(h/a);y=[];for(var b=f,i;b<=v;b++)i=b+1,y.push(i);var k=e.mapping.page(t.contents,t.section.cfiBase,g,h);return{index:d,href:u,pages:y,totalPages:m,mapping:k}});return i}},{key:'paginatedLocation',value:function(){var e=this,t=this.visible(),n=this.container.getBoundingClientRect(),a=0,o=0;this.settings.fullsize&&(a=window.scrollX);var i=t.map(function(t){var r=t.section,s=r.index,d=r.href,u=t.offset().left,c=t.position().left,p=t.width(),g=a+n.left-c+o,h=g+e.layout.width-o,m=e.mapping.page(t.contents,t.section.cfiBase,g,h),f=e.layout.count(p).pages,y=l(g/e.layout.pageWidth),v=[],b=l(h/e.layout.pageWidth);if(0>y&&(y=0,++b),'rtl'===e.settings.direction){var k=y;y=f-b,b=f-k}for(var x=y+1,i;x<=b;x++)i=x,v.push(i);return{index:s,href:d,pages:v,totalPages:f,mapping:m}});return i}},{key:'isVisible',value:function(e,t,n,a){var i=e.position(),o=a||this.bounds();return'horizontal'===this.settings.axis&&i.right>o.left-t&&i.lefto.top-t&&i.top'==e&&'>'||'&'==e&&'&'||'"'==e&&'"'||'&#'+e.charCodeAt()+';'}function m(e,t){if(t(e))return!0;if(e=e.firstChild)do if(m(e,t))return!0;while(e=e.nextSibling)}function f(){}function y(e,t,n){e&&e._inc++;var a=n.namespaceURI;'http://www.w3.org/2000/xmlns/'==a&&(t._nsMap[n.prefix?n.localName:'']=n.value)}function v(e,t,n){e&&e._inc++;var a=n.namespaceURI;'http://www.w3.org/2000/xmlns/'==a&&delete t._nsMap[n.prefix?n.localName:'']}function b(e,t,n){if(e&&e._inc){e._inc++;var a=t.childNodes;if(n)a[a.length++]=n;else{for(var o=t.firstChild,r=0;o;)a[r++]=o,o=o.nextSibling;a.length=r}}}function k(e,t){var n=t.previousSibling,a=t.nextSibling;return n?n.nextSibling=a:e.firstChild=a,a?a.previousSibling=n:e.lastChild=n,b(e.ownerDocument,e),t}function x(e,t,n){var a=t.parentNode;if(a&&a.removeChild(t),t.nodeType===ee){var i=t.firstChild;if(null==i)return t;var o=t.lastChild}else i=o=t;var r=n?n.previousSibling:e.lastChild;i.previousSibling=r,o.nextSibling=n,r?r.nextSibling=i:e.firstChild=i,null==n?e.lastChild=o:n.previousSibling=o;do i.parentNode=e;while(i!==o&&(i=i.nextSibling));return b(e.ownerDocument||e,e),t.nodeType==ee&&(t.firstChild=t.lastChild=null),t}function E(e,t){var n=t.parentNode;if(n){var a=e.lastChild;n.removeChild(t);var a=e.lastChild}var a=e.lastChild;return t.parentNode=e,t.previousSibling=a,t.nextSibling=null,a?a.nextSibling=t:e.firstChild=t,e.lastChild=t,b(e.ownerDocument,e,t),t}function _(){this._nsMap={}}function N(){}function S(){}function w(){}function T(){}function C(){}function R(){}function I(){}function A(){}function L(){}function O(){}function D(){}function P(){}function z(e,t){var n=[],a=9==this.nodeType?this.documentElement:this,i=a.prefix,o=a.namespaceURI;if(o&&null==i){var i=a.lookupPrefix(o);if(null==i)var r=[{namespace:o,prefix:null}]}return B(this,n,e,t,r),n.join('')}function M(e,t,n){var a=e.prefix||'',o=e.namespaceURI;if(!a&&!o)return!1;if('xml'===a&&'http://www.w3.org/XML/1998/namespace'===o||'http://www.w3.org/2000/xmlns/'==o)return!1;for(var r=n.length;r--;){var i=n[r];if(i.prefix==a)return i.namespace!=o}return!0}function B(e,t,n,a,o){if(a){if(e=a(e),!e)return;if('string'==typeof e)return void t.push(e)}switch(e.nodeType){case F:o||(o=[]);var r=o.length,s=e.attributes,l=s.length,d=e.firstChild,u=e.tagName;n=V===e.namespaceURI||n,t.push('<',u);for(var c=0,i;c'),n&&/^script$/i.test(u))for(;d;)d.data?t.push(d.data):B(d,t,n,a,o),d=d.nextSibling;else for(;d;)B(d,t,n,a,o),d=d.nextSibling;t.push('')}else t.push('/>');return;case J:case ee:for(var d=e.firstChild;d;)B(d,t,n,a,o),d=d.nextSibling;return;case H:return t.push(' ',e.name,'="',e.value.replace(/[<&"]/g,h),'"');case X:return t.push(e.data.replace(/[<&]/g,h));case Y:return t.push('');case Q:return t.push('');case $:var f=e.publicId,y=e.systemId;if(t.push('');else if(y&&'.'!=y)t.push(' SYSTEM "',y,'">');else{var v=e.internalSubset;v&&t.push(' [',v,']'),t.push('>')}return;case Z:return t.push('');case G:return t.push('&',e.nodeName,';');default:t.push('??',e.nodeName);}}function j(e,t,n){var a;switch(t.nodeType){case F:a=t.cloneNode(!1),a.ownerDocument=e;case ee:break;case H:n=!0;}if(a||(a=t.cloneNode(!1)),a.ownerDocument=e,a.parentNode=null,n)for(var i=t.firstChild;i;)a.appendChild(j(e,i,n)),i=i.nextSibling;return a}function q(e,t,a){var o=new t.constructor;for(var s in t){var n=t[s];'object'!=typeof n&&n!=o[s]&&(o[s]=n)}switch(t.childNodes&&(o.childNodes=new r),o.ownerDocument=e,o.nodeType){case F:var d=t.attributes,u=o.attributes=new l,c=d.length;u._ownerElement=o;for(var p=0;p=a.end.displayed.total&&(a.atEnd=!0),t.index===this.book.spine.first().index&&1===a.start.displayed.page&&(a.atStart=!0),a}},{key:'destroy',value:function(){this.manager&&this.manager.destroy(),this.book=void 0}},{key:'passEvents',value:function(t){var n=this;N.DOM_EVENTS.forEach(function(a){t.on(a,function(e){return n.triggerViewEvent(e,t)})}),t.on(N.EVENTS.CONTENTS.SELECTED,function(a){return n.triggerSelectedEvent(a,t)})}},{key:'triggerViewEvent',value:function(t,e){this.emit(t.type,t,e)}},{key:'triggerSelectedEvent',value:function(e,t){this.emit(N.EVENTS.RENDITION.SELECTED,e,t)}},{key:'triggerMarkEvent',value:function(e,t,n){this.emit(N.EVENTS.RENDITION.MARK_CLICKED,e,t,n)}},{key:'getRange',value:function(e,t){var n=new g.default(e),a=this.manager.visible().filter(function(e){if(n.spinePos===e.index)return!0});if(a.length)return a[0].contents.range(n,t)}},{key:'adjustImages',value:function(e){if('pre-paginated'===this._layout.name)return new Promise(function(e){e()});var t=e.window.getComputedStyle(e.content,null),n=.95*(e.content.offsetHeight-(parseFloat(t.paddingTop)+parseFloat(t.paddingBottom))),a=parseFloat(t.verticalPadding);return e.addStylesheetRules({img:{"max-width":(this._layout.columnWidth?this._layout.columnWidth-a+'px':'100%')+'!important',"max-height":n+'px!important',"object-fit":'contain',"page-break-inside":'avoid',"break-inside":'avoid',"box-sizing":'border-box'},svg:{"max-width":(this._layout.columnWidth?this._layout.columnWidth-a+'px':'100%')+'!important',"max-height":n+'px!important',"page-break-inside":'avoid',"break-inside":'avoid'}}),new Promise(function(e){setTimeout(function(){e()},1)})}},{key:'getContents',value:function(){return this.manager?this.manager.getContents():[]}},{key:'views',value:function(){var e=this.manager?this.manager.views:void 0;return e||[]}},{key:'handleLinks',value:function(e){var t=this;e&&e.on(N.EVENTS.CONTENTS.LINK_CLICKED,function(e){var n=t.book.path.relative(e);t.display(n)})}},{key:'injectStylesheet',value:function(e){var t=e.createElement('link');t.setAttribute('type','text/css'),t.setAttribute('rel','stylesheet'),t.setAttribute('href',this.settings.stylesheet),e.getElementsByTagName('head')[0].appendChild(t)}},{key:'injectScript',value:function(e){var t=e.createElement('script');t.setAttribute('type','text/javascript'),t.setAttribute('src',this.settings.script),t.textContent=' ',e.getElementsByTagName('head')[0].appendChild(t)}},{key:'injectIdentifier',value:function(e){var t=this.book.packaging.metadata.identifier,n=e.createElement('meta');n.setAttribute('name','dc.relation.ispartof'),t&&n.setAttribute('content',t),e.getElementsByTagName('head')[0].appendChild(n)}}]),e}();(0,l.default)(A.prototype),t.default=A,e.exports=t['default']},function(e,t,n){'use strict';function a(e,t){if(!(e instanceof t))throw new TypeError('Cannot call a class as a function')}Object.defineProperty(t,'__esModule',{value:!0});var i=function(){function e(e,t){for(var n=0,a;n=t&&r<=n)return e;if(s>t)return e;o=e,i.push(e)}else if(a.horizontal&&'rtl'===a.direction){if(r=c.left,s=c.right,s<=n&&s>=t)return e;if(r=t&&l<=n)return e;if(u>t)return e;o=e,i.push(e)}}),s)return this.findTextStartRange(s,t,n);return this.findTextStartRange(o,t,n)}},{key:'findEnd',value:function(e,t,n){for(var a=this,i=[e],o=e,s,l;i.length;)if(s=i.shift(),l=this.walk(s,function(e){var s,l,u,c,p;if(p=(0,d.nodeBounds)(e),a.horizontal&&'ltr'===a.direction){if(s=r(p.left),l=r(p.right),s>n&&o)return o;if(l>n)return e;o=e,i.push(e)}else if(a.horizontal&&'rtl'===a.direction){if(s=r(a.horizontal?p.left:p.top),l=r(a.horizontal?p.right:p.bottom),ln&&o)return o;if(c>n)return e;o=e,i.push(e)}}),l)return this.findTextEndRange(l,t,n);return this.findTextEndRange(o,t,n)}},{key:'findTextStartRange',value:function(e,t,n){for(var a=this.splitTextNodeIntoRanges(e),o=0,i,r,s,l,d;o=t)return i;}else if(this.horizontal&&'rtl'===this.direction){if(d=r.right,d<=n)return i;}else if(l=r.top,l>=t)return i;return a[0]}},{key:'findTextEndRange',value:function(e,t,n){for(var a=this.splitTextNodeIntoRanges(e),o=0,i,r,s,l,d,u,c;on&&i)return i;if(d>n)return r}else if(this.horizontal&&'rtl'===this.direction){if(l=s.left,d=s.right,dn&&i)return i;if(c>n)return r}i=r}return a[a.length-1]}},{key:'splitTextNodeIntoRanges',value:function(e,t){var n=[],a=e.textContent||'',i=a.trim(),o=e.ownerDocument,r=t||' ',s=i.indexOf(r),l;if(-1===s||e.nodeType!=Node.TEXT_NODE)return l=o.createRange(),l.selectNodeContents(e),[l];for(l=o.createRange(),l.setStart(e,0),l.setEnd(e,s),n.push(l),l=!1;-1!=s;)s=i.indexOf(r,s+1),0=t||0>n||y&&a>=x}function p(){var e=o();return c(e)?g(e):void(_=setTimeout(p,u(e)))}function g(e){return(_=void 0,v&&b)?l(e):(b=k=void 0,E)}function h(){var e=o(),n=c(e);if(b=arguments,k=this,N=e,n){if(void 0===_)return d(N);if(y)return _=setTimeout(p,t),l(N)}return void 0===_&&(_=setTimeout(p,t)),E}var m=0,f=!1,y=!1,v=!0,b,k,x,E,_,N;if('function'!=typeof e)throw new TypeError('Expected a function');return t=r(t)||0,a(n)&&(f=!!n.leading,y='maxWait'in n,x=y?s(r(n.maxWait)||0,t):x,v='trailing'in n?!!n.trailing:v),h.cancel=function(){void 0!==_&&clearTimeout(_),m=0,b=N=k=_=void 0},h.flush=function(){return void 0===_?E:g(o())},h}},function(e,t,n){var a=n(62),i='object'==typeof self&&self&&self.Object===Object&&self,o=a||i||Function('return this')();e.exports=o},function(e,t,n){var a=n(22),i=a.Symbol;e.exports=i},function(e,t,n){'use strict';function i(e){return e&&e.__esModule?e:{default:e}}function o(e,t){if(!(e instanceof t))throw new TypeError('Cannot call a class as a function')}function r(e,t){if(!e)throw new ReferenceError('this hasn\'t been initialised - super() hasn\'t been called');return t&&('object'==typeof t||'function'==typeof t)?t:e}function s(e,t){if('function'!=typeof t&&null!==t)throw new TypeError('Super expression must either be null or a function, not '+typeof t);e.prototype=Object.create(t&&t.prototype,{constructor:{value:e,enumerable:!1,writable:!0,configurable:!0}}),t&&(Object.setPrototypeOf?Object.setPrototypeOf(e,t):e.__proto__=t)}Object.defineProperty(t,'__esModule',{value:!0});var d='function'==typeof Symbol&&'symbol'==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&'function'==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?'symbol':typeof e},u=function(){function e(e,t){for(var n=0,a;n=h&&(o&&d?m():f()),0>c-r&&(o&&d?f():m());var y=i.map(function(e){return e.displayed});return i.length?Promise.all(y).then(function(){if('pre-paginated'===n.layout.name&&n.layout.props.spread)return n.check()}).then(function(){return n.update(r)},function(e){return e}):(this.q.enqueue(function(){this.update()}.bind(this)),a.resolve(!1),a.promise)}},{key:'trim',value:function(){for(var e=new p.defer,t=this.views.displayed(),n=t[0],a=t[t.length-1],o=this.views.indexOf(n),r=this.views.indexOf(a),s=this.views.slice(0,o),l=this.views.slice(r+1),d=0;darguments.length||'string'!=typeof t?(d=n,n=t,t=null):d=arguments[2],null==t?(o=l=!0,s=!1):(o=r.call(t,'c'),s=r.call(t,'e'),l=r.call(t,'w')),u={value:n,configurable:o,enumerable:s,writable:l},d?a(i(d),u):u},s.gs=function(t,n,s){var l,d,u,p;return'string'==typeof t?u=arguments[3]:(u=s,s=n,n=t,t=null),null==n?n=void 0:o(n)?null==s?s=void 0:!o(s)&&(u=s,s=void 0):(u=n,n=s=void 0),null==t?(l=!0,d=!1):(l=r.call(t,'c'),d=r.call(t,'e')),p={get:n,set:s,configurable:l,enumerable:d},u?a(i(u),p):p}},function(e,t,n){'use strict';e.exports=n(29)()?Object.assign:n(30)},function(e){'use strict';e.exports=function(){var e=Object.assign,t;return!('function'!=typeof e)&&(t={foo:'raz'},e(t,{bar:'dwa'},{trzy:'trzy'}),'razdwatrzy'===t.foo+t.bar+t.trzy)}},function(e,t,n){'use strict';var a=n(31),o=n(35);e.exports=function(e,t){var n=s(arguments.length,2),r,l,i;for(e=Object(o(e)),i=function(n){try{e[n]=t[n]}catch(t){r||(r=t)}},l=1;l=t+n||t?new java.lang.String(e,t,n)+'':e}function d(e,t){e.currentElement?e.currentElement.appendChild(t):e.doc.appendChild(t)}a.prototype.parseFromString=function(e,t){var n=this.options,a=new u,r=n.domBuilder||new o,s=n.errorHandler,l=n.locator,d=n.xmlns||{},c={lt:'<',gt:'>',amp:'&',quot:'"',apos:'\''};return l&&r.setDocumentLocator(l),a.errorHandler=i(s,r,l),a.domBuilder=n.domBuilder||r,/\/x?html?$/.test(t)&&(c.nbsp='\xA0',c.copy='\xA9',d['']='http://www.w3.org/1999/xhtml'),d.xml=d.xml||'http://www.w3.org/XML/1998/namespace',e?a.parse(e,d,c):a.errorHandler.error('invalid doc source'),r.doc},o.prototype={startDocument:function(){this.doc=new c().createDocument(null,null,null),this.locator&&(this.doc.documentURI=this.locator.systemId)},startElement:function(e,t,n,a){var o=this.doc,s=o.createElementNS(e,n||t),l=a.length;d(this,s),this.currentElement=s,this.locator&&r(this.locator,s);for(var u=0;u>10),a=56320+(1023&e);return t(n,a)}return t(e)}function y(e){var t=e.slice(1,-1);return t in n?n[t]:'#'===t.charAt(0)?f(parseInt(t.substr(1).replace('x','0x'))):(m.error('entity not found:'+e),e)}function v(t){if(t>w){var n=e.substring(w,t).replace(/&#?\w+;/g,y);_&&b(w),c.characters(n,0,t-w),w=t}}function b(t,n){for(;t>=x&&(n=E.exec(e));)k=n.index,x=k+n[0].length,_.lineNumber++;_.columnNumber=t-k+1}for(var k=0,x=0,E=/.*(?:\r\n?|\n)|.*$/g,_=c.locator,N=[{currentNSMap:t}],S={},w=0;;){try{var T=e.indexOf('<',w);if(0>T){if(!e.substr(w).match(/^\s*$/)){var C=c.doc,R=C.createTextNode(e.substr(w));C.appendChild(R),c.currentElement=R}return}switch(T>w&&v(T),e.charAt(T+1)){case'/':var I=e.indexOf('>',T+3),A=e.substring(T+2,I),L=N.pop();0>I?(A=e.substring(T+2).replace(/[\s<].*/,''),m.error('end tag name: '+A+' is not complete:'+L.tagName),I=T+1+A.length):A.match(/\sw?w=I:v(s(T,w)+1)}}function o(e,n){return n.lineNumber=e.lineNumber,n.columnNumber=e.columnNumber,n}function r(e,t,n,a,i,o){for(var r=++t,l=b,s,d;;){var u=e.charAt(r);switch(u){case'=':if(l==k)s=e.slice(t,r),l=E;else if(l==x)l=E;else throw new Error('attribute equal must after attrName');break;case'\'':case'"':if(l==E||l==k){if(l==k&&(o.warning('attribute value must after "="'),s=e.slice(t,r)),t=r+1,r=e.indexOf(u,t),0=u)switch(l){case b:n.setTagName(e.slice(t,r)),l=S;break;case k:s=e.slice(t,r),l=x;break;case _:var d=e.slice(t,r).replace(/&#?\w+;/g,i);o.warning('attribute "'+d+'" missed quot(")!!'),n.add(s,d,t);case N:l=S;}else switch(l){case x:n.tagName;'http://www.w3.org/1999/xhtml'===a['']&&s.match(/^(?:disabled|checked|selected)$/i)||o.warning('attribute "'+s+'" missed value!! "'+s+'" instead2!!'),n.add(s,s,t),t=r,l=k;break;case N:o.warning('attribute space is required"'+s+'"!!');case S:l=k,t=r;break;case E:l=_,t=r;break;case w:throw new Error('elements closed character \'/\' and \'>\' must be connected to');}}r++}}function l(e,t,n){for(var o=e.tagName,r=null,s=e.length;s--;){var i=e[s],a=i.qName,l=i.value,d=a.indexOf(':');if(0',t),r=e.substring(t+1,o);if(/[&<]/.test(r))return /^script$/i.test(n)?(i.characters(r,0,r.length),o):(r=r.replace(/&#?\w+;/g,a),i.characters(r,0,r.length),o)}return t+1}function u(e,t,n,a){var i=a[n];return null==i&&(i=e.lastIndexOf(''),i',t+4);return o>t?(n.comment(e,t+4,o-t-4),o+3):(a.error('Unclosed comment'),-1)}return-1;default:if('CDATA['==e.substr(t+3,6)){var o=e.indexOf(']]>',t+9);return n.startCDATA(),n.characters(e,t+9,o-t-9),n.endCDATA(),o+3}var r=m(e,t),s=r.length;if(1',t);if(a){var i=e.substring(t,a).match(/^<\?(\S*)\s*([\s\S]*?)\s*$/);if(i){i[0].length;return n.processingInstruction(i[1],i[2]),a+2}return-1}return-1}function h(){}function i(e,t){return e.__proto__=t,e}function m(e,t){var n=[],a=/'[^']+'|"[^"]+"|[^\s<>\/=]+=?|(\/?\s*>|<)/g,i;for(a.lastIndex=t,a.exec(e);i=a.exec(e);)if(n.push(i),i[1])return n}var f=/[A-Z_a-z\xC0-\xD6\xD8-\xF6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD]/,y=new RegExp('[\\-\\.0-9'+f.source.slice(1,-1)+'\\u00B7\\u0300-\\u036F\\u203F-\\u2040]'),v=new RegExp('^'+f.source+y.source+'*(?::'+f.source+y.source+'*)?$'),b=0,k=1,x=2,E=3,_=4,N=5,S=6,w=7;n.prototype={parse:function(e,t,n){var i=this.domBuilder;i.startDocument(),c(t,t={}),a(e,t,n,i,this.errorHandler),i.endDocument()}},h.prototype={setTagName:function(e){if(!v.test(e))throw new Error('invalid tagName:'+e);this.tagName=e},add:function(e,t,n){if(!v.test(e))throw new Error('invalid attribute:'+e);this[this.length++]={qName:e,value:t,offset:n}},length:0,getLocalName:function(e){return this[e].localName},getLocator:function(e){return this[e].locator},getQName:function(e){return this[e].qName},getURI:function(e){return this[e].uri},getValue:function(e){return this[e].value}},i({},i.prototype)instanceof i||(i=function(e,t){function n(){}for(t in n.prototype=t,n=new n,e)n[t]=e[t];return n}),t.XMLReader=n},function(e,t,n){'use strict';function a(e){return e&&e.__esModule?e:{default:e}}function i(e,t){if(!(e instanceof t))throw new TypeError('Cannot call a class as a function')}Object.defineProperty(t,'__esModule',{value:!0});var r=function(){function e(e,t){for(var n=0,a;nn&&(r+=n,i=n);i=n)r+=n-i,i=n;else{i+=o,d.endContainer=e,d.endOffset=i;var s=new c.default(d,t).toString();a.push(s),r=0}u=e}.bind(this)),d&&d.startContainer&&u){d.endContainer=u,d.endOffset=u.length;var p=new c.default(d,t).toString();a.push(p),r=0}return a}},{key:'locationFromCfi',value:function(e){var t;return(c.default.prototype.isCfiString(e)&&(e=new c.default(e)),0===this._locations.length)?-1:(t=(0,s.locationOf)(e,this._locations,this.epubcfi.compare),t>this.total?this.total:t)}},{key:'percentageFromCfi',value:function(e){if(0===this._locations.length)return null;var t=this.locationFromCfi(e);return this.percentageFromLocation(t)}},{key:'percentageFromLocation',value:function(e){return e&&this.total?e/this.total:0}},{key:'cfiFromLocation',value:function(e){var t=-1;return'number'!=typeof e&&(e=parseInt(e)),0<=e&&e=this._minSpreadWidth?2:1,'reflowable'!==this.name||'paginated'!==this._flow||0<=n||(i=0==s%2?s:s-1),'pre-paginated'===this.name&&(i=0),1=e.left&&t.top>=e.top&&t.bottom<=e.bottom}var u='function'==typeof Symbol&&'symbol'==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&'function'==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?'symbol':typeof e};Object.defineProperty(t,'__esModule',{value:!0}),t.Underline=t.Highlight=t.Mark=t.Pane=void 0;var c=function e(t,n,a){null===t&&(t=Function.prototype);var i=Object.getOwnPropertyDescriptor(t,n);if(i===void 0){var o=Object.getPrototypeOf(t);return null===o?void 0:e(o,n,a)}if('value'in i)return i.value;var r=i.get;return void 0===r?void 0:r.call(a)},p=function(){function e(e,t){for(var n=0,a;nn&&r>t}var s=t.getBoundingClientRect(),r=e.getBoundingClientRect();if(!o(r,n,a))return!1;for(var l=e.getClientRects(),d=0,i=l.length;d(e/=0.5)?0.5*s(e,5):0.5*(s(e-2,5)+2)},easeInCubic:function(e){return s(e,3)}},m=function(){function e(t,n){o(this,e),this.settings=(0,u.extend)({duration:80,minVelocity:0.2,minDistance:10,easing:h.easeInCubic},n||{}),this.supportsTouch=this.supportsTouch(),this.supportsTouch&&this.setup(t)}return d(e,[{key:'setup',value:function(e){this.manager=e,this.layout=this.manager.layout,this.fullsize=this.manager.settings.fullsize,this.fullsize?(this.element=this.manager.stage.element,this.scroller=window,this.disableScroll()):(this.element=this.manager.stage.container,this.scroller=this.element,this.element.style.WebkitOverflowScrolling='touch'),this.manager.settings.offset=this.layout.width,this.manager.settings.afterScrolledTimeout=2*this.settings.duration,this.isVertical='vertical'===this.manager.settings.axis,!this.manager.isPaginated||this.isVertical||(this.touchCanceler=!1,this.resizeCanceler=!1,this.snapping=!1,this.scrollLeft,this.scrollTop,this.startTouchX=void 0,this.startTouchY=void 0,this.startTime=void 0,this.endTouchX=void 0,this.endTouchY=void 0,this.endTime=void 0,this.addListeners())}},{key:'supportsTouch',value:function(){return'ontouchstart'in window||window.DocumentTouch&&document instanceof DocumentTouch}},{key:'disableScroll',value:function(){this.element.style.overflow='hidden'}},{key:'enableScroll',value:function(){this.element.style.overflow=''}},{key:'addListeners',value:function(){this._onResize=this.onResize.bind(this),window.addEventListener('resize',this._onResize),this._onScroll=this.onScroll.bind(this),this.scroller.addEventListener('scroll',this._onScroll),this._onTouchStart=this.onTouchStart.bind(this),this.scroller.addEventListener('touchstart',this._onTouchStart,{passive:!0}),this.on('touchstart',this._onTouchStart),this._onTouchMove=this.onTouchMove.bind(this),this.scroller.addEventListener('touchmove',this._onTouchMove,{passive:!0}),this.on('touchmove',this._onTouchMove),this._onTouchEnd=this.onTouchEnd.bind(this),this.scroller.addEventListener('touchend',this._onTouchEnd,{passive:!0}),this.on('touchend',this._onTouchEnd),this._afterDisplayed=this.afterDisplayed.bind(this),this.manager.on(c.EVENTS.MANAGERS.ADDED,this._afterDisplayed)}},{key:'removeListeners',value:function(){window.removeEventListener('resize',this._onResize),this._onResize=void 0,this.scroller.removeEventListener('scroll',this._onScroll),this._onScroll=void 0,this.scroller.removeEventListener('touchstart',this._onTouchStart,{passive:!0}),this.off('touchstart',this._onTouchStart),this._onTouchStart=void 0,this.scroller.removeEventListener('touchmove',this._onTouchMove,{passive:!0}),this.off('touchmove',this._onTouchMove),this._onTouchMove=void 0,this.scroller.removeEventListener('touchend',this._onTouchEnd,{passive:!0}),this.off('touchend',this._onTouchEnd),this._onTouchEnd=void 0,this.manager.off(c.EVENTS.MANAGERS.ADDED,this._afterDisplayed),this._afterDisplayed=void 0}},{key:'afterDisplayed',value:function(e){var t=this,n=e.contents;['touchstart','touchmove','touchend'].forEach(function(a){n.on(a,function(e){return t.triggerViewEvent(e,n)})})}},{key:'triggerViewEvent',value:function(t,e){this.emit(t.type,t,e)}},{key:'onScroll',value:function(){this.scrollLeft=this.fullsize?window.scrollX:this.scroller.scrollLeft,this.scrollTop=this.fullsize?window.scrollY:this.scroller.scrollTop}},{key:'onResize',value:function(){this.resizeCanceler=!0}},{key:'onTouchStart',value:function(t){var e=t.touches[0],n=e.screenX,a=e.screenY;this.fullsize&&this.enableScroll(),this.touchCanceler=!0,this.startTouchX||(this.startTouchX=n,this.startTouchY=a,this.startTime=this.now()),this.endTouchX=n,this.endTouchY=a,this.endTime=this.now()}},{key:'onTouchMove',value:function(t){var e=t.touches[0],n=e.screenX,i=e.screenY,o=a(i-this.endTouchY);this.touchCanceler=!0,!this.fullsize&&10>o&&(this.element.scrollLeft-=n-this.endTouchX),this.endTouchX=n,this.endTouchY=i,this.endTime=this.now()}},{key:'onTouchEnd',value:function(){this.fullsize&&this.disableScroll(),this.touchCanceler=!1;var e=this.wasSwiped();0===e?this.snap():this.snap(e),this.startTouchX=void 0,this.startTouchY=void 0,this.startTime=void 0,this.endTouchX=void 0,this.endTouchY=void 0,this.endTime=void 0}},{key:'wasSwiped',value:function(){var e=this.layout.pageWidth*this.layout.divisor,t=this.endTouchX-this.startTouchX,n=a(t),i=this.endTime-this.startTime,o=t/i,r=this.settings.minVelocity;return n<=this.settings.minDistance||n>=e?0:o>r?-1:o<-r?1:void 0}},{key:'needsSnap',value:function(){var e=this.scrollLeft,t=this.layout.pageWidth*this.layout.divisor;return 0!=e%t}},{key:'snap',value:function(){var e=0d?(window.requestAnimationFrame(t.bind(this)),this.scrollTo(a+(e-a)*d,0)):(this.scrollTo(e,0),this.snapping=!1,n.resolve()))}var n=new u.defer,a=this.scrollLeft,o=this.now(),r=this.settings.duration,s=this.settings.easing;return this.snapping=!0,t.call(this),n.promise}},{key:'scrollTo',value:function(){var e=0=n.oldVersion&&e.createObjectStore(j)}catch(e){if('ConstraintError'===e.name)console.warn('The database "'+t.name+'" has been upgraded from version '+n.oldVersion+' to version '+n.newVersion+', but the storage "'+t.storeName+'" already exists.');else throw e}}),o.onerror=function(t){t.preventDefault(),a(o.error)},o.onsuccess=function(){n(o.result),p(t)}})}function m(e){return h(e,!1)}function f(e){return h(e,!0)}function y(e,t){if(!e.db)return!0;var n=!e.db.objectStoreNames.contains(e.storeName),a=e.versione.db.version;if(a&&(e.version!==t&&console.warn('The database "'+e.name+'" can\'t be downgraded from version '+e.db.version+' to version '+e.version+'.'),e.version=e.db.version),i||n){if(n){var o=e.db.version+1;o>e.version&&(e.version=o)}return!0}return!1}function v(t){return new B(function(n,e){var a=new FileReader;a.onerror=e,a.onloadend=function(a){var e=btoa(a.target.result||'');n({__local_forage_encoded_blob:!0,data:e,type:t.type})},a.readAsBinaryString(t)})}function b(e){var t=l(atob(e.data));return a([t],{type:e.type})}function k(e){return e&&e.__local_forage_encoded_blob}function x(e){var t=this,n=t._initReady().then(function(){var e=U[t._dbInfo.name];if(e&&e.dbReady)return e.dbReady});return o(n,e,e),n}function E(e){c(e);for(var t=U[e.name],n=t.forages,a=0,i;a>4,u[a++]=(15&r)<<4|s>>2,u[a++]=(3&s)<<6|63&l;return d}function w(e){var t=new Uint8Array(e),n='',a;for(a=0;a>2],n+=X[(3&t[a])<<4|t[a+1]>>4],n+=X[(15&t[a+1])<<2|t[a+2]>>6],n+=X[63&t[a+2]];return 2==t.length%3?n=n.substring(0,n.length-1)+'=':1==t.length%3&&(n=n.substring(0,n.length-2)+'=='),n}function T(e,t,n,a){e.executeSql('CREATE TABLE IF NOT EXISTS '+t.storeName+' (id INTEGER PRIMARY KEY, key unique, value)',[],n,a)}function C(e,n,a,i,o,r){e.executeSql(a,i,o,function(e,s){s.code===s.SYNTAX_ERR?e.executeSql('SELECT name FROM sqlite_master WHERE type=\'table\' AND name = ?',[n.storeName],function(e,t){t.rows.length?r(e,s):T(e,n,function(){e.executeSql(a,i,o,r)},r)},r):r(e,s)},r)}function R(e,t,n,a){var o=this;e=r(e);var s=new B(function(i,r){o.ready().then(function(){void 0===t&&(t=null);var s=t,l=o._dbInfo;l.serializer.serialize(t,function(d,t){t?r(t):l.db.transaction(function(n){C(n,l,'INSERT OR REPLACE INTO '+l.storeName+' (key, value) VALUES (?, ?)',[e,d],function(){i(s)},function(e,t){r(t)})},function(t){if(t.code===t.QUOTA_ERR){if(0 \'__WebKitDatabaseInfoTable__\'',[],function(a,t){for(var o=[],r=0;re?void t(null):void n.ready().then(function(){_(n._dbInfo,W,function(i,o){if(i)return a(i);try{var r=o.objectStore(n._dbInfo.storeName),s=!1,l=r.openCursor();l.onsuccess=function(){var n=l.result;return n?void(0===e?t(n.key):s?t(n.key):(s=!0,n.advance(e))):void t(null)},l.onerror=function(){a(l.error)}}catch(t){a(t)}})})['catch'](a)});return i(a,t),a},keys:function(e){var t=this,n=new B(function(e,n){t.ready().then(function(){_(t._dbInfo,W,function(a,i){if(a)return n(a);try{var o=i.objectStore(t._dbInfo.storeName),r=o.openCursor(),s=[];r.onsuccess=function(){var t=r.result;return t?void(s.push(t.key),t['continue']()):void e(s)},r.onerror=function(){n(r.error)}}catch(t){n(t)}})})['catch'](n)});return i(n,e),n},dropInstance:function(e,t){t=s.apply(this,arguments);var n=this.config();e='function'!=typeof e&&e||{},e.name||(e.name=e.name||n.name,e.storeName=e.storeName||n.storeName);var a=this,o;if(!e.name)o=B.reject('Invalid arguments');else{var r=e.name===n.name&&a._dbInfo.db,l=r?B.resolve(a._dbInfo.db):m(e).then(function(t){var n=U[e.name],a=n.forages;n.db=t;for(var o=0;ot[0]?1:0}),e._entries&&(e._entries={});for(var n=0;nn/2.5&&(p=n/2.5,pop_content.style.maxHeight=p+"px"),popRect.height+l>=n-25?(c.style.top=l-popRect.height+"px",c.classList.add("above")):c.classList.remove("above"),k-popRect.width<=0?(c.style.left=k+"px",c.classList.add("left")):c.classList.remove("left"),k+popRect.width/2>=o?(c.style.left=k-300+"px",popRect=c.getBoundingClientRect(),c.style.left=k-popRect.width+"px",popRect.height+l>=n-25?(c.style.top=l-popRect.height+"px",c.classList.add("above")):c.classList.remove("above"),c.classList.add("right")):c.classList.remove("right")}function d(){f[i].classList.add("on")}function e(){f[i].classList.remove("on")}function g(){setTimeout(function(){f[i].classList.remove("show")},100)}var h,i,j,k,l,m;"noteref"==a.getAttribute("epub:type")&&(h=a.getAttribute("href"),i=h.replace("#",""),j=b.render.document.getElementById(i),a.addEventListener("mouseover",c,!1),a.addEventListener("mouseout",g,!1))}),a&&a()},EPUBJS.Hooks.register("beforeChapterDisplay").mathml=function(a,b){if(b.currentChapter.manifestProperties.indexOf("mathml")!==-1){b.render.iframe.contentWindow.mathmlCallback=a;var c=document.createElement("script");c.type="text/x-mathjax-config",c.innerHTML=' MathJax.Hub.Register.StartupHook("End",function () { window.mathmlCallback(); }); MathJax.Hub.Config({jax: ["input/TeX","input/MathML","output/SVG"],extensions: ["tex2jax.js","mml2jax.js","MathEvents.js"],TeX: {extensions: ["noErrors.js","noUndefined.js","autoload-all.js"]},MathMenu: {showRenderer: false},menuSettings: {zoom: "Click"},messageStyle: "none"}); ',b.doc.body.appendChild(c),EPUBJS.core.addScript("http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML",null,b.doc.head)}else a&&a()},EPUBJS.Hooks.register("beforeChapterDisplay").smartimages=function(a,b){var c=b.contents.querySelectorAll("img"),d=Array.prototype.slice.call(c),e=b.height;if("reflowable"!=b.layoutSettings.layout)return void a();d.forEach(function(a){var c=function(){var c,d=a.getBoundingClientRect(),f=d.height,g=d.top,h=a.getAttribute("data-height"),i=h||f,j=Number(getComputedStyle(a,"").fontSize.match(/(\d*(\.\d*)?)px/)[1]),k=j?j/2:0;e=b.contents.clientHeight,g<0&&(g=0),a.style.maxWidth="100%",i+g>=e?(ge&&(a.style.maxHeight=e+"px",a.style.width="auto",d=a.getBoundingClientRect(),i=d.height),a.style.display="block",a.style.WebkitColumnBreakBefore="always",a.style.breakBefore="column"),a.setAttribute("data-height",c)):(a.style.removeProperty("max-height"),a.style.removeProperty("margin-top"))},d=function(){b.off("renderer:resized",c),b.off("renderer:chapterUnload",this)};a.addEventListener("load",c,!1),b.on("renderer:resized",c),b.on("renderer:chapterUnload",d),c()}),a&&a()},EPUBJS.Hooks.register("beforeChapterDisplay").transculsions=function(a,b){var c=b.contents.querySelectorAll("[transclusion]");Array.prototype.slice.call(c).forEach(function(a){function c(){j=g,k=h,j>chapter.colWidth&&(d=chapter.colWidth/j,j=chapter.colWidth,k*=d),f.width=j,f.height=k}var d,e=a.getAttribute("ref"),f=document.createElement("iframe"),g=a.getAttribute("width"),h=a.getAttribute("height"),i=a.parentNode,j=g,k=h;c(),b.listenUntil("renderer:resized","renderer:chapterUnloaded",c),f.src=e,i.replaceChild(f,a)}),a&&a()}; \ No newline at end of file diff --git a/static/epub.js/js/hooks.min.map b/static/epub.js/js/hooks.min.map new file mode 100644 index 00000000..5da22bee --- /dev/null +++ b/static/epub.js/js/hooks.min.map @@ -0,0 +1 @@ +{"version":3,"file":"hooks.min.js","sources":["../../hooks/default/endnotes.js","../../hooks/default/mathml.js","../../hooks/default/smartimages.js","../../hooks/default/transculsions.js"],"names":["EPUBJS","Hooks","register","endnotes","callback","renderer","notes","contents","querySelectorAll","items","Array","prototype","slice","call","attr","type","folder","core","location","pathname","popups","cssPath","addCss","render","document","head","forEach","item","showPop","pop","itemRect","iheight","height","iwidth","width","maxHeight","txt","el","cloneNode","querySelector","id","createElement","setAttribute","pop_content","appendChild","body","addEventListener","onPop","offPop","on","hidePop","this","getBoundingClientRect","left","top","classList","add","popRect","style","remove","setTimeout","href","epubType","getAttribute","replace","getElementById","mathml","currentChapter","manifestProperties","indexOf","iframe","contentWindow","mathmlCallback","s","innerHTML","doc","addScript","smartimages","images","layoutSettings","layout","size","newHeight","rectHeight","oHeight","fontSize","Number","getComputedStyle","match","fontAdjust","clientHeight","display","removeProperty","unloaded","off","transculsions","trans","orginal_width","orginal_height","chapter","colWidth","ratio","src","parent","parentNode","listenUntil","replaceChild"],"mappings":"AAAAA,OAAOC,MAAMC,SAAS,wBAAwBC,SAAW,SAASC,EAAUC,GAE1E,GAAIC,GAAQD,EAASE,SAASC,iBAAiB,WAC9CC,EAAQC,MAAMC,UAAUC,MAAMC,KAAKP,GACnCQ,EAAO,YACPC,EAAO,UACPC,EAAShB,OAAOiB,KAAKD,OAAOE,SAASC,UAErCC,GADWJ,EAAShB,OAAOqB,SAAYL,KAGxChB,QAAOiB,KAAKK,OAAOtB,OAAOqB,QAAU,aAAa,EAAOhB,EAASkB,OAAOC,SAASC,MAGjFhB,EAAMiB,QAAQ,SAASC,GAqBtB,QAASC,KACR,GAICC,GAEAC,EALAC,EAAU1B,EAAS2B,OACnBC,EAAS5B,EAAS6B,MAGlBC,EAAY,GAGTC,KACHP,EAAMQ,EAAGC,WAAU,GACnBF,EAAMP,EAAIU,cAAc,MAKrBnB,EAAOoB,KACVpB,EAAOoB,GAAMhB,SAASiB,cAAc,OACpCrB,EAAOoB,GAAIE,aAAa,QAAS,SAEjCC,YAAcnB,SAASiB,cAAc,OAErCrB,EAAOoB,GAAII,YAAYD,aAEvBA,YAAYC,YAAYR,GACxBO,YAAYD,aAAa,QAAS,eAElCrC,EAASkB,OAAOC,SAASqB,KAAKD,YAAYxB,EAAOoB,IAGjDpB,EAAOoB,GAAIM,iBAAiB,YAAaC,GAAO,GAChD3B,EAAOoB,GAAIM,iBAAiB,WAAYE,GAAQ,GAKhD3C,EAAS4C,GAAG,uBAAwBC,EAASC,MAC7C9C,EAAS4C,GAAG,uBAAwBD,EAAQG,OAI7CtB,EAAMT,EAAOoB,GAIbV,EAAWH,EAAKyB,wBAChBC,EAAOvB,EAASuB,KAChBC,EAAMxB,EAASwB,IAGfzB,EAAI0B,UAAUC,IAAI,QAGlBC,QAAU5B,EAAIuB,wBAGdvB,EAAI6B,MAAML,KAAOA,EAAOI,QAAQvB,MAAQ,EAAI,KAC5CL,EAAI6B,MAAMJ,IAAMA,EAAM,KAInBnB,EAAYJ,EAAU,MACxBI,EAAYJ,EAAU,IACtBY,YAAYe,MAAMvB,UAAYA,EAAY,MAIxCsB,QAAQzB,OAASsB,GAAOvB,EAAU,IACpCF,EAAI6B,MAAMJ,IAAMA,EAAMG,QAAQzB,OAAU,KACxCH,EAAI0B,UAAUC,IAAI,UAElB3B,EAAI0B,UAAUI,OAAO,SAInBN,EAAOI,QAAQvB,OAAS,GAC1BL,EAAI6B,MAAML,KAAOA,EAAO,KACxBxB,EAAI0B,UAAUC,IAAI,SAElB3B,EAAI0B,UAAUI,OAAO,QAInBN,EAAOI,QAAQvB,MAAQ,GAAKD,GAE9BJ,EAAI6B,MAAML,KAAOA,EAAO,IAAM,KAE9BI,QAAU5B,EAAIuB,wBACdvB,EAAI6B,MAAML,KAAOA,EAAOI,QAAQvB,MAAQ,KAErCuB,QAAQzB,OAASsB,GAAOvB,EAAU,IACpCF,EAAI6B,MAAMJ,IAAMA,EAAMG,QAAQzB,OAAU,KACxCH,EAAI0B,UAAUC,IAAI,UAElB3B,EAAI0B,UAAUI,OAAO,SAGtB9B,EAAI0B,UAAUC,IAAI,UAElB3B,EAAI0B,UAAUI,OAAO,SAMvB,QAASZ,KACR3B,EAAOoB,GAAIe,UAAUC,IAAI,MAG1B,QAASR,KACR5B,EAAOoB,GAAIe,UAAUI,OAAO,MAG7B,QAAST,KACRU,WAAW,WACVxC,EAAOoB,GAAIe,UAAUI,OAAO,SAC1B,KAxIJ,GACCE,GACArB,EACAH,EAGAgB,EACAC,EACAlB,EARG0B,EAAWnC,EAAKoC,aAAajD,EAU9BgD,IAAY/C,IAEf8C,EAAOlC,EAAKoC,aAAa,QACzBvB,EAAKqB,EAAKG,QAAQ,IAAK,IACvB3B,EAAKhC,EAASkB,OAAOC,SAASyC,eAAezB,GAG7Cb,EAAKmB,iBAAiB,YAAalB,GAAS,GAC5CD,EAAKmB,iBAAiB,WAAYI,GAAS,MA4HzC9C,GAAUA,KC5JfJ,OAAOC,MAAMC,SAAS,wBAAwBgE,OAAS,SAAS9D,EAAUC,GAGtE,GAAoE,KAAjEA,EAAS8D,eAAeC,mBAAmBC,QAAQ,UAAkB,CAGpEhE,EAASkB,OAAO+C,OAAOC,cAAcC,eAAiBpE,CAGtD,IAAIqE,GAAIjD,SAASiB,cAAc,SAC/BgC,GAAE1D,KAAO,wBACT0D,EAAEC,UAAY,6ZAMdrE,EAASsE,IAAI9B,KAAKD,YAAY6B,GAE9BzE,OAAOiB,KAAK2D,UAAU,gFAAiF,KAAMvE,EAASsE,IAAIlD,UAGvHrB,IAAUA,KCtBrBJ,OAAOC,MAAMC,SAAS,wBAAwB2E,YAAc,SAASzE,EAAUC,GAC7E,GAAIyE,GAASzE,EAASE,SAASC,iBAAiB,OAC/CC,EAAQC,MAAMC,UAAUC,MAAMC,KAAKiE,GACnC/C,EAAU1B,EAAS2B,MAGpB,OAAqC,cAAlC3B,EAAS0E,eAAeC,WAC1B5E,MAIDK,EAAMiB,QAAQ,SAASC,GAEtB,GAAIsD,GAAO,WACV,GAKCC,GALGpD,EAAWH,EAAKyB,wBACnB+B,EAAarD,EAASE,OACtBsB,EAAMxB,EAASwB,IACf8B,EAAUzD,EAAKoC,aAAa,eAC5B/B,EAASoD,GAAWD,EAEpBE,EAAWC,OAAOC,iBAAiB5D,EAAM,IAAI0D,SAASG,MAAM,mBAAmB,IAC/EC,EAAaJ,EAAWA,EAAW,EAAI,CAExCtD,GAAU1B,EAASE,SAASmF,aACnB,EAANpC,IAASA,EAAM,GAEftB,EAASsB,GAAOvB,GAETA,EAAQ,EAAduB,GAEF4B,EAAYnD,EAAUuB,EAAMmC,EAC5B9D,EAAK+B,MAAMvB,UAAY+C,EAAY,KACnCvD,EAAK+B,MAAMxB,MAAO,SAEfF,EAASD,IACXJ,EAAK+B,MAAMvB,UAAYJ,EAAU,KACjCJ,EAAK+B,MAAMxB,MAAO,OAClBJ,EAAWH,EAAKyB,wBAChBpB,EAASF,EAASE,QAEnBL,EAAK+B,MAAMiC,QAAU,QACrBhE,EAAK+B,MAA+B,wBAAI,SACxC/B,EAAK+B,MAAmB,YAAI,UAI7B/B,EAAKe,aAAa,cAAewC,KAGjCvD,EAAK+B,MAAMkC,eAAe,cAC1BjE,EAAK+B,MAAMkC,eAAe,gBAIxBC,EAAW,WAEdxF,EAASyF,IAAI,mBAAoBb,GACjC5E,EAASyF,IAAI,yBAA0B3C,MAGxCxB,GAAKmB,iBAAiB,OAAQmC,GAAM,GAEpC5E,EAAS4C,GAAG,mBAAoBgC,GAEhC5E,EAAS4C,GAAG,yBAA0B4C,GAEtCZ,WAIE7E,GAAUA,OCtEfJ,OAAOC,MAAMC,SAAS,wBAAwB6F,cAAgB,SAAS3F,EAAUC,GAO/E,GAAI2F,GAAQ3F,EAASE,SAASC,iBAAiB,kBAC7CC,EAAQC,MAAMC,UAAUC,MAAMC,KAAKmF,EAErCvF,GAAMiB,QAAQ,SAASC,GAWtB,QAASsD,KACR/C,EAAQ+D,EACRjE,EAASkE,EAENhE,EAAQiE,QAAQC,WAClBC,EAAQF,QAAQC,SAAWlE,EAE3BA,EAAQiE,QAAQC,SAChBpE,GAAkBqE,GAGnB/B,EAAOpC,MAAQA,EACfoC,EAAOtC,OAASA,EAtBjB,GAOCqE,GAPGC,EAAM3E,EAAKoC,aAAa,OAC3BO,EAAS9C,SAASiB,cAAc,UAChCwD,EAAgBtE,EAAKoC,aAAa,SAClCmC,EAAiBvE,EAAKoC,aAAa,UACnCwC,EAAS5E,EAAK6E,WACdtE,EAAQ+D,EACRjE,EAASkE,CAoBVjB,KAKA5E,EAASoG,YAAY,mBAAoB,2BAA4BxB,GAErEX,EAAOgC,IAAMA,EAGbC,EAAOG,aAAapC,EAAQ3C,KAQ1BvB,GAAUA"} \ No newline at end of file diff --git a/static/epub.js/js/hooks/extensions/highlight.js b/static/epub.js/js/hooks/extensions/highlight.js new file mode 100644 index 00000000..1dd1c671 --- /dev/null +++ b/static/epub.js/js/hooks/extensions/highlight.js @@ -0,0 +1,14 @@ +EPUBJS.Hooks.register("beforeChapterDisplay").highlight = function(callback, renderer){ + + // EPUBJS.core.addScript("js/libs/jquery.highlight.js", null, renderer.doc.head); + + var s = document.createElement("style"); + s.innerHTML =".highlight { background: yellow; font-weight: normal; }"; + + renderer.render.document.head.appendChild(s); + + if(callback) callback(); + +} + + diff --git a/static/epub.js/js/libs/jquery.min.js b/static/epub.js/js/libs/jquery.min.js new file mode 100644 index 00000000..4024b662 --- /dev/null +++ b/static/epub.js/js/libs/jquery.min.js @@ -0,0 +1,4 @@ +/*! jQuery v2.2.4 | (c) jQuery Foundation | jquery.org/license */ +!function(a,b){"object"==typeof module&&"object"==typeof module.exports?module.exports=a.document?b(a,!0):function(a){if(!a.document)throw new Error("jQuery requires a window with a document");return b(a)}:b(a)}("undefined"!=typeof window?window:this,function(a,b){var c=[],d=a.document,e=c.slice,f=c.concat,g=c.push,h=c.indexOf,i={},j=i.toString,k=i.hasOwnProperty,l={},m="2.2.4",n=function(a,b){return new n.fn.init(a,b)},o=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,p=/^-ms-/,q=/-([\da-z])/gi,r=function(a,b){return b.toUpperCase()};n.fn=n.prototype={jquery:m,constructor:n,selector:"",length:0,toArray:function(){return e.call(this)},get:function(a){return null!=a?0>a?this[a+this.length]:this[a]:e.call(this)},pushStack:function(a){var b=n.merge(this.constructor(),a);return b.prevObject=this,b.context=this.context,b},each:function(a){return n.each(this,a)},map:function(a){return this.pushStack(n.map(this,function(b,c){return a.call(b,c,b)}))},slice:function(){return this.pushStack(e.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(a){var b=this.length,c=+a+(0>a?b:0);return this.pushStack(c>=0&&b>c?[this[c]]:[])},end:function(){return this.prevObject||this.constructor()},push:g,sort:c.sort,splice:c.splice},n.extend=n.fn.extend=function(){var a,b,c,d,e,f,g=arguments[0]||{},h=1,i=arguments.length,j=!1;for("boolean"==typeof g&&(j=g,g=arguments[h]||{},h++),"object"==typeof g||n.isFunction(g)||(g={}),h===i&&(g=this,h--);i>h;h++)if(null!=(a=arguments[h]))for(b in a)c=g[b],d=a[b],g!==d&&(j&&d&&(n.isPlainObject(d)||(e=n.isArray(d)))?(e?(e=!1,f=c&&n.isArray(c)?c:[]):f=c&&n.isPlainObject(c)?c:{},g[b]=n.extend(j,f,d)):void 0!==d&&(g[b]=d));return g},n.extend({expando:"jQuery"+(m+Math.random()).replace(/\D/g,""),isReady:!0,error:function(a){throw new Error(a)},noop:function(){},isFunction:function(a){return"function"===n.type(a)},isArray:Array.isArray,isWindow:function(a){return null!=a&&a===a.window},isNumeric:function(a){var b=a&&a.toString();return!n.isArray(a)&&b-parseFloat(b)+1>=0},isPlainObject:function(a){var b;if("object"!==n.type(a)||a.nodeType||n.isWindow(a))return!1;if(a.constructor&&!k.call(a,"constructor")&&!k.call(a.constructor.prototype||{},"isPrototypeOf"))return!1;for(b in a);return void 0===b||k.call(a,b)},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},type:function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?i[j.call(a)]||"object":typeof a},globalEval:function(a){var b,c=eval;a=n.trim(a),a&&(1===a.indexOf("use strict")?(b=d.createElement("script"),b.text=a,d.head.appendChild(b).parentNode.removeChild(b)):c(a))},camelCase:function(a){return a.replace(p,"ms-").replace(q,r)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,b){var c,d=0;if(s(a)){for(c=a.length;c>d;d++)if(b.call(a[d],d,a[d])===!1)break}else for(d in a)if(b.call(a[d],d,a[d])===!1)break;return a},trim:function(a){return null==a?"":(a+"").replace(o,"")},makeArray:function(a,b){var c=b||[];return null!=a&&(s(Object(a))?n.merge(c,"string"==typeof a?[a]:a):g.call(c,a)),c},inArray:function(a,b,c){return null==b?-1:h.call(b,a,c)},merge:function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;d++)a[e++]=b[d];return a.length=e,a},grep:function(a,b,c){for(var d,e=[],f=0,g=a.length,h=!c;g>f;f++)d=!b(a[f],f),d!==h&&e.push(a[f]);return e},map:function(a,b,c){var d,e,g=0,h=[];if(s(a))for(d=a.length;d>g;g++)e=b(a[g],g,c),null!=e&&h.push(e);else for(g in a)e=b(a[g],g,c),null!=e&&h.push(e);return f.apply([],h)},guid:1,proxy:function(a,b){var c,d,f;return"string"==typeof b&&(c=a[b],b=a,a=c),n.isFunction(a)?(d=e.call(arguments,2),f=function(){return a.apply(b||this,d.concat(e.call(arguments)))},f.guid=a.guid=a.guid||n.guid++,f):void 0},now:Date.now,support:l}),"function"==typeof Symbol&&(n.fn[Symbol.iterator]=c[Symbol.iterator]),n.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(a,b){i["[object "+b+"]"]=b.toLowerCase()});function s(a){var b=!!a&&"length"in a&&a.length,c=n.type(a);return"function"===c||n.isWindow(a)?!1:"array"===c||0===b||"number"==typeof b&&b>0&&b-1 in a}var t=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=ga(),z=ga(),A=ga(),B=function(a,b){return a===b&&(l=!0),0},C=1<<31,D={}.hasOwnProperty,E=[],F=E.pop,G=E.push,H=E.push,I=E.slice,J=function(a,b){for(var c=0,d=a.length;d>c;c++)if(a[c]===b)return c;return-1},K="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",L="[\\x20\\t\\r\\n\\f]",M="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",N="\\["+L+"*("+M+")(?:"+L+"*([*^$|!~]?=)"+L+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+M+"))|)"+L+"*\\]",O=":("+M+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+N+")*)|.*)\\)|)",P=new RegExp(L+"+","g"),Q=new RegExp("^"+L+"+|((?:^|[^\\\\])(?:\\\\.)*)"+L+"+$","g"),R=new RegExp("^"+L+"*,"+L+"*"),S=new RegExp("^"+L+"*([>+~]|"+L+")"+L+"*"),T=new RegExp("="+L+"*([^\\]'\"]*?)"+L+"*\\]","g"),U=new RegExp(O),V=new RegExp("^"+M+"$"),W={ID:new RegExp("^#("+M+")"),CLASS:new RegExp("^\\.("+M+")"),TAG:new RegExp("^("+M+"|[*])"),ATTR:new RegExp("^"+N),PSEUDO:new RegExp("^"+O),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+L+"*(even|odd|(([+-]|)(\\d*)n|)"+L+"*(?:([+-]|)"+L+"*(\\d+)|))"+L+"*\\)|)","i"),bool:new RegExp("^(?:"+K+")$","i"),needsContext:new RegExp("^"+L+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+L+"*((?:-\\d)?\\d*)"+L+"*\\)|)(?=[^-]|$)","i")},X=/^(?:input|select|textarea|button)$/i,Y=/^h\d$/i,Z=/^[^{]+\{\s*\[native \w/,$=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,_=/[+~]/,aa=/'|\\/g,ba=new RegExp("\\\\([\\da-f]{1,6}"+L+"?|("+L+")|.)","ig"),ca=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:0>d?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},da=function(){m()};try{H.apply(E=I.call(v.childNodes),v.childNodes),E[v.childNodes.length].nodeType}catch(ea){H={apply:E.length?function(a,b){G.apply(a,I.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function fa(a,b,d,e){var f,h,j,k,l,o,r,s,w=b&&b.ownerDocument,x=b?b.nodeType:9;if(d=d||[],"string"!=typeof a||!a||1!==x&&9!==x&&11!==x)return d;if(!e&&((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,p)){if(11!==x&&(o=$.exec(a)))if(f=o[1]){if(9===x){if(!(j=b.getElementById(f)))return d;if(j.id===f)return d.push(j),d}else if(w&&(j=w.getElementById(f))&&t(b,j)&&j.id===f)return d.push(j),d}else{if(o[2])return H.apply(d,b.getElementsByTagName(a)),d;if((f=o[3])&&c.getElementsByClassName&&b.getElementsByClassName)return H.apply(d,b.getElementsByClassName(f)),d}if(c.qsa&&!A[a+" "]&&(!q||!q.test(a))){if(1!==x)w=b,s=a;else if("object"!==b.nodeName.toLowerCase()){(k=b.getAttribute("id"))?k=k.replace(aa,"\\$&"):b.setAttribute("id",k=u),r=g(a),h=r.length,l=V.test(k)?"#"+k:"[id='"+k+"']";while(h--)r[h]=l+" "+qa(r[h]);s=r.join(","),w=_.test(a)&&oa(b.parentNode)||b}if(s)try{return H.apply(d,w.querySelectorAll(s)),d}catch(y){}finally{k===u&&b.removeAttribute("id")}}}return i(a.replace(Q,"$1"),b,d,e)}function ga(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ha(a){return a[u]=!0,a}function ia(a){var b=n.createElement("div");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function ja(a,b){var c=a.split("|"),e=c.length;while(e--)d.attrHandle[c[e]]=b}function ka(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&(~b.sourceIndex||C)-(~a.sourceIndex||C);if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function la(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function ma(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function na(a){return ha(function(b){return b=+b,ha(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function oa(a){return a&&"undefined"!=typeof a.getElementsByTagName&&a}c=fa.support={},f=fa.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return b?"HTML"!==b.nodeName:!1},m=fa.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=n.documentElement,p=!f(n),(e=n.defaultView)&&e.top!==e&&(e.addEventListener?e.addEventListener("unload",da,!1):e.attachEvent&&e.attachEvent("onunload",da)),c.attributes=ia(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=ia(function(a){return a.appendChild(n.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=Z.test(n.getElementsByClassName),c.getById=ia(function(a){return o.appendChild(a).id=u,!n.getElementsByName||!n.getElementsByName(u).length}),c.getById?(d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c=b.getElementById(a);return c?[c]:[]}},d.filter.ID=function(a){var b=a.replace(ba,ca);return function(a){return a.getAttribute("id")===b}}):(delete d.find.ID,d.filter.ID=function(a){var b=a.replace(ba,ca);return function(a){var c="undefined"!=typeof a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}}),d.find.TAG=c.getElementsByTagName?function(a,b){return"undefined"!=typeof b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){return"undefined"!=typeof b.getElementsByClassName&&p?b.getElementsByClassName(a):void 0},r=[],q=[],(c.qsa=Z.test(n.querySelectorAll))&&(ia(function(a){o.appendChild(a).innerHTML="",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+L+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+L+"*(?:value|"+K+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),ia(function(a){var b=n.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+L+"*[*^$|!~]?="),a.querySelectorAll(":enabled").length||q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=Z.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&ia(function(a){c.disconnectedMatch=s.call(a,"div"),s.call(a,"[s!='']:x"),r.push("!=",O)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=Z.test(o.compareDocumentPosition),t=b||Z.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===n||a.ownerDocument===v&&t(v,a)?-1:b===n||b.ownerDocument===v&&t(v,b)?1:k?J(k,a)-J(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,g=[a],h=[b];if(!e||!f)return a===n?-1:b===n?1:e?-1:f?1:k?J(k,a)-J(k,b):0;if(e===f)return ka(a,b);c=a;while(c=c.parentNode)g.unshift(c);c=b;while(c=c.parentNode)h.unshift(c);while(g[d]===h[d])d++;return d?ka(g[d],h[d]):g[d]===v?-1:h[d]===v?1:0},n):n},fa.matches=function(a,b){return fa(a,null,null,b)},fa.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(T,"='$1']"),c.matchesSelector&&p&&!A[b+" "]&&(!r||!r.test(b))&&(!q||!q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return fa(b,n,null,[a]).length>0},fa.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},fa.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&D.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},fa.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},fa.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=fa.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=fa.selectors={cacheLength:50,createPseudo:ha,match:W,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(ba,ca),a[3]=(a[3]||a[4]||a[5]||"").replace(ba,ca),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||fa.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&fa.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return W.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&U.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(ba,ca).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+L+")"+a+"("+L+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||"undefined"!=typeof a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=fa.attr(d,a);return null==e?"!="===b:b?(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(P," ")+" ").indexOf(c)>-1:"|="===b?e===c||e.slice(0,c.length+1)===c+"-":!1):!0}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h,t=!1;if(q){if(f){while(p){m=b;while(m=m[p])if(h?m.nodeName.toLowerCase()===r:1===m.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){m=q,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n&&j[2],m=n&&q.childNodes[n];while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if(1===m.nodeType&&++t&&m===b){k[a]=[w,n,t];break}}else if(s&&(m=b,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n),t===!1)while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if((h?m.nodeName.toLowerCase()===r:1===m.nodeType)&&++t&&(s&&(l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),k[a]=[w,t]),m===b))break;return t-=e,t===d||t%d===0&&t/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||fa.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ha(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=J(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ha(function(a){var b=[],c=[],d=h(a.replace(Q,"$1"));return d[u]?ha(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ha(function(a){return function(b){return fa(a,b).length>0}}),contains:ha(function(a){return a=a.replace(ba,ca),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ha(function(a){return V.test(a||"")||fa.error("unsupported lang: "+a),a=a.replace(ba,ca).toLowerCase(),function(b){var c;do if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return Y.test(a.nodeName)},input:function(a){return X.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:na(function(){return[0]}),last:na(function(a,b){return[b-1]}),eq:na(function(a,b,c){return[0>c?c+b:c]}),even:na(function(a,b){for(var c=0;b>c;c+=2)a.push(c);return a}),odd:na(function(a,b){for(var c=1;b>c;c+=2)a.push(c);return a}),lt:na(function(a,b,c){for(var d=0>c?c+b:c;--d>=0;)a.push(d);return a}),gt:na(function(a,b,c){for(var d=0>c?c+b:c;++db;b++)d+=a[b].value;return d}function ra(a,b,c){var d=b.dir,e=c&&"parentNode"===d,f=x++;return b.first?function(b,c,f){while(b=b[d])if(1===b.nodeType||e)return a(b,c,f)}:function(b,c,g){var h,i,j,k=[w,f];if(g){while(b=b[d])if((1===b.nodeType||e)&&a(b,c,g))return!0}else while(b=b[d])if(1===b.nodeType||e){if(j=b[u]||(b[u]={}),i=j[b.uniqueID]||(j[b.uniqueID]={}),(h=i[d])&&h[0]===w&&h[1]===f)return k[2]=h[2];if(i[d]=k,k[2]=a(b,c,g))return!0}}}function sa(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function ta(a,b,c){for(var d=0,e=b.length;e>d;d++)fa(a,b[d],c);return c}function ua(a,b,c,d,e){for(var f,g=[],h=0,i=a.length,j=null!=b;i>h;h++)(f=a[h])&&(c&&!c(f,d,e)||(g.push(f),j&&b.push(h)));return g}function va(a,b,c,d,e,f){return d&&!d[u]&&(d=va(d)),e&&!e[u]&&(e=va(e,f)),ha(function(f,g,h,i){var j,k,l,m=[],n=[],o=g.length,p=f||ta(b||"*",h.nodeType?[h]:h,[]),q=!a||!f&&b?p:ua(p,m,a,h,i),r=c?e||(f?a:o||d)?[]:g:q;if(c&&c(q,r,h,i),d){j=ua(r,n),d(j,[],h,i),k=j.length;while(k--)(l=j[k])&&(r[n[k]]=!(q[n[k]]=l))}if(f){if(e||a){if(e){j=[],k=r.length;while(k--)(l=r[k])&&j.push(q[k]=l);e(null,r=[],j,i)}k=r.length;while(k--)(l=r[k])&&(j=e?J(f,l):m[k])>-1&&(f[j]=!(g[j]=l))}}else r=ua(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):H.apply(g,r)})}function wa(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=ra(function(a){return a===b},h,!0),l=ra(function(a){return J(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];f>i;i++)if(c=d.relative[a[i].type])m=[ra(sa(m),c)];else{if(c=d.filter[a[i].type].apply(null,a[i].matches),c[u]){for(e=++i;f>e;e++)if(d.relative[a[e].type])break;return va(i>1&&sa(m),i>1&&qa(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(Q,"$1"),c,e>i&&wa(a.slice(i,e)),f>e&&wa(a=a.slice(e)),f>e&&qa(a))}m.push(c)}return sa(m)}function xa(a,b){var c=b.length>0,e=a.length>0,f=function(f,g,h,i,k){var l,o,q,r=0,s="0",t=f&&[],u=[],v=j,x=f||e&&d.find.TAG("*",k),y=w+=null==v?1:Math.random()||.1,z=x.length;for(k&&(j=g===n||g||k);s!==z&&null!=(l=x[s]);s++){if(e&&l){o=0,g||l.ownerDocument===n||(m(l),h=!p);while(q=a[o++])if(q(l,g||n,h)){i.push(l);break}k&&(w=y)}c&&((l=!q&&l)&&r--,f&&t.push(l))}if(r+=s,c&&s!==r){o=0;while(q=b[o++])q(t,u,g,h);if(f){if(r>0)while(s--)t[s]||u[s]||(u[s]=F.call(i));u=ua(u)}H.apply(i,u),k&&!f&&u.length>0&&r+b.length>1&&fa.uniqueSort(i)}return k&&(w=y,j=v),t};return c?ha(f):f}return h=fa.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=wa(b[c]),f[u]?d.push(f):e.push(f);f=A(a,xa(e,d)),f.selector=a}return f},i=fa.select=function(a,b,e,f){var i,j,k,l,m,n="function"==typeof a&&a,o=!f&&g(a=n.selector||a);if(e=e||[],1===o.length){if(j=o[0]=o[0].slice(0),j.length>2&&"ID"===(k=j[0]).type&&c.getById&&9===b.nodeType&&p&&d.relative[j[1].type]){if(b=(d.find.ID(k.matches[0].replace(ba,ca),b)||[])[0],!b)return e;n&&(b=b.parentNode),a=a.slice(j.shift().value.length)}i=W.needsContext.test(a)?0:j.length;while(i--){if(k=j[i],d.relative[l=k.type])break;if((m=d.find[l])&&(f=m(k.matches[0].replace(ba,ca),_.test(j[0].type)&&oa(b.parentNode)||b))){if(j.splice(i,1),a=f.length&&qa(j),!a)return H.apply(e,f),e;break}}}return(n||h(a,o))(f,b,!p,e,!b||_.test(a)&&oa(b.parentNode)||b),e},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=ia(function(a){return 1&a.compareDocumentPosition(n.createElement("div"))}),ia(function(a){return a.innerHTML="","#"===a.firstChild.getAttribute("href")})||ja("type|href|height|width",function(a,b,c){return c?void 0:a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&ia(function(a){return a.innerHTML="",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||ja("value",function(a,b,c){return c||"input"!==a.nodeName.toLowerCase()?void 0:a.defaultValue}),ia(function(a){return null==a.getAttribute("disabled")})||ja(K,function(a,b,c){var d;return c?void 0:a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),fa}(a);n.find=t,n.expr=t.selectors,n.expr[":"]=n.expr.pseudos,n.uniqueSort=n.unique=t.uniqueSort,n.text=t.getText,n.isXMLDoc=t.isXML,n.contains=t.contains;var u=function(a,b,c){var d=[],e=void 0!==c;while((a=a[b])&&9!==a.nodeType)if(1===a.nodeType){if(e&&n(a).is(c))break;d.push(a)}return d},v=function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c},w=n.expr.match.needsContext,x=/^<([\w-]+)\s*\/?>(?:<\/\1>|)$/,y=/^.[^:#\[\.,]*$/;function z(a,b,c){if(n.isFunction(b))return n.grep(a,function(a,d){return!!b.call(a,d,a)!==c});if(b.nodeType)return n.grep(a,function(a){return a===b!==c});if("string"==typeof b){if(y.test(b))return n.filter(b,a,c);b=n.filter(b,a)}return n.grep(a,function(a){return h.call(b,a)>-1!==c})}n.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?n.find.matchesSelector(d,a)?[d]:[]:n.find.matches(a,n.grep(b,function(a){return 1===a.nodeType}))},n.fn.extend({find:function(a){var b,c=this.length,d=[],e=this;if("string"!=typeof a)return this.pushStack(n(a).filter(function(){for(b=0;c>b;b++)if(n.contains(e[b],this))return!0}));for(b=0;c>b;b++)n.find(a,e[b],d);return d=this.pushStack(c>1?n.unique(d):d),d.selector=this.selector?this.selector+" "+a:a,d},filter:function(a){return this.pushStack(z(this,a||[],!1))},not:function(a){return this.pushStack(z(this,a||[],!0))},is:function(a){return!!z(this,"string"==typeof a&&w.test(a)?n(a):a||[],!1).length}});var A,B=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,C=n.fn.init=function(a,b,c){var e,f;if(!a)return this;if(c=c||A,"string"==typeof a){if(e="<"===a[0]&&">"===a[a.length-1]&&a.length>=3?[null,a,null]:B.exec(a),!e||!e[1]&&b)return!b||b.jquery?(b||c).find(a):this.constructor(b).find(a);if(e[1]){if(b=b instanceof n?b[0]:b,n.merge(this,n.parseHTML(e[1],b&&b.nodeType?b.ownerDocument||b:d,!0)),x.test(e[1])&&n.isPlainObject(b))for(e in b)n.isFunction(this[e])?this[e](b[e]):this.attr(e,b[e]);return this}return f=d.getElementById(e[2]),f&&f.parentNode&&(this.length=1,this[0]=f),this.context=d,this.selector=a,this}return a.nodeType?(this.context=this[0]=a,this.length=1,this):n.isFunction(a)?void 0!==c.ready?c.ready(a):a(n):(void 0!==a.selector&&(this.selector=a.selector,this.context=a.context),n.makeArray(a,this))};C.prototype=n.fn,A=n(d);var D=/^(?:parents|prev(?:Until|All))/,E={children:!0,contents:!0,next:!0,prev:!0};n.fn.extend({has:function(a){var b=n(a,this),c=b.length;return this.filter(function(){for(var a=0;c>a;a++)if(n.contains(this,b[a]))return!0})},closest:function(a,b){for(var c,d=0,e=this.length,f=[],g=w.test(a)||"string"!=typeof a?n(a,b||this.context):0;e>d;d++)for(c=this[d];c&&c!==b;c=c.parentNode)if(c.nodeType<11&&(g?g.index(c)>-1:1===c.nodeType&&n.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?n.uniqueSort(f):f)},index:function(a){return a?"string"==typeof a?h.call(n(a),this[0]):h.call(this,a.jquery?a[0]:a):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(n.uniqueSort(n.merge(this.get(),n(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function F(a,b){while((a=a[b])&&1!==a.nodeType);return a}n.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return u(a,"parentNode")},parentsUntil:function(a,b,c){return u(a,"parentNode",c)},next:function(a){return F(a,"nextSibling")},prev:function(a){return F(a,"previousSibling")},nextAll:function(a){return u(a,"nextSibling")},prevAll:function(a){return u(a,"previousSibling")},nextUntil:function(a,b,c){return u(a,"nextSibling",c)},prevUntil:function(a,b,c){return u(a,"previousSibling",c)},siblings:function(a){return v((a.parentNode||{}).firstChild,a)},children:function(a){return v(a.firstChild)},contents:function(a){return a.contentDocument||n.merge([],a.childNodes)}},function(a,b){n.fn[a]=function(c,d){var e=n.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=n.filter(d,e)),this.length>1&&(E[a]||n.uniqueSort(e),D.test(a)&&e.reverse()),this.pushStack(e)}});var G=/\S+/g;function H(a){var b={};return n.each(a.match(G)||[],function(a,c){b[c]=!0}),b}n.Callbacks=function(a){a="string"==typeof a?H(a):n.extend({},a);var b,c,d,e,f=[],g=[],h=-1,i=function(){for(e=a.once,d=b=!0;g.length;h=-1){c=g.shift();while(++h-1)f.splice(c,1),h>=c&&h--}),this},has:function(a){return a?n.inArray(a,f)>-1:f.length>0},empty:function(){return f&&(f=[]),this},disable:function(){return e=g=[],f=c="",this},disabled:function(){return!f},lock:function(){return e=g=[],c||(f=c=""),this},locked:function(){return!!e},fireWith:function(a,c){return e||(c=c||[],c=[a,c.slice?c.slice():c],g.push(c),b||i()),this},fire:function(){return j.fireWith(this,arguments),this},fired:function(){return!!d}};return j},n.extend({Deferred:function(a){var b=[["resolve","done",n.Callbacks("once memory"),"resolved"],["reject","fail",n.Callbacks("once memory"),"rejected"],["notify","progress",n.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return n.Deferred(function(c){n.each(b,function(b,f){var g=n.isFunction(a[b])&&a[b];e[f[1]](function(){var a=g&&g.apply(this,arguments);a&&n.isFunction(a.promise)?a.promise().progress(c.notify).done(c.resolve).fail(c.reject):c[f[0]+"With"](this===d?c.promise():this,g?[a]:arguments)})}),a=null}).promise()},promise:function(a){return null!=a?n.extend(a,d):d}},e={};return d.pipe=d.then,n.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[1^a][2].disable,b[2][2].lock),e[f[0]]=function(){return e[f[0]+"With"](this===e?d:this,arguments),this},e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=e.call(arguments),d=c.length,f=1!==d||a&&n.isFunction(a.promise)?d:0,g=1===f?a:n.Deferred(),h=function(a,b,c){return function(d){b[a]=this,c[a]=arguments.length>1?e.call(arguments):d,c===i?g.notifyWith(b,c):--f||g.resolveWith(b,c)}},i,j,k;if(d>1)for(i=new Array(d),j=new Array(d),k=new Array(d);d>b;b++)c[b]&&n.isFunction(c[b].promise)?c[b].promise().progress(h(b,j,i)).done(h(b,k,c)).fail(g.reject):--f;return f||g.resolveWith(k,c),g.promise()}});var I;n.fn.ready=function(a){return n.ready.promise().done(a),this},n.extend({isReady:!1,readyWait:1,holdReady:function(a){a?n.readyWait++:n.ready(!0)},ready:function(a){(a===!0?--n.readyWait:n.isReady)||(n.isReady=!0,a!==!0&&--n.readyWait>0||(I.resolveWith(d,[n]),n.fn.triggerHandler&&(n(d).triggerHandler("ready"),n(d).off("ready"))))}});function J(){d.removeEventListener("DOMContentLoaded",J),a.removeEventListener("load",J),n.ready()}n.ready.promise=function(b){return I||(I=n.Deferred(),"complete"===d.readyState||"loading"!==d.readyState&&!d.documentElement.doScroll?a.setTimeout(n.ready):(d.addEventListener("DOMContentLoaded",J),a.addEventListener("load",J))),I.promise(b)},n.ready.promise();var K=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===n.type(c)){e=!0;for(h in c)K(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,n.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(n(a),c)})),b))for(;i>h;h++)b(a[h],c,g?d:d.call(a[h],h,b(a[h],c)));return e?a:j?b.call(a):i?b(a[0],c):f},L=function(a){return 1===a.nodeType||9===a.nodeType||!+a.nodeType};function M(){this.expando=n.expando+M.uid++}M.uid=1,M.prototype={register:function(a,b){var c=b||{};return a.nodeType?a[this.expando]=c:Object.defineProperty(a,this.expando,{value:c,writable:!0,configurable:!0}),a[this.expando]},cache:function(a){if(!L(a))return{};var b=a[this.expando];return b||(b={},L(a)&&(a.nodeType?a[this.expando]=b:Object.defineProperty(a,this.expando,{value:b,configurable:!0}))),b},set:function(a,b,c){var d,e=this.cache(a);if("string"==typeof b)e[b]=c;else for(d in b)e[d]=b[d];return e},get:function(a,b){return void 0===b?this.cache(a):a[this.expando]&&a[this.expando][b]},access:function(a,b,c){var d;return void 0===b||b&&"string"==typeof b&&void 0===c?(d=this.get(a,b),void 0!==d?d:this.get(a,n.camelCase(b))):(this.set(a,b,c),void 0!==c?c:b)},remove:function(a,b){var c,d,e,f=a[this.expando];if(void 0!==f){if(void 0===b)this.register(a);else{n.isArray(b)?d=b.concat(b.map(n.camelCase)):(e=n.camelCase(b),b in f?d=[b,e]:(d=e,d=d in f?[d]:d.match(G)||[])),c=d.length;while(c--)delete f[d[c]]}(void 0===b||n.isEmptyObject(f))&&(a.nodeType?a[this.expando]=void 0:delete a[this.expando])}},hasData:function(a){var b=a[this.expando];return void 0!==b&&!n.isEmptyObject(b)}};var N=new M,O=new M,P=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,Q=/[A-Z]/g;function R(a,b,c){var d;if(void 0===c&&1===a.nodeType)if(d="data-"+b.replace(Q,"-$&").toLowerCase(),c=a.getAttribute(d),"string"==typeof c){try{c="true"===c?!0:"false"===c?!1:"null"===c?null:+c+""===c?+c:P.test(c)?n.parseJSON(c):c; +}catch(e){}O.set(a,b,c)}else c=void 0;return c}n.extend({hasData:function(a){return O.hasData(a)||N.hasData(a)},data:function(a,b,c){return O.access(a,b,c)},removeData:function(a,b){O.remove(a,b)},_data:function(a,b,c){return N.access(a,b,c)},_removeData:function(a,b){N.remove(a,b)}}),n.fn.extend({data:function(a,b){var c,d,e,f=this[0],g=f&&f.attributes;if(void 0===a){if(this.length&&(e=O.get(f),1===f.nodeType&&!N.get(f,"hasDataAttrs"))){c=g.length;while(c--)g[c]&&(d=g[c].name,0===d.indexOf("data-")&&(d=n.camelCase(d.slice(5)),R(f,d,e[d])));N.set(f,"hasDataAttrs",!0)}return e}return"object"==typeof a?this.each(function(){O.set(this,a)}):K(this,function(b){var c,d;if(f&&void 0===b){if(c=O.get(f,a)||O.get(f,a.replace(Q,"-$&").toLowerCase()),void 0!==c)return c;if(d=n.camelCase(a),c=O.get(f,d),void 0!==c)return c;if(c=R(f,d,void 0),void 0!==c)return c}else d=n.camelCase(a),this.each(function(){var c=O.get(this,d);O.set(this,d,b),a.indexOf("-")>-1&&void 0!==c&&O.set(this,a,b)})},null,b,arguments.length>1,null,!0)},removeData:function(a){return this.each(function(){O.remove(this,a)})}}),n.extend({queue:function(a,b,c){var d;return a?(b=(b||"fx")+"queue",d=N.get(a,b),c&&(!d||n.isArray(c)?d=N.access(a,b,n.makeArray(c)):d.push(c)),d||[]):void 0},dequeue:function(a,b){b=b||"fx";var c=n.queue(a,b),d=c.length,e=c.shift(),f=n._queueHooks(a,b),g=function(){n.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return N.get(a,c)||N.access(a,c,{empty:n.Callbacks("once memory").add(function(){N.remove(a,[b+"queue",c])})})}}),n.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length",""],thead:[1,"","
"],col:[2,"","
"],tr:[2,"","
"],td:[3,"","
"],_default:[0,"",""]};$.optgroup=$.option,$.tbody=$.tfoot=$.colgroup=$.caption=$.thead,$.th=$.td;function _(a,b){var c="undefined"!=typeof a.getElementsByTagName?a.getElementsByTagName(b||"*"):"undefined"!=typeof a.querySelectorAll?a.querySelectorAll(b||"*"):[];return void 0===b||b&&n.nodeName(a,b)?n.merge([a],c):c}function aa(a,b){for(var c=0,d=a.length;d>c;c++)N.set(a[c],"globalEval",!b||N.get(b[c],"globalEval"))}var ba=/<|&#?\w+;/;function ca(a,b,c,d,e){for(var f,g,h,i,j,k,l=b.createDocumentFragment(),m=[],o=0,p=a.length;p>o;o++)if(f=a[o],f||0===f)if("object"===n.type(f))n.merge(m,f.nodeType?[f]:f);else if(ba.test(f)){g=g||l.appendChild(b.createElement("div")),h=(Y.exec(f)||["",""])[1].toLowerCase(),i=$[h]||$._default,g.innerHTML=i[1]+n.htmlPrefilter(f)+i[2],k=i[0];while(k--)g=g.lastChild;n.merge(m,g.childNodes),g=l.firstChild,g.textContent=""}else m.push(b.createTextNode(f));l.textContent="",o=0;while(f=m[o++])if(d&&n.inArray(f,d)>-1)e&&e.push(f);else if(j=n.contains(f.ownerDocument,f),g=_(l.appendChild(f),"script"),j&&aa(g),c){k=0;while(f=g[k++])Z.test(f.type||"")&&c.push(f)}return l}!function(){var a=d.createDocumentFragment(),b=a.appendChild(d.createElement("div")),c=d.createElement("input");c.setAttribute("type","radio"),c.setAttribute("checked","checked"),c.setAttribute("name","t"),b.appendChild(c),l.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,b.innerHTML="",l.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue}();var da=/^key/,ea=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,fa=/^([^.]*)(?:\.(.+)|)/;function ga(){return!0}function ha(){return!1}function ia(){try{return d.activeElement}catch(a){}}function ja(a,b,c,d,e,f){var g,h;if("object"==typeof b){"string"!=typeof c&&(d=d||c,c=void 0);for(h in b)ja(a,h,c,d,b[h],f);return a}if(null==d&&null==e?(e=c,d=c=void 0):null==e&&("string"==typeof c?(e=d,d=void 0):(e=d,d=c,c=void 0)),e===!1)e=ha;else if(!e)return a;return 1===f&&(g=e,e=function(a){return n().off(a),g.apply(this,arguments)},e.guid=g.guid||(g.guid=n.guid++)),a.each(function(){n.event.add(this,b,e,d,c)})}n.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,o,p,q,r=N.get(a);if(r){c.handler&&(f=c,c=f.handler,e=f.selector),c.guid||(c.guid=n.guid++),(i=r.events)||(i=r.events={}),(g=r.handle)||(g=r.handle=function(b){return"undefined"!=typeof n&&n.event.triggered!==b.type?n.event.dispatch.apply(a,arguments):void 0}),b=(b||"").match(G)||[""],j=b.length;while(j--)h=fa.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o&&(l=n.event.special[o]||{},o=(e?l.delegateType:l.bindType)||o,l=n.event.special[o]||{},k=n.extend({type:o,origType:q,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&n.expr.match.needsContext.test(e),namespace:p.join(".")},f),(m=i[o])||(m=i[o]=[],m.delegateCount=0,l.setup&&l.setup.call(a,d,p,g)!==!1||a.addEventListener&&a.addEventListener(o,g)),l.add&&(l.add.call(a,k),k.handler.guid||(k.handler.guid=c.guid)),e?m.splice(m.delegateCount++,0,k):m.push(k),n.event.global[o]=!0)}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,o,p,q,r=N.hasData(a)&&N.get(a);if(r&&(i=r.events)){b=(b||"").match(G)||[""],j=b.length;while(j--)if(h=fa.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o){l=n.event.special[o]||{},o=(d?l.delegateType:l.bindType)||o,m=i[o]||[],h=h[2]&&new RegExp("(^|\\.)"+p.join("\\.(?:.*\\.|)")+"(\\.|$)"),g=f=m.length;while(f--)k=m[f],!e&&q!==k.origType||c&&c.guid!==k.guid||h&&!h.test(k.namespace)||d&&d!==k.selector&&("**"!==d||!k.selector)||(m.splice(f,1),k.selector&&m.delegateCount--,l.remove&&l.remove.call(a,k));g&&!m.length&&(l.teardown&&l.teardown.call(a,p,r.handle)!==!1||n.removeEvent(a,o,r.handle),delete i[o])}else for(o in i)n.event.remove(a,o+b[j],c,d,!0);n.isEmptyObject(i)&&N.remove(a,"handle events")}},dispatch:function(a){a=n.event.fix(a);var b,c,d,f,g,h=[],i=e.call(arguments),j=(N.get(this,"events")||{})[a.type]||[],k=n.event.special[a.type]||{};if(i[0]=a,a.delegateTarget=this,!k.preDispatch||k.preDispatch.call(this,a)!==!1){h=n.event.handlers.call(this,a,j),b=0;while((f=h[b++])&&!a.isPropagationStopped()){a.currentTarget=f.elem,c=0;while((g=f.handlers[c++])&&!a.isImmediatePropagationStopped())a.rnamespace&&!a.rnamespace.test(g.namespace)||(a.handleObj=g,a.data=g.data,d=((n.event.special[g.origType]||{}).handle||g.handler).apply(f.elem,i),void 0!==d&&(a.result=d)===!1&&(a.preventDefault(),a.stopPropagation()))}return k.postDispatch&&k.postDispatch.call(this,a),a.result}},handlers:function(a,b){var c,d,e,f,g=[],h=b.delegateCount,i=a.target;if(h&&i.nodeType&&("click"!==a.type||isNaN(a.button)||a.button<1))for(;i!==this;i=i.parentNode||this)if(1===i.nodeType&&(i.disabled!==!0||"click"!==a.type)){for(d=[],c=0;h>c;c++)f=b[c],e=f.selector+" ",void 0===d[e]&&(d[e]=f.needsContext?n(e,this).index(i)>-1:n.find(e,this,null,[i]).length),d[e]&&d.push(f);d.length&&g.push({elem:i,handlers:d})}return h]*)\/>/gi,la=/\s*$/g;function pa(a,b){return n.nodeName(a,"table")&&n.nodeName(11!==b.nodeType?b:b.firstChild,"tr")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function qa(a){return a.type=(null!==a.getAttribute("type"))+"/"+a.type,a}function ra(a){var b=na.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function sa(a,b){var c,d,e,f,g,h,i,j;if(1===b.nodeType){if(N.hasData(a)&&(f=N.access(a),g=N.set(b,f),j=f.events)){delete g.handle,g.events={};for(e in j)for(c=0,d=j[e].length;d>c;c++)n.event.add(b,e,j[e][c])}O.hasData(a)&&(h=O.access(a),i=n.extend({},h),O.set(b,i))}}function ta(a,b){var c=b.nodeName.toLowerCase();"input"===c&&X.test(a.type)?b.checked=a.checked:"input"!==c&&"textarea"!==c||(b.defaultValue=a.defaultValue)}function ua(a,b,c,d){b=f.apply([],b);var e,g,h,i,j,k,m=0,o=a.length,p=o-1,q=b[0],r=n.isFunction(q);if(r||o>1&&"string"==typeof q&&!l.checkClone&&ma.test(q))return a.each(function(e){var f=a.eq(e);r&&(b[0]=q.call(this,e,f.html())),ua(f,b,c,d)});if(o&&(e=ca(b,a[0].ownerDocument,!1,a,d),g=e.firstChild,1===e.childNodes.length&&(e=g),g||d)){for(h=n.map(_(e,"script"),qa),i=h.length;o>m;m++)j=e,m!==p&&(j=n.clone(j,!0,!0),i&&n.merge(h,_(j,"script"))),c.call(a[m],j,m);if(i)for(k=h[h.length-1].ownerDocument,n.map(h,ra),m=0;i>m;m++)j=h[m],Z.test(j.type||"")&&!N.access(j,"globalEval")&&n.contains(k,j)&&(j.src?n._evalUrl&&n._evalUrl(j.src):n.globalEval(j.textContent.replace(oa,"")))}return a}function va(a,b,c){for(var d,e=b?n.filter(b,a):a,f=0;null!=(d=e[f]);f++)c||1!==d.nodeType||n.cleanData(_(d)),d.parentNode&&(c&&n.contains(d.ownerDocument,d)&&aa(_(d,"script")),d.parentNode.removeChild(d));return a}n.extend({htmlPrefilter:function(a){return a.replace(ka,"<$1>")},clone:function(a,b,c){var d,e,f,g,h=a.cloneNode(!0),i=n.contains(a.ownerDocument,a);if(!(l.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||n.isXMLDoc(a)))for(g=_(h),f=_(a),d=0,e=f.length;e>d;d++)ta(f[d],g[d]);if(b)if(c)for(f=f||_(a),g=g||_(h),d=0,e=f.length;e>d;d++)sa(f[d],g[d]);else sa(a,h);return g=_(h,"script"),g.length>0&&aa(g,!i&&_(a,"script")),h},cleanData:function(a){for(var b,c,d,e=n.event.special,f=0;void 0!==(c=a[f]);f++)if(L(c)){if(b=c[N.expando]){if(b.events)for(d in b.events)e[d]?n.event.remove(c,d):n.removeEvent(c,d,b.handle);c[N.expando]=void 0}c[O.expando]&&(c[O.expando]=void 0)}}}),n.fn.extend({domManip:ua,detach:function(a){return va(this,a,!0)},remove:function(a){return va(this,a)},text:function(a){return K(this,function(a){return void 0===a?n.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=a)})},null,a,arguments.length)},append:function(){return ua(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=pa(this,a);b.appendChild(a)}})},prepend:function(){return ua(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=pa(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return ua(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return ua(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},empty:function(){for(var a,b=0;null!=(a=this[b]);b++)1===a.nodeType&&(n.cleanData(_(a,!1)),a.textContent="");return this},clone:function(a,b){return a=null==a?!1:a,b=null==b?a:b,this.map(function(){return n.clone(this,a,b)})},html:function(a){return K(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a&&1===b.nodeType)return b.innerHTML;if("string"==typeof a&&!la.test(a)&&!$[(Y.exec(a)||["",""])[1].toLowerCase()]){a=n.htmlPrefilter(a);try{for(;d>c;c++)b=this[c]||{},1===b.nodeType&&(n.cleanData(_(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=[];return ua(this,arguments,function(b){var c=this.parentNode;n.inArray(this,a)<0&&(n.cleanData(_(this)),c&&c.replaceChild(b,this))},a)}}),n.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){n.fn[a]=function(a){for(var c,d=[],e=n(a),f=e.length-1,h=0;f>=h;h++)c=h===f?this:this.clone(!0),n(e[h])[b](c),g.apply(d,c.get());return this.pushStack(d)}});var wa,xa={HTML:"block",BODY:"block"};function ya(a,b){var c=n(b.createElement(a)).appendTo(b.body),d=n.css(c[0],"display");return c.detach(),d}function za(a){var b=d,c=xa[a];return c||(c=ya(a,b),"none"!==c&&c||(wa=(wa||n("